pharmacophore.Pharma-ID | pharmacophore/metadata/Gene-Name | pharmacophore/metadata/Uniprot-AC | pharmacophore/metadata/Kegg-Identifier | pharmacophore/metadata/Target-Class | pharmacophore/metadata/Target-Class-A | pharmacophore/metadata/Target-Class-B | pharmacophore/metadata/Target-Class-C | pharmacophore/metadata/Target-Class-D | pharmacophore/metadata/pdb.complex_id | pharmacophore/metadata/Taxonomic-ID | pharmacophore.name | pharmacophore.selectivity_index | pharmacophore/metadata/drug-classification | pharmacophore/metadata/target | pharmacophore/metadata/target-subclass | pharmacophore/metadata/target-family | pharmacophore/metadata/target-acronym | pharmacophore/metadata/therapeutic-classification | pharmacophore/metadata/mode-of-action | pharmacophore/metadata/pdb.ligand_id | pharmacophore/metadata/pdb.resolution | pharmacophore/actives/molecule.name | pharmacophore/actives/molecule.smiles | pharmacophore/actives/molecule.registry | pharmacophore/actives/molecule.regtype | pharmacophore/bibliography/reference.title | pharmacophore/bibliography/reference.author | pharmacophore/bibliography/reference.source | pharmacophore/bibliography/reference.year | pharmacophore/bibliography/reference.doi |
1a42 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1a42 | |||||||||||||||||||||
1a69 | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1a69 | |||||||||||||||||||||
1a85 | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1a85 | |||||||||||||||||||||
1a86 | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1a86 | |||||||||||||||||||||
1a9p | PNPH_BOVIN | P55859 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1a9p | |||||||||||||||||||||
1a9s | PNPH_BOVIN | P55859 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1a9s | |||||||||||||||||||||
1add | ADA_MOUSE | P03958 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1add | |||||||||||||||||||||
1afq | CTRA_BOVIN | P00766 | KO_id not found | Others | Others | Others | Others | Others | 1afq | |||||||||||||||||||||
1ag9 | FLAV_ECOLI | P61949 | K03839 | Others | Others | Others | Others | Others | 1ag9 | 83333 | ||||||||||||||||||||
1agw | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 1agw | |||||||||||||||||||||
1ahb | RIP1_MOMCH | P16094 | KO_id not found | Others | Others | Others | Others | Others | 1ahb | |||||||||||||||||||||
1apw | PENP_PENJA | P00798 | KO_id not found | Others | Others | Others | Others | Others | 1apw | |||||||||||||||||||||
1aqj | MTTA_THEAQ | P14385 | KO_id not found | Others | Others | Others | Others | Others | 1aqj | |||||||||||||||||||||
1b3d | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1b3d | |||||||||||||||||||||
1b8n | PNPH_BOVIN | P55859 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1b8n | |||||||||||||||||||||
1b8o | PNPH_BOVIN | P55859 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1b8o | |||||||||||||||||||||
1b8y | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1b8y | |||||||||||||||||||||
1b9i | O52552_AMYMD | O52552 | KO_id not found | Others | Others | Others | Others | Others | 1b9i | |||||||||||||||||||||
1bb7 | LYSC2_ONCMY | P11941 | KO_id not found | Others | Others | Others | Others | Others | 1bb7 | |||||||||||||||||||||
1bh6 | SUBD_BACLI | P00781 | KO_id not found | Others | Others | Others | Others | Others | 1bh6 | |||||||||||||||||||||
1biw | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1biw | |||||||||||||||||||||
Signaling proteins | 1bjy | 1bjy-ctc-2.70-d-1 | 399 | antiinfective | tetracycline repressor protein | Intracellular transduction | DNA repressors | TetR | fundamental research bacterial infection |
resistance to tetracycline antibiotics at the transcriptional level | ctc | 2.70 | 7-chlorotetracycline | CN(C)[C@H]1[C@@H]2C[C@H]3C(=C(O)[C@]2(O)C(=O)C(=C1O)C(=O)N)C(=O)c4c(O)ccc(Cl)c4[C@@]3(C)O | 57-62-5 | cas | Tetracycline-chelated Mg2+ ion initiates helix unwinding in Tet repressor induction | Orth P, Saenger W, Hinrichs W | Biochemistry 38(1):191-8 | 1999 | 10.1021/bi9816610 | |||||||||
1bkc | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 1bkc | |||||||||||||||||||||
1bmk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1bmk | |||||||||||||||||||||
1bnn | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1bnn | |||||||||||||||||||||
1bnt | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1bnt | |||||||||||||||||||||
1bnu | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1bnu | |||||||||||||||||||||
1bnv | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1bnv | |||||||||||||||||||||
Enzymes | 1br5 | 1br5-neo-2.50-h-1 | 171 | antidote | ricin a chain | EC3.- (hydrolases) | glycosylases | ricin | antidot | Neopterin inhibits the Ricin A chain with Ki 2 mM54. The aminopteridinone scaffold is situated in an aromatic cage built by TYR80, PHE93, and TYR123 (Figure 36). An extensive hydrogen bond network is established to SER176 and ARG180 by the oxygen as well as by several nitrogen atoms to VAL81, GLY121, and TYR123. The glycerol moiety links to GLU177 and GLU208, and indirectly via a water molecule to GLY212. |
neo | 2.50 | 2009-64-5 | Nc1nc2ncc(nc2c(=O)[nH]1)[C@@H](O)[C@H](O)CO | D-Neopterin | CAS | Structure-based identification of a ricin inhibitor | Yan X, Hollis T, Svinth M, Day P, Monzingo AF, Milne GW, Robertus JD | J Mol Biol 266(5):1043-9 | 1997 | 10.1006/jmbi.1996.0865 | |||||||||
1bu5 | FLAV_DESVH | P00323 | K05278 | Enzymes | Oxidoreductases | Acting on paired donors, with O2 as oxidant and incorporation or reduction of oxygen. The oxygen incorporated need not be derived from O2 | With 2-oxoglutarate as one donor, and incorporation of one atom of oxygen into each donor | Flavonol synthase | 1bu5 | |||||||||||||||||||||
1byg | CSK_HUMAN | P41240 | K05728 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1byg | |||||||||||||||||||||
Enzymes | 1bzc | 1bzc-tpi-2.35-h-1 | 183 | endocrine | protein tyrosine phosphatase 1B | EC3.- (hydrolases) | phosphatases | PTP 1B | diabetes obesity |
dephosphorylation of insulin receptor and insulin receptor substrate tyrosine residues prevention of insulin resistance |
tpi | 2.35 | 219316-40-2 | NC(=O)[C@H](CCC(=O)O)NC(=O)c1ccc2cc(ccc2c1)C(F)(F)P(=O)(O)O | 219316-40-2 | CAS | Structural basis for inhibition of the protein tyrosine phosphatase 1B by phosphotyrosine peptide mimetics | Groves MR, Yao ZJ, Roller PP, Burke TR Jr, Barford D | Biochemistry 37(51):17773-83 | 1998 | - | |||||||||
Enzymes | 1bzj | 1bzj-pic-2.25-h-1 | 1674 | endocrine | protein tyrosine phosphatase 1B | EC3.- (hydrolases) | phosphatases | PTP 1B | diabetes obesity |
dephosphorylation of insulin receptor and insulin receptor substrate tyrosine residues prevention of insulin resistance |
pic | 2.25 | 219316-39-9 | OC(=O)c1ccc2cc(ccc2c1)C(F)(F)P(=O)(O)O | 219316-39-9 | CAS | Structural basis for inhibition of the protein tyrosine phosphatase 1B by phosphotyrosine peptide mimetics | Groves MR, Yao ZJ, Roller PP, Burke TR Jr, Barford D | Biochemistry 37(51):17773-83 | 1998 | - | |||||||||
1bzs | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1bzs | |||||||||||||||||||||
1c1c | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1c1c | |||||||||||||||||||||
1c1d | Q59771_RHOSO | Q59771 | KO_id not found | Others | Others | Others | Others | Others | 1c1d | |||||||||||||||||||||
1c3x | PUNA_CELSP | P81989 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1c3x | |||||||||||||||||||||
1c7s | CHB_SERMA | Q54468 | KO_id not found | Others | Others | Others | Others | Others | 1c7s | |||||||||||||||||||||
1c8v | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1c8v | |||||||||||||||||||||
1c9k | COBU_SALTY | Q05599 | K02231 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Adenosylcobinamide kinase | 1c9k | |||||||||||||||||||||
1cbf | CBIF_BACME | O87696 | KO_id not found | Others | Others | Others | Others | Others | 1cbf | |||||||||||||||||||||
1cg6 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1cg6 | |||||||||||||||||||||
1cgk | CHS2_MEDSA | P30074 | K00698 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Chitin synthase | 1cgk | |||||||||||||||||||||
1coy | CHOD_BREST | P22637 | K10078 (inferred by homologyHUMAN) | Glycan Binding Proteins | C-Type lectin | Group 8 Layilin and related receptors | CHODL; chondrolectin | Cholesterol oxidase | 1coy | 1702 | ||||||||||||||||||||
1cw2 | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1cw2 | |||||||||||||||||||||
1cx4 | KAP3_RAT | P12369 | K04739 | Others | Organismal Systems | Endocrine system | Insulin signaling pathway | PRKAR; cAMP-dependent protein kinase regulator | 1cx4 | |||||||||||||||||||||
1d2s | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1d2s | |||||||||||||||||||||
1d4a | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1d4a | |||||||||||||||||||||
1d4h | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1d4h | |||||||||||||||||||||
1d4i | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1d4i | |||||||||||||||||||||
1d4l | POL_HV1A2 | P03369 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1d4l | |||||||||||||||||||||
Enzymes | 1d5l | 1d5l-cyn-1.90-x-1 | 841 | immunologic | myeloperoxidase | EC1.- (oxydo-reductases) | peroxydases | myeloperoxidase | cognitive defects cardiovascular diseases cancer multiple sclerosis COPD inflammation |
modulation of HOCl generation at sites of inflammation | cyn | 1.90 | salicylhydroxamic acid | ONC(=O)c1ccccc1O | 89-73-6 | cas | Human myeloperoxidase: structure of a cyanide complex and its interaction with bromide and thiocyanate substrates at 1.9 A resolution | Blair-Johnson M, Fiedler T, Fenna R | Biochemistry 40(46):13990-7 | 2001 | 10.1021/bi0111808 | |||||||||
1d6s | CYSK_SALTI | P0A1E4 | K01738 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Cysteine synthase | 1d6s | |||||||||||||||||||||
1d7u | DGDA_BURCE | P16932 | KO_id not found | Enzymes | 4. Lyases | decarboxylases | DGD (bacterial) | Others | 1d7u | |||||||||||||||||||||
1d7x | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1d7x | |||||||||||||||||||||
1d8f | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1d8f | |||||||||||||||||||||
1dht | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1dht | |||||||||||||||||||||
1dig | C1TC_HUMAN | P11586 | K00288 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Formate---tetrahydrofolate ligase | 1dig | |||||||||||||||||||||
1djn | DHTM_METME | P16099 | KO_id not found | Others | Others | Others | Others | Others | 1djn | |||||||||||||||||||||
1dl5 | PIMT_THEMA | Q56308 | K00573 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Protein-L-isoaspartate(D-aspartate) O-methyltransferase | 1dl5 | |||||||||||||||||||||
Enzymes | 1dm2 | 1dm2-hmd-2.10-h-1 | 1681 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | hmd | 2.10 | Hymenialdisine | NC1=NC(=O)/C(=C/2\CCNC(=O)c3[nH]c(Br)cc23)/N1 | 82005-12-7 | CAS | Inhibition of cyclin-dependent kinases, GSK-3beta and CK1 by hymenialdisine, a marine sponge constituent | Meijer L, Thunnissen AM, White AW, Garnier M, Nikolic M, Tsai LH, Walter J, Cleverley KE, Salinas PC, Wu YZ, Biernat J, Mandelkow EM, Kim SH, Pettit GR | Chem Biol 7(1):51-63 | 2000 | 10.1016/S1074-5521(00)00063-6 | |||||||||
1dqn | Q24973_GIAIN | Q24973 | KO_id not found | Enzymes | 2. Transferases | phosphoribosyl transferases | GPRTase (G.lambia) | Others | 1dqn | |||||||||||||||||||||
1dth | VM1AD_CROAT | P15167 | KO_id not found | Others | Others | Others | Others | Others | 1dth | |||||||||||||||||||||
Enzymes | 1e1x | 1e1x-nw1-1.85-h-1 | 1335 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | nw1 | 1.85 | NU 6027 | Nc1nc(N)c(N=O)c(OCC2CCCCC2)n1 | 220036-08-8 | CAS | Identification of novel purine and pyrimidine cyclin-dependent kinase inhibitors with distinct molecular interactions and tumor cell growth inhibition profiles | Arris CE, Boyle FT, Calvert AH, Curtin NJ, Endicott JA, Garman EF, Gibson AE, Golding BT, Grant S, Griffin RJ, Jewsbury P, Johnson LN, Lawrie AM, Newell DR, Noble ME, Sausville EA, Schultz R, Yu W | J Med Chem 43(15):2797-804 | 2000 | 10.1021/jm990628o | |||||||||
1e1x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1e1x | |||||||||||||||||||||
Enzymes | 1e2k | 1e2k-tmc-1.70-d-1-s | 1061 | antiinfective | herpes simplex virus thymidine kinase | EC2.- (transferases) | kinases (thymidine) | TK (HSV1) | herpes infection | phosphorylation of prodrug, inhibition of viral DNA polymerase | tmc | 1.7 | 2'-exo-methanocarba-thymidine | Cc1cn([C@H]2C[C@H](O)[C@]3(CO)C[C@H]23)c(=O)[nH]c1=O | 156126-12-4 | cas | Kinetics and Crystal Structure of the Wild-Type and the Engineered Y101F Mutant of Herpes Simplex Virus Type 1 Thymidine Kinase Interacting with (North)-Methanocarba-Thymidine | Prota, A., Vogt, J., Pilger, B., Perozzo, R., Wurth, C., Marquez, V., Russ, P., Schulz, G. E., Folkers, G., Scapozza, L. | Biochemistry 39 pp. 9597 | 2000 | ||||||||||
1e2k | KITH_HHV11 | P03176 | K00857 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Thymidine kinase | 1e2k | |||||||||||||||||||||
Enzymes | 1e2l | 1e2l-tmc-2.40-d-1 | 3.53989290283855 | antiinfective | Herpes simplex virus thymidine kinase | EC2.- (transferases) | kinases (thymidine) | TK (HSV1) | herpes infection | substrate of viral thymidine kinase thereby activation of prodrug termination of viral DNA elongation at the viral DNA polymerase |
tmc | 2.40 | 156126-12-4 | Cc1cn([C@H]2C[C@H](O)[C@]3(CO)C[C@H]23)c(=O)[nH]c1=O | 156126-12-4 | cas | Kinetics and crystal structure of the wild-type and the engineered Y101F mutant of Herpes simplex virus type 1 thymidine kinase interacting with (North)-methanocarba-thymidine | Prota A, Vogt J, Pilger B, Perozzo R, Wurth C, Marquez VE, Russ P, Schulz GE, Folkers G, Scapozza L | Biochemistry 39(31):9597-603 | 2000 | 10.1021/bi000668q | |||||||||
1e2n | KITH_HHV11 | P03176 | K00857 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Thymidine kinase | 1e2n | |||||||||||||||||||||
1e5d | ROO_DESGI | Q9F0J6 | KO_id not found | Others | Others | Others | Others | Others | 1e5d | |||||||||||||||||||||
1e81 | CARP_CRYPA | P11838 | K01381 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Saccharopepsin | 1e81 | |||||||||||||||||||||
1e82 | CARP_CRYPA | P11838 | K01381 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Saccharopepsin | 1e82 | |||||||||||||||||||||
1e8h | VAOX_PENSI | P56216 | KO_id not found | Others | Others | Others | Others | Others | 1e8h | |||||||||||||||||||||
1e8m | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1e8m | |||||||||||||||||||||
1e8w | PK3CG_PIG | O02697 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 1e8w | |||||||||||||||||||||
1e90 | PK3CG_PIG | O02697 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 1e90 | |||||||||||||||||||||
Enzymes | 1e9h | 1e9h-inr-2.50-h-1 | 10.07159 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | inr | 2.50 | 478283-10-2 | [C=1C=CC2=C(C1)C(=O)\C(=C\3/C=4C=C(C=CC4NC3=O)S(=O)(=O)O)\N2] | 478283-10-2 | CAS | Inhibitor binding to active and inactive CDK2: the crystal structure of CDK2-cyclin A/indirubin-5-sulphonate. | Davies TG, Tunnah P, Meijer L, Marko D, Eisenbrand G, Endicott JA, Noble ME. | Structure 9(5):389-97 | 2001 | 10.1016/S0969-2126(01)00598-6 | |||||||||
1ebw | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1ebw | |||||||||||||||||||||
1ebz | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1ebz | |||||||||||||||||||||
1ec1 | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1ec1 | |||||||||||||||||||||
1ec2 | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1ec2 | |||||||||||||||||||||
1ecj | PUR1_ECOLI | P0AG16 | K00764 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Amidophosphoribosyltransferase | 1ecj | |||||||||||||||||||||
Enzymes | 1ecv | 1ecv-878-1.95-d-2 | 1843 | endocrine | protein tyrosine phosphatase 1B | EC3.- (hydrolases) | phosphatases | PTP 1B | diabetes obesity |
dephosphorylation of insulin receptor and insulin receptor substrate tyrosine residues prevention of insulin resistance |
878 | 1.95 | 243989-50-6 | OC(=O)C(=O)Nc1ccc(I)cc1C(=O)O | 243989-50-6 | cas | 2-(oxalylamino)-benzoic acid is a general, competitive inhibitor of protein-tyrosine phosphatases | Andersen HS, Iversen LF, Jeppesen CB, Branner S, Norris K, Rasmussen HB, Moller KB, Moller NP | J Biol Chem 275(10):7101-8 | 2000 | - | |||||||||
1eed | CARP_CRYPA | P11838 | K01381 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Saccharopepsin | 1eed | |||||||||||||||||||||
Toxins and defence proteins | 1eei | 1eei-gaa-2.00-d-1 | 1589 | antiinfective | cholera toxin | Toxins | bacterial toxins | toxin (cholera) | diarrhoea | inhibition of cell receptor binding by toxin interference with bacterial toxin entry into host cell |
gaa | 2.00 | 52571-71-8 | OC[C@H]1O[C@H](Oc2cccc(c2)N(=O)=O)[C@H](O)[C@@H](O)[C@H]1O | 52571-71-8 | cas | Exploration of the GM1 receptor-binding site of heat-labile enterotoxin and cholera toxin by phenyl-ring-containing galactose derivatives | Fan E, Merritt EA, Zhang Z, Pickens JC, Roach C, Ahn M, Hol WG | Acta Crystallogr D Biol Crystallogr 57(Pt 2):201-12 | 2001 | 10.1107/S0907444900016814 | |||||||||
1eet | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1eet | |||||||||||||||||||||
Enzymes | 1ef3 | 1ef3-fid-2.80-f-1-s | 0.180462341536167 | endocrine | aldose reductase | EC1.- (oxydo-reductases) | aldehyde reductases | ALR2 | antidiabetic | catalyzes the NADPH-dependent reduction of aldehydes to their corresponding alcohols | fid | 2.80 | fidarestat | NC(=O)[C@H]3C[C@@]1(NC(=O)NC1=O)c2cc(F)ccc2O3 | 136087-85-9 | CAS | Ultrahigh resolution drug design. II. Atomic resolution structures of human aldose reductase holoenzyme complexed with Fidarestat and Minalrestat: implications for the binding of cyclic imide inhibitors | El-Kabbani O, Darmanin C, Schneider TR, Hazemann I, Ruiz F, Oka M, Joachimiak A, Schulze-Briese C, Tomizaki T, Mitschler A, Podjarny A | Proteins 55(4):805-13 | 2004 | 10.1002/prot.20001 | |||||||||
1efy | PARP1_CHICK | P26446 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 1efy | |||||||||||||||||||||
1ej3 | AEQ2_AEQVI | P02592 | KO_id not found | Others | Others | Others | Others | Others | 1ej3 | |||||||||||||||||||||
1eje | P152_METTH | O26255 | KO_id not found | Others | Others | Others | Others | Others | 1eje | |||||||||||||||||||||
1ek2 | HYES_MOUSE | P34914 | K08726 | Enzymes | Hydrolases | Acting on ether bonds | Ether hydrolases | Soluble epoxide hydrolase | 1ek2 | |||||||||||||||||||||
1el3 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 1el3 | |||||||||||||||||||||
1el4 | OBL_OBELO | Q27709 | KO_id not found | Others | Others | Others | Others | Others | 1el4 | |||||||||||||||||||||
1eno | FABI_BRANA | P80030 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 1eno | |||||||||||||||||||||
1eou | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1eou | |||||||||||||||||||||
1epq | CARP_CRYPA | P11838 | K01381 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Saccharopepsin | 1epq | |||||||||||||||||||||
1esw | MALQ_THETH | O87172 | K00705 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | 4-alpha-glucanotransferase | 1esw | |||||||||||||||||||||
1f4p | FLAV_DESVH | P00323 | K05278 | Enzymes | Oxidoreductases | Acting on paired donors, with O2 as oxidant and incorporation or reduction of oxygen. The oxygen incorporated need not be derived from O2 | With 2-oxoglutarate as one donor, and incorporation of one atom of oxygen into each donor | Flavonol synthase | 1f4p | |||||||||||||||||||||
1f8g | PNTAA_RHORT | Q2RSB2 | K00324 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With NAD+ or NADP+ as acceptor | NAD(P)+ transhydrogenase (AB-specific) | 1f8g | |||||||||||||||||||||
1fbo | GUNF_CLOCE | P37698 | KO_id not found | Others | Others | Others | Others | Others | 1fbo | |||||||||||||||||||||
1fhd | GUX_CELFI | P07986 | KO_id not found | Others | Others | Others | Others | Others | 1fhd | |||||||||||||||||||||
1fkh | FKB1A_HUMAN | P62942 | K09568 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 1fkh | |||||||||||||||||||||
1fkw | ADA_MOUSE | P03958 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1fkw | |||||||||||||||||||||
1fm7 | CFI1_MEDSA | P28012 | K01859 | Enzymes | Isomerases | Intramolecular lyases | Intramolecular lyases (only sub-subclass identified to date) | Chalcone isomerase | 1fm7 | |||||||||||||||||||||
Receptors | 1fm9 | 1fm9-570-2.10-x-1 | 617 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | metabolic syndrome diabetes cardiovascular diseases obesity |
activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
570 | 2.10 | farglitazar | Cc1oc(nc1CCOc2ccc(C[C@H](Nc3ccccc3C(=O)c4ccccc4)C(=O)O)cc2)c5ccccc5 | 196808-45-4 | CAS | Asymmetry in the PPARgamma/RXRalpha crystal structure reveals the molecular basis of heterodimerization among nuclear receptors | Gampe RT Jr, Montana VG, Lambert MH, Miller AB, Bledsoe RK, Milburn MV, Kliewer SA, Willson TM, Xu HE | Mol Cell 5(3):545-55 | 2000 | 10.1016/S1097-2765(00)80448-7 | |||||||||
Receptors | 1fm9 | 1fm9-570-2.10-x-2 | 276 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | metabolic syndrome diabetes cardiovascular diseases obesity |
activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
570 | 2.10 | farglitazar | Cc1oc(nc1CCOc2ccc(C[C@H](Nc3ccccc3C(=O)c4ccccc4)C(=O)O)cc2)c5ccccc5 | 196808-45-4 | CAS | Asymmetry in the PPARgamma/RXRalpha crystal structure reveals the molecular basis of heterodimerization among nuclear receptors | Gampe RT Jr, Montana VG, Lambert MH, Miller AB, Bledsoe RK, Milburn MV, Kliewer SA, Willson TM, Xu HE | Mol Cell 5(3):545-55 | 2000 | 10.1016/S1097-2765(00)80448-7 | |||||||||
1fmo | KAPCA_MOUSE | P05132 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 1fmo | |||||||||||||||||||||
Enzymes | 1fsg | 1fsg-9dg-1.05-d-1 | 2196 | antiinfective | toxoplasma gondii hypoxanthine phosphoribosyltransferase | EC2.- (transferases) | phosphoribosyl transferases | HGPRTase (T.gondii) | parasitic infection | inhibition of parasitic hypoxanthine phosphoribosyltransferase purine salvage from host for parasitic RNA and DNA synthesis |
9dg | 1.05 | 9-deazaguanine | NC2=NC(=O)C1N=CCC1=N2 | 65996-58-9 | cas | Substrate deformation in a hypoxanthine-guanine phosphoribosyltransferase ternary complex: the structural basis for catalysis | Heroux A, White EL, Ross LJ, Kuzin AP, Borhani DW | Structure Fold Des 8(12):1309-18 | 2000 | 10.1016/S0969-2126(00)00546-3 | |||||||||
1ftl | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 1ftl | |||||||||||||||||||||
Enzymes | 1fvt | 1fvt-106-2.20-h-1 | 0.88441 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | 106 | 2.20 | 222035-13-4 | [C=1C=C(C=CC1NN=C2C3=CC(=CC=C3NC2=O)Br)S(=O)(=O)N] | 222035-13-4 | CAS | Prevention of chemotherapy-induced alopecia in rats by CDK inhibitors | Davis, S.T., Benson, B.G., Bramson, H.N., Chapman, D.E., Dickerson, S.H., Dold, K.M., Eberwein, D.J., Edelstein, M., Frye, S.V., Gampe Jr, R.T., Griffin, R.J., Harris, P.A., Hassell, A.M., Holmes, W.D., Hunter, R.N., Knick, V.B., Lackey, K., Lovejoy, B., Luzzio, M.J., Murray, D., Parker, P., Rocque, W.J., Shewchuk, L., Veal, J.M., Walker, D.H., Kuyper, L.F. | Science 291:134-137 | 2001 | 10.1126/science.291.5501.134 | |||||||||
1fwk | KHSE_METJA | Q58504 | K00872 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Homoserine kinase | 1fwk | |||||||||||||||||||||
1fxo | Q9HU22_PSEAE | Q9HU22 | K00973 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Glucose-1-phosphate thymidylyltransferase | 1fxo | |||||||||||||||||||||
1fxu | PNPH_BOVIN | P55859 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1fxu | |||||||||||||||||||||
Enzymes | 1g27 | 1g27-bb1-2.10-d-1 | 1746 | antiinfective | escherichia coli formylmethionine deformylase | EC3.- (hydrolases) | amidases | PDF (E.coli) | bacterial infection fundamental research |
inhibition of formyl removal from growing polypeptide N-terminus (methionine) interference with bacterial protein synthesis |
bb1 | 2.10 | BB-3479 | CCCC[C@H](CN(O)C=O)C(=O)N[C@H](C(=O)N(C)C)C(C)(C)C | 235784-88-0 | cas | Antibiotic activity and characterization of BB-3497, a novel peptide deformylase inhibitor | Clements JM, Beckett RP, Brown A, Catlin G, Lobell M, Palan S, Thomas W, Whittaker M, Wood S, Salama S, Baker PJ, Rodgers HF, Barynin V, Rice DW, Hunter MG | Antimicrob Agents Chemother 45(2):563-70 | 2001 | 10.1128/AAC.45.2.563-570.2001 | |||||||||
1g27 | DEF_ECOLI | P0A6K3 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 1g27 | |||||||||||||||||||||
1g49 | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1g49 | |||||||||||||||||||||
Enzymes | 1g5s | 1g5s-i17-2.60-h-1 | 4.25652 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | i17 | 2.60 | 714963-24-3 | [C=1C=CC(=CC1)CNC=2C3=C(N=C(N2)NC4CCC(CC4)N)N(C=N3)C5CCCC5] | 714963-24-3 | CAS | Crystal structure of human cyclin-dependent kinase 2 in complex with the adenine-derived inhibitor H717 | Dreyer MK, Borcherding DR, Dumont JA, Peet NP, Tsay JT, Wright PS, Bitonti AJ, Shen J, Kim SH | J Med Chem 44(4):524-530 | 2001 | 10.1021/jm001043t | |||||||||
1g63 | EPID_STAEP | P30197 | KO_id not found | Others | Others | Others | Others | Others | 1g63 | |||||||||||||||||||||
1g8o | GGTA1_BOVIN | P14769 | K00743 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | N-acetyllactosaminide 3-alpha-galactosyltransferase | 1g8o | |||||||||||||||||||||
1g9s | HPRT_ECOLI | P0A9M2 | K00760 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Hypoxanthine phosphoribosyltransferase | 1g9s | |||||||||||||||||||||
1gg5 | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1gg5 | |||||||||||||||||||||
1gii | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1gii | |||||||||||||||||||||
1gs4 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1gs4 | |||||||||||||||||||||
Enzymes | 1gu1 | 1gu1-fa1-1.80-d-1 | 0.12527964 | antiinfective | bacterial 3-dehydroquinate dehydratase | EC4.- (lyases) | hydro-lyases | type II DHQase (S.coelicolor) | bacterial infection | inhibition of bacterial 3-dehydroquinate dehydratase interference with biosynthetic shikimate pathway interference with biosynthesis of aromatic compounds |
fa1 | 1.80 | 227002-11-1 | O=C(O)[C@]1(O)C=C[C@@H](O)[C@H](O)C1 | 227002-11-1 | cas | The structure and mechanism of the type II dehydroquinase from Streptomyces coelicolor | Roszak AW, Robinson DA, Krell T, Hunter IS, Fredrickson M, Abell C, Coggins JR, Lapthorn AJ | Structure 10(4):493-503 | 2002 | 10.1016/S0969-2126(02)00747-5 | |||||||||
1gvt | CARP_CRYPA | P11838 | K01381 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Saccharopepsin | 1gvt | |||||||||||||||||||||
1gx1 | ISPF_ECO57 | P62618 | K01770 | Enzymes | Lyases | Phosphorus-oxygen lyases | Phosphorus-oxygen lyases (only sub-subclass identified to date) | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | 1gx1 | |||||||||||||||||||||
Enzymes | 1h00 | 1h00-fap-1.60-h-1 | 0.81730 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | fap | 1.60 | 620629-44-9 | [CN(C)C[C@@H](COC1=CC=C(C=C1)NC2=CC(=NC=N2)NC3=C(C=CC=C3F)F)O] | 620629-44-9 | CAS | Cyclin-dependent kinase 4 inhibitors as a treatment for cancer. Part 1: identification and optimisation of substituted 4,6-bis anilino pyrimidines | Beattie, J.F., Breault, G.A., Ellston, R.P., Green, S., Jewsbury, P.J., Midgley, C.J., Naven, R.T., Minshull, C.A., Pauptit, R.A., Tucker, J.A., Pease, J.E. | Bioorg Med Chem Lett 13:2955-2960 | 2003 | 10.1016/S0960-894X(03)00202-6 | |||||||||
Enzymes | 1h0r | 1h0r-fa1-2.10-d-1 | 0.07307979 | antiinfective | bacterial 3-dehydroquinate dehydratase | EC4.- (lyases) | hydro-lyases | type II DHQase (M.tuberculosis) | tuberculosis bacterial infection |
inhibition of bacterial 3-dehydroquinate dehydratase interference with biosynthetic shikimate pathway interference with biosynthesis of aromatic compounds |
fa1 | 2.10 | 227002-11-1 | O=C(O)[C@]1(O)C=C[C@@H](O)[C@H](O)C1 | 227002-11-1 | cas | Structural Basis for Specificity of Oxime Based Inhibitors Towards Type II Dehydroquinase from Mycobacterium Tuberculosis | Robinson DA, Roszak AW, Frederickson M, Abell C, Coggins JR, Lapthorn AJ | to be published | 2003 | - | |||||||||
Enzymes | 1h1q | 1h1q-2a6-2.5-h-1-s | 323 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | 2a6 | 2.50 | NU 6094 | C(Oc1nc(Nc2ccccc2)nc3[nH]cnc13)C4CCCCC4 | 444722-80-9 | CAS | Structure-based design of a potent purine-based cyclin-dependent kinase inhibitor | Davies TG, Bentley J, Arris CE, Boyle FT, Curtin NJ, Endicott JA, Gibson AE, Golding BT, Griffin RJ, Hardcastle IR, Jewsbury P, Johnson LN, Mesguiche V, Newell DR, Noble ME, Tucker JA, Wang L, Whitfield HJ | Nat Struct Biol 9(10):745-9 | 2002 | 10.1038/nsb842 | |||||||||
Enzymes | 1h1s | 1h1s-4sp-2.0-h-1 | 449 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | 4sp | 2.00 | NU 6102 | NS(=O)(=O)c1ccc(Nc2nc(OCC3CCCCC3)c4nc[nH]c4n2)cc1 | 444722-95-6 | CAS | Structure-based design of a potent purine-based cyclin-dependent kinase inhibitor | Davies TG, Bentley J, Arris CE, Boyle FT, Curtin NJ, Endicott JA, Gibson AE, Golding BT, Griffin RJ, Hardcastle IR, Jewsbury P, Johnson LN, Mesguiche V, Newell DR, Noble ME, Tucker JA, Wang L, Whitfield HJ | Nat Struct Biol 9(10):745-9 | 2002 | 10.1038/nsb842 | |||||||||
1h1s | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1h1s | |||||||||||||||||||||
1h2h | ASPD_THEMA | Q9X1X6 | K06989 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With NAD+ or NADP+ as acceptor | Aspartate dehydrogenase | 1h2h | |||||||||||||||||||||
1h69 | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1h69 | |||||||||||||||||||||
1h8d | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1h8d | |||||||||||||||||||||
Transport proteins | 1h9z | 1h9z-rwf-2.50-h-1 | 13576 | immunologic | Serum albumin | extracellular proteins | serum proteins | HSA | inflammation | Serum albumin, the main protein of plasma, has a good binding capacity for water, Ca(2+), Na(+), K(+), fatty acids, hormones, bilirubin and drugs. Its main function is the regulation of the colloidal osmotic pressure of blood. | rwf | 2.50 | (S)-Warfarin | CC(=O)C[C@H](c1ccccc1)c2c(O)c3ccccc3oc2=O | 5543-57-7 | CAS | Crystal structure analysis of warfarin binding to human serum albumin: anatomy of drug site I | Petitpas I, Bhattacharya AA, Twine S, East M, Curry S | J Biol Chem 276(25):22804-9 | 2001 | 10.1074/jbc.M100575200 | |||||||||
Transport proteins | 1ha2 | 1ha2-swf-2.50-h-1-s | 1310 | immunologic | Serum albumin | extracellular proteins | serum proteins | HSA | inflammation | Serum albumin, the main protein of plasma, has a good binding capacity for water, Ca(2+), Na(+), K(+), fatty acids, hormones, bilirubin and drugs. Its main function is the regulation of the colloidal osmotic pressure of blood. | swf | 2.50 | (R)-Warfarin | CC(=O)C[C@@H](c1ccccc1)c2c(O)c3ccccc3oc2=O | 5543-58-8 | CAS | Crystal structure analysis of warfarin binding to human serum albumin: anatomy of drug site I | Petitpas I, Bhattacharya AA, Twine S, East M, Curry S | J Biol Chem 276(25):22804-9 | 2001 | 10.1074/jbc.M100575200 | |||||||||
Transport proteins | 1ha2 | 1ha2-swf-2.50-h-1 | 12247 | immunologic | Serum albumin | extracellular proteins | serum proteins | HSA | inflammation | Serum albumin, the main protein of plasma, has a good binding capacity for water, Ca(2+), Na(+), K(+), fatty acids, hormones, bilirubin and drugs. Its main function is the regulation of the colloidal osmotic pressure of blood. | swf | 2.50 | (R)-Warfarin | CC(=O)C[C@@H](c1ccccc1)c2c(O)c3ccccc3oc2=O | 5543-58-8 | CAS | Crystal structure analysis of warfarin binding to human serum albumin: anatomy of drug site I | Petitpas I, Bhattacharya AA, Twine S, East M, Curry S | J Biol Chem 276(25):22804-9 | 2001 | 10.1074/jbc.M100575200 | |||||||||
1hgx | HGXR_TRIFO | P51900 | KO_id not found | Others | Others | Others | Others | Others | 1hgx | |||||||||||||||||||||
1hon | PURA_ECOLI | P0A7D4 | K01939 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Adenylosuccinate synthase | 1hon | |||||||||||||||||||||
1hpg | Q54211_STRGR | Q54211 | KO_id not found | Others | Others | Others | Others | Others | 1hpg | |||||||||||||||||||||
1hpo | POL_HV1BR | P03367 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1hpo | |||||||||||||||||||||
1hpx | POL_HV1BR | P03367 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1hpx | |||||||||||||||||||||
1hy7 | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1hy7 | |||||||||||||||||||||
1hyh | DHL2_LACCO | P14295 | KO_id not found | Others | Others | Others | Others | Others | 1hyh | |||||||||||||||||||||
1i73 | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1i73 | |||||||||||||||||||||
1i8z | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1i8z | |||||||||||||||||||||
1i90 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1i90 | |||||||||||||||||||||
Enzymes | 1ia1 | 1ia1-tq3-1.70-d-1 | 2425 | antiinfective | candida albicans dihydrofolate reductase | EC1.- (oxydo-reductases) | dihydrofolate reductases | DHFR (C.albicans) | fungal infection | inhibition of fungal dihydrofolate reductase reduction of tetrahydrofolate |
tq3 | 1.70 | 123241-99-6 | Nc1nc(N)c2c(Sc3ccccc3)cccc2n1 | 123241-99-6 | cas | X-Ray crystal structures of Candida albicans dihydrofolate reductase: high resolution ternary complexes in which the dihydronicotinamide moiety of NADPH is displaced by an inhibitor | Whitlow M, Howard AJ, Stewart D, Hardman KD, Chan JH, Baccanari DP, Tansik RL, Hong JS, Kuyper LF | J Med Chem 44(18):2928-32 | 2001 | 10.1021/jm0101444 | |||||||||
Enzymes | 1ia2 | 1ia2-tq4-1.82-d-1-s | 2024 | antiinfective | candida albicans dihydrofolate reductase | EC1.- (oxydo-reductases) | dihydrofolate reductases | DHFR (C.albicans) | fungal infection | inhibition of fungal dihydrofolate reductase reduction of tetrahydrofolate |
tq4 | 1.82 | 168910-32-5 | Cc1ccc(Sc2cccc3nc(N)nc(N)c23)cc1 | 168910-32-5 | cas | X-Ray crystal structures of Candida albicans dihydrofolate reductase: high resolution ternary complexes in which the dihydronicotinamide moiety of NADPH is displaced by an inhibitor | Whitlow M, Howard AJ, Stewart D, Hardman KD, Chan JH, Baccanari DP, Tansik RL, Hong JS, Kuyper LF | J Med Chem 44(18):2928-32 | 2001 | 10.1021/jm0101444 | |||||||||
1if9 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1if9 | |||||||||||||||||||||
1ij8 | AVID_CHICK | P02701 | KO_id not found | Others | Others | Others | Others | Others | 1ij8 | |||||||||||||||||||||
1iky | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1iky | |||||||||||||||||||||
1ish | BST1_HUMAN | Q10588 | K01242 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | NAD+ nucleosidase | 1ish | |||||||||||||||||||||
1isj | BST1_HUMAN | Q10588 | K01242 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | NAD+ nucleosidase | 1isj | |||||||||||||||||||||
Enzymes | 1j2g | 1j2g-aza-2.20-d-2 | 727 | antiinfective | Bacillus sp urate oxidase | EC1.- (oxydo-reductases) | urate oxidases | Uox (Bacillus sp.) | bacterial infection fundamental research |
inhibition of bacterial urate oxidase interference with purine degradation |
aza | 2.20 | 8-azaxanthine | O=c1[nH]c(=O)c2[nH]nnc2[nH]1 | 1468-26-4 | cas | Crystal structure of urate oxidase from Bacillus SP | Hibi T, Nago T, Nishiya Y, Oda J | to be published | 2004 | - | |||||||||
1jdt | PNPH_SULSO | P50389 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1jdt | |||||||||||||||||||||
1jdv | PNPH_SULSO | P50389 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1jdv | |||||||||||||||||||||
1jdz | PNPH_SULSO | P50389 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1jdz | |||||||||||||||||||||
1je1 | PNPH_SULSO | P50389 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1je1 | |||||||||||||||||||||
1jiz | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 1jiz | |||||||||||||||||||||
1jk3 | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 1jk3 | |||||||||||||||||||||
1jla | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1jla | |||||||||||||||||||||
1jlx | Q71QF2_AMACA | Q71QF2 | KO_id not found | Others | Others | Others | Others | Others | 1jlx | |||||||||||||||||||||
1jm6 | PDK2_RAT | Q64536 | K00898 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 1jm6 | |||||||||||||||||||||
1jnq | LOX3_SOYBN | P09186 | K00454 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | Linoleate 13S-lipoxygenase | 1jnq | |||||||||||||||||||||
1jot | LECA_MACPO | P18674 | KO_id not found | Others | Others | Others | Others | Others | 1jot | |||||||||||||||||||||
Enzymes | 1jr1 | 1jr1-moa-2.60-d-1-s | 30 | antiinfective oncolytic immunologic |
IMP dehydrogenase | EC1.- (oxydo-reductases) | IMP dehydrogenases | IMPDH | cancer viral infection autoimmune suppression herpes infection fundamental research |
inhibition of conversion of IMP to XMP and consequently of de novo guanine nucleotide biosynthesis depletion of the guanylate (GMP, GDP, GTP and dGTP) pools inhibition of growth and differentiation of human lymphocytes (suppression of T and B lyphocyte proliferation) |
moa | 2.60 | mycophenolic acid | COc1c(C)c2COC(=O)c2c(O)c1C/C=C(\C)/CCC(=O)O | 24280-93-1 | CAS | Structure and mechanism of inosine monophosphate dehydrogenase in complex with the immunosuppressant mycophenolic acid | Sintchak MD, Fleming MA, Futer O, Raybuck SA, Chambers SP, Caron PR, Murcko MA, Wilson KP | Cell 85(6):921-30 | 1996 | 10.1016/S0092-8674(00)81275-1 | |||||||||
Enzymes | 1jr1 | 1jr1-moa-2.60-d-1 | 133 | antiinfective oncolytic immunologic |
IMP dehydrogenase | EC1.- (oxydo-reductases) | IMP dehydrogenases | IMPDH | cancer viral infection autoimmune suppression herpes infection fundamental research |
inhibition of conversion of IMP to XMP and consequently of de novo guanine nucleotide biosynthesis depletion of the guanylate (GMP, GDP, GTP and dGTP) pools inhibition of growth and differentiation of human lymphocytes (suppression of T and B lyphocyte proliferation) |
moa | 2.60 | mycophenolic acid | COc1c(C)c2COC(=O)c2c(O)c1C/C=C(\C)/CCC(=O)O | 24280-93-1 | CAS | Structure and mechanism of inosine monophosphate dehydrogenase in complex with the immunosuppressant mycophenolic acid | Sintchak MD, Fleming MA, Futer O, Raybuck SA, Chambers SP, Caron PR, Murcko MA, Wilson KP | Cell 85(6):921-30 | 1996 | 10.1016/S0092-8674(00)81275-1 | |||||||||
Enzymes | 1jsv | 1jsv-u55-1.90-h-1 | 9.52573 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | u55 | 1.90 | 400611-95-2 | [C=1C=C(C=CC1NC=2C=C(N=CN2)N)S(=O)(=O)N] | 400611-95-2 | CAS | The cyclin-dependent kinases cdk2 and cdk5 act by a random, anticooperative kinetic mechanism | Clare, P.M., Poorman, R.A., Kelley, L.C., Watenpaugh, K.D., Bannow, C.A., Leach, K.L. | J Biol Chem 276:48292-48299 | 2001 | 10.1074/jbc.M102034200 | |||||||||
Enzymes | 1jsv | 1jsv-u55-1.96-h-1 | 1316 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | u55 | 1.95 | PNU 112455A | Nc1cc(Nc2ccc(cc2)S(=O)(=O)N)ncn1 | 400611-95-2 | CAS | The Cyclin-dependent Kinases cdk2 and cdk5 Act by a Random, Anticooperative Kinetic Mechanism | Clare PM, Poorman RA, Kelley LC, Watenpaugh KD, Bannow CA, Leach KL | J. Biol. Chem 276(51), 48292-48299 | 2001 | 10.1074/jbc.M102034200 | |||||||||
Enzymes | 1jvp | 1jvp-lig-1.53-h-1 | 8.57867 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | lig | 1.5 | 54714-78-2 | [C=1C=CC2=C(C1)CC3=C2NN=C3C4=CC=NC=C4] | 54714-78-2 | CAS | Structure-based design and protein X-ray analysis of a protein kinase inhibitor | Furet, P., Meyer, T., Strauss, A., Raccuglia, S., Rondeau, J.M. | Bioorg Med Chem Lett 12:221-224 | 2002 | 10.1016/S0960-894X(01)00715-6 | |||||||||
1jyv | BGAL_ECOLI | P00722 | K12309 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Beta-galactosidase | 1jyv | |||||||||||||||||||||
1jyw | BGAL_ECOLI | P00722 | K12309 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Beta-galactosidase | 1jyw | |||||||||||||||||||||
1k3u | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1k3u | |||||||||||||||||||||
1k4g | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 1k4g | |||||||||||||||||||||
1k7f | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1k7f | |||||||||||||||||||||
Enzymes | 1k9s | 1k9s-fm2-2.00-d-1 | 0.840349408438245 | antiinfective | escherichia coli purine nucleoside phosphorylase | EC2.- (transferases) | nucleoside phosphorylase | PNP (E.coli) | bacterial infection | inhibition of bacterial purine nucleoside phosphorylase, an important enzyme in purine salvage pathway | fm2 | 2.00 | 502174-44-9 | CN1C=NC2=C(C1=N)NN=C2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O | 502174-44-9 | CAS | Open and closed conformation of the E. coli purine nucleoside phosphorylase active center and implications for the catalytic mechanism | Koellner G, Bzowska A, Wielgus-Kutrowska B, Luic M, Steiner T, Saenger W, Stepinski J | J Mol Biol 315(3):351-71 | 2002 | 10.1006/jmbi.2001.5211 | |||||||||
1kap | APRA_PSEAE | Q03023 | KO_id not found | Others | Others | Others | Others | Others | 1kap | |||||||||||||||||||||
1kbq | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1kbq | |||||||||||||||||||||
Enzymes | 1ke5 | 1ke5-ls1-2.20-h-1 | 8.68158 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | ls1 | 2.2 | 388627-55-2 | [CNS(=O)(=O)C1=CC=C(C=C1)NC=C2C=3C=CC=CC3NC2=O] | 388627-55-2 | CAS | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem 44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
1ke5 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ke5 | |||||||||||||||||||||
Enzymes | 1ke7 | 1ke7-ls3-2.00-d-1 | 300 | oncolytic | cyclin-dependent kinase 2 CDK2 |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer | inhibition of cell cycle controlling enzyme CDK2 apoptosis in tumour cells |
ls3 | 2.00 | 388627-76-7 | O=C/1Nc2ccc(cc2\C1=C\Nc3ccc4CS(=O)(=O)Cc4c3)c5cnco5 | 388627-76-7 | cas | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem ;44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
1ke7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ke7 | |||||||||||||||||||||
Enzymes | 1ke9 | 1ke9-ls5-2.00-h-1 | 105 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | ls5 | 2.00 | 388627-61-0 | NC(=N)NS(=O)(=O)c1ccc(N/C=C/2\C(=O)Nc3ccccc23)cc1 | 388627-61-0 | CAS | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem 44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
Enzymes | 1ki3 | 1ki3-pe2-2.37-d-1 | 0.799279700507053 | antiinfective | Herpes simplex virus thymidine kinase | EC2.- (transferases) | kinases (thymidine) | TK (HSV1) | herpes infection | substrate of viral thymidine kinase thereby activation of prodrug termination of viral DNA elongation at the viral DNA polymerase |
pe2 | 2.37 | penciclovir | C1=NC=2C(=O)NC(=NC2N1CCC(CO)CO)N | 39809-25-1 | CAS | Exploring the active site of herpes simplex virus type-1 thymidine kinase by X-ray crystallography of complexes with aciclovir and other ligands | Champness JN, Bennett MS, Wien F, Visse R, Summers WC, Herdewijn P, de Clerq E, Ostrowski T, Jarvest RL, Sanderson MR | Proteins 32(3):350-61 | 1998 | - | |||||||||
1kie | Q9GPQ4_TRYVI | Q9GPQ4 | KO_id not found | Others | Others | Others | Others | Others | 1kie | |||||||||||||||||||||
1klm | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 1klm | |||||||||||||||||||||
1krv | THGA_ECOLI | P07464 | K00633 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Galactoside O-acetyltransferase | 1krv | |||||||||||||||||||||
1kug | VM2T3_PROMU | O57413 | KO_id not found | Others | Others | Others | Others | Others | 1kug | |||||||||||||||||||||
1kui | VM2T3_PROMU | O57413 | KO_id not found | Others | Others | Others | Others | Others | 1kui | |||||||||||||||||||||
1kuk | VM2T3_PROMU | O57413 | KO_id not found | Others | Others | Others | Others | Others | 1kuk | |||||||||||||||||||||
1kv1 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1kv1 | |||||||||||||||||||||
1kv2 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1kv2 | |||||||||||||||||||||
1kyv | RIB4_SCHPO | Q9UUB1 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 1kyv | |||||||||||||||||||||
1kyx | RIB4_SCHPO | Q9UUB1 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 1kyx | |||||||||||||||||||||
1kyy | RIB4_SCHPO | Q9UUB1 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 1kyy | |||||||||||||||||||||
1kzl | RISA_SCHPO | Q9Y7P0 | K00793 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Riboflavin synthase | 1kzl | |||||||||||||||||||||
1l2s | AMPC_ECOLI | P00811 | K01467 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amides | Beta-lactamase | 1l2s | |||||||||||||||||||||
1lcw | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 1lcw | |||||||||||||||||||||
1lcz | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 1lcz | |||||||||||||||||||||
1led | LEC4_GRISI | P24146 | KO_id not found | Others | Others | Others | Others | Others | 1led | |||||||||||||||||||||
1lho | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1lho | |||||||||||||||||||||
1lhr | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1lhr | |||||||||||||||||||||
1lhv | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1lhv | |||||||||||||||||||||
1lkd | BPHC_BURXL | P47228 | K00462 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | Biphenyl-2,3-diol 1,2-dioxygenase | 1lkd | |||||||||||||||||||||
1llq | MAOM_ASCSU | P27443 | K00027 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Malate dehydrogenase (oxaloacetate-decarboxylating) | 1llq | |||||||||||||||||||||
Toxins and defence proteins | 1llr | 1llr-fng-1.46-d-1 | 1820 | antiinfective | cholera toxin | Toxins | bacterial toxins | toxin (cholera) | diarrhoea | inhibition of cell receptor binding by toxin interference with bacterial toxin entry into host cell |
fng | 1.46 | INT-1llr-fng-d | Nc3c(NCCCOCCOCCOCCCNC(=O)c2cc(O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)cc(N(=O)=O)c2)c(=O)c3=O | INT-1llr-fng-d | int | Characterization and crystal structure of a high-affinity pentavalent receptor-binding inhibitor for cholera toxin and E. coli heat-labile enterotoxin | Merritt EA, Zhang Z, Pickens JC, Ahn M, Hol WG, Fan E | J Am Chem Soc 124(30):8818-24 | 2002 | 10.1021/ja0202560 | |||||||||
1lp6 | PYRF_METTH | O26232 | K01591 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Orotidine-5'-phosphate decarboxylase | 1lp6 | |||||||||||||||||||||
1lqy | DEF2_GEOSE | O31410 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 1lqy | |||||||||||||||||||||
1lry | DEF_PSEAE | Q9I7A8 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 1lry | |||||||||||||||||||||
1lsj | HCDH_HUMAN | Q16836 | K00022 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3-hydroxyacyl-CoA dehydrogenase | 1lsj | |||||||||||||||||||||
1lvw | O27819_METTH | O27819 | KO_id not found | Others | Others | Others | Others | Others | 1lvw | |||||||||||||||||||||
1m26 | LECA_ARTIN | P18670 | KO_id not found | Others | Others | Others | Others | Others | 1m26 | |||||||||||||||||||||
1m2r | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 1m2r | |||||||||||||||||||||
Enzymes | 1me7 | 1me7-moa-2.20-d-1 | 1215 | antiinfective oncolytic immunologic |
IMP dehydrogenase | EC1.- (oxydo-reductases) | IMP dehydrogenases | IMPDH | cancer viral infection autoimmune suppression herpes infection fundamental research |
inhibition of conversion of IMP to XMP and consequently of de novo guanine nucleotide biosynthesis depletion of the guanylate (GMP, GDP, GTP and dGTP) pools inhibition of growth and differentiation of human lymphocytes (suppression of T and B lyphocyte proliferation) |
moa | 2.20 | mycophenolic acid | COc1c(C)c2COC(=O)c2c(O)c1C/C=C(\C)/CCC(=O)O | 24280-93-1 | CAS | Crystal structure of Tritrichomonas foetus inosine monophosphate dehydrogenase in complex with the inhibitor ribavirin monophosphate reveals a catalysis-dependent ion-binding site | Prosise GL, Wu JZ, Luecke H | J Biol Chem 277(52):50654-9 | 2002 | 10.1074/jbc.M208330200 | |||||||||
Enzymes | 1me8 | 1me8-rvp-1.90-d-1 | 37 | antiinfective oncolytic immunologic |
IMP dehydrogenase | EC1.- (oxydo-reductases) | IMP dehydrogenases | IMPDH | cancer viral infection autoimmune suppression herpes infection fundamental research |
inhibition of conversion of IMP to XMP and consequently of de novo guanine nucleotide biosynthesis depletion of the guanylate (GMP, GDP, GTP and dGTP) pools inhibition of growth and differentiation of human lymphocytes (suppression of T and B lyphocyte proliferation) |
rvp | 1.90 | ribavirin monophosphate | NC(=O)c1ncn(n1)[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O | 40925-28-8 | CAS | Crystal structure of Tritrichomonas foetus inosine monophosphate dehydrogenase in complex with the inhibitor ribavirin monophosphate reveals a catalysis-dependent ion-binding site | Prosise GL, Wu JZ, Luecke H | J Biol Chem 277(52):50654-9 | 2002 | 10.1074/jbc.M208330200 | |||||||||
1me8 | IMDH_TRIFO | P50097 | K00088 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | IMP dehydrogenase | 1me8 | |||||||||||||||||||||
1me9 | IMDH_TRIFO | P50097 | K00088 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | IMP dehydrogenase | 1me9 | |||||||||||||||||||||
Enzymes | 1meh | 1meh-moa-2.00-d-1 | 590 | antiinfective oncolytic immunologic |
IMP dehydrogenase | EC1.- (oxydo-reductases) | IMP dehydrogenases | IMPDH | cancer viral infection autoimmune suppression herpes infection fundamental research |
inhibition of conversion of IMP to XMP and consequently of de novo guanine nucleotide biosynthesis depletion of the guanylate (GMP, GDP, GTP and dGTP) pools inhibition of growth and differentiation of human lymphocytes (suppression of T and B lyphocyte proliferation) |
moa | 2.00 | mycophenolic acid | COc1c(C)c2COC(=O)c2c(O)c1C/C=C(\C)/CCC(=O)O | 24280-93-1 | CAS | Crystal Structures of Tritrichomonas foetus Inosine Monophosphate Dehydrogenase in Complex with Substrate, Cofactor and Analogs: A Structural Basis for the Random-in Ordered-out Kinetic Mechanism | Prosise GL, Luecke H | J Mol Biol ;326(2):517-27 | 2003 | 10.1016/S0022-2836(02)01383-9 | |||||||||
Enzymes | 1mei | 1mei-moa-2.20-d-1 | 500 | antiinfective oncolytic immunologic |
IMP dehydrogenase | EC1.- (oxydo-reductases) | IMP dehydrogenases | IMPDH | cancer viral infection autoimmune suppression herpes infection fundamental research |
inhibition of conversion of IMP to XMP and consequently of de novo guanine nucleotide biosynthesis depletion of the guanylate (GMP, GDP, GTP and dGTP) pools inhibition of growth and differentiation of human lymphocytes (suppression of T and B lyphocyte proliferation) |
moa | 2.20 | mycophenolic acid | COc1c(C)c2COC(=O)c2c(O)c1C/C=C(\C)/CCC(=O)O | 24280-93-1 | CAS | Crystal Structures of Tritrichomonas foetus Inosine Monophosphate Dehydrogenase in Complex with Substrate, Cofactor and Analogs: A Structural Basis for the Random-in Ordered-out Kinetic Mechanism | Prosise GL, Luecke H | J Mol Biol ;326(2):517-27 | 2003 | 10.1016/S0022-2836(02)01383-9 | |||||||||
1mf1 | PURA1_MOUSE | P28650 | K01939 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Adenylosuccinate synthase | 1mf1 | |||||||||||||||||||||
1mmb | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1mmb | |||||||||||||||||||||
1mmp | MMP7_HUMAN | P09237 | K01397 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Matrilysin | 1mmp | |||||||||||||||||||||
1mmq | MMP7_HUMAN | P09237 | K01397 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Matrilysin | 1mmq | |||||||||||||||||||||
1mmr | MMP7_HUMAN | P09237 | K01397 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Matrilysin | 1mmr | |||||||||||||||||||||
1mnc | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1mnc | |||||||||||||||||||||
1mrh | RIP1_MOMCH | P16094 | KO_id not found | Others | Others | Others | Others | Others | 1mrh | |||||||||||||||||||||
1mvn | HAL3A_ARATH | Q9SWE5 | K01598 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Phosphopantothenoylcysteine decarboxylase | 1mvn | |||||||||||||||||||||
1mvt | DYR_HUMAN | P00374 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 1mvt | |||||||||||||||||||||
1mxi | TRML_HAEIN | P44868 | K03216 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | TRNA (cytidine34-2'-O)-methyltransferase | 1mxi | |||||||||||||||||||||
1n2i | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 1n2i | |||||||||||||||||||||
1n3p | Q8GSD2_PTEAG | Q8GSD2 | KO_id not found | Others | Others | Others | Others | Others | 1n3p | |||||||||||||||||||||
1nb0 | RIFK_HUMAN | Q969G6 | K00861 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Riboflavin kinase | 1nb0 | |||||||||||||||||||||
1nb9 | RIFK_HUMAN | Q969G6 | K00861 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Riboflavin kinase | 1nb9 | |||||||||||||||||||||
1nc1 | MTNN_ECO57 | P0AF14 | K01243 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | Adenosylhomocysteine nucleosidase | 1nc1 | |||||||||||||||||||||
1nc3 | MTNN_ECO57 | P0AF14 | K01243 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | Adenosylhomocysteine nucleosidase | 1nc3 | |||||||||||||||||||||
1ndy | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1ndy | |||||||||||||||||||||
1ne4 | KAP0_BOVIN | P00514 | K04739 | Others | Organismal Systems | Endocrine system | Insulin signaling pathway | PRKAR; cAMP-dependent protein kinase regulator | 1ne4 | |||||||||||||||||||||
1ne6 | KAP0_BOVIN | P00514 | K04739 | Others | Organismal Systems | Endocrine system | Insulin signaling pathway | PRKAR; cAMP-dependent protein kinase regulator | 1ne6 | |||||||||||||||||||||
1nlu | PICP_PSESR | P42790 | KO_id not found | Others | Others | Others | Others | Others | 1nlu | |||||||||||||||||||||
1nmk | PPIA_HUMAN | P62937 | K03767 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 1nmk | |||||||||||||||||||||
1nqu | RISB_AQUAE | O66529 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 1nqu | |||||||||||||||||||||
1nqv | RISB_AQUAE | O66529 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 1nqv | |||||||||||||||||||||
1nup | NMNA3_HUMAN | Q96T66 | K06210 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Nicotinamide-nucleotide adenylyltransferase | 1nup | |||||||||||||||||||||
1nva | ARO1_EMENI | P07547 | K13830 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Shikimate dehydrogenase | 1nva | |||||||||||||||||||||
Enzymes | 1nvs | 1nvs-ucm-1.80-d-1-s | 1784 | oncolytic | serine/threonine-protein kinase Chk1 (checkpoint kinase) | EC2.- (transferases) | kinases (serine-threonine) | Chk1 | cancer | prevention of cell cycle delays that provide opportunities for cells to repair DNA damage interference with G(2)/M cell cycle control |
ucm | 1.80 | SB-218078 | O=C1NC(=O)c2c1c3c4ccccc4n5[C@H]6CC[C@H](O6)n7c8ccccc8c2c7c53 | 135897-06-2 | cas | Structural basis for Chk1 inhibition by UCN-01 | Zhao B, Bower MJ, McDevitt PJ, Zhao H, Davis ST, Johanson KO, Green SM, Concha NO, Zhou BB | J Biol Chem 277(48):46609-15 | 2002 | 10.1074/jbc.M201233200 | |||||||||
1nwk | ACTS_RABIT | P68135 | K10354 | Others | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actins | Actins | 1nwk | |||||||||||||||||||||
1o5o | UPP_THEMA | Q9WZI0 | K00761 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Uracil phosphoribosyltransferase | 1o5o | |||||||||||||||||||||
1o5r | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1o5r | |||||||||||||||||||||
1o69 | Q9S5Y7_CAMJU | Q9S5Y7 | KO_id not found | Others | Others | Others | Others | Others | 1o69 | |||||||||||||||||||||
1o6g | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1o6g | |||||||||||||||||||||
1o6y | PKNB_MYCTU | P0A5S4 | K08884 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1o6y | |||||||||||||||||||||
1ocn | GUX6_HUMIN | Q9C1S9 | KO_id not found | Others | Others | Others | Others | Others | 1ocn | |||||||||||||||||||||
1od1 | CARP_CRYPA | P11838 | K01381 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Saccharopepsin | 1od1 | |||||||||||||||||||||
1of1 | KITH_HHV11 | P03176 | K00857 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Thymidine kinase | 1of1 | |||||||||||||||||||||
Enzymes | 1ogu | 1ogu-st8-2.6-h-1 | 52 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | st8 | 2.60 | 610755-06-1 | NC(=O)c1ccc(Nc2nc(N)c(N=O)c(OCC3CCCCC3)n2)cc1 | 610755-06-1 | CAS | Structure-based design of 2-arylamino-4-cyclohexylmethyl-5-nitroso-6-aminopyrimidine inhibitors of cyclin-dependent kinases 1 and 2 | Sayle KL, Bentley J, Boyle FT, Calvert AH, Cheng Y, Curtin NJ, Endicott JA, Golding BT, Hardcastle IR, Jewsbury P, Mesguiche V, Newell DR, Noble ME, Parsons RJ, Pratt DJ, Wang LZ, Griffin RJ | Bioorg Med Chem Lett 13(18):3079-82 | 2003 | 10.1016/S0960-894X(03)00651-6 | |||||||||
1ogu | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ogu | |||||||||||||||||||||
Enzymes | 1oi9 | 1oi9-n20-2.1-h-1-s | 36 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | n20 | 2.10 | 444722-92-3 | Oc1ccc(Nc2nc(OCC3CCCCC3)c4nc[nH]c4n2)cc1 | 444722-92-3 | CAS | N2-substituted O6-cyclohexylmethylguanine derivatives: potent inhibitors of cyclin-dependent kinases 1 and 2 | Hardcastle IR, Arris CE, Bentley J, Boyle FT, Chen Y, Curtin NJ, Endicott JA, Gibson AE, Golding BT, Griffin RJ, Jewsbury P, Menyerol J, Mesguiche V, Newell DR, Noble ME, Pratt DJ, Wang LZ, Whitfield HJ | J Med Chem 47(15):3710-22 | 2004 | 10.1021/jm0311442 | |||||||||
Enzymes | 1oiq | 1oiq-hdu-2.31-h-1-s | 229 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | hdu | 2.31 | 611239-38-4 | CC(=O)Nc1nccc(n1)c2c(C)nc3ccccn23 | 611239-38-4 | CAS | Imidazo[1,2-a]pyridines: a potent and selective class of cyclin-dependent kinase inhibitors identified through structure-based hybridisation | Anderson M, Beattie JF, Breault GA, Breed J, Byth KF, Culshaw JD, Ellston RP, Green S, Minshull CA, Norman RA, Pauptit RA, Stanway J, Thomas AP, Jewsbury PJ | Bioorg Med Chem Lett 13(18):3021-6 | 2003 | 10.1016/S0960-894X(03)00638-3 | |||||||||
Enzymes | 1oiu | 1oiu-n76-2.00-h-1-s | 8 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | n76 | 2.00 | 721925-82-2 | NS(=O)(=O)c1cccc(Nc2nc(OCC3CCCCC3)c4nc[nH]c4n2)c1 | 721925-82-2 | CAS | N2-substituted O6-cyclohexylmethylguanine derivatives: potent inhibitors of cyclin-dependent kinases 1 and 2 | Hardcastle IR, Arris CE, Bentley J, Boyle FT, Chen Y, Curtin NJ, Endicott JA, Gibson AE, Golding BT, Griffin RJ, Jewsbury P, Menyerol J, Mesguiche V, Newell DR, Noble ME, Pratt DJ, Wang LZ, Whitfield HJ | J Med Chem 47(15):3710-22 | 2004 | 10.1021/jm0311442 | |||||||||
Enzymes | 1oiu | 1oiu-n76-2.00-h-1 | 430 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | n76 | 2.00 | 721925-82-2 | NS(=O)(=O)c1cccc(Nc2nc(OCC3CCCCC3)c4nc[nH]c4n2)c1 | 721925-82-2 | CAS | N2-substituted O6-cyclohexylmethylguanine derivatives: potent inhibitors of cyclin-dependent kinases 1 and 2 | Hardcastle IR, Arris CE, Bentley J, Boyle FT, Chen Y, Curtin NJ, Endicott JA, Gibson AE, Golding BT, Griffin RJ, Jewsbury P, Menyerol J, Mesguiche V, Newell DR, Noble ME, Pratt DJ, Wang LZ, Whitfield HJ | J Med Chem 47(15):3710-22 | 2004 | 10.1021/jm0311442 | |||||||||
1olt | HEMN_ECOLI | P32131 | K02495 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With other acceptors | Coproporphyrinogen dehydrogenase | 1olt | |||||||||||||||||||||
1oq5 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1oq5 | |||||||||||||||||||||
Enzymes | 1os5 | 1os5-nh1-2.20-d-1 | 2889 | antiinfective | RNA-dependent RNA polymerase (NS5B) from hepatitic C virus | EC2.- (transferases) | RNA polymerases | NS5B (HCV) | hepatitis C virus infection | inhibition of viral replication inhibition of transcription of viral genomic RNA and consequently of viral genome replication |
nh1 | 2.20 | INT-239804-71-8-art-1-d | Cc1cc(SC2=C(O)C[C@](CCc3ccc(O)cc3)(OC2=O)C4CCCC4)c(cc1N)C(C)(C)C | INT-239804-71-8-art-1-d | INT | Crystallographic identification of a noncompetitive inhibitor binding site on the hepatitis C virus NS5B RNA polymerase enzyme | Love RA, Parge HE, Yu X, Hickey MJ, Diehl W, Gao J, Wriggers H, Ekker A, Wang L, Thomson JA, Dragovich PS, Fuhrman SA | J Virol 77(13):7575-81 | 2003 | 10.1128/JVI.77.13.7575-7581.2003 | |||||||||
Enzymes | 1osn | 1osn-bvp-3.20-d-1-s | 0.252736664191954 | antiinfective | Varicella zoster virus thymidine kinase | EC2.- (transferases) | kinases (thymidine) | TK (V.zoster) | herpes infection | substrate of viral thymidine kinase thereby activation of prodrug termination of viral DNA elongation at the viral DNA polymerase |
bvp | 3.20 | brivudin monophosphate | C1=C(C(=O)NC(=O)N1[C@H]2C[C@@H]([C@H](O2)COP(=O)(O)O)O)C=CBr | 80860-82-8 | CAS | Crystal structure of varicella zoster virus thymidine kinase | Bird LE, Ren J, Wright A, Leslie KD, Degreve B, Balzarini J, Stammers DK | J Biol Chem 278(27):24680-7 | 2003 | 10.1074/jbc.M302025200 | |||||||||
Enzymes | 1osn | 1osn-bvp-3.20-d-1 | 0.807177721263051 | antiinfective | Varicella zoster virus thymidine kinase | EC2.- (transferases) | kinases (thymidine) | TK (V.zoster) | herpes infection | substrate of viral thymidine kinase thereby activation of prodrug termination of viral DNA elongation at the viral DNA polymerase |
bvp | 3.20 | brivudin monophosphate | C1=C(C(=O)NC(=O)N1[C@H]2C[C@@H]([C@H](O2)COP(=O)(O)O)O)C=CBr | 80860-82-8 | CAS | Crystal structure of varicella zoster virus thymidine kinase | Bird LE, Ren J, Wright A, Leslie KD, Degreve B, Balzarini J, Stammers DK | J Biol Chem 278(27):24680-7 | 2003 | 10.1074/jbc.M302025200 | |||||||||
1oum | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1oum | |||||||||||||||||||||
1ov6 | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1ov6 | |||||||||||||||||||||
1ovg | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1ovg | |||||||||||||||||||||
1oxl | PA2B8_DABRR | P59071 | KO_id not found | Others | Others | Others | Others | Others | 1oxl | |||||||||||||||||||||
1p19 | Q27796_TRYCR | Q27796 | KO_id not found | Others | Others | Others | Others | Others | 1p19 | |||||||||||||||||||||
Enzymes | 1p2a | 1p2a-5bn-2.5-h-1-s | 0.77405 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | sbn | 2.5 | 444099-54-1 | [C=1C=C(NC1)C=2C=C(C=3C(=CC=C4C3C2C(=O)N4)F)NCCN] | 444099-54-1 | CAS | 3,5,6-Trisubstituted Naphthostyrils as CDK2 Inhibitors | Liu, J.-J., Dermatakis, A., Lukacs, C.M., Konzelmann, F., Chen, Y., Kammlott, U., Depinto, W., Yang, H., Yin, X., Chen, Y., Schutt, A., Simcox, M.E., Luk, K.-C. | Bioorg Med Chem 13:2465-2468 | 2003 | 10.1016/S0960-894X(03)00488-8 | |||||||||
Enzymes | 1p2a | 1p2a-5bn-2.5-h-1 | 6.85309 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | sbn | 2.5 | 444099-54-1 | [C=1C=C(NC1)C=2C=C(C=3C(=CC=C4C3C2C(=O)N4)F)NCCN] | 444099-54-1 | CAS | 3,5,6-Trisubstituted Naphthostyrils as CDK2 Inhibitors | Liu, J.-J., Dermatakis, A., Lukacs, C.M., Konzelmann, F., Chen, Y., Kammlott, U., Depinto, W., Yang, H., Yin, X., Chen, Y., Schutt, A., Simcox, M.E., Luk, K.-C. | Bioorg Med Chem 13:2465-2468 | 2003 | 10.1016/S0960-894X(03)00488-8 | |||||||||
Enzymes | 1p2a | 1p2a-5bn-2.50-h-1-s | 94 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | 5bn | 2.50 | 444099-54-1 | NCCNc1cc(c2ccc[nH]2)c3C(=O)Nc4ccc(F)c1c43 | 444099-54-1 | CAS | 3,5,6-Trisubstituted naphthostyrils as CDK2 inhibitors | Liu JJ, Dermatakis A, Lukacs C, Konzelmann F, Chen Y, Kammlott U, Depinto W, Yang H, Yin X, Chen Y, Schutt A, Simcox ME, Luk KC | Bioorg Med Chem Lett 13(15):2465-8 | 2003 | 10.1016/S0960-894X(03)00488-8 | |||||||||
Enzymes | 1p2a | 1p2a-5bn-2.50-h-1 | 947 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | 5bn | 2.50 | 444099-54-1 | NCCNc1cc(c2ccc[nH]2)c3C(=O)Nc4ccc(F)c1c43 | 444099-54-1 | CAS | 3,5,6-Trisubstituted naphthostyrils as CDK2 inhibitors | Liu JJ, Dermatakis A, Lukacs C, Konzelmann F, Chen Y, Kammlott U, Depinto W, Yang H, Yin X, Chen Y, Schutt A, Simcox ME, Luk KC | Bioorg Med Chem Lett 13(15):2465-8 | 2003 | 10.1016/S0960-894X(03)00488-8 | |||||||||
1p33 | PTR1_LEITA | P42556 | KO_id not found | Enzymes | 1. Oxidoreductases | pteridine reductases | PTR1 (L.tarantolae) | Others | 1p33 | |||||||||||||||||||||
1p91 | RLMA_ECOLI | P36999 | K00563 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 23S rRNA (guanine745-N1)-methyltransferase | 1p91 | |||||||||||||||||||||
Enzymes | 1pbk | 1pbk-rap-2.50-d-1 | 186 | immunologic | 25 kDa FK506 binding protein C-terminal domain peptidyl-prolyl isomerase | EC5.- (isomerases) | peptidyl-prolyl cis-trans isomerases | FKBP | autoimmune suppression | blockage of T-cell activation | rap | 2.50 | rapamycin | CO[C@@H]1C[C@H](C[C@@H](C)[C@@H]2CC(=O)[C@H](C)/C=C(\C)/[C@@H](O)[C@@H](OC)C(=O)[C@H](C)C[C@H](C)/C=C/C=C/C=C(\C)/[C@H](C[C@@H]3CC[C@@H](C)[C@@](O)(O3)C(=O)C(=O)N4CCCC[C@H]4C(=O)O2)OC)CC[C@H]1O | 53123-88-9 | cas | Structure of the human 25 kDa FK506 binding protein complexed with rapamycin | Liang J, Hung DT, Schreiber SL, Clardy J | Am Chem Soc 118 pp. 1231 | 1996 | 10.1021/ja953139w | |||||||||
1pf7 | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pf7 | |||||||||||||||||||||
1pj7 | Q9AGP8_ARTGO | Q9AGP8 | KO_id not found | Others | Others | Others | Others | Others | 1pj7 | |||||||||||||||||||||
1pj8 | PRTK_TRIAL | P06873 | KO_id not found | Others | Others | Others | Others | Others | 1pj8 | |||||||||||||||||||||
1pjq | CYSG_SALTY | P25924 | K02302 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Precorrin-2 dehydrogenase | 1pjq | |||||||||||||||||||||
1pk7 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pk7 | |||||||||||||||||||||
1pk9 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pk9 | |||||||||||||||||||||
1pke | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pke | |||||||||||||||||||||
Enzymes | 1ppl | 1ppl-val-1.70-d-1 | 644 | antiinfective cardiovascular |
penicillopepsin | EC3.- (hydrolases) | proteases (aspartic) | penicillopepsin | fundamental research cardiovascular diseases |
inhibition of aspartic protease proteolytic activity | val | 1.70 | 128923-36-4 | COC(=O)[C@H](Cc1ccccc1)O[P@@](=O)(O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CC(C)C)C(C)C)C(C)C | 128923-36-4 | CAS | Crystallographic analysis of transition-state mimics bound to penicillopepsin: phosphorus-containing peptide analogues | Fraser ME, Strynadka NC, Bartlett PA, Hanson JE, James MN | Biochemistry 31(22):5201-14 | 1992 | - | |||||||||
1ppl | PENP_PENJA | P00798 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | penicillopepsin | Others | 1ppl | |||||||||||||||||||||
1pr0 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pr0 | |||||||||||||||||||||
1pr4 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pr4 | |||||||||||||||||||||
1pr5 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pr5 | |||||||||||||||||||||
1pr6 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pr6 | |||||||||||||||||||||
1pwm | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 1pwm | |||||||||||||||||||||
1pye | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1pye | |||||||||||||||||||||
1pzg | P90613_TOXGO | P90613 | KO_id not found | Others | Others | Others | Others | Others | 1pzg | |||||||||||||||||||||
1q0h | DXR_ECOLI | P45568 | K00099 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 1-deoxy-D-xylulose-5-phosphate reductoisomerase | 1q0h | |||||||||||||||||||||
1q23 | CAT_ECOLX | P62577 | KO_id not found | Others | Others | Others | Others | Others | 1q23 | |||||||||||||||||||||
1q3a | MMP10_HUMAN | P09238 | K01396 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 2 | 1q3a | |||||||||||||||||||||
1q3d | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 1q3d | |||||||||||||||||||||
1q3s | THSA_PYRKO | P61111 | KO_id not found | Others | Others | Others | Others | Others | 1q3s | |||||||||||||||||||||
1q5k | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 1q5k | |||||||||||||||||||||
1q66 | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 1q66 | |||||||||||||||||||||
1qcf | HCK_HUMAN | P08631 | K08893 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1qcf | |||||||||||||||||||||
1qf1 | THER_BACTH | P00800 | KO_id not found | Others | Others | Others | Others | Others | 1qf1 | |||||||||||||||||||||
1qf2 | THER_BACTH | P00800 | KO_id not found | Others | Others | Others | Others | Others | 1qf2 | |||||||||||||||||||||
Enzymes | 1qhi | 1qhi-bpg-1.90-d-1-s | 61 | antiinfective | Herpes simplex virus thymidine kinase | EC2.- (transferases) | kinases (thymidine) | TK (HSV1) | herpes infection | inhbition of viral thymidine kinase prevention of viral DNA elongation |
bpg | 1.90 | 161363-19-5 | OCCCCn1cnc2c(=O)nc(Nc3ccccc3)[nH]c12 | 161363-19-5 | cas | Structure to 1.9 A resolution of a complex with herpes simplex virus type-1 thymidine kinase of a novel, non-substrate inhibitor: X-ray crystallographic comparison with binding of aciclovir | Bennett MS, Wien F, Champness JN, Batuwangala T, Rutherford T, Summers WC, Sun H, Wright G, Sanderson MR | FEBS Lett 443(2):121-5 | 1999 | 10.1016/S0014-5793(98)01619-6 | |||||||||
Enzymes | 1qhi | 1qhi-bpg-1.90-d-1 | 752 | antiinfective | herpes simplex virus thymidine kinase | EC2.- (transferases) | kinases (thymidine) | TK (HSV1) | herpes infection | phosphorylation of prodrug, inhibition of viral DNA polymerase | bpg | 1.9 | 9-(4-Hydroxybutyl)-N2-phenylguanine | OCCCCn1cnc2c(=O)nc(Nc3ccccc3)[nH]c12 | 161363-19-5 | cas | Structure to 1.9A Resolution of a Complex with Herpes Simplex Virus Type-I Thymidine Kinase of a Novel Non-Substrate Inhibitor: X-Ray Crystallographic Comparison with Binding of Aciclovir | Bennett, M. S., Wien, F., Champness, J. N., Batuwangala, T., Rutherford, T., Summers, W. C., Sun, H., Wright, G., Sanderson, M. R. | FEBS Lett. 443 pp. 121 | 1999 | ||||||||||
1qhi | KITH_HHV11 | P03176 | K00857 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Thymidine kinase | 1qhi | |||||||||||||||||||||
1qji | ASTA_ASTFL | P07584 | K00673 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Arginine N-succinyltransferase | 1qji | |||||||||||||||||||||
1qjj | ASTA_ASTFL | P07584 | K00673 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Arginine N-succinyltransferase | 1qjj | |||||||||||||||||||||
1qk3 | HGXR_TOXGO | Q26997 | KO_id not found | Enzymes | 2. Transferases | phosphoribosyl transferases | HGPRTase (T.gondii) | Others | 1qk3 | |||||||||||||||||||||
1qk4 | HGXR_TOXGO | Q26997 | KO_id not found | Enzymes | 2. Transferases | phosphoribosyl transferases | HGPRTase (T.gondii) | Others | 1qk4 | |||||||||||||||||||||
1qk5 | HGXR_TOXGO | Q26997 | KO_id not found | Others | Others | Others | Others | Others | 1qk5 | |||||||||||||||||||||
1qon | ACES_DROME | P07140 | K01049 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Acetylcholinesterase | 1qon | |||||||||||||||||||||
1qoq | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1qoq | |||||||||||||||||||||
Enzymes | 1qpc | 1qpc-anp-1.60-h-1-s | 125 | no info | Lymphocyte-specific kinase LCK | EC2.- (transferases) | kinases (tyrosine) | Lck | autoimmune suppression | no info | anp | 1.60 | 47542-69-8 | Nc1ncnc2n(cnc12)[C@@H]3O[C@H](CO[P@](=O)(O)O[P@@](=O)(N)O)[C@@H](O)[C@H]3O | 47542-69-8 | CAS | Structural analysis of the lymphocyte-specific kinase Lck in complex with non-selective and Src family selective kinase inhibitors | Zhu X, Kim JL, Newcomb JR, Rose PE, Stover DR, Toledo LM, Zhao H, Morgenstern KA | Structure Fold Des 7(6):651-61 | 1999 | - | |||||||||
Enzymes | 1qpc | 1qpc-anp-1.60-h-1 | 885 | no info | Lymphocyte-specific kinase LCK | EC2.- (transferases) | kinases (tyrosine) | Lck | autoimmune suppression | no info | anp | 1.60 | 47542-69-8 | Nc1ncnc2n(cnc12)[C@@H]3O[C@H](CO[P@](=O)(O)O[P@@](=O)(N)O)[C@@H](O)[C@H]3O | 47542-69-8 | CAS | Structural analysis of the lymphocyte-specific kinase Lck in complex with non-selective and Src family selective kinase inhibitors | Zhu X, Kim JL, Newcomb JR, Rose PE, Stover DR, Toledo LM, Zhao H, Morgenstern KA | Structure Fold Des 7(6):651-61 | 1999 | ||||||||||
1qpe | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 1qpe | |||||||||||||||||||||
1qsn | Q27198_TETTH | Q27198 | KO_id not found | Others | Others | Others | Others | Others | 1qsn | |||||||||||||||||||||
1qv0 | OBL_OBELO | Q27709 | KO_id not found | Others | Others | Others | Others | Others | 1qv0 | |||||||||||||||||||||
1qw8 | ABFA_GEOSE | Q9XBQ3 | K01209 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Alpha-N-arabinofuranosidase | 1qw8 | |||||||||||||||||||||
1qw9 | ABFA_GEOSE | Q9XBQ3 | K01209 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Alpha-N-arabinofuranosidase | 1qw9 | |||||||||||||||||||||
1qy5 | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 1qy5 | |||||||||||||||||||||
1qy8 | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 1qy8 | |||||||||||||||||||||
1qzy | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 1qzy | |||||||||||||||||||||
Enzymes | 1r0p | 1r0p-ksa-1.80-d-1-s | 185 | oncolytic | protein-tyrosine kinase (hepatocyte growth factor receptor tyrosine kinase) | EC2.- (transferases) | kinases (tyrosine) | c-Met | cancer | inhibition of enzyme activation via autophosphorylation inhibition of cell proliferation |
ksa | 1.80 | K-252A | COC(=O)[C@@]1(O)C[C@H]2O[C@]1(C)n3c4ccccc4c5c6CNC(=O)c6c7c8ccccc8n2c7c35 | 99533-80-9 | cas | Crystal structure of the tyrosine kinase domain of the hepatocyte growth factor receptor c-Met and its complex with the microbial alkaloid K-252a | Schiering N, Knapp S, Marconi M, Flocco MM, Cui J, Perego R, Rusconi L, Cristiani C | Proc Natl Acad Sci U S A 100(22):12654-9 | 2003 | 10.1073/pnas.1734128100 | |||||||||
Enzymes | 1r0p | 1r0p-ksa-1.80-d-1 | 1187 | oncolytic | protein-tyrosine kinase (hepatocyte growth factor receptor tyrosine kinase) | EC2.- (transferases) | kinases (tyrosine) | c-Met | cancer | inhibition of enzyme activation via autophosphorylation inhibition of cell proliferation |
ksa | 1.80 | K-252A | COC(=O)[C@@]1(O)C[C@H]2O[C@]1(C)n3c4ccccc4c5c6CNC(=O)c6c7c8ccccc8n2c7c35 | 99533-80-9 | cas | Crystal structure of the tyrosine kinase domain of the hepatocyte growth factor receptor c-Met and its complex with the microbial alkaloid K-252a | Schiering N, Knapp S, Marconi M, Flocco MM, Cui J, Perego R, Rusconi L, Cristiani C | Proc Natl Acad Sci U S A 100(22):12654-9 | 2003 | 10.1073/pnas.1734128100 | |||||||||
Enzymes | 1r0p | 1r0p-ksa-1.80-d-2-s | 79 | oncolytic | protein-tyrosine kinase (hepatocyte growth factor receptor tyrosine kinase) | EC2.- (transferases) | kinases (tyrosine) | c-Met | cancer | inhibition of enzyme activation via autophosphorylation inhibition of cell proliferation |
ksa | 1.80 | K-252A | COC(=O)[C@@]1(O)C[C@H]2O[C@]1(C)n3c4ccccc4c5c6CNC(=O)c6c7c8ccccc8n2c7c35 | 99533-80-9 | cas | Crystal structure of the tyrosine kinase domain of the hepatocyte growth factor receptor c-Met and its complex with the microbial alkaloid K-252a | Schiering N, Knapp S, Marconi M, Flocco MM, Cui J, Perego R, Rusconi L, Cristiani C | Proc Natl Acad Sci U S A 100(22):12654-9 | 2003 | 10.1073/pnas.1734128100 | |||||||||
Enzymes | 1r0p | 1r0p-ksa-1.80-d-2 | 626 | oncolytic | protein-tyrosine kinase (hepatocyte growth factor receptor tyrosine kinase) | EC2.- (transferases) | kinases (tyrosine) | c-Met | cancer | inhibition of enzyme activation via autophosphorylation inhibition of cell proliferation |
ksa | 1.80 | K-252A | COC(=O)[C@@]1(O)C[C@H]2O[C@]1(C)n3c4ccccc4c5c6CNC(=O)c6c7c8ccccc8n2c7c35 | 99533-80-9 | cas | Crystal structure of the tyrosine kinase domain of the hepatocyte growth factor receptor c-Met and its complex with the microbial alkaloid K-252a | Schiering N, Knapp S, Marconi M, Flocco MM, Cui J, Perego R, Rusconi L, Cristiani C | Proc Natl Acad Sci U S A 100(22):12654-9 | 2003 | 10.1073/pnas.1734128100 | |||||||||
1r0p | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 1r0p | |||||||||||||||||||||
Enzymes | 1r78 | 1r78-fmd-2.00-h-1 | 196 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | fmd | 2.00 | 275387-94-5 | COc1cc[nH]c1/C=C/2\C(=O)Nc3ccc(F)c(C#C[C@@H](O)[C@@H](N)[C@@H](C)O)c23 | 275387-94-5 | CAS | A new series of potent oxindole inhibitors of CDK2 | Luk KC, Simcox ME, Schutt A, Rowan K, Thompson T, Chen Y, Kammlott U, DePinto W, Dunten P, Dermatakis A | Bioorg Med Chem Lett 14(4):913-7 | 2004 | 10.1016/j.bmcl.2003.12.009 | |||||||||
1rct | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1rct | |||||||||||||||||||||
1rd4 | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 1rd4 | |||||||||||||||||||||
Toxins and defence proteins | 1rdp | 1rdp-bv3-1.35-d-1-s | 0.23117077 | antiinfective | cholera toxin | Toxins | bacterial toxins | toxin (cholera) | diarrhoea | inhibition of cell receptor binding by toxin interference with bacterial toxin entry into host cell |
bv3 | 1.35 | INT-836666-90-1-art-2-d | C=1C(=CC(=CC1[N+](=O)[O-])O[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)C(=O)N | INT-836666-90-1-art-2-d | int | Nonspanning bivalent ligands as improved surface receptor binding inhibitors of the cholera toxin B pentamer | Pickens JC, Mitchell DD, Liu J, Tan X, Zhang Z, Verlinde CL, Hol WG, Fan E | Chem Biol 11(9):1205-15 | 2004 | 10.1016/j.chembiol.2004.06.008 | |||||||||
1rev | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rev | |||||||||||||||||||||
Toxins and defence proteins | 1rf2 | 1rf2-bv4-1.35-d-1-s | 0.60402685 | antiinfective | cholera toxin | Toxins | bacterial toxins | toxin (cholera) | diarrhoea | inhibition of cell receptor binding by toxin interference with bacterial toxin entry into host cell |
bv4 | 1.35 | INT-836666-90-1-art-2-d | C=1C(=CC(=CC1[N+](=O)[O-])O[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)C(=O)N | INT-836666-90-1-art-2-d | int | Nonspanning bivalent ligands as improved surface receptor binding inhibitors of the cholera toxin B pentamer | Pickens JC, Mitchell DD, Liu J, Tan X, Zhang Z, Verlinde CL, Hol WG, Fan E | Chem Biol 11(9):1205-15 | 2004 | 10.1016/j.chembiol.2004.06.008 | |||||||||
Toxins and defence proteins | 1rf2 | 1rf2-bv4-1.35-d-1 | 2.39970172 | antiinfective | cholera toxin | Toxins | bacterial toxins | toxin (cholera) | diarrhoea | inhibition of cell receptor binding by toxin interference with bacterial toxin entry into host cell |
bv4 | 1.35 | INT-836666-90-1-art-2-d | C=1C(=CC(=CC1[N+](=O)[O-])O[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)C(=O)N | INT-836666-90-1-art-2-d | int | Nonspanning bivalent ligands as improved surface receptor binding inhibitors of the cholera toxin B pentamer | Pickens JC, Mitchell DD, Liu J, Tan X, Zhang Z, Verlinde CL, Hol WG, Fan E | Chem Biol 11(9):1205-15 | 2004 | 10.1016/j.chembiol.2004.06.008 | |||||||||
1rfg | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1rfg | |||||||||||||||||||||
1rft | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1rft | |||||||||||||||||||||
1rfv | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1rfv | |||||||||||||||||||||
1rgs | KAP0_BOVIN | P00514 | K04739 | Others | Organismal Systems | Endocrine system | Insulin signaling pathway | PRKAR; cAMP-dependent protein kinase regulator | 1rgs | |||||||||||||||||||||
1rjk | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 1rjk | |||||||||||||||||||||
1rkd | RBSK_ECOLI | P0A9J6 | K00852 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Ribokinase | 1rkd | |||||||||||||||||||||
Enzymes | 1rkp | 1rkp-ibm-2.05-x-1-s | 3.818046234 | cardiovascular | phosphodiesterase 5A | EC3.- (hydrolases) | phosphodiesterases | PDE 5A | cardiovascular diseases | inhibition of cGMP degradation | ibm | 2.05 | 3-isobutyl-1-methylxanthine | CC(C)CN1C2=C(C(=O)N(C1=O)C)N=CN2 | 28822-58-4 | CAS | Crystal structures of phosphodiesterases 4 and 5 in complex with inhibitor 3-isobutyl-1-methylxanthine suggest a conformation determinant of inhibitor selectivity | Huai Q, Liu Y, Francis SH, Corbin JD, Ke H | J Biol Chem 279(13):13095-101 | 2004 | 10.1074/jbc.M311556200 | |||||||||
1rmh | PPIA_CHLAE | P62938 | K03767 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 1rmh | |||||||||||||||||||||
1ro6 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1ro6 | |||||||||||||||||||||
1rq9 | Q5RTL1_9HIV1 | Q5RTL1 | KO_id not found | Others | Others | Others | Others | Others | 1rq9 | |||||||||||||||||||||
1rrm | FUCO_ECOLI | P0A9S1 | K01206 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Alpha-L-fucosidase | 1rrm | |||||||||||||||||||||
1rrv | Q9AFC7_AMYOR | Q9AFC7 | KO_id not found | Others | Others | Others | Others | Others | 1rrv | |||||||||||||||||||||
1rsz | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1rsz | |||||||||||||||||||||
1rt1 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rt1 | |||||||||||||||||||||
1rvv | RISB_BACSU | P11998 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 1rvv | |||||||||||||||||||||
1rxj | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 1rxj | |||||||||||||||||||||
1ry0 | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 1ry0 | |||||||||||||||||||||
1rzy | HINT1_RABIT | P80912 | KO_id not found | Others | Others | Others | Others | Others | 1rzy | |||||||||||||||||||||
1s2c | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 1s2c | |||||||||||||||||||||
1s3v | DYR_HUMAN | P00374 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 1s3v | |||||||||||||||||||||
1s64 | FNTA_RAT | Q04631 | K05955 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Protein farnesyltransferase | 1s64 | |||||||||||||||||||||
1s9d | ARF1_BOVIN | P84080 | K07937 | GTP-binding proteins | Small (Monomeric) G-proteins | Arf-Sar Family | Arf-Arl1 | ARF1; ADP-ribosylation factor 1 | 1s9d | |||||||||||||||||||||
Enzymes | 1s9j | 1s9j-bbm-2.40-h-1 | 0.86204 | oncolytic | mitogen-activated protein kinase kinase 1 | EC2.- (transferases) | kinases (serine-threonine) | MEK1 | anticancer | inhibition (enzyme); non-competitive | bbm | 2.40 | 915304-20-0 | [C1=CC(=C(C=C1I)F)NC=2C(=CC(=C(C2F)F)Br)C(=O)NOC[C@H](CO)O] | 915304-20-0 | CAS | Structures of human MAP kinase kinase 1 (MEK1) and MEK2 describe novel noncompetitive kinase inhibition | Ohren JF, Chen H, Pavlovsky A, Whitehead C, Zhang E, Kuffa P, Yan C, McConnell P, Spessard C, Banotai C, Mueller WT, Delaney A, Omer C, Sebolt-Leopold J, Dudley DT, Leung IK, Flamme C, Warmus J, Kaufman M, Barrett S, Tecle H, Hasemann CA | Nat Struct Mol Biol 11(12):1192-7 | 2004 | 10.1038/nsmb859 | |||||||||
1s9p | ERR3_MOUSE | P62509 | K01689 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Phosphopyruvate hydratase | 1s9p | |||||||||||||||||||||
1sb1 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1sb1 | |||||||||||||||||||||
1sbr | YKOF_BACSU | O34911 | KO_id not found | Others | Others | Others | Others | Others | 1sbr | |||||||||||||||||||||
1sd1 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1sd1 | |||||||||||||||||||||
1sd2 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1sd2 | |||||||||||||||||||||
1sjw | Q9RN59_STRNO | Q9RN59 | KO_id not found | Others | Others | Others | Others | Others | 1sjw | |||||||||||||||||||||
1srg | SAV_STRAV | P22629 | KO_id not found | Other proteins | Bacterial proteins | binding proteins | streptavidin | Others | 1srg | 1895 | ||||||||||||||||||||
1srj | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 1srj | |||||||||||||||||||||
1sua | SUBT_BACAM | P00782 | K01342 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Subtilisin | 1sua | |||||||||||||||||||||
Other proteins | 1swn | 1swn-btn-2.20-d-1 | 1 | antiinfective | streptavidin | Bacterial proteins | binding proteins | streptavidin | fundamental research | stabilisation of streptavidin tool for universal test systems in immunology and molecular diagnostics system for analysis of intermolecular interactions of the tight binding of the small molecule ligand biotin to the protein |
btn | 2.20 | biotin | OC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12 | 58-85-5 | CAS | Structural studies of binding site tryptophan mutants in the high-affinity streptavidin-biotin complex | Freitag S, Le Trong I, Chilkoti A, Klumb LA, Stayton PS, Stenkamp RE | J Mol Biol 279(1):211-21 | 1998 | 10.1006/jmbi.1998.1735 | |||||||||
1sx3 | CH60_ECOLI | P0A6F5 | K04077 | Chaperones and folding catalysts | Heat shock proteins | HSP60 - Chaperonin | GroEL, HSPD1; chaperonin GroELMitochondria | Others | 1sx3 | |||||||||||||||||||||
1szm | KAPCA_BOVIN | P00517 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 1szm | |||||||||||||||||||||
1t2w | Q9S446_STAAU | Q9S446 | KO_id not found | Others | Others | Others | Others | Others | 1t2w | |||||||||||||||||||||
1t47 | HPPD_STRAW | Q53586 | K00457 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | 4-hydroxyphenylpyruvate dioxygenase | 1t47 | |||||||||||||||||||||
1t57 | O27711_METTH | O27711 | KO_id not found | Others | Others | Others | Others | Others | 1t57 | |||||||||||||||||||||
1t5b | AZOR_SALTY | P63462 | KO_id not found | Others | Others | Others | Others | Others | 1t5b | |||||||||||||||||||||
1t64 | HDAC8_HUMAN | Q9BY41 | K11405 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Histone deacetylase | 1t64 | |||||||||||||||||||||
1t7j | POL_HV1Y2 | P35963 | KO_id not found | Others | Others | Others | Others | Others | 1t7j | |||||||||||||||||||||
1tbb | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1tbb | |||||||||||||||||||||
1tbf | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 1tbf | |||||||||||||||||||||
1tez | PHR_SYNP6 | P05327 | K01669 | Enzymes | Lyases | Carbon-carbon lyases | Other carbon-carbon lyases | Deoxyribodipyrimidine photo-lyase | 1tez | |||||||||||||||||||||
1tgv | UDP_ECOLI | P12758 | K00757 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Uridine phosphorylase | 1tgv | |||||||||||||||||||||
1th8 | SP2AB_GEOSE | O32727 | K06379 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1th8 | |||||||||||||||||||||
1tjp | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1tjp | |||||||||||||||||||||
1tkx | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tkx | |||||||||||||||||||||
1tl1 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tl1 | |||||||||||||||||||||
1tou | FABP4_HUMAN | P15090 | KO_id not found | Others | Others | Others | Others | Others | 1tou | |||||||||||||||||||||
1tqf | BACE1_HUMAN | P56817 | K04521 | Peptidases | Aspartic Peptidase | Family A1 pepsin family | Beta-secretase 1 | Others | 1tqf | 9606 | ||||||||||||||||||||
1tu6 | CATK_HUMAN | P43235 | K01371 | Chaperones and folding catalysts | Intramolecular chaperones | Papain family | CTSK; cathepsin K | Others | 1tu6 | |||||||||||||||||||||
1tvo | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1tvo | |||||||||||||||||||||
1ty8 | YMX7_YEAST | Q04299 | KO_id not found | Others | Others | Others | Others | Others | 1ty8 | |||||||||||||||||||||
1u1c | UDP_ECOLI | P12758 | K00757 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Uridine phosphorylase | 1u1c | |||||||||||||||||||||
1u1d | UDP_ECOLI | P12758 | K00757 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Uridine phosphorylase | 1u1d | |||||||||||||||||||||
1u1f | UDP_ECOLI | P12758 | K00757 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Uridine phosphorylase | 1u1f | |||||||||||||||||||||
1u1g | UDP_ECOLI | P12758 | K00757 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Uridine phosphorylase | 1u1g | |||||||||||||||||||||
1u3r | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1u3r | |||||||||||||||||||||
1u59 | ZAP70_HUMAN | P43403 | K07360 | Cellular antigens | Non-CD molecules | ZAP70; zeta-chain (TCR) associated protein kinase 70kDa | Others | Others | 1u59 | |||||||||||||||||||||
1u71 | DYR_HUMAN | P00374 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 1u71 | |||||||||||||||||||||
1u9z | KPRS_METJA | Q58761 | K00948 | Enzymes | Transferases | Transferring phosphorus-containing groups | Diphosphotransferases | Ribose-phosphate diphosphokinase | 1u9z | |||||||||||||||||||||
Enzymes | 1udu | 1udu-cia-2.80-x-1-s | 1.285607755 | cardiovascular | phosphodiesterase 5A | EC3.- (hydrolases) | phosphodiesterases | PDE 5A | cardiovascular diseases | inhibition of cGMP degradation | cia | 2.80 | tadalafil | CN1CC(=O)N2[C@@H](C1=O)CC=3C4=CC=CC=C4NC3[C@H]2C5=CC=C6C(=C5)OCO6 | 171596-29-5 | CAS | Structure of the catalytic domain of human phosphodiesterase 5 with bound drug molecules | Sung BJ, Hwang KY, Jeon YH, Lee JI, Heo YS, Kim JH, Moon J, Yoon JM, Hyun YL, Kim E, Eum SJ, Park SY, Lee JO, Lee TG, Ro S, Cho JM | Nature 425(6953):98-102 | 2003 | 10.1038/nature01914 | |||||||||
1uio | ADA_MOUSE | P03958 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1uio | |||||||||||||||||||||
Enzymes | 1ung | 1ung-alh-2.30-h-1 | 1.92692 | oncolytic neurological |
cdk5 cell division kinase 5 pssalre cyclin-dependent kinase 5 pdpk proline-directed protein kinase 33kDa subunit Proline-directed protein kinase F(A) serine/threonine protein kinase pssalre tpk II catalytic subunit tau protein kinase II catalytic subunit |
EC2.- (transferases) | kinases (serine-threonine) | CDK5 | cognitive defects cancer |
inhibition (enzyme); competitive | alh | 2.30 | 496864-16-5 | [CCCCC=1C2=C(NC1C3=CC=C(C=C3)O)N=CC=N2] | 496864-16-5 | CAS | Mechanism of CDK5/p25 binding by CDK inhibitors | Mapelli M, Massimiliano L, Crovace C, Seeliger MA, Tsai LH, Meijer L, Musacchio A | J Med Chem 48(3):671-9 | 2005 | 10.1021/jm049323m | |||||||||
1uoo | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1uoo | |||||||||||||||||||||
1uop | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1uop | |||||||||||||||||||||
1uoq | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1uoq | |||||||||||||||||||||
Enzymes | 1upf | 1upf-urf-2.30-d-1 | 1043 | antiinfective | parasitic uracil phosphoribosyltransferase (from Toxoplasma gondii) | EC2.- (transferases) | phosphoribosyl transferases | UPRTase (T.gondii) | parasitic infection | interference with parasitic pyrimidine salvage pathway inhibition of transfer of a ribosyl phosphate group from alpha-D-5-phosphoribosyl-1-pyrophosphate to the N1 nitrogen of uracil to form uridine monophosphate |
urf | 2.30 | 5-fluorouracil | FC1=CNC(=O)NC1=O | 51-21-8 | CAS | Crystal structures of Toxoplasma gondii uracil phosphoribosyltransferase reveal the atomic basis of pyrimidine discrimination and prodrug binding | Schumacher MA, Carter D, Scott DM, Roos DS, Ullman B, Brennan RG | EMBO J 17(12):3219-32 | 1998 | 10.1093/emboj/17.12.3219 | |||||||||
Enzymes | 1ur8 | 1ur8-nag-1.90-d-1-s | 1 | antiinfective | Serratia marcescens chitinase | EC3.- (hydrolases) | glycosidases | chitinase (S.marcescens) | bacterial infection | inhibition of bacterial chitinase | nag | 1.90 | 80019-02-9 | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@H]2[C@H](O)[C@@H](NC(=O)C)C(=O)O[C@@H]2CO | 80019-02-9 | CAS | Interactions of a family 18 chitinase with the designed inhibitor HM508 and its degradation product, chitobiono-delta-lactone | Vaaje-Kolstad G, Vasella A, Peter MG, Netter C, Houston DR, Westereng B, Synstad B, Eijsink VG, van Aalten DM | J Biol Chem 279(5):3612-9 | 2004 | 10.1074/jbc.M310057200 | |||||||||
Enzymes | 1ur8 | 1ur8-nag-1.90-d-1 | 14 | antiinfective | Serratia marcescens chitinase | EC3.- (hydrolases) | glycosidases | chitinase (S.marcescens) | bacterial infection | inhibition of bacterial chitinase | nag | 1.90 | 80019-02-9 | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@H]2[C@H](O)[C@@H](NC(=O)C)C(=O)O[C@@H]2CO | 80019-02-9 | CAS | Interactions of a family 18 chitinase with the designed inhibitor HM508 and its degradation product, chitobiono-delta-lactone | Vaaje-Kolstad G, Vasella A, Peter MG, Netter C, Houston DR, Westereng B, Synstad B, Eijsink VG, van Aalten DM | J Biol Chem 279(5):3612-9 | 2004 | 10.1074/jbc.M310057200 | |||||||||
Enzymes | 1urw | 1urw-i1p-1.60-h-1 | 10.45488 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | i1p | 1.60 | 453547-81-4 | [CN(C)CCCNS(=O)(=O)C1=CC=C(C=C1)NC=2N=CC=C(N2)C3=CN=C4N3N=CC=C4] | 453547-81-4 | CAS | Imidazo[1,2-b]pyridazines: a potent and selective class of cyclin-dependent kinase inhibitors | Byth, K.F., Cooper, N., Culshaw, J.D., Heaton, D.W., Oakes, S.E., Minshull, C.A., Norman, R.A., Pauptit, R.A., Tucker, J.A., Breed, J., Pannifer, A., Rowsell, S., Stanway, J.J., Valentine, A.L., Thomas, A.P. | Bioorg Med Chem Lett 14:2249-2252 | 2004 | 10.1016/j.bmcl.2004.02.008 | |||||||||
1usn | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1usn | |||||||||||||||||||||
1uu3 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1uu3 | |||||||||||||||||||||
1uu7 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1uu7 | |||||||||||||||||||||
Enzymes | 1uu9 | 1uu9-bi3-1.95-h-1-s | 29 | oncolytic | pdk1 3-phosphoinositide-dependent kinase 1 hPDK1 |
EC2.- (transferases) | kinases (serine-threonine) | PDK1 | cancer diabetes |
no info | bi3 | 1.95 | bisindolylmaleimide III | NCCCn1cc(C2=C(C(=O)NC2=O)c3c[nH]c4ccccc34)c5ccccc15 | 137592-43-9 | CAS | Interactions of LY333531 and other bisindolyl maleimide inhibitors with PDK1 | Komander D, Kular GS, Schuttelkopf AW, Deak M, Prakash KR, Bain J, Elliott M, Garrido-Franco M, Kozikowski AP, Alessi DR, van Aalten DM | Structure (Camb) 12(2):215-26 | 2004 | - | |||||||||
Enzymes | 1uu9 | 1uu9-bi3-1.95-h-1 | 269 | oncolytic | pdk1 3-phosphoinositide-dependent kinase 1 hPDK1 |
EC2.- (transferases) | kinases (serine-threonine) | PDK1 | cancer diabetes |
no info | bi3 | 1.95 | bisindolylmaleimide III | NCCCn1cc(C2=C(C(=O)NC2=O)c3c[nH]c4ccccc34)c5ccccc15 | 137592-43-9 | CAS | Interactions of LY333531 and other bisindolyl maleimide inhibitors with PDK1 | Komander D, Kular GS, Schuttelkopf AW, Deak M, Prakash KR, Bain J, Elliott M, Garrido-Franco M, Kozikowski AP, Alessi DR, van Aalten DM | Structure (Camb) 12(2):215-26 | 2004 | ||||||||||
Enzymes | 1v1j | 1v1j-fa3-2.20-d-1 | 0.80536913 | antiinfective | bacterial 3-dehydroquinate dehydratase | EC4.- (lyases) | hydro-lyases | type II DHQase (S.coelicolor) | bacterial infection | inhibition of bacterial 3-dehydroquinate dehydratase interference with biosynthetic shikimate pathway interference with biosynthesis of aromatic compounds |
fa3 | 2.20 | 486430-83-5 | O=C(O)[C@]1(O)C=C(F)[C@@H](O)[C@H](O)C1 | 486430-83-5 | cas | (1R,4S,5R)-3-Fluoro-1,4,5-Trihydroxy-2-Cyclohexene-1-Carboxylic Acid: The Fluoro Analogue of the Enolate Intermediate in the Reaction Catalyzed by Type II Dehydroquinases | Frederickson M, Roszak AW, Coggins JR, Lapthorn AJ, Abell C | Org Biomol Chem 2(11):1592-6 | 2004 | 10.1039/b404535a | |||||||||
1v1k | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1v1k | |||||||||||||||||||||
1v45 | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1v45 | |||||||||||||||||||||
1v79 | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1v79 | |||||||||||||||||||||
1v7a | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1v7a | |||||||||||||||||||||
1v9t | PPIA_ECO57 | P0AFL5 | K03767 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 1v9t | |||||||||||||||||||||
1vbt | PPIA_CHLAE | P62938 | K03767 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 1vbt | |||||||||||||||||||||
1vhw | DEOD1_VIBCH | Q9KPM0 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1vhw | |||||||||||||||||||||
1vwe | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 1vwe | |||||||||||||||||||||
Enzymes | 1vyz | 1vyz-n5b-2.21-d-1 | 2772 | oncolytic | cyclin-dependent kinase 2 CDK2 |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer | inhibition of cell cycle controlling enzyme CDK2 apoptosis in tumour cells |
n5b | 2.21 | 326822-81-5 | O=C(Nc1cc([nH]n1)C2CC2)c3ccccc3 | 326822-81-5 | cas | 3-Aminopyrazole inhibitors of CDK2/cyclin A as antitumor agents. 1. Lead finding | Pevarello P, Brasca MG, Amici R, Orsini P, Traquandi G, Corti L, Piutti C, Sansonna P, Villa M, Pierce BS, Pulici M, Giordano P, Martina K, Fritzen EL, Nugent RA, Casale E, Cameron A, Ciomei M, Roletto F, Isacchi A, Fogliatto G, Pesenti E, Pastori W, Marsiglio A, Leach KL, Clare PM, Fiorentini F, Varasi M, Vulpetti A, Warpehoski MA | J Med Chem 47(13):3367-80 | 2004 | 10.1021/jm031145u | |||||||||
Enzymes | 1w0c | 1w0c-taq-2.60-d-1 | 0.285908351367147 | antiinfective | leishmania major pteridine reductase | EC1.- (oxydo-reductases) | pteridine reductases | PTR1 (L.major) | parasitic infection | inhibition of parasitic pteridine reductase salvage of pterins |
taq | 2.60 | NSC 158574 | C1=CC=2C(C=C1N)=C(N=C(N2)N)N | 13741-90-7 | CAS | Inhibition of Leishmania major pteridine reductase by 2,4,6-triaminoquinazoline: structure of the NADPH ternary complex | McLuskey K, Gibellini F, Carvalho P, Avery MA, W. N. Hunter WN | Acta Cryst D60, 1780-1785 | 2004 | 10.1107/S0907444904018955 | |||||||||
1w0h | ERI1_HUMAN | Q8IV48 | KO_id not found | Others | Others | Others | Others | Others | 1w0h | |||||||||||||||||||||
Enzymes | 1w0x | 1w0x-olo-2.20-h-1-s | 1628 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | olo | 2.20 | Olomoucine | Cn1cnc2c(NCc3ccccc3)nc(NCCO)nc12 | 101622-51-9 | CAS | Crystals Structure of Human Cdk2 in Complex with the Inhibitor Olomoucine | Schulze-Gahmen U, Meijer L, Kim SH | to be published | 2005 | ||||||||||
1w0x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1w0x | |||||||||||||||||||||
Enzymes | 1w1y | 1w1y-typ-1.90-d-1 | 1365 | antiinfective | Serratia marcescens chitinase | EC3.- (hydrolases) | glycosidases | chitinase (S.marcescens) | bacterial infection | inhibition of bacterial chitinase | typ | 1.90 | maculosin | Oc1ccc(C[C@@H]2NC(=O)[C@@H]3CCCN3C2=O)cc1 | 4549-02-4 | CAS | Structure-based exploration of cyclic dipeptide chitinase inhibitors | Houston DR, Synstad B, Eijsink VG, Stark MJ, Eggleston IM, van Aalten DM | J Med Chem 47(23):5713-20 | 2004 | 10.1021/jm049940a | |||||||||
1w2h | KTHY_MYCTU | O05891 | K00943 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with a phosphate group as acceptor | DTMP kinase | 1w2h | |||||||||||||||||||||
1w82 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1w82 | |||||||||||||||||||||
1w96 | ACAC_YEAST | Q00955 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 1w96 | |||||||||||||||||||||
1w9q | SDCB1_HUMAN | O00560 | KO_id not found | Others | Others | Others | Others | Others | 1w9q | |||||||||||||||||||||
Enzymes | 1w9u | 1w9u-rig-1.85-d-1 | 1917 | antiinfective | aspergillus fumigatus chitinase | EC3.- (hydrolases) | glycosidases | ChiB1 (A.fumigatus) | fungal infection | inhibition of fungal chitinase interference with cell wall |
rig | 1.85 | argadin | CC(=O)NC(=N)NCCC[C@@H]1NC(=O)[C@H](CCCC(=O)O)NC(=O)[C@H](Cc2cnc[nH]2)N3[C@H](O)C[C@H](NC(=O)[C@H]4CCCN4C1=O)C3=O | 289665-92-5 | cas | Specificity and affinity of natural product cyclopentapeptide inhibitors against A. fumigatus, human, and bacterial chitinases | Rao FV, Houston DR, Boot RG, Aerts JM, Hodkinson M, Adams DJ, Shiomi K, Omura S, van Aalten DM | Chem Biol 12(1):65-76 | 2005 | 10.1016/j.chembiol.2004.10.013 | |||||||||
1w9v | Q873X9_ASPFM | Q873X9 | KO_id not found | Enzymes | 3. Hydrolases | glycosidases | ChiB1 (A.fumigatus) | Others | 1w9v | |||||||||||||||||||||
1wb0 | CHIT1_HUMAN | Q13231 | K01183 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Chitinase | 1wb0 | |||||||||||||||||||||
1wbs | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wbs | |||||||||||||||||||||
1wbv | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wbv | |||||||||||||||||||||
1wbw | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wbw | |||||||||||||||||||||
1wdk | FADB_PSEFR | P28793 | K13767 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Enoyl-CoA hydratase | 1wdk | |||||||||||||||||||||
1wl4 | THIC_HUMAN | Q9BWD1 | K00626 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Acetyl-CoA C-acetyltransferase | 1wl4 | |||||||||||||||||||||
1wok | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 1wok | |||||||||||||||||||||
Enzymes | 1wrr | 1wrr-unc-1.60-d-1 | 2146 | antiinfective | aspergillus flavus urate oxidase | EC1.- (oxydo-reductases) | urate oxidases | Uox (A.flavus) | fungal infection | inhibition of fungal urate oxidase interference with purine degradation |
unc | 1.60 | INT-NSC 99321-art-1-d | NC1=C(NC(=O)NC1=O)N(=O)=O | INT-NSC 99321-art-1-d | int | Urate oxidase from Aspergillus flavus: new crystal-packing contacts in relation to the content of the active site | Retailleau P, Colloc'h N, Vivares D, Bonnete F, Castro B, El Hajji M, Prange T | Acta Crystallogr D Biol Crystallogr 61(Pt 3):218-29 | 2005 | 10.1107/S0907444904031531 | |||||||||
1ws1 | DEF1_BACCR | Q819U0 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 1ws1 | |||||||||||||||||||||
1wsv | GCST_HUMAN | P48728 | K00605 | Enzymes | Transferases | Transferring one-carbon groups | Hydroxymethyl-, formyl- and related transferases | Aminomethyltransferase | 1wsv | |||||||||||||||||||||
1wxj | TRPA_THET2 | P16608 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1wxj | |||||||||||||||||||||
1wxz | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1wxz | |||||||||||||||||||||
1wzy | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wzy | |||||||||||||||||||||
1x8b | WEE1_HUMAN | P30291 | K06632 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1x8b | |||||||||||||||||||||
1x97 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 1x97 | |||||||||||||||||||||
1xan | GSHR_HUMAN | P00390 | K00383 | Enzymes | Oxidoreductases | Acting on a sulfur group of donors | With NAD+ or NADP+ as acceptor | Glutathione-disulfide reductase | 1xan | |||||||||||||||||||||
1xbc | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1xbc | |||||||||||||||||||||
1xgi | AMPC_ECOLI | P00811 | K01467 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amides | Beta-lactamase | 1xgi | |||||||||||||||||||||
1xjj | O33839_THEMT | O33839 | K00525 | Enzymes | Oxidoreductases | Acting on CH or CH2 groups | With a disulfide as acceptor | Ribonucleoside-diphosphate reductase | 1xjj | |||||||||||||||||||||
1xlx | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xlx | |||||||||||||||||||||
1xnn | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1xnn | |||||||||||||||||||||
Enzymes | 1xo2 | 1xo2-fse-2.90-h-1 | 0.18941 | oncolytic | plstire cdk6 cyclin-dependent kinase 6 serine/theronine protein kinase plstire |
EC2.- (transferases) | kinases (serine-threonine) | CDK6 | cancer | inhibition (enzyme); competitive | fse | 2.90 | Fisetin (6CI) | [C=1C=C(C(=CC1C2=C(C(=O)C3=CC=C(C=C3O2)O)O)O)O] | 528-48-3 | CAS | Crystal Structure of a Human Cyclin-Dependent Kinase 6 Complex with a Flavonol Inhibitor, Fisetin | Lu, H.S., Chang, D.J., Baratte, B., Meijer, L., Schulze-Gahmen, U. | J Med Chem 48: 737-747 | 2005 | 10.1021/jm049353p S0022-2623(04)09353-7 | |||||||||
1xo2 | CGH2_SHV21 | Q01043 | KO_id not found | Enzymes | 2. Transferases | kinases (serine-threonine) | CDK6 | Others | 1xo2 | |||||||||||||||||||||
1xom | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xom | |||||||||||||||||||||
1xoq | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xoq | |||||||||||||||||||||
1xor | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xor | |||||||||||||||||||||
1xow | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1xow | |||||||||||||||||||||
Enzymes | 1xoz | 1xoz-cia-1.37-x-1-s | 0.155108128 | cardiovascular | phosphodiesterase 5A | EC3.- (hydrolases) | phosphodiesterases | PDE 5A | cardiovascular diseases | inhibition of cGMP degradation | cia | 1.37 | tadalafil | CN1CC(=O)N2[C@@H](C1=O)CC=3C4=CC=CC=C4NC3[C@H]2C5=CC=C6C(=C5)OCO6 | 171596-29-5 | CAS | Structural basis for the activity of drugs that inhibit phosphodiesterases | Card GL, England BP, Suzuki Y, Fong D, Powell B, Lee B, Luu C, Tabrizizad M, Gillette S, Ibrahim PN, Artis DR, Bollag G, Milburn MV, Kim SH, Schlessinger J, Zhang KY | Structure 12(12):2233-47 | 2004 | 10.1016/j.str.2004.10.004 | |||||||||
Enzymes | 1xoz | 1xoz-cia-1.37-x-1 | 4.298284862 | cardiovascular | phosphodiesterase 5A | EC3.- (hydrolases) | phosphodiesterases | PDE 5A | cardiovascular diseases | inhibition of cGMP degradation | cia | 1.37 | tadalafil | CN1CC(=O)N2[C@@H](C1=O)CC=3C4=CC=CC=C4NC3[C@H]2C5=CC=C6C(=C5)OCO6 | 171596-29-5 | CAS | Structural basis for the activity of drugs that inhibit phosphodiesterases | Card GL, England BP, Suzuki Y, Fong D, Powell B, Lee B, Luu C, Tabrizizad M, Gillette S, Ibrahim PN, Artis DR, Bollag G, Milburn MV, Kim SH, Schlessinger J, Zhang KY | Structure 12(12):2233-47 | 2004 | 10.1016/j.str.2004.10.004 | |||||||||
1xpz | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1xpz | |||||||||||||||||||||
1xq0 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1xq0 | |||||||||||||||||||||
1xqp | AGOG_PYRAE | Q8ZVK6 | K01741 | Enzymes | Lyases | Carbon-oxygen lyases | Other carbon-oxygen lyases | DNA-(apurinic or apyrimidinic site) lyase | 1xqp | |||||||||||||||||||||
1xwf | SAHH_RAT | P10760 | K01251 | Enzymes | Hydrolases | Acting on ether bonds | Thioether and trialkylsulfonium hydrolases | Adenosylhomocysteinase | 1xwf | |||||||||||||||||||||
1y2e | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1y2e | |||||||||||||||||||||
1y5v | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 1y5v | |||||||||||||||||||||
1y8j | NEP_HUMAN | P08473 | K01389 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neprilysin | 1y8j | |||||||||||||||||||||
Enzymes | 1y8y | 1y8y-ct7-2.00-h-1 | 8.64877 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | ct7 | 2.00 | 771498-73-8 | [CS(=O)(=O)C1=CC=C(C=C1)NC2=CC(=NC=3N2N=CC3)Cl] | 771498-73-8 | CAS | Structure-guided design of pyrazolo[1,5-a]pyrimidines as inhibitors of human cyclin-dependent kinase 2 | Williamson, D.S., Parratt, M.J., Bower, J.F., Moore, J.D., Richardson, C.M., Dokurno, P., Cansfield, A.D., Francis, G.L., Hebdon, R.J., Howes, R., Jackson, P.S., Lockie, A.M., Murray, J.B., Nunns, C.L., Powles, J., Robertson, A., Surgenor, A.E., Torrance, C.J. | Bioorg Med Chem Lett 15:863-867 | 2005 | 10.1016/j.bmcl.2004.12.073 | |||||||||
1y8y | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1y8y | |||||||||||||||||||||
Enzymes | 1y91 | 1y91-ct9-2.15-h-1 | 39 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | ct9 | 2.15 | 771499-44-6 | CS(=O)(=O)c1ccc(Nc2cc(Cl)nc3ccnn23)cc1 | 771499-44-6 | CAS | Structure-guided design of pyrazolo[1,5-a]pyrimidines as inhibitors of human cyclin-dependent kinase 2 | Williamson DS, Parratt MJ, Bower JF, Moore JD, Richardson CM, Dokurno P, Cansfield AD, Francis GL, Hebdon RJ, Howes R, Jackson PS, Lockie AM, Murray JB, Nunns CL, Powles J, Robertson A, Surgenor AE, Torrance CJ | Bioorg Med Chem Lett 15(4):863-7 | 2005 | 10.1016/j.bmcl.2004.12.073 | |||||||||
1ygk | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1ygk | |||||||||||||||||||||
1yhj | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1yhj | |||||||||||||||||||||
1ykd | P94182_9NOST | P94182 | KO_id not found | Others | Others | Others | Others | Others | 1ykd | |||||||||||||||||||||
1ykr | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ykr | |||||||||||||||||||||
1yp4 | GLGS_SOLTU | P23509 | K00975 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Glucose-1-phosphate adenylyltransferase | 1yp4 | |||||||||||||||||||||
1yry | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1yry | |||||||||||||||||||||
1ysz | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 1ysz | |||||||||||||||||||||
1yt7 | CATK_HUMAN | P43235 | K01371 | Chaperones and folding catalysts | Intramolecular chaperones | Papain family | CTSK; cathepsin K | Others | 1yt7 | |||||||||||||||||||||
1z1h | POL_HV1A2 | P03369 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1z1h | |||||||||||||||||||||
1z1r | POL_HV1A2 | P03369 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 1z1r | |||||||||||||||||||||
Enzymes | 1z4r | 1z4r-aco-1.74-t-2 | 2445 | oncolytic | general control of amino acid synthesis protein 5-like 2 (histone acetyltransferase GCN5L2) | EC2.- (transferases) | acyltransferases | GCN5 | cancer | GCN5L2 inhibition influences transcription and is suggested to moderate other DNA-based mechanisms as well (e.g. cell-cycle progression, DNA recombination, DNA repair, and apoptosis). | aco | 1.74 | acetyl coenzyme A | CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)CO[P@@](=O)(O)O[P@@](=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)O | 72-89-9 | cas | Crystal Structure of Human Acetyltransferase GCN5 | Bernstein G, Dong A, Schuetz A, Antoshenko T, Wu H, Loppnau P, Bochkarev A, Plotnikov A | to be published | 2006 | ||||||||||
Enzymes | 1z5m | 1z5m-li8-2.17-h-1 | 54 | oncolytic | pdk1 3-phosphoinositide-dependent kinase 1 hPDK1 |
EC2.- (transferases) | kinases (serine-threonine) | PDK1 | cancer diabetes |
no info | li8 | 2.17 | 0 | CC(C)(C(=O)N)C(=O)N/C=C\CNc1nc(Nc2cccc(NC(=O)N3CCCC3)c2)ncc1Br | 0 | CAS | Novel small molecule inhibitors of 3-phosphoinositide-dependent kinase-1 | Feldman RI, Wu JM, Polokoff MA, Kochanny MJ, Dinter H, Zhu D, Biroc SL, Alicke B, Bryant J, Yuan S, Buckman BO, Lentz D, Ferrer M, Whitlow M, Adler M, Finster S, Chang Z, Arnaiz DO | J Biol Chem 280(20):19867-74 | 2005 | 10.1074/jbc.M501367200 | |||||||||
1z5m | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1z5m | |||||||||||||||||||||
1z5o | MTNN_ECO57 | P0AF14 | K01243 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | Adenosylhomocysteine nucleosidase | 1z5o | |||||||||||||||||||||
1z7y | CYSK1_ARATH | P47998 | K01738 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Cysteine synthase | 1z7y | |||||||||||||||||||||
1zaf | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1zaf | |||||||||||||||||||||
1zd4 | HYES_HUMAN | P34913 | K08726 | Enzymes | Hydrolases | Acting on ether bonds | Ether hydrolases | Soluble epoxide hydrolase | 1zd4 | |||||||||||||||||||||
1zdp | THER_BACTH | P00800 | KO_id not found | Others | Others | Others | Others | Others | 1zdp | |||||||||||||||||||||
1zfj | IMDH_STRPY | P0C0H6 | K00088 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | IMP dehydrogenase | 1zfj | |||||||||||||||||||||
1zgi | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1zgi | |||||||||||||||||||||
1zgs | LEC_PARPC | P83304 | KO_id not found | Others | Others | Others | Others | Others | 1zgs | |||||||||||||||||||||
1zht | KES1_YEAST | P35844 | KO_id not found | Others | Others | Others | Others | Others | 1zht | |||||||||||||||||||||
1zkk | SETD8_HUMAN | Q9NQR1 | K11428 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 1zkk | |||||||||||||||||||||
1zp5 | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1zp5 | |||||||||||||||||||||
1zxc | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 1zxc | |||||||||||||||||||||
2a3i | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 2a3i | |||||||||||||||||||||
2a58 | RIB4_SCHPO | Q9UUB1 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 2a58 | |||||||||||||||||||||
2a59 | RIB4_SCHPO | Q9UUB1 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 2a59 | |||||||||||||||||||||
2a7x | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 2a7x | |||||||||||||||||||||
2a94 | LDH_PLAFD | Q27743 | K00016 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | L-lactate dehydrogenase | 2a94 | |||||||||||||||||||||
2aa3 | Q4PRK9_PLAVI | Q4PRK9 | KO_id not found | Others | Others | Others | Others | Others | 2aa3 | |||||||||||||||||||||
2aax | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 2aax | |||||||||||||||||||||
2ab2 | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 2ab2 | |||||||||||||||||||||
Enzymes | 2aia | 2aia-sb8-1.70-d-1-s | 0.29977629 | antiinfective | bacterial peptide deformylase | EC3.- (hydrolases) | amidases | PDF (S.pneumoniae) | bacterial infection | interference with bacterial protein maturation | sb8 | 1.70 | SB-543668 | C1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)OCCN(C=O)O | 372951-18-3 | cas | Structural variation and inhibitor binding in polypeptide deformylase from four different bacterial species | Smith KJ, Petit CM, Aubart K, Smyth M, McManus E, Jones J, Fosberry A, Lewis C, Lonetto M, Christensen SB | Protein Sci 12(2):349-60 | 2003 | 10.1110/ps.0229303 | |||||||||
Enzymes | 2aia | 2aia-sb8-1.70-d-1 | 1.47651007 | antiinfective | bacterial peptide deformylase | EC3.- (hydrolases) | amidases | PDF (S.pneumoniae) | bacterial infection | interference with bacterial protein maturation | sb8 | 1.70 | SB-543668 | C1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)OCCN(C=O)O | 372951-18-3 | cas | Structural variation and inhibitor binding in polypeptide deformylase from four different bacterial species | Smith KJ, Petit CM, Aubart K, Smyth M, McManus E, Jones J, Fosberry A, Lewis C, Lonetto M, Christensen SB | Protein Sci 12(2):349-60 | 2003 | 10.1110/ps.0229303 | |||||||||
2aia | DEF_STRR6 | Q8DP79 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 2aia | |||||||||||||||||||||
2aio | BLA1_STEMA | P52700 | K06479 (inferred by homologyHUMAN) | CAM ligands | 1. Immunoglobulin Superfamily | Immune system | CD2 family | Metallo-beta-lactamase L1 | 2aio | 40324 | ||||||||||||||||||||
2ax6 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax6 | |||||||||||||||||||||
2ax9 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax9 | |||||||||||||||||||||
2axr | Q6PW77_ACRST | Q6PW77 | KO_id not found | Others | Others | Others | Others | Others | 2axr | |||||||||||||||||||||
2bb3 | O29536_ARCFU | O29536 | K03399 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Precorrin-6Y C5,15-methyltransferase (decarboxylating) | 2bb3 | |||||||||||||||||||||
2bfq | Y1521_ARCFU | O28751 | KO_id not found | Others | Others | Others | Others | Others | 2bfq | |||||||||||||||||||||
2bfr | Y1521_ARCFU | O28751 | KO_id not found | Others | Others | Others | Others | Others | 2bfr | |||||||||||||||||||||
2bfy | AUKBA_XENLA | Q6DE08 | K11479 | Chromosome | Eukaryotic Type | Centromeric chromatin formation proteins | Kinetochore proteins | Serine-threonine-protein kinase 12-A | 2bfy | 8355 | ||||||||||||||||||||
2bgd | PTN1_HUMAN | P18031 | K05696 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-monoester hydrolases | Protein-tyrosine-phosphatase | 2bgd | |||||||||||||||||||||
Enzymes | 2bhh | 2bhh-ryu-2.60-h-1-s | 0.17151 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | ryu | 2.60 | 860817-52-3 | [C[C@@]1(C2=CC=CC=C2NC1=C3C=4C=C(C=CC4NC3=O)S(=O)(=O)N5CCC(CC5)O)O] | 860817-52-3 | CAS | From the insoluble dye indirubin towards highly active, soluble CDK2-inhibitors | Jautelat, R., Brumby, T., Schafer, M., Briem, H., Eisenbrand, G., Schwahn, S., Kruger, M., Lucking, U., Prien, O., Siemeister, G. | Chembiochem 6:531-540 | 2005 | 10.1002/cbic.200400108 | |||||||||
Enzymes | 2bhh | 2bhh-ryu-2.60-h-1 | 2.43102 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | ryu | 2.60 | 860817-52-3 | [C[C@@]1(C2=CC=CC=C2NC1=C3C=4C=C(C=CC4NC3=O)S(=O)(=O)N5CCC(CC5)O)O] | 860817-52-3 | CAS | From the insoluble dye indirubin towards highly active, soluble CDK2-inhibitors | Jautelat, R., Brumby, T., Schafer, M., Briem, H., Eisenbrand, G., Schwahn, S., Kruger, M., Lucking, U., Prien, O., Siemeister, G. | Chembiochem 6:531-540 | 2005 | 10.1002/cbic.200400108 | |||||||||
2ble | GMPR1_HUMAN | P36959 | K00364 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With NAD+ or NADP+ as acceptor | GMP reductase | 2ble | |||||||||||||||||||||
2bmc | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bmc | |||||||||||||||||||||
2boh | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2boh | |||||||||||||||||||||
2bpm | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2bpm | |||||||||||||||||||||
2bqv | O92139_9HIV1 | O92139 | KO_id not found | Others | Others | Others | Others | Others | 2bqv | |||||||||||||||||||||
Enzymes | 2br1 | 2br1-pfp-2.00-h-1-s | 413 | no info | serin-threonin kinase | EC2.- (transferases) | kinases (serine-threonine) | Chk1 | cancer | no info | pfp | 2.00 | 378775-98-5 | COc1ccc(cc1)c2oc3ncnc(NCCO)c3c2c4ccc(OC)cc4 | 378775-98-5 | CAS | Structure-based design of novel Chk1 inhibitors: insights into hydrogen bonding and protein-ligand affinity | Foloppe N, Fisher LM, Howes R, Kierstan P, Potter A, Robertson AG, Surgenor AE | J Med Chem 48(13):4332-45 | 2005 | 10.1021/jm049022c | |||||||||
2br1 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2br1 | |||||||||||||||||||||
2brb | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brb | |||||||||||||||||||||
2brm | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brm | |||||||||||||||||||||
Enzymes | 2brn | 2brn-df1-2.80-h-1-s | 620 | no info | serin-threonin kinase | EC2.- (transferases) | kinases (serine-threonine) | Chk1 | cancer | no info | df1 | 2.80 | 859501-29-4 | C[C@@H](O)CNc1ncnc2[nH]c(c(c3ccccc3)c12)c4ccccc4 | 859501-29-4 | CAS | Structure-based design of novel Chk1 inhibitors: insights into hydrogen bonding and protein-ligand affinity | Foloppe N, Fisher LM, Howes R, Kierstan P, Potter A, Robertson AG, Surgenor AE | J Med Chem 48(13):4332-45 | 2005 | 10.1021/jm049022c | |||||||||
2brn | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brn | |||||||||||||||||||||
Enzymes | 2bro | 2bro-df2-2.20-h-1-s | 390 | no info | serin-threonin kinase | EC2.- (transferases) | kinases (serine-threonine) | Chk1 | cancer | no info | df2 | 2.20 | 859501-30-7 | OC[C@H](O)CNc1ncnc2[nH]c(c(c3ccccc3)c12)c4ccccc4 | 859501-30-7 | CAS | Structure-based design of novel Chk1 inhibitors: insights into hydrogen bonding and protein-ligand affinity | Foloppe N, Fisher LM, Howes R, Kierstan P, Potter A, Robertson AG, Surgenor AE | J Med Chem 48(13):4332-45 | 2005 | 10.1021/jm049022c | |||||||||
2bro | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bro | |||||||||||||||||||||
2bsx | Q8T9Z7_PLAFA | Q8T9Z7 | KO_id not found | Others | Others | Others | Others | Others | 2bsx | |||||||||||||||||||||
2btr | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2btr | |||||||||||||||||||||
2bts | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2bts | |||||||||||||||||||||
Enzymes | 2c57 | 2c57-fa1-3.10-d-1 | 0.03281133 | antiinfective | bacterial 3-dehydroquinate dehydratase | EC4.- (lyases) | hydro-lyases | type II DHQase (H.pylori) | gastric ulcer bacterial infection |
inhibition of bacterial 3-dehydroquinate dehydratase interference with biosynthetic shikimate pathway interference with biosynthesis of aromatic compounds |
fa1 | 3.10 | 227002-11-1 | O=C(O)[C@]1(O)C=C[C@@H](O)[C@H](O)C1 | 227002-11-1 | cas | Crystal structures of Helicobacter pylori type II dehydroquinase inhibitor complexes: new directions for inhibitor design | Robinson DA, Stewart KA, Price NC, Chalk PA, Coggins JR, Lapthorn AJ | J Med Chem 49(4):1282-90 | 2006 | 10.1021/jm0505361 | |||||||||
2c5x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c5x | |||||||||||||||||||||
2c69 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c69 | |||||||||||||||||||||
2c6i | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c6i | |||||||||||||||||||||
2c6m | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c6m | |||||||||||||||||||||
2c9b | RISB_MYCTU | P66034 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 2c9b | |||||||||||||||||||||
2cgw | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2cgw | |||||||||||||||||||||
Enzymes | 2cnf | 2cnf-f32-2.20-d-1-s | 0.01789709 | endocrine | protein tyrosine phosphatase 1B | EC3.- (hydrolases) | phosphatases | PTP 1B | diabetes obesity |
dephosphorylation of insulin receptor and insulin receptor substrate tyrosine residues prevention of insulin resistance |
f32 | 2.20 | 850326-88-4 | C1=CC=C2C(=C1)NC(=N2)[C@H](CC3=CC=C(C=C3)[C@@H]4CC(=O)NS4(=O)=O)NC5=NC6=CC=CC=C6S5 | 850326-88-4 | cas | Structural Insights Into the Design of Nonpeptidic Isothiazolidinone-Containing Inhibitors of Protein Tyrosine Phosphatase 1B | Ala PJ, Gonneville L, Hillman M, Becker-Pasha M, Yue EW, Douty B, Wayland B, Polam P, Crawley ML, Mclaughlin E, Sparks RB, Glass B, Takvorian A, Combs AP, Burn TC, Hollis GF, Wynn R | to be published | 2006 | - | |||||||||
Enzymes | 2cnf | 2cnf-f32-2.20-d-1 | 0.06860552 | endocrine | protein tyrosine phosphatase 1B | EC3.- (hydrolases) | phosphatases | PTP 1B | diabetes obesity |
dephosphorylation of insulin receptor and insulin receptor substrate tyrosine residues prevention of insulin resistance |
f32 | 2.20 | 850326-88-4 | C1=CC=C2C(=C1)NC(=N2)[C@H](CC3=CC=C(C=C3)[C@@H]4CC(=O)NS4(=O)=O)NC5=NC6=CC=CC=C6S5 | 850326-88-4 | cas | Structural Insights Into the Design of Nonpeptidic Isothiazolidinone-Containing Inhibitors of Protein Tyrosine Phosphatase 1B | Ala PJ, Gonneville L, Hillman M, Becker-Pasha M, Yue EW, Douty B, Wayland B, Polam P, Crawley ML, Mclaughlin E, Sparks RB, Glass B, Takvorian A, Combs AP, Burn TC, Hollis GF, Wynn R | to be published | 2006 | - | |||||||||
Enzymes | 2cni | 2cni-izf-2.00-d-1-s | 0.03579418 | endocrine | protein tyrosine phosphatase 1B | EC3.- (hydrolases) | phosphatases | PTP 1B | diabetes obesity |
dephosphorylation of insulin receptor and insulin receptor substrate tyrosine residues prevention of insulin resistance |
izf | 2.00 | INT-850318-08-0-art-1-d | COC(=O)C=1C(=CC=CC1OCCCCCNC(=O)[C@H](CC=2C=CC(=C(C2)Cl)[C@@H]3CC(=O)NS3(=O)=O)NS(=O)(=O)C4=CC=CC=C4)O | INT-850318-08-0-art-1-d | int | Structural Insights Into the Design of Nonpeptidic Isothiazolidinone-Containing Inhibitors of Protein Tyrosine Phosphatase 1B | Ala PJ, Gonneville L, Hillman M, Becker-Pasha M, Yue EW, Douty B, Wayland B, Polam P, Crawley ML, Mclaughlin E, Sparks RB, Glass B, Takvorian A, Combs AP, Burn TC, Hollis GF, Wynn R | to be published | 2006 | - | |||||||||
Enzymes | 2cni | 2cni-izf-2.00-d-1 | 0.05070843 | endocrine | protein tyrosine phosphatase 1B | EC3.- (hydrolases) | phosphatases | PTP 1B | diabetes obesity |
dephosphorylation of insulin receptor and insulin receptor substrate tyrosine residues prevention of insulin resistance |
izf | 2.00 | INT-850318-08-0-art-1-d | COC(=O)C=1C(=CC=CC1OCCCCCNC(=O)[C@H](CC=2C=CC(=C(C2)Cl)[C@@H]3CC(=O)NS3(=O)=O)NS(=O)(=O)C4=CC=CC=C4)O | INT-850318-08-0-art-1-d | int | Structural Insights Into the Design of Nonpeptidic Isothiazolidinone-Containing Inhibitors of Protein Tyrosine Phosphatase 1B | Ala PJ, Gonneville L, Hillman M, Becker-Pasha M, Yue EW, Douty B, Wayland B, Polam P, Crawley ML, Mclaughlin E, Sparks RB, Glass B, Takvorian A, Combs AP, Burn TC, Hollis GF, Wynn R | to be published | 2006 | - | |||||||||
2cvu | RIR1_YEAST | P21524 | K10807 | DNA repair and recombination proteins | Eukaryotic Type | Other factors with a suspected DNA repair function | Modulation of nucleotide pools | RRM1; ribonucleoside-diphosphate reductase subunit M1 | 2cvu | |||||||||||||||||||||
2cvv | RIR1_YEAST | P21524 | K10807 | DNA repair and recombination proteins | Eukaryotic Type | Other factors with a suspected DNA repair function | Modulation of nucleotide pools | RRM1; ribonucleoside-diphosphate reductase subunit M1 | 2cvv | |||||||||||||||||||||
2czc | G3P_PYRHO | O59494 | K00150 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) | 2czc | |||||||||||||||||||||
2d1s | LUCI_LUCCR | P13129 | KO_id not found | Others | Others | Others | Others | Others | 2d1s | |||||||||||||||||||||
2d3s | LEC1_PSOTE | O24313 | KO_id not found | Others | Others | Others | Others | Others | 2d3s | |||||||||||||||||||||
2ddo | PDXK_ECOLI | P40191 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 2ddo | |||||||||||||||||||||
2ds1 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2ds1 | |||||||||||||||||||||
2duv | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2duv | |||||||||||||||||||||
2e14 | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2e14 | |||||||||||||||||||||
2e1q | XDH_HUMAN | P47989 | K00106 | Enzymes | Oxidoreductases | Acting on CH or CH2 groups | With oxygen as acceptor | Xanthine oxidase | 2e1q | |||||||||||||||||||||
2e1w | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 2e1w | |||||||||||||||||||||
2e9u | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2e9u | |||||||||||||||||||||
2e9v | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2e9v | |||||||||||||||||||||
2egh | DXR_ECOLI | P45568 | K00099 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 1-deoxy-D-xylulose-5-phosphate reductoisomerase | 2egh | |||||||||||||||||||||
2egv | RSME_AQUAE | O66552 | K09761 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 16S rRNA (uracil1498-N3)-methyltransferase | 2egv | |||||||||||||||||||||
2euf | CGH2_SHV21 | Q01043 | KO_id not found | Others | Others | Others | Others | Others | 2euf | |||||||||||||||||||||
Enzymes | 2ew5 | 2ew5-y12-2.20-d-1 | 3.0797912 | antiinfective | bacterial peptide deformylase | EC3.- (hydrolases) | amidases | PDF (H.pylori) | bacterial infection | interference with bacterial protein maturation | y12 | 2.20 | 913283-06-4 | CC(=O)OC1=CC=C(C=C1OC(=O)C)C=CC(=O)NCCC=2C=CC=CC2 | 913283-06-4 | cas | Peptide deformylase is a potential target for anti-Helicobacter pylori drugs: reverse docking, enzymatic assay, and X-ray crystallography validation | Cai J, Han C, Hu T, Zhang J, Wu D, Wang F, Liu Y, Ding J, Chen K, Yue J, Shen X, Jiang H | Protein Sci 15(9):2071-81 | 2006 | 10.1110/ps.062238406 | |||||||||
Enzymes | 2ew6 | 2ew6-y13-2.20-d-2 | 0.33407905 | antiinfective | bacterial peptide deformylase | EC3.- (hydrolases) | amidases | PDF (H.pylori) | bacterial infection | interference with bacterial protein maturation | y13 | 2.20 | N-trans-caffeoyltyramine | C=1C=C(C=CC1CCNC(=O)C=CC=2C=CC(=C(C2)O)O)O | 103188-48-3 | cas | Peptide deformylase is a potential target for anti-Helicobacter pylori drugs: reverse docking, enzymatic assay, and X-ray crystallography validation | Cai J, Han C, Hu T, Zhang J, Wu D, Wang F, Liu Y, Ding J, Chen K, Yue J, Shen X, Jiang H | Protein Sci 15(9):2071-81 | 2006 | 10.1110/ps.062238406 | |||||||||
2ex1 | Q15KI8_PASMD | Q15KI8 | KO_id not found | Others | Others | Others | Others | Others | 2ex1 | |||||||||||||||||||||
2f1o | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 2f1o | |||||||||||||||||||||
2f8p | OBL_OBELO | Q27709 | KO_id not found | Others | Others | Others | Others | Others | 2f8p | |||||||||||||||||||||
2f99 | O52646_9ACTO | O52646 | KO_id not found | Others | Others | Others | Others | Others | 2f99 | |||||||||||||||||||||
2fes | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2fes | |||||||||||||||||||||
2fhl | AVR4_CHICK | P56734 | KO_id not found | Others | Others | Others | Others | Others | 2fhl | |||||||||||||||||||||
2fqw | TMPC_TREPA | P29724 | KO_id not found | Others | Others | Others | Others | Others | 2fqw | |||||||||||||||||||||
2fqx | TMPC_TREPA | P29724 | KO_id not found | Others | Others | Others | Others | Others | 2fqx | |||||||||||||||||||||
Enzymes | 2fub | 2fub-aza-2.30-d-2 | 1159 | antiinfective | aspergillus flavus urate oxidase | EC1.- (oxydo-reductases) | urate oxidases | Uox (A.flavus) | fungal infection | inhibition of fungal urate oxidase interference with purine degradation |
aza | 2.30 | 8-azaxanthine | O=c1[nH]c(=O)c2[nH]nnc2[nH]1 | 1468-26-4 | cas | High pressure macromolecular crystallography: the 140-MPa crystal structure at 2.3 A resolution of urate oxidase, a 135-kDa tetrameric assembly | Colloc'h N, Girard E, Dhaussy AC, Kahn R, Ascone I, Mezouar M, Fourme R | Biochim Biophys Acta 1764(3):391-7 | 2006 | 10.1016/j.bbapap.2006.01.006 | |||||||||
2g0e | QACR_STAHA | P0A0N5 | KO_id not found | Others | Others | Others | Others | Others | 2g0e | |||||||||||||||||||||
2gc2 | G6PI_PYRFU | P83194 | K01810 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting aldoses and ketoses, and related compounds | Glucose-6-phosphate isomerase | 2gc2 | |||||||||||||||||||||
2gmv | PCKGC_HUMAN | P35558 | K01596 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Phosphoenolpyruvate carboxykinase (GTP) | 2gmv | |||||||||||||||||||||
2h15 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2h15 | |||||||||||||||||||||
2h5z | LYS1_MUSDO | Q7YT16 | K00290 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Saccharopine dehydrogenase (NAD+, L-lysine-forming) | 2h5z | |||||||||||||||||||||
2h7c | EST1_HUMAN | P23141 | K01044 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Carboxylesterase | 2h7c | |||||||||||||||||||||
2h8m | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 2h8m | |||||||||||||||||||||
2hbh | VDRA_DANRE | Q9PTN2 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 2hbh | |||||||||||||||||||||
2hc4 | VDRA_DANRE | Q9PTN2 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 2hc4 | |||||||||||||||||||||
2hct | CD38_HUMAN | P28907 | K01242 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | NAD+ nucleosidase | 2hct | |||||||||||||||||||||
2hkj | TOP6B_SULSH | O05207 | KO_id not found | Others | Others | Others | Others | Others | 2hkj | |||||||||||||||||||||
2hl2 | SYT_PYRAB | Q9UZ14 | K01868 | Enzymes | Ligases | Forming carbon-oxygen bonds | Ligases forming aminoacyl-tRNA and related compounds | Threonine---tRNA ligase | 2hl2 | |||||||||||||||||||||
2hoc | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2hoc | |||||||||||||||||||||
2hog | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2hog | |||||||||||||||||||||
2hpv | AZOR_ENTFA | Q831B2 | KO_id not found | Others | Others | Others | Others | Others | 2hpv | |||||||||||||||||||||
2hxl | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2hxl | |||||||||||||||||||||
2hxm | UNG_HUMAN | P13051 | K03648 | DNA repair and recombination proteins | Prokaryotic Type | SSBR (single strand breaks repair) | BER (base exicision repair) | DNA glycosylases | 2hxm | |||||||||||||||||||||
2hxz | CATS_HUMAN | P25774 | K01368 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Cysteine endopeptidases | Cathepsin S | 2hxz | |||||||||||||||||||||
2i0d | O38732_9HIV1 | O38732 | KO_id not found | Others | Others | Others | Others | Others | 2i0d | |||||||||||||||||||||
2i2c | PPNK1_LISMO | Q8Y8D7 | K00858 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | NAD+ kinase | 2i2c | |||||||||||||||||||||
2i2d | PPNK1_LISMO | Q8Y8D7 | K00858 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | NAD+ kinase | 2i2d | |||||||||||||||||||||
2i3g | ARGC_MYCTU | P63562 | K00145 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | N-acetyl-gamma-glutamyl-phosphate reductase | 2i3g | |||||||||||||||||||||
2i4i | DDX3X_HUMAN | O00571 | K11594 | Enzymes | Hydrolases | Acting on acid anhydrides | Acting on acid anhydrides to facilitate cellular and subcellular movement | RNA helicase | 2i4i | |||||||||||||||||||||
2ieg | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 2ieg | |||||||||||||||||||||
2igb | PYRR_BACCL | P41007 | K02825 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Uracil phosphoribosyltransferase | 2igb | |||||||||||||||||||||
2igq | EHMT1_HUMAN | Q9H9B1 | K11420 | Chromosome | Eukaryotic Type | Histone modification proteins | HMTs (histone methyltransferases) | HKMTs (histone lysine methyltransferases) | 2igq | |||||||||||||||||||||
2ih2 | MTTA_THEAQ | P14385 | KO_id not found | Others | Others | Others | Others | Others | 2ih2 | |||||||||||||||||||||
2ihq | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ihq | |||||||||||||||||||||
2ikg | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2ikg | |||||||||||||||||||||
2ikh | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2ikh | |||||||||||||||||||||
2ilt | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 2ilt | |||||||||||||||||||||
2imp | ALDA_ECOLI | P25553 | K07248 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Glycolaldehyde dehydrogenase | 2imp | |||||||||||||||||||||
2io6 | WEE1_HUMAN | P30291 | K06632 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2io6 | |||||||||||||||||||||
2iod | P93799_VITVI | P93799 | KO_id not found | Others | Others | Others | Others | Others | 2iod | |||||||||||||||||||||
2ipf | AK1CL_MOUSE | Q91WR5 | KO_id not found | Others | Others | Others | Others | Others | 2ipf | |||||||||||||||||||||
2iu8 | LPXD_CHLT2 | B0B7F9 | K02536 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | UDP-3-O-(3-hydroxymyristoyl)glucosamine N-acyltransferase | 2iu8 | |||||||||||||||||||||
2ivs | RET_HUMAN | P07949 | K05126 | Cytokine receptors | Receptor tyrosine kinase | RTK class XIV (RET receptor family) | RET; proto-oncogene tyrosine-protein kinase Ret | Others | 2ivs | |||||||||||||||||||||
2iw9 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2iw9 | |||||||||||||||||||||
Other proteins | 2izl | 2izl-imi-1.48-d-2 | 108 | antiinfective | streptavidin | Bacterial proteins | binding proteins | streptavidin | fundamental research | stabilisation of streptavidin tool for universal test systems in immunology and molecular diagnostics system for analysis of intermolecular interactions of the tight binding of the small molecule ligand biotin to the protein |
imi | 1.48 | iminobiotin | OC(=O)CCCC[C@@H]1SC[C@@H]2NC(=N)N[C@H]12 | 13395-35-2 | CAS | Binding of biotin to streptavidin stabilizes intersubunit salt bridges between Asp61 and His87 at low pH | Katz BA | J Mol Biol 274(5):776-800 | 1997 | 10.1006/jmbi.1997.1444 | |||||||||
2izu | KC1G3_HUMAN | Q9Y6M4 | K08958 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2izu | |||||||||||||||||||||
2j07 | PHR_THET8 | P61497 | K01669 | Enzymes | Lyases | Carbon-carbon lyases | Other carbon-carbon lyases | Deoxyribodipyrimidine photo-lyase | 2j07 | |||||||||||||||||||||
2j08 | PHR_THET8 | P61497 | K01669 | Enzymes | Lyases | Carbon-carbon lyases | Other carbon-carbon lyases | Deoxyribodipyrimidine photo-lyase | 2j08 | |||||||||||||||||||||
2j2u | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2j2u | |||||||||||||||||||||
2j50 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2j50 | |||||||||||||||||||||
2j51 | SLK_HUMAN | Q9H2G2 | K08836 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2j51 | |||||||||||||||||||||
2j62 | OGA_CLOP1 | Q0TR53 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2j62 | |||||||||||||||||||||
2j7c | BGLA_THEMA | Q08638 | K01223 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | 6-phospho-beta-glucosidase | 2j7c | |||||||||||||||||||||
2j7d | BGLA_THEMA | Q08638 | K01223 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | 6-phospho-beta-glucosidase | 2j7d | |||||||||||||||||||||
2j7e | BGLA_THEMA | Q08638 | K01223 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | 6-phospho-beta-glucosidase | 2j7e | |||||||||||||||||||||
2j7y | ESR2_RAT | Q62986 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2j7y | |||||||||||||||||||||
2j94 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2j94 | |||||||||||||||||||||
2j9m | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2j9m | |||||||||||||||||||||
2jc6 | KCC1D_HUMAN | Q8IU85 | K08794 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2jc6 | |||||||||||||||||||||
2jf6 | SG1_RAUSE | Q8GU20 | KO_id not found | Others | Others | Others | Others | Others | 2jf6 | |||||||||||||||||||||
2jg7 | Q4KTQ7_ACASC | Q4KTQ7 | KO_id not found | Others | Others | Others | Others | Others | 2jg7 | |||||||||||||||||||||
2jh0 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2jh0 | |||||||||||||||||||||
2jh5 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2jh5 | |||||||||||||||||||||
2jh6 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2jh6 | |||||||||||||||||||||
2jj8 | DNK_DROME | Q9XZT6 | K05961 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Deoxynucleoside kinase | 2jj8 | |||||||||||||||||||||
2jjk | F16P1_HUMAN | P09467 | K03841 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-monoester hydrolases | Fructose-bisphosphatase | 2jjk | |||||||||||||||||||||
2jle | Q72547_9HIV1 | Q72547 | KO_id not found | Others | Others | Others | Others | Others | 2jle | |||||||||||||||||||||
2jxr | CARP_YEAST | P07267 | K01381 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Saccharopepsin | 2jxr | |||||||||||||||||||||
2kzz | DPO1_ECOLI | P00582 | K02335 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | DNA-directed DNA polymerase | 2kzz | |||||||||||||||||||||
2nm2 | FOLB_STAAU | P56740 | K13649 | Others | Cellular Processes | Transport and catabolism | Endocytosis | FOLR; folate receptor | 2nm2 | |||||||||||||||||||||
2nnl | P93799_VITVI | P93799 | KO_id not found | Others | Others | Others | Others | Others | 2nnl | |||||||||||||||||||||
2npn | Q6NIF5_CORDI | Q6NIF5 | K02228 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Precorrin-6A synthase (deacetylating) | 2npn | |||||||||||||||||||||
2nvc | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2nvc | |||||||||||||||||||||
2nxx | A1JUG2_TRICA | A1JUG2 | KO_id not found | Others | Others | Others | Others | Others | 2nxx | |||||||||||||||||||||
2o06 | SPEE_HUMAN | P19623 | K00797 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Spermidine synthase | 2o06 | |||||||||||||||||||||
2o1u | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 2o1u | |||||||||||||||||||||
2o2c | G6PI_TRYBB | P13377 | K01810 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting aldoses and ketoses, and related compounds | Glucose-6-phosphate isomerase | 2o2c | |||||||||||||||||||||
2o4j | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 2o4j | |||||||||||||||||||||
2o4r | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 2o4r | |||||||||||||||||||||
2o4s | POL_HV1BR | P03367 | KO_id not found | Others | Others | Others | Others | Others | 2o4s | |||||||||||||||||||||
2o6h | RISB1_BRUME | Q8YGH2 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 2o6h | |||||||||||||||||||||
2o7o | TETR4_ECOLX | P0ACT4 | KO_id not found | Others | Others | Others | Others | Others | 2o7o | |||||||||||||||||||||
2o8h | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2o8h | |||||||||||||||||||||
2o9r | BGLB_PAEPO | P22505 | K01223 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | 6-phospho-beta-glucosidase | 2o9r | |||||||||||||||||||||
2oaz | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 2oaz | |||||||||||||||||||||
2obx | RISB2_RHILO | Q986N2 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 2obx | |||||||||||||||||||||
2oht | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 2oht | |||||||||||||||||||||
2ohu | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 2ohu | |||||||||||||||||||||
2oi0 | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 2oi0 | |||||||||||||||||||||
2ojg | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2ojg | |||||||||||||||||||||
2ojj | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2ojj | |||||||||||||||||||||
2on6 | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 2on6 | |||||||||||||||||||||
2ops | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 2ops | |||||||||||||||||||||
2os1 | DEF_ENTFA | Q82ZJ0 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 2os1 | |||||||||||||||||||||
2os3 | DEF_STRP1 | P68771 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 2os3 | |||||||||||||||||||||
2our | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2our | |||||||||||||||||||||
2ovh | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 2ovh | |||||||||||||||||||||
2oxn | NAGZ_VIBCH | Q9KU37 | K01207 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Beta-N-acetylhexosaminidase | 2oxn | |||||||||||||||||||||
2p0e | NRK1_HUMAN | Q9NWW6 | K10524 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Ribosylnicotinamide kinase | 2p0e | |||||||||||||||||||||
2pdg | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2pdg | |||||||||||||||||||||
2pdw | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2pdw | |||||||||||||||||||||
2pe2 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2pe2 | |||||||||||||||||||||
2pnu | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2pnu | |||||||||||||||||||||
2pou | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2pou | |||||||||||||||||||||
2pow | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2pow | |||||||||||||||||||||
2prm | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 2prm | |||||||||||||||||||||
2psj | LUCI_RENRE | P27652 | KO_id not found | Others | Others | Others | Others | Others | 2psj | |||||||||||||||||||||
2pvj | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2pvj | |||||||||||||||||||||
2pvn | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2pvn | |||||||||||||||||||||
2pw3 | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2pw3 | |||||||||||||||||||||
2pza | NADE_BACAN | Q81RP3 | K01916 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-ammonia (or amine) ligases (amide synthases) | NAD+ synthase | 2pza | |||||||||||||||||||||
2pzi | PKNG_MYCTU | P65728 | K14949 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2pzi | |||||||||||||||||||||
2q11 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 2q11 | |||||||||||||||||||||
2q15 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 2q15 | |||||||||||||||||||||
2q4h | GALT_ARATH | Q9FK51 | K00965 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | UDP-glucose---hexose-1-phosphate uridylyltransferase | 2q4h | |||||||||||||||||||||
2q54 | O38732_9HIV1 | O38732 | KO_id not found | Others | Others | Others | Others | Others | 2q54 | |||||||||||||||||||||
2q55 | O38732_9HIV1 | O38732 | KO_id not found | Others | Others | Others | Others | Others | 2q55 | |||||||||||||||||||||
2q5k | O38732_9HIV1 | O38732 | KO_id not found | Others | Others | Others | Others | Others | 2q5k | |||||||||||||||||||||
2q6f | Q3Y5H1_9GAMC | Q3Y5H1 | KO_id not found | Others | Others | Others | Others | Others | 2q6f | |||||||||||||||||||||
2q7o | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 2q7o | |||||||||||||||||||||
2q8g | PDK1_HUMAN | Q15118 | K12077 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2q8g | |||||||||||||||||||||
2q8i | PDK3_HUMAN | Q15120 | K00898 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2q8i | |||||||||||||||||||||
2q95 | AMPM_ECOLI | P0AE18 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 2q95 | |||||||||||||||||||||
2q9u | Q86QZ1_GIAIN | Q86QZ1 | KO_id not found | Others | Others | Others | Others | Others | 2q9u | |||||||||||||||||||||
2qa9 | PRTB_STRGR | P00777 | K01336 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Cerevisin | 2qa9 | |||||||||||||||||||||
2qab | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qab | |||||||||||||||||||||
2qbu | O27402_METTH | O27402 | K03394 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Precorrin-2 C20-methyltransferase | 2qbu | |||||||||||||||||||||
2qgt | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qgt | |||||||||||||||||||||
2qhx | PTR1_LEIMA | Q01782 | KO_id not found | Others | Others | Others | Others | Others | 2qhx | |||||||||||||||||||||
2qhy | O38732_9HIV1 | O38732 | KO_id not found | Others | Others | Others | Others | Others | 2qhy | |||||||||||||||||||||
2qi5 | O38732_9HIV1 | O38732 | KO_id not found | Others | Others | Others | Others | Others | 2qi5 | |||||||||||||||||||||
2qkm | DCP1_SCHPO | Q9P805 | K12611 | Enzymes | Hydrolases | - | -.- | -.-.- | 2qkm | |||||||||||||||||||||
2qkn | CKX1_MAIZE | Q9T0N8 | K00279 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With other acceptors | Cytokinin dehydrogenase | 2qkn | |||||||||||||||||||||
2qln | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 2qln | |||||||||||||||||||||
2qn7 | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 2qn7 | |||||||||||||||||||||
2qn8 | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 2qn8 | |||||||||||||||||||||
2qn9 | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 2qn9 | |||||||||||||||||||||
2qnb | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 2qnb | |||||||||||||||||||||
2qrq | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 2qrq | |||||||||||||||||||||
2qtg | MTN1_ARATH | Q9T0I8 | K01244 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | Methylthioadenosine nucleosidase | 2qtg | |||||||||||||||||||||
2qtn | Q6HT60_BACAN | Q6HT60 | K00969 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Nicotinate-nucleotide adenylyltransferase | 2qtn | |||||||||||||||||||||
2qtt | MTN1_ARATH | Q9T0I8 | K01244 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | Methylthioadenosine nucleosidase | 2qtt | |||||||||||||||||||||
2qv7 | DAGK_STAAR | Q6GFF9 | KO_id not found | Others | Others | Others | Others | Others | 2qv7 | |||||||||||||||||||||
2qvn | A5KE01_PLAVS | A5KE01 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 2qvn | |||||||||||||||||||||
2qwx | NQO2_HUMAN | P16083 | K08071 | Enzymes | Oxidoreductases | Acting on diphenols and related substances as donors | With other acceptors | Ribosyldihydronicotinamide dehydrogenase (quinone) | 2qwx | |||||||||||||||||||||
2qzr | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 2qzr | |||||||||||||||||||||
2r0p | Q8KI25_NOCAE | Q8KI25 | KO_id not found | Others | Others | Others | Others | Others | 2r0p | |||||||||||||||||||||
2r2l | Q5RKJ4_RAT | Q5RKJ4 | KO_id not found | Others | Others | Others | Others | Others | 2r2l | |||||||||||||||||||||
2r3j | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3j | |||||||||||||||||||||
2r3k | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3k | |||||||||||||||||||||
2r3m | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3m | |||||||||||||||||||||
2r64 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r64 | |||||||||||||||||||||
2r6h | Q7MT22_PORGI | Q7MT22 | K00351 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | - | 2r6h | |||||||||||||||||||||
2r6r | FTSZ_AQUAE | O66809 | KO_id not found | Others | Others | Others | Others | Others | 2r6r | |||||||||||||||||||||
2rbe | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 2rbe | |||||||||||||||||||||
2rcw | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 2rcw | |||||||||||||||||||||
2rh6 | Q8PIS1_XANAC | Q8PIS1 | KO_id not found | Others | Others | Others | Others | Others | 2rh6 | |||||||||||||||||||||
2rh9 | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 2rh9 | |||||||||||||||||||||
2rhr | ACT3_STRCO | P16544 | K12420 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | - | 2rhr | |||||||||||||||||||||
2rhs | SYFA_STAHJ | Q4L5E3 | K01889 | Enzymes | Ligases | Forming carbon-oxygen bonds | Ligases forming aminoacyl-tRNA and related compounds | Phenylalanine---tRNA ligase | 2rhs | |||||||||||||||||||||
2rht | BPHD_BURXL | P47229 | K10222 | Enzymes | Hydrolases | Acting on carbon-carbon bonds | In ketonic substances | 2,6-dioxo-6-phenylhexa-3-enoate hydrolase | 2rht | |||||||||||||||||||||
Signaling proteins | 2trt | 2trt-tac-2.50-d-1-s | 1816 | antiinfective | tetracycline repressor protein | Intracellular transduction | DNA repressors | TetR | fundamental research bacterial infection |
resistance to tetracycline antibiotics at the transcriptional level | tac | 2.50 | tetracycline | CN(C)[C@H]1[C@@H]2C[C@H]3C(=C(O)[C@]2(O)C(=O)C(=C1O)C(=O)N)C(=O)c4c(O)cccc4[C@@]3(C)O | 60-54-8 | cas | Structure of the Tet repressor-tetracycline complex and regulation of antibiotic resistance | Hinrichs W, Kisker C, Duvel M, Muller A, Tovar K, Hillen W, Saenger W | Science 264(5157):418-20 | 1994 | - | |||||||||
2tsr | TYSY_RAT | P45352 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 2tsr | |||||||||||||||||||||
2upj | POL_HV1BR | P03367 | KO_id not found | Others | Others | Others | Others | Others | 2upj | |||||||||||||||||||||
2usn | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 2usn | |||||||||||||||||||||
2uue | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2uue | |||||||||||||||||||||
2uv2 | SLK_HUMAN | Q9H2G2 | K08836 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2uv2 | |||||||||||||||||||||
2uxh | TTGR_PSEPU | Q9AIU0 | KO_id not found | Others | Others | Others | Others | Others | 2uxh | |||||||||||||||||||||
2uxz | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2uxz | |||||||||||||||||||||
2uy0 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2uy0 | |||||||||||||||||||||
2uzd | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2uzd | |||||||||||||||||||||
2uzh | A0R559_MYCS2 | A0R559 | K01770 | Enzymes | Lyases | Phosphorus-oxygen lyases | Phosphorus-oxygen lyases (only sub-subclass identified to date) | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | 2uzh | |||||||||||||||||||||
2uzo | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2uzo | |||||||||||||||||||||
2v2q | ISPE_AQUAE | O67060 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 2v2q | |||||||||||||||||||||
2v2z | ISPE_AQUAE | O67060 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 2v2z | |||||||||||||||||||||
2v4l | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2v4l | |||||||||||||||||||||
2v57 | Q58L87_MYCSM | Q58L87 | KO_id not found | Others | Others | Others | Others | Others | 2v57 | |||||||||||||||||||||
2v58 | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2v58 | |||||||||||||||||||||
2v59 | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2v59 | |||||||||||||||||||||
2v5a | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2v5a | |||||||||||||||||||||
2v8p | ISPE_AQUAE | O67060 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 2v8p | |||||||||||||||||||||
2va6 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 2va6 | |||||||||||||||||||||
2va7 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 2va7 | |||||||||||||||||||||
2vap | FTSZ1_METJA | Q57816 | KO_id not found | Others | Others | Others | Others | Others | 2vap | |||||||||||||||||||||
2vf3 | ISPE_AQUAE | O67060 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 2vf3 | |||||||||||||||||||||
2vg5 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2vg5 | |||||||||||||||||||||
2vg7 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2vg7 | |||||||||||||||||||||
2vgo | AUKBA_XENLA | Q6DE08 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2vgo | |||||||||||||||||||||
2vi5 | RISB_MYCTU | P66034 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 2vi5 | |||||||||||||||||||||
2vig | ACADS_HUMAN | P16219 | K00248 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a flavin as acceptor | Short-chain acyl-CoA dehydrogenase | 2vig | |||||||||||||||||||||
2vkh | Q46342_CLOSO | Q46342 | KO_id not found | Others | Others | Others | Others | Others | 2vkh | |||||||||||||||||||||
2vl8 | Q46342_CLOSO | Q46342 | KO_id not found | Others | Others | Others | Others | Others | 2vl8 | |||||||||||||||||||||
2vpr | Q799E2_PASMD | Q799E2 | KO_id not found | Others | Others | Others | Others | Others | 2vpr | |||||||||||||||||||||
2vqs | DNK_DROME | Q9XZT6 | K05961 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Deoxynucleoside kinase | 2vqs | |||||||||||||||||||||
2vrx | AUKBA_XENLA | Q6DE08 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2vrx | |||||||||||||||||||||
2vto | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2vto | |||||||||||||||||||||
2vur | OGA_CLOP1 | Q0TR53 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2vur | |||||||||||||||||||||
2vvs | OGA_BACTN | Q89ZI2 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2vvs | |||||||||||||||||||||
2vwx | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vwx | |||||||||||||||||||||
2vwy | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vwy | |||||||||||||||||||||
2vwz | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vwz | |||||||||||||||||||||
2vx0 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vx0 | |||||||||||||||||||||
2vx1 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vx1 | |||||||||||||||||||||
2vz6 | KCC2A_HUMAN | Q9UQM7 | K04515 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2vz6 | |||||||||||||||||||||
2vze | ACS2A_HUMAN | Q08AH3 | K01896 | Enzymes | Ligases | Forming carbon-sulfur bonds | Acid-thiol ligases | Butyrate---CoA ligase | 2vze | |||||||||||||||||||||
2w1e | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2w1e | |||||||||||||||||||||
2w1h | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2w1h | |||||||||||||||||||||
2w3r | O54051_RHOCA | O54051 | KO_id not found | Others | Others | Others | Others | Others | 2w3r | |||||||||||||||||||||
2w3s | O54050_RHOCA | O54050 | KO_id not found | Others | Others | Others | Others | Others | 2w3s | |||||||||||||||||||||
2w3v | O30463_MYCAV | O30463 | KO_id not found | Others | Others | Others | Others | Others | 2w3v | |||||||||||||||||||||
2w4o | KCC4_HUMAN | Q16566 | K05869 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2w4o | |||||||||||||||||||||
2w4x | OGA_BACTN | Q89ZI2 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2w4x | |||||||||||||||||||||
2w6m | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2w6m | |||||||||||||||||||||
2w6n | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2w6n | |||||||||||||||||||||
2w71 | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2w71 | |||||||||||||||||||||
2w8r | SSDH_HUMAN | P51649 | K00139 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Succinate-semialdehyde dehydrogenase (NAD+) | 2w8r | |||||||||||||||||||||
2w98 | PTGR2_HUMAN | Q8N8N7 | K13949 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | 15-oxoprostaglandin 13-oxidase | 2w98 | |||||||||||||||||||||
2wa9 | CLPS_ECOLI | P0A8Q6 | KO_id not found | Others | Others | Others | Others | Others | 2wa9 | |||||||||||||||||||||
2wb5 | OGA_CLOP1 | Q0TR53 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2wb5 | |||||||||||||||||||||
2wbk | Q8AAK6_BACTN | Q8AAK6 | K01192 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Beta-mannosidase | 2wbk | |||||||||||||||||||||
2wca | OGA_BACTN | Q89ZI2 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2wca | |||||||||||||||||||||
2wd1 | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 2wd1 | |||||||||||||||||||||
2wd7 | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 2wd7 | |||||||||||||||||||||
2wea | PENP_PENJA | P00798 | KO_id not found | Others | Others | Others | Others | Others | 2wea | |||||||||||||||||||||
2web | PENP_PENJA | P00798 | KO_id not found | Others | Others | Others | Others | Others | 2web | |||||||||||||||||||||
2wec | PENP_PENJA | P00798 | KO_id not found | Others | Others | Others | Others | Others | 2wec | |||||||||||||||||||||
2weh | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2weh | |||||||||||||||||||||
2wgs | GLNA1_MYCTU | P0A590 | K01915 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-ammonia (or amine) ligases (amide synthases) | Glutamate---ammonia ligase | 2wgs | |||||||||||||||||||||
2wks | AROQ_HELPY | Q48255 | K03786 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | 3-dehydroquinate dehydratase | 2wks | |||||||||||||||||||||
2wkz | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2wkz | |||||||||||||||||||||
2wl0 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2wl0 | |||||||||||||||||||||
2wmd | NMRL1_HUMAN | Q9HBL8 | KO_id not found | Others | Others | Others | Others | Others | 2wmd | |||||||||||||||||||||
2wmr | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2wmr | |||||||||||||||||||||
2wms | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2wms | |||||||||||||||||||||
2wn9 | Q8WSF8_APLCA | Q8WSF8 | KO_id not found | Others | Others | Others | Others | Others | 2wn9 | |||||||||||||||||||||
2wo9 | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 2wo9 | |||||||||||||||||||||
2won | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 2won | |||||||||||||||||||||
2wqb | TIE2_HUMAN | Q02763 | K05121 | Cellular antigens | CD (clusters of differentiation) molecules | CD202b; TEK tyrosine kinase, endothelial | Others | Others | 2wqb | |||||||||||||||||||||
2wtc | CHK2_HUMAN | O96017 | K06641 | DNA repair and recombination proteins | Eukaryotic Type | Check point factors | Other check point factors | CHK2; serine-threonine-protein kinase Chk2 | 2wtc | |||||||||||||||||||||
2wtd | CHK2_HUMAN | O96017 | K06641 | DNA repair and recombination proteins | Eukaryotic Type | Check point factors | Other check point factors | CHK2; serine-threonine-protein kinase Chk2 | 2wtd | |||||||||||||||||||||
2wu6 | CLK3_HUMAN | P49761 | K08823 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 2wu6 | |||||||||||||||||||||
2wuf | HSAD_MYCTU | P96851 | K16050 | Enzymes | Hydrolases | Acting on carbon-carbon bonds | In ketonic substances | 4,5-9,10-diseco-3-hydroxy-5,9,17-trioxoandrosta-1(10),2-diene-4-oate hydrolase | 2wuf | |||||||||||||||||||||
2wvz | Q8A0N1_BACTN | Q8A0N1 | KO_id not found | Others | Others | Others | Others | Others | 2wvz | |||||||||||||||||||||
2ww3 | Q8A0N1_BACTN | Q8A0N1 | KO_id not found | Others | Others | Others | Others | Others | 2ww3 | |||||||||||||||||||||
2wxf | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxf | |||||||||||||||||||||
2wxm | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxm | |||||||||||||||||||||
2wxn | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxn | |||||||||||||||||||||
2wxp | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxp | |||||||||||||||||||||
2wxq | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxq | |||||||||||||||||||||
2wxv | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2wxv | |||||||||||||||||||||
2wyg | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2wyg | |||||||||||||||||||||
2wzh | OGA_BACTN | Q89ZI2 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2wzh | |||||||||||||||||||||
2x0y | OGA_CLOP1 | Q0TR53 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2x0y | |||||||||||||||||||||
2x1n | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2x1n | |||||||||||||||||||||
2x2l | RET_HUMAN | P07949 | K05126 | Cytokine receptors | Receptor tyrosine kinase | RTK class XIV (RET receptor family) | RET; proto-oncogene tyrosine-protein kinase Ret | Others | 2x2l | |||||||||||||||||||||
2x38 | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2x38 | |||||||||||||||||||||
2x7f | TNIK_HUMAN | Q9UKE5 | K08840 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2x7f | |||||||||||||||||||||
2x7t | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2x7t | |||||||||||||||||||||
2x9f | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2x9f | |||||||||||||||||||||
2x9g | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 2x9g | |||||||||||||||||||||
2x9n | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 2x9n | |||||||||||||||||||||
2xb9 | AROQ_HELPY | Q48255 | K03786 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | 3-dehydroquinate dehydratase | 2xb9 | |||||||||||||||||||||
2xhm | ACE_DROME | Q10714 | K01283 | Cellular antigens | CD (clusters of differentiation) molecules | CD143; angiotensin I converting enzyme (peptidyl-dipeptidase A) 1 | Others | Others | 2xhm | |||||||||||||||||||||
2xiq | MUTA_HUMAN | P22033 | K01847 | Enzymes | Isomerases | Intramolecular transferases | Transferring other groups | Methylmalonyl-CoA mutase | 2xiq | |||||||||||||||||||||
2xm1 | OGA_BACTN | Q89ZI2 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2xm1 | |||||||||||||||||||||
2xm2 | OGA_BACTN | Q89ZI2 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2xm2 | |||||||||||||||||||||
2xng | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2xng | |||||||||||||||||||||
2xoc | CHFR_HUMAN | Q96EP1 | K10644 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Ubiquitin---protein ligase | 2xoc | |||||||||||||||||||||
2xpu | TETR4_ECOLX | P0ACT4 | KO_id not found | Others | Others | Others | Others | Others | 2xpu | |||||||||||||||||||||
2xrl | TETR4_ECOLX | P0ACT4 | KO_id not found | Others | Others | Others | Others | Others | 2xrl | |||||||||||||||||||||
2xsb | Q2CEE3_9RHOB | Q2CEE3 | KO_id not found | Others | Others | Others | Others | Others | 2xsb | |||||||||||||||||||||
2xtb | Q584S0_TRYB2 | Q584S0 | K00856 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Adenosine kinase | 2xtb | |||||||||||||||||||||
2xtk | B0Y2Y2_ASPFC | B0Y2Y2 | KO_id not found | Others | Others | Others | Others | Others | 2xtk | |||||||||||||||||||||
2xxb | LDH_THET8 | Q5SJA1 | K00016 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | L-lactate dehydrogenase | 2xxb | |||||||||||||||||||||
2xye | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2xye | |||||||||||||||||||||
2xyf | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2xyf | |||||||||||||||||||||
2xyu | EPHA4_MOUSE | Q03137 | K05105 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2xyu | |||||||||||||||||||||
2y4o | B4EL89_BURCJ | B4EL89 | K01912 | Enzymes | Ligases | Forming carbon-sulfur bonds | Acid-thiol ligases | Phenylacetate---CoA ligase | 2y4o | |||||||||||||||||||||
2y5k | F16P1_HUMAN | P09467 | K03841 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-monoester hydrolases | Fructose-bisphosphatase | 2y5k | |||||||||||||||||||||
2ybo | P95417_PSEAI | P95417 | K02303 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Uroporphyrinogen-III C-methyltransferase | 2ybo | |||||||||||||||||||||
2ybu | CHIA_HUMAN | Q9BZP6 | K01183 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Chitinase | 2ybu | |||||||||||||||||||||
2ydo | AA2AR_HUMAN | P29274 | K04266 | G Protein-Coupled Receptors | Class A. Rhodopsin family | Base and nucleoside | Adenosine | Adenosine receptor A2a | 2ydo | 9606 | ||||||||||||||||||||
2ydv | AA2AR_HUMAN | P29274 | K04266 | G Protein-Coupled Receptors | Class A. Rhodopsin family | Base and nucleoside | Adenosine | Adenosine receptor A2a | 2ydv | 9606 | ||||||||||||||||||||
2yer | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2yer | |||||||||||||||||||||
2yjd | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2yjd | |||||||||||||||||||||
2yk5 | LST_NEIMB | P72097 | K00785 | Enzymes | Transferases | Glycosyltransferases | Transferring other glycosyl groups | - | 2yk5 | |||||||||||||||||||||
2yk7 | LST_NEIMB | P72097 | K00785 | Enzymes | Transferases | Glycosyltransferases | Transferring other glycosyl groups | - | 2yk7 | |||||||||||||||||||||
2yxu | PDXK_HUMAN | O00764 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 2yxu | |||||||||||||||||||||
2z0y | Q5SKI6_THET8 | Q5SKI6 | K09761 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 16S rRNA (uracil1498-N3)-methyltransferase | 2z0y | |||||||||||||||||||||
2z2w | WEE1_HUMAN | P30291 | K06632 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2z2w | |||||||||||||||||||||
2z4t | A8QYL1_9GAMM | A8QYL1 | KO_id not found | Others | Others | Others | Others | Others | 2z4t | |||||||||||||||||||||
2z6i | Q9FBC5_STREE | Q9FBC5 | KO_id not found | Others | Others | Others | Others | Others | 2z6i | |||||||||||||||||||||
2z6r | DPHB_PYRHO | O58456 | K00586 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Diphthine synthase | 2z6r | |||||||||||||||||||||
2z7g | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 2z7g | |||||||||||||||||||||
2z7l | MK01_RAT | P63086 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2z7l | |||||||||||||||||||||
2z98 | AZOR_ECOLI | P41407 | KO_id not found | Others | Others | Others | Others | Others | 2z98 | |||||||||||||||||||||
2zba | O94197_FUSSP | O94197 | KO_id not found | Others | Others | Others | Others | Others | 2zba | |||||||||||||||||||||
2zdv | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zdv | |||||||||||||||||||||
2zff | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zff | |||||||||||||||||||||
2zfp | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zfp | |||||||||||||||||||||
2zjw | CSK21_HUMAN | P68400 | K03097 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2zjw | |||||||||||||||||||||
2zl2 | CLPP_HELPY | P56156 | K01358 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Endopeptidase Clp | 2zl2 | |||||||||||||||||||||
2zm1 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 2zm1 | |||||||||||||||||||||
2zoq | MK03_HUMAN | P27361 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2zoq | |||||||||||||||||||||
2zoz | Q8NMG3_CORGL | Q8NMG3 | KO_id not found | Others | Others | Others | Others | Others | 2zoz | |||||||||||||||||||||
2zv9 | LYN_MOUSE | P25911 | K05854 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 2zv9 | |||||||||||||||||||||
2zvb | Q53WA6_THET8 | Q53WA6 | K05934 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Precorrin-3B C17-methyltransferase | 2zvb | |||||||||||||||||||||
2zwi | A5LHX0_PHOPO | A5LHX0 | KO_id not found | Others | Others | Others | Others | Others | 2zwi | |||||||||||||||||||||
3a14 | DXR_THEMA | Q9WZZ1 | K00099 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 1-deoxy-D-xylulose-5-phosphate reductoisomerase | 3a14 | |||||||||||||||||||||
3a26 | TYW2_PYRHO | O58523 | K07055 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | - | 3a26 | |||||||||||||||||||||
3a2q | NYLA_FLASK | P13398 | KO_id not found | Others | Others | Others | Others | Others | 3a2q | |||||||||||||||||||||
3a37 | GET3_YEAST | Q12154 | K01551 | Enzymes | Hydrolases | Acting on acid anhydrides | Acting on acid anhydrides to catalyse transmembrane movement of substances | Arsenite-transporting ATPase | 3a37 | |||||||||||||||||||||
3a3w | Q93LD7_RHIRD | Q93LD7 | KO_id not found | Others | Others | Others | Others | Others | 3a3w | |||||||||||||||||||||
3a3z | VDR_HUMAN | P11473 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 3a3z | |||||||||||||||||||||
3ac1 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ac1 | |||||||||||||||||||||
3ac3 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ac3 | |||||||||||||||||||||
3ad6 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ad6 | |||||||||||||||||||||
3adt | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3adt | |||||||||||||||||||||
3afo | POS5_YEAST | Q06892 | KO_id not found | Others | Others | Others | Others | Others | 3afo | |||||||||||||||||||||
3ais | Q1XH05_WHEAT | Q1XH05 | KO_id not found | Others | Others | Others | Others | Others | 3ais | |||||||||||||||||||||
3ama | KAPCA_HUMAN | P17612 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 3ama | |||||||||||||||||||||
3amb | KAPCA_HUMAN | P17612 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 3amb | |||||||||||||||||||||
3anx | SPEE_THET8 | Q5SK28 | K00797 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Spermidine synthase | 3anx | |||||||||||||||||||||
3atw | R1A_CVHSA | P0C6U8 | KO_id not found | Others | Others | Others | Others | Others | 3atw | |||||||||||||||||||||
3aty | Q8I6L9_TRYCR | Q8I6L9 | KO_id not found | Others | Others | Others | Others | Others | 3aty | |||||||||||||||||||||
3atz | Q8I6L9_TRYCR | Q8I6L9 | KO_id not found | Others | Others | Others | Others | Others | 3atz | |||||||||||||||||||||
3avp | COAA_MYCTU | P63810 | K00867 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pantothenate kinase | 3avp | |||||||||||||||||||||
3aw0 | R1A_CVHSA | P0C6U8 | KO_id not found | Others | Others | Others | Others | Others | 3aw0 | |||||||||||||||||||||
3ax8 | VDR_HUMAN | P11473 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 3ax8 | |||||||||||||||||||||
3b1n | Q2SZE4_BURTA | Q2SZE4 | K00856 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Adenosine kinase | 3b1n | |||||||||||||||||||||
3b1q | Q2SZE4_BURTA | Q2SZE4 | K00856 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Adenosine kinase | 3b1q | |||||||||||||||||||||
3b2s | Q9HDE2_GIBZA | Q9HDE2 | KO_id not found | Others | Others | Others | Others | Others | 3b2s | |||||||||||||||||||||
3b4f | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3b4f | |||||||||||||||||||||
3b66 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 3b66 | |||||||||||||||||||||
3b68 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 3b68 | |||||||||||||||||||||
3b92 | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3b92 | |||||||||||||||||||||
3b9o | A4IU28_GEOTN | A4IU28 | KO_id not found | Others | Others | Others | Others | Others | 3b9o | |||||||||||||||||||||
3baa | DNLJ_ENTFA | Q837V6 | K01972 | Enzymes | Ligases | Forming phosphoric-ester bonds | Ligases that form phosphoric-ester bonds (only sub-subclass identified to date) | DNA ligase (NAD+) | 3baa | |||||||||||||||||||||
3bab | DNLJ_ENTFA | Q837V6 | K01972 | Enzymes | Ligases | Forming phosphoric-ester bonds | Ligases that form phosphoric-ester bonds (only sub-subclass identified to date) | DNA ligase (NAD+) | 3bab | |||||||||||||||||||||
3bac | DNLJ_HAEIN | P43813 | K01972 | Enzymes | Ligases | Forming phosphoric-ester bonds | Ligases that form phosphoric-ester bonds (only sub-subclass identified to date) | DNA ligase (NAD+) | 3bac | |||||||||||||||||||||
3bdj | XDH_BOVIN | P80457 | K00106 | Enzymes | Oxidoreductases | Acting on CH or CH2 groups | With oxygen as acceptor | Xanthine oxidase | 3bdj | |||||||||||||||||||||
3bea | CSF1R_HUMAN | P07333 | K05090 | Cellular antigens | CD (clusters of differentiation) molecules | CD115; colony stimulating factor 1 receptor (macrophage) | Others | Others | 3bea | |||||||||||||||||||||
3bgi | TPMT_MOUSE | O55060 | K00569 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thiopurine S-methyltransferase | 3bgi | |||||||||||||||||||||
3bgs | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3bgs | |||||||||||||||||||||
3bhh | KCC2B_HUMAN | Q13554 | K04515 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 3bhh | |||||||||||||||||||||
3bhj | CBR1_HUMAN | P16152 | K00079 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Carbonyl reductase (NADPH) | 3bhj | |||||||||||||||||||||
3bhm | CBR1_HUMAN | P16152 | K00079 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Carbonyl reductase (NADPH) | 3bhm | |||||||||||||||||||||
3bhu | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3bhu | |||||||||||||||||||||
3bhv | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3bhv | |||||||||||||||||||||
3bjc | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3bjc | |||||||||||||||||||||
3bjh | Q9U9J6_APIME | Q9U9J6 | KO_id not found | Others | Others | Others | Others | Others | 3bjh | |||||||||||||||||||||
3bk2 | Q72JJ7_THET2 | Q72JJ7 | KO_id not found | Others | Others | Others | Others | Others | 3bk2 | |||||||||||||||||||||
3bl9 | DCPS_HUMAN | Q96C86 | K12584 | Enzymes | Hydrolases | - | -.- | -.-.- | 3bl9 | |||||||||||||||||||||
3bla | DCPS_HUMAN | Q96C86 | K12584 | Enzymes | Hydrolases | - | -.- | -.-.- | 3bla | |||||||||||||||||||||
3bll | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 3bll | |||||||||||||||||||||
3blo | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 3blo | |||||||||||||||||||||
3bmc | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 3bmc | |||||||||||||||||||||
3bo5 | SETMR_HUMAN | Q53H47 | K11433 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 3bo5 | |||||||||||||||||||||
3bpr | MERTK_HUMAN | Q12866 | K05117 | Cytokine receptors | Receptor tyrosine kinase | RTK class IX (AXL receptor family) | MERTK, MER; c-mer proto-oncogene tyrosine kinase | Others | 3bpr | |||||||||||||||||||||
3bqm | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 3bqm | |||||||||||||||||||||
3bus | Q8KI52_NOCAE | Q8KI52 | KO_id not found | Others | Others | Others | Others | Others | 3bus | |||||||||||||||||||||
3bw2 | Q9FDD4_9ACTO | Q9FDD4 | KO_id not found | Others | Others | Others | Others | Others | 3bw2 | |||||||||||||||||||||
3bxr | POL_HV1A2 | P03369 | KO_id not found | Others | Others | Others | Others | Others | 3bxr | |||||||||||||||||||||
3bxs | POL_HV1A2 | P03369 | KO_id not found | Others | Others | Others | Others | Others | 3bxs | |||||||||||||||||||||
3bxx | P93799_VITVI | P93799 | KO_id not found | Others | Others | Others | Others | Others | 3bxx | |||||||||||||||||||||
3bys | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3bys | |||||||||||||||||||||
3bz8 | MYS2_DICDI | P08799 | K10352 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actin-binding proteins | Myosins | 3bz8 | |||||||||||||||||||||
3bzu | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3bzu | |||||||||||||||||||||
3c79 | Q8WSF8_APLCA | Q8WSF8 | KO_id not found | Others | Others | Others | Others | Others | 3c79 | |||||||||||||||||||||
3cb2 | TBG1_HUMAN | P23258 | K10389 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulins | TUBG; tubulin gamma | 3cb2 | |||||||||||||||||||||
3cds | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3cds | |||||||||||||||||||||
3cf6 | A2ASW3_MOUSE | A2ASW3 | KO_id not found | Others | Others | Others | Others | Others | 3cf6 | |||||||||||||||||||||
3cow | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3cow | |||||||||||||||||||||
3coy | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3coy | |||||||||||||||||||||
3coz | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3coz | |||||||||||||||||||||
3cpb | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3cpb | |||||||||||||||||||||
3cqe | WEE1_HUMAN | P30291 | K06632 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3cqe | |||||||||||||||||||||
3cw9 | Q8GN86_9BURK | Q8GN86 | KO_id not found | Others | Others | Others | Others | Others | 3cw9 | |||||||||||||||||||||
3cy3 | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3cy3 | |||||||||||||||||||||
3d14 | AURKA_MOUSE | P97477 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3d14 | |||||||||||||||||||||
3d15 | AURKA_MOUSE | P97477 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3d15 | |||||||||||||||||||||
3d28 | POLG_HCVBK | P26663 | KO_id not found | Others | Others | Others | Others | Others | 3d28 | |||||||||||||||||||||
3d2i | AURKA_MOUSE | P97477 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3d2i | |||||||||||||||||||||
3d2k | AURKA_MOUSE | P97477 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3d2k | |||||||||||||||||||||
3d2r | PDK4_HUMAN | Q16654 | K00898 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 3d2r | |||||||||||||||||||||
3d7k | Q9F4L3_PSEFL | Q9F4L3 | KO_id not found | Others | Others | Others | Others | Others | 3d7k | |||||||||||||||||||||
3d8w | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3d8w | |||||||||||||||||||||
3d9z | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3d9z | |||||||||||||||||||||
3da9 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3da9 | |||||||||||||||||||||
3dba | PDE6C_CHICK | P52731 | K13757 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3dba | |||||||||||||||||||||
3dbs | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3dbs | |||||||||||||||||||||
3dbu | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3dbu | |||||||||||||||||||||
3dcc | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3dcc | |||||||||||||||||||||
3dcj | P71554_MYCTU | P71554 | K11175 | Enzymes | Transferases | Transferring one-carbon groups | Hydroxymethyl-, formyl- and related transferases | Phosphoribosylglycinamide formyltransferase | 3dcj | |||||||||||||||||||||
3dcv | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3dcv | |||||||||||||||||||||
3ddu | PPCE_HUMAN | P48147 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3ddu | |||||||||||||||||||||
3dh7 | Q53W52_THET8 | Q53W52 | K01823 | Enzymes | Isomerases | Intramolecular oxidoreductases | Transposing C=C bonds | Isopentenyl-diphosphate Delta-isomerase | 3dh7 | |||||||||||||||||||||
3dhe | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 3dhe | |||||||||||||||||||||
3dhy | SAHH_MYCTU | P60176 | K01251 | Enzymes | Hydrolases | Acting on ether bonds | Thioether and trialkylsulfonium hydrolases | Adenosylhomocysteinase | 3dhy | |||||||||||||||||||||
3di6 | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3di6 | |||||||||||||||||||||
3djk | POL_HV1BR | P03367 | KO_id not found | Others | Others | Others | Others | Others | 3djk | |||||||||||||||||||||
3dk1 | POL_HV1BR | P03367 | KO_id not found | Others | Others | Others | Others | Others | 3dk1 | |||||||||||||||||||||
3dn5 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3dn5 | |||||||||||||||||||||
3dng | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 3dng | |||||||||||||||||||||
3dox | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3dox | |||||||||||||||||||||
3dpk | CSF1R_HUMAN | P07333 | K05090 | Cellular antigens | CD (clusters of differentiation) molecules | CD115; colony stimulating factor 1 receptor (macrophage) | Others | Others | 3dpk | |||||||||||||||||||||
3drw | K6PF_PYRHO | O59355 | K00850 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 6-phosphofructokinase | 3drw | |||||||||||||||||||||
3dsl | VM3BP_BOTJA | O93523 | KO_id not found | Others | Others | Others | Others | Others | 3dsl | |||||||||||||||||||||
3dtc | M3K9_HUMAN | P80192 | K04417 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase kinase kinase | 3dtc | |||||||||||||||||||||
3dv1 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3dv1 | |||||||||||||||||||||
3dxz | TRMB_ECOLI | P0A8I5 | K03439 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | TRNA (guanine46-N7)-methyltransferase | 3dxz | |||||||||||||||||||||
3dyl | PDE9A_HUMAN | O76083 | K13761 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3dyl | |||||||||||||||||||||
3dz4 | DCAM_HUMAN | P17707 | K01611 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Adenosylmethionine decarboxylase | 3dz4 | |||||||||||||||||||||
3dz6 | DCAM_HUMAN | P17707 | K01611 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Adenosylmethionine decarboxylase | 3dz6 | |||||||||||||||||||||
3dz7 | DCAM_HUMAN | P17707 | K01611 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Adenosylmethionine decarboxylase | 3dz7 | |||||||||||||||||||||
3e5a | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3e5a | |||||||||||||||||||||
3e6e | Q837J0_ENTFA | Q837J0 | K01775 | Enzymes | Isomerases | Racemases and epimerases | Acting on amino acids and derivatives | Alanine racemase | 3e6e | |||||||||||||||||||||
3e6n | NOS2_MOUSE | P29477 | K13241 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | With NADH or NADPH as one donor, and incorporation of one atom of oxygen into the other donor | Nitric-oxide synthase (NADPH dependent) | 3e6n | |||||||||||||||||||||
3e7v | HASP_HUMAN | Q8TF76 | K16315 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3e7v | |||||||||||||||||||||
3e8r | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3e8r | |||||||||||||||||||||
3e9z | Q9BMI9_SCHMA | Q9BMI9 | KO_id not found | Others | Others | Others | Others | Others | 3e9z | |||||||||||||||||||||
3edo | Q5FKC3_LACAC | Q5FKC3 | KO_id not found | Others | Others | Others | Others | Others | 3edo | |||||||||||||||||||||
3elz | Q6IMW5_DANRE | Q6IMW5 | KO_id not found | Others | Others | Others | Others | Others | 3elz | |||||||||||||||||||||
3ene | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ene | |||||||||||||||||||||
3eou | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 3eou | |||||||||||||||||||||
3eq7 | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3eq7 | |||||||||||||||||||||
3etn | Q5LIW1_BACFN | Q5LIW1 | K06041 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting aldoses and ketoses, and related compounds | Arabinose-5-phosphate isomerase | 3etn | |||||||||||||||||||||
3euf | UPP1_HUMAN | Q16831 | K00757 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Uridine phosphorylase | 3euf | |||||||||||||||||||||
3ewj | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3ewj | |||||||||||||||||||||
3ewr | R1A_CVH22 | P0C6U2 | KO_id not found | Others | Others | Others | Others | Others | 3ewr | |||||||||||||||||||||
3eyg | JAK1_HUMAN | P23458 | K11217 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3eyg | |||||||||||||||||||||
3f10 | Q97FM4_CLOAB | Q97FM4 | K03660 | Enzymes | Lyases | Carbon-oxygen lyases | Other carbon-oxygen lyases | DNA-(apurinic or apyrimidinic site) lyase | 3f10 | |||||||||||||||||||||
3f16 | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3f16 | |||||||||||||||||||||
3f1q | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3f1q | |||||||||||||||||||||
3f2v | Q73QT9_TREDE | Q73QT9 | KO_id not found | Others | Others | Others | Others | Others | 3f2v | |||||||||||||||||||||
3f3z | Q5CYL9_CRYPI | Q5CYL9 | K13412 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3f3z | |||||||||||||||||||||
3f4x | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3f4x | |||||||||||||||||||||
3f6r | FLAV_DESDE | P26492 | K05278 | Enzymes | Oxidoreductases | Acting on paired donors, with O2 as oxidant and incorporation or reduction of oxygen. The oxygen incorporated need not be derived from O2 | With 2-oxoglutarate as one donor, and incorporation of one atom of oxygen into each donor | Flavonol synthase | 3f6r | |||||||||||||||||||||
3f7b | CAH4_HUMAN | P22748 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3f7b | |||||||||||||||||||||
3f7o | Q01471_9HYPO | Q01471 | KO_id not found | Others | Others | Others | Others | Others | 3f7o | |||||||||||||||||||||
3f7z | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3f7z | |||||||||||||||||||||
3f88 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3f88 | |||||||||||||||||||||
3f8p | Q97W27_SULSO | Q97W27 | K00384 | Enzymes | Oxidoreductases | Acting on a sulfur group of donors | With NAD+ or NADP+ as acceptor | Thioredoxin-disulfide reductase | 3f8p | |||||||||||||||||||||
3f8w | Q9BMI9_SCHMA | Q9BMI9 | KO_id not found | Others | Others | Others | Others | Others | 3f8w | |||||||||||||||||||||
3faz | Q9BMI9_SCHMA | Q9BMI9 | KO_id not found | Others | Others | Others | Others | Others | 3faz | |||||||||||||||||||||
3fcf | UNG_HUMAN | P13051 | K03648 | DNA repair and recombination proteins | Prokaryotic Type | SSBR (single strand breaks repair) | BER (base exicision repair) | DNA glycosylases | 3fcf | |||||||||||||||||||||
3fci | UNG_HUMAN | P13051 | K03648 | DNA repair and recombination proteins | Prokaryotic Type | SSBR (single strand breaks repair) | BER (base exicision repair) | DNA glycosylases | 3fci | |||||||||||||||||||||
3fdn | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3fdn | |||||||||||||||||||||
3fh0 | A6T8F5_KLEP7 | A6T8F5 | KO_id not found | Others | Others | Others | Others | Others | 3fh0 | |||||||||||||||||||||
3fhx | PDXK_HUMAN | O00764 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 3fhx | |||||||||||||||||||||
3fi4 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fi4 | |||||||||||||||||||||
3fiu | Q2A4B6_FRATH | Q2A4B6 | K01916 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-ammonia (or amine) ligases (amide synthases) | NAD+ synthase | 3fiu | |||||||||||||||||||||
3fkl | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fkl | |||||||||||||||||||||
3fl8 | Q81R22_BACAN | Q81R22 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3fl8 | |||||||||||||||||||||
3fls | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fls | |||||||||||||||||||||
3flw | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3flw | |||||||||||||||||||||
3fly | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fly | |||||||||||||||||||||
3flz | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3flz | |||||||||||||||||||||
3fmh | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmh | |||||||||||||||||||||
3fmk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmk | |||||||||||||||||||||
3fml | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fml | |||||||||||||||||||||
3fmn | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmn | |||||||||||||||||||||
3frg | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3frg | |||||||||||||||||||||
3frq | Q9EVJ6_ECOLX | Q9EVJ6 | KO_id not found | Others | Others | Others | Others | Others | 3frq | |||||||||||||||||||||
3fsj | MDLC_PSEPU | P20906 | KO_id not found | Others | Others | Others | Others | Others | 3fsj | |||||||||||||||||||||
3fsk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fsk | |||||||||||||||||||||
3ftf | RSMA_AQUAE | O67680 | K02528 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 16S rRNA (adenine1518-N6-adenine1519-N6)-dimethyltransferase | 3ftf | |||||||||||||||||||||
3ftv | LKHA4_HUMAN | P09960 | K01254 | Enzymes | Hydrolases | Acting on ether bonds | Ether hydrolases | Leukotriene-A4 hydrolase | 3ftv | |||||||||||||||||||||
3fuj | LKHA4_HUMAN | P09960 | K01254 | Enzymes | Hydrolases | Acting on ether bonds | Ether hydrolases | Leukotriene-A4 hydrolase | 3fuj | |||||||||||||||||||||
3fuu | RSMA_THET8 | Q5SM60 | K02528 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 16S rRNA (adenine1518-N6-adenine1519-N6)-dimethyltransferase | 3fuu | |||||||||||||||||||||
3fuw | RSMA_THET8 | Q5SM60 | K02528 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 16S rRNA (adenine1518-N6-adenine1519-N6)-dimethyltransferase | 3fuw | |||||||||||||||||||||
3fxw | MAPK3_HUMAN | Q16644 | K04444 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3fxw | |||||||||||||||||||||
3fxx | EPHA3_HUMAN | P29320 | K05104 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 3fxx | |||||||||||||||||||||
3fzr | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fzr | |||||||||||||||||||||
3fzs | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fzs | |||||||||||||||||||||
3g0y | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3g0y | |||||||||||||||||||||
3g11 | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3g11 | |||||||||||||||||||||
3g3e | OXDA_HUMAN | P14920 | K00273 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With oxygen as acceptor | D-amino-acid oxidase | 3g3e | |||||||||||||||||||||
3g4k | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3g4k | |||||||||||||||||||||
3g5k | DEFM_HUMAN | Q9HBH1 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3g5k | |||||||||||||||||||||
3gc0 | A8BZ95_GIAIC | A8BZ95 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3gc0 | |||||||||||||||||||||
3gcq | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3gcq | |||||||||||||||||||||
3gcu | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3gcu | |||||||||||||||||||||
3gga | Q9Q2G8_9HIV1 | Q9Q2G8 | KO_id not found | Others | Others | Others | Others | Others | 3gga | |||||||||||||||||||||
3ggf | MST4_HUMAN | Q9P289 | K16314 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ggf | |||||||||||||||||||||
3gid | ACACB_HUMAN | O00763 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 3gid | |||||||||||||||||||||
3gie | DESK_BACSU | O34757 | K07778 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3gie | |||||||||||||||||||||
3gko | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3gko | |||||||||||||||||||||
3glv | RIBL_THEVO | Q979C2 | KO_id not found | Others | Others | Others | Others | Others | 3glv | |||||||||||||||||||||
3gn8 | NCOA2_HUMAN | Q15596 | KO_id not found | Others | Others | Others | Others | Others | 3gn8 | |||||||||||||||||||||
3gob | Q5S3I3_STEMA | Q5S3I3 | KO_id not found | Others | Others | Others | Others | Others | 3gob | |||||||||||||||||||||
3grr | RSMA_METJA | Q58435 | K02528 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 16S rRNA (adenine1518-N6-adenine1519-N6)-dimethyltransferase | 3grr | |||||||||||||||||||||
3grv | RSMA_METJA | Q58435 | K02528 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 16S rRNA (adenine1518-N6-adenine1519-N6)-dimethyltransferase | 3grv | |||||||||||||||||||||
3gsi | Q9AGP8_ARTGO | Q9AGP8 | KO_id not found | Others | Others | Others | Others | Others | 3gsi | |||||||||||||||||||||
3gvi | MDH_BRUA2 | Q2YLR9 | K00024 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Malate dehydrogenase | 3gvi | |||||||||||||||||||||
3gx9 | Q51990_PSEPU | Q51990 | KO_id not found | Others | Others | Others | Others | Others | 3gx9 | |||||||||||||||||||||
3gy9 | B1YEL6_EXIS2 | B1YEL6 | KO_id not found | Others | Others | Others | Others | Others | 3gy9 | |||||||||||||||||||||
3gye | Q4QEW7_LEIMA | Q4QEW7 | K00226 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With other, known, acceptors | Dihydroorotate dehydrogenase (fumarate) | 3gye | |||||||||||||||||||||
3h0b | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3h0b | |||||||||||||||||||||
3h0w | DCAM_HUMAN | P17707 | K01611 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Adenosylmethionine decarboxylase | 3h0w | |||||||||||||||||||||
3h0z | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3h0z | |||||||||||||||||||||
3h1q | Q3AE93_CARHZ | Q3AE93 | KO_id not found | Others | Others | Others | Others | Others | 3h1q | |||||||||||||||||||||
3h1v | HXK4_HUMAN | P35557 | K12407 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Glucokinase | 3h1v | |||||||||||||||||||||
3h23 | B1UXN2_BACAN | B1UXN2 | KO_id not found | Others | Others | Others | Others | Others | 3h23 | |||||||||||||||||||||
3h24 | B1UXN2_BACAN | B1UXN2 | KO_id not found | Others | Others | Others | Others | Others | 3h24 | |||||||||||||||||||||
3h2a | B1UXN2_BACAN | B1UXN2 | KO_id not found | Others | Others | Others | Others | Others | 3h2a | |||||||||||||||||||||
3h2n | B1UXN2_BACAN | B1UXN2 | KO_id not found | Others | Others | Others | Others | Others | 3h2n | |||||||||||||||||||||
3h2y | Q81LQ0_BACAN | Q81LQ0 | KO_id not found | Others | Others | Others | Others | Others | 3h2y | |||||||||||||||||||||
3h3c | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3h3c | |||||||||||||||||||||
3h3q | C43BP_HUMAN | Q9Y5P4 | K08283 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Goodpasture-antigen-binding protein kinase | 3h3q | |||||||||||||||||||||
3h3r | C43BP_HUMAN | Q9Y5P4 | K08283 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Goodpasture-antigen-binding protein kinase | 3h3r | |||||||||||||||||||||
3h4t | P96558_AMYOR | P96558 | KO_id not found | Others | Others | Others | Others | Others | 3h4t | |||||||||||||||||||||
3h5b | POL_HV1BR | P03367 | KO_id not found | Others | Others | Others | Others | Others | 3h5b | |||||||||||||||||||||
3h65 | HMD_METJA | Q58194 | K13942 | Enzymes | Oxidoreductases | Acting on hydrogen as donor | With other, known, acceptors | 5,10-methenyltetrahydromethanopterin hydrogenase | 3h65 | |||||||||||||||||||||
3h6l | SETD2_HUMAN | Q9BYW2 | K11423 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 3h6l | |||||||||||||||||||||
3h6v | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3h6v | |||||||||||||||||||||
3h9o | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3h9o | |||||||||||||||||||||
3ha6 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ha6 | |||||||||||||||||||||
3hbn | PSEG_CAMJE | Q0P8U5 | K15897 | Enzymes | Hydrolases | Acting on acid anhydrides | In phosphorus-containing anhydrides | UDP-2,4-diacetamido-2,4,6-trideoxy-beta-L-altropyranose hydrolase | 3hbn | |||||||||||||||||||||
3hdh | HCDH_PIG | P00348 | K00022 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3-hydroxyacyl-CoA dehydrogenase | 3hdh | |||||||||||||||||||||
3hfw | ADPRH_HUMAN | P54922 | K01245 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | [protein ADP-ribosylarginine] hydrolase | 3hfw | |||||||||||||||||||||
3hgy | Q7B8P6_CAMJU | Q7B8P6 | KO_id not found | Others | Others | Others | Others | Others | 3hgy | |||||||||||||||||||||
3hku | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3hku | |||||||||||||||||||||
3hlj | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3hlj | |||||||||||||||||||||
3hlv | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3hlv | |||||||||||||||||||||
3hmi | ABL2_HUMAN | P42684 | K08887 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3hmi | |||||||||||||||||||||
3hnz | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3hnz | |||||||||||||||||||||
3ho2 | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3ho2 | |||||||||||||||||||||
3ho9 | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3ho9 | |||||||||||||||||||||
3hs4 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3hs4 | |||||||||||||||||||||
3hth | Q79SH7_STRLI | Q79SH7 | KO_id not found | Others | Others | Others | Others | Others | 3hth | |||||||||||||||||||||
3huc | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3huc | |||||||||||||||||||||
3hv6 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3hv6 | |||||||||||||||||||||
3hv7 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3hv7 | |||||||||||||||||||||
3hvh | COMT_RAT | P22734 | K00545 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Catechol O-methyltransferase | 3hvh | |||||||||||||||||||||
3i0r | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3i0r | |||||||||||||||||||||
3i1l | Q70KP4_9NIDO | Q70KP4 | KO_id not found | Others | Others | Others | Others | Others | 3i1l | |||||||||||||||||||||
3i28 | HYES_HUMAN | P34913 | K08726 | Enzymes | Hydrolases | Acting on ether bonds | Ether hydrolases | Soluble epoxide hydrolase | 3i28 | |||||||||||||||||||||
3i4b | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3i4b | |||||||||||||||||||||
3i52 | Q4W2K4_VITVI | Q4W2K4 | KO_id not found | Others | Others | Others | Others | Others | 3i52 | |||||||||||||||||||||
3i6r | PYRD_PLAF7 | Q08210 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3i6r | |||||||||||||||||||||
3i73 | VATA_PYRHO | O57728 | K02117 | Enzymes | Hydrolases | Acting on acid anhydrides | Acting on acid anhydrides to catalyse transmembrane movement of substances | H+-transporting two-sector ATPase | 3i73 | |||||||||||||||||||||
3i8p | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3i8p | |||||||||||||||||||||
3i9l | NADA_APLCA | P29241 | K03517 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Quinolinate synthase | 3i9l | |||||||||||||||||||||
3iaa | Q8KNE0_MICEC | Q8KNE0 | KO_id not found | Others | Others | Others | Others | Others | 3iaa | |||||||||||||||||||||
3iad | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3iad | |||||||||||||||||||||
3iai | CAH9_HUMAN | Q16790 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3iai | |||||||||||||||||||||
3iar | ADA_HUMAN | P00813 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 3iar | |||||||||||||||||||||
3iem | RNSE_THET8 | Q5SLP1 | KO_id not found | Others | Others | Others | Others | Others | 3iem | |||||||||||||||||||||
3iex | Q9BMI9_SCHMA | Q9BMI9 | KO_id not found | Others | Others | Others | Others | Others | 3iex | |||||||||||||||||||||
3ig7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3ig7 | |||||||||||||||||||||
3igg | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3igg | |||||||||||||||||||||
3ihg | Q54530_9ACTO | Q54530 | KO_id not found | Others | Others | Others | Others | Others | 3ihg | |||||||||||||||||||||
3ij8 | AMYP_HUMAN | P04746 | K01176 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Alpha-amylase | 3ij8 | |||||||||||||||||||||
3ik6 | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3ik6 | |||||||||||||||||||||
3ilt | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3ilt | |||||||||||||||||||||
3ilu | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3ilu | |||||||||||||||||||||
3in3 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3in3 | |||||||||||||||||||||
3in4 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3in4 | |||||||||||||||||||||
3inj | ALDH2_HUMAN | P05091 | K00128 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Aldehyde dehydrogenase (NAD+) | 3inj | |||||||||||||||||||||
3inn | PANC_BRUME | Q8YFC9 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3inn | |||||||||||||||||||||
3iob | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3iob | |||||||||||||||||||||
3ioe | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3ioe | |||||||||||||||||||||
3iom | PUNA_MYCTU | P0A538 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3iom | |||||||||||||||||||||
3ioq | Q84XA1_CARCN | Q84XA1 | KO_id not found | Others | Others | Others | Others | Others | 3ioq | |||||||||||||||||||||
3ip8 | AMDA_BORBO | Q05115 | KO_id not found | Others | Others | Others | Others | Others | 3ip8 | |||||||||||||||||||||
3iq7 | HASP_HUMAN | Q8TF76 | K16315 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3iq7 | |||||||||||||||||||||
3itl | Q75WH8_PSEST | Q75WH8 | KO_id not found | Others | Others | Others | Others | Others | 3itl | |||||||||||||||||||||
3iu9 | AMPM2_MYCTU | P0A5J2 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 3iu9 | |||||||||||||||||||||
3ivm | Q9X6R4_AERPU | Q9X6R4 | KO_id not found | Others | Others | Others | Others | Others | 3ivm | |||||||||||||||||||||
3iwj | Q93YB2_PEA | Q93YB2 | KO_id not found | Others | Others | Others | Others | Others | 3iwj | |||||||||||||||||||||
3jq6 | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jq6 | |||||||||||||||||||||
3jq7 | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jq7 | |||||||||||||||||||||
3jq8 | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jq8 | |||||||||||||||||||||
3jq9 | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jq9 | |||||||||||||||||||||
3jqa | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jqa | |||||||||||||||||||||
3jqb | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jqb | |||||||||||||||||||||
3jqc | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jqc | |||||||||||||||||||||
3jqd | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jqd | |||||||||||||||||||||
3jqe | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jqe | |||||||||||||||||||||
3jqg | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jqg | |||||||||||||||||||||
3jsu | A7UD79_PLAFA | A7UD79 | KO_id not found | Others | Others | Others | Others | Others | 3jsu | |||||||||||||||||||||
3jsx | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 3jsx | |||||||||||||||||||||
3jtk | NMT1_HUMAN | P30419 | K00671 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Glycylpeptide N-tetradecanoyltransferase | 3jtk | |||||||||||||||||||||
3k24 | CATL1_HUMAN | P07711 | K01365 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Cysteine endopeptidases | Cathepsin L | 3k24 | |||||||||||||||||||||
3k2f | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3k2f | |||||||||||||||||||||
3k31 | Q2GKM8_ANAPZ | Q2GKM8 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 3k31 | |||||||||||||||||||||
3k3j | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3k3j | |||||||||||||||||||||
3k4l | Q7ZA32_TRAOC | Q7ZA32 | KO_id not found | Others | Others | Others | Others | Others | 3k4l | |||||||||||||||||||||
3k6b | A4_CAEEL | Q10651 | K04520 | Heparan sulfate-heparin binding proteins | Others | APP; amyloid beta A4 proteinPlaque formation | Others | Others | 3k6b | |||||||||||||||||||||
3k6l | DEF_ECOLI | P0A6K3 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3k6l | |||||||||||||||||||||
3k73 | G3P1_STAAR | Q6GIL8 | K00134 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 3k73 | |||||||||||||||||||||
3k8q | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3k8q | |||||||||||||||||||||
3k8t | RIR1_YEAST | P21524 | K10807 | DNA repair and recombination proteins | Eukaryotic Type | Other factors with a suspected DNA repair function | Modulation of nucleotide pools | RRM1; ribonucleoside-diphosphate reductase subunit M1 | 3k8t | |||||||||||||||||||||
3kb8 | C3P9L0_BACAA | C3P9L0 | K00760 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Hypoxanthine phosphoribosyltransferase | 3kb8 | |||||||||||||||||||||
3kdb | POL_HV1BR | P03367 | KO_id not found | Others | Others | Others | Others | Others | 3kdb | |||||||||||||||||||||
3kdc | POL_HV1BR | P03367 | KO_id not found | Others | Others | Others | Others | Others | 3kdc | |||||||||||||||||||||
3kdd | POL_HV1BR | P03367 | KO_id not found | Others | Others | Others | Others | Others | 3kdd | |||||||||||||||||||||
3kfy | DYR_ECOLI | P0ABQ4 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3kfy | |||||||||||||||||||||
3kgc | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3kgc | |||||||||||||||||||||
3ki3 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki3 | |||||||||||||||||||||
3ki4 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki4 | |||||||||||||||||||||
3ki5 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki5 | |||||||||||||||||||||
3ki6 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki6 | |||||||||||||||||||||
3kig | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3kig | |||||||||||||||||||||
3kk6 | PGH1_SHEEP | P05979 | K00509 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 3kk6 | |||||||||||||||||||||
3km8 | ADA_MOUSE | P03958 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 3km8 | |||||||||||||||||||||
3kmc | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3kmc | |||||||||||||||||||||
3kme | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3kme | |||||||||||||||||||||
3kn0 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3kn0 | |||||||||||||||||||||
3kne | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3kne | |||||||||||||||||||||
3ko5 | Q8IIS0_PLAF7 | Q8IIS0 | KO_id not found | Others | Others | Others | Others | Others | 3ko5 | |||||||||||||||||||||
3kti | CLPP_BACSU | P80244 | K01358 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Endopeptidase Clp | 3kti | |||||||||||||||||||||
3ku2 | Q9BJF5_TOXGO | Q9BJF5 | KO_id not found | Others | Others | Others | Others | Others | 3ku2 | |||||||||||||||||||||
3kzb | Q7NWW7_CHRVO | Q7NWW7 | K00854 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Xylulokinase | 3kzb | |||||||||||||||||||||
3l03 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3l03 | |||||||||||||||||||||
3l0v | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3l0v | |||||||||||||||||||||
3l14 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3l14 | |||||||||||||||||||||
3l16 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l16 | |||||||||||||||||||||
3l17 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l17 | |||||||||||||||||||||
3l30 | PA21B_PIG | P00592 | K01047 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Phospholipase A2 | 3l30 | |||||||||||||||||||||
3l3l | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3l3l | |||||||||||||||||||||
3l5c | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3l5c | |||||||||||||||||||||
3l5d | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3l5d | |||||||||||||||||||||
3l5f | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3l5f | |||||||||||||||||||||
3l5r | MIF_HUMAN | P14174 | K07253 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting keto- and enol-groups | Phenylpyruvate tautomerase | 3l5r | |||||||||||||||||||||
3l5u | MIF_HUMAN | P14174 | K07253 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting keto- and enol-groups | Phenylpyruvate tautomerase | 3l5u | |||||||||||||||||||||
3l8w | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3l8w | |||||||||||||||||||||
3lal | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3lal | |||||||||||||||||||||
3lcc | HOL1_ARATH | Q0WP12 | KO_id not found | Others | Others | Others | Others | Others | 3lcc | |||||||||||||||||||||
3ld4 | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3ld4 | |||||||||||||||||||||
3ldr | Q1W3Z7_ASPJA | Q1W3Z7 | KO_id not found | Others | Others | Others | Others | Others | 3ldr | |||||||||||||||||||||
3le9 | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3le9 | |||||||||||||||||||||
3lfb | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3lfb | |||||||||||||||||||||
3lfn | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3lfn | |||||||||||||||||||||
3lfs | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3lfs | |||||||||||||||||||||
3lhh | Q8EDE1_SHEON | Q8EDE1 | K03699 | Bacterial toxins | Type II toxins- Membrane damaging toxins | Pore-forming toxins, Other | K03699 tlyC; putative hemolysin | Others | 3lhh | |||||||||||||||||||||
3lin | Q82134_9DELA | Q82134 | KO_id not found | Others | Others | Others | Others | Others | 3lin | |||||||||||||||||||||
3lix | Q82134_9DELA | Q82134 | KO_id not found | Others | Others | Others | Others | Others | 3lix | |||||||||||||||||||||
3ljg | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3ljg | |||||||||||||||||||||
3lk8 | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3lk8 | |||||||||||||||||||||
3lka | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3lka | |||||||||||||||||||||
3lkh | POLG_HCVJ4 | O92972 | KO_id not found | Others | Others | Others | Others | Others | 3lkh | |||||||||||||||||||||
3lm0 | ST17B_HUMAN | O94768 | K08804 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3lm0 | |||||||||||||||||||||
3lm5 | ST17B_HUMAN | O94768 | K08804 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3lm5 | |||||||||||||||||||||
3lnv | Q5ZTD3_LEGPH | Q5ZTD3 | KO_id not found | Others | Others | Others | Others | Others | 3lnv | |||||||||||||||||||||
3lu8 | ALBU_HUMAN | P02768 | KO_id not found | Others | Others | Others | Others | Others | 3lu8 | |||||||||||||||||||||
3lxe | CAH1_HUMAN | P00915 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3lxe | |||||||||||||||||||||
3lxg | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3lxg | |||||||||||||||||||||
3lzu | Q9QB59_9HIV1 | Q9QB59 | KO_id not found | Others | Others | Others | Others | Others | 3lzu | |||||||||||||||||||||
3m04 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m04 | |||||||||||||||||||||
3m14 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m14 | |||||||||||||||||||||
3m2p | Q814Z6_BACCR | Q814Z6 | KO_id not found | Others | Others | Others | Others | Others | 3m2p | |||||||||||||||||||||
3m2w | MAPK2_HUMAN | P49137 | K04443 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3m2w | |||||||||||||||||||||
3m2x | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m2x | |||||||||||||||||||||
3m3l | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3m3l | |||||||||||||||||||||
3m42 | MAPK2_HUMAN | P49137 | K04443 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3m42 | |||||||||||||||||||||
3m67 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m67 | |||||||||||||||||||||
3m7u | PRLA_LYSEN | P00778 | KO_id not found | Others | Others | Others | Others | Others | 3m7u | |||||||||||||||||||||
3m8q | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3m8q | |||||||||||||||||||||
3m96 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m96 | |||||||||||||||||||||
3m98 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m98 | |||||||||||||||||||||
3mc5 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3mc5 | |||||||||||||||||||||
3mcv | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 3mcv | |||||||||||||||||||||
3mcy | Q9S497_ECOLX | Q9S497 | KO_id not found | Others | Others | Others | Others | Others | 3mcy | |||||||||||||||||||||
3mdz | CAH7_HUMAN | P43166 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3mdz | |||||||||||||||||||||
3mg5 | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 3mg5 | |||||||||||||||||||||
3mhc | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3mhc | |||||||||||||||||||||
3mhj | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3mhj | |||||||||||||||||||||
3mhk | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3mhk | |||||||||||||||||||||
3mjw | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3mjw | |||||||||||||||||||||
3ml5 | CAH7_HUMAN | P43166 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3ml5 | |||||||||||||||||||||
3ml8 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ml8 | |||||||||||||||||||||
3mnp | GCR_MOUSE | P06537 | K05771 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C1, GR; glucocorticoid receptor | Others | 3mnp | |||||||||||||||||||||
3ms2 | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 3ms2 | |||||||||||||||||||||
3ms4 | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 3ms4 | |||||||||||||||||||||
3msl | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3msl | |||||||||||||||||||||
3mt7 | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 3mt7 | |||||||||||||||||||||
3mt8 | PYGM_RABIT | P00489 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 3mt8 | |||||||||||||||||||||
3mtl | CDK16_HUMAN | Q00536 | K08820 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3mtl | |||||||||||||||||||||
3myq | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3myq | |||||||||||||||||||||
3mz6 | HDAC8_HUMAN | Q9BY41 | K11405 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Histone deacetylase | 3mz6 | |||||||||||||||||||||
3n1s | HINT_ECOLI | P0ACE7 | KO_id not found | Others | Others | Others | Others | Others | 3n1s | |||||||||||||||||||||
3n2u | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3n2u | |||||||||||||||||||||
3n3i | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3n3i | |||||||||||||||||||||
3n4k | TRML_YERPE | Q74Y93 | K03216 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | TRNA (cytidine34-2'-O)-methyltransferase | 3n4k | |||||||||||||||||||||
3n83 | ALDH2_HUMAN | P05091 | K00128 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Aldehyde dehydrogenase (NAD+) | 3n83 | |||||||||||||||||||||
3ncg | A3FQ16_CRYPI | A3FQ16 | K13412 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ncg | |||||||||||||||||||||
3nd1 | O68102_RHOCA | O68102 | K02228 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Precorrin-6A synthase (deacetylating) | 3nd1 | |||||||||||||||||||||
3nd7 | COAD_ENTFA | Q831P9 | K00954 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Pantetheine-phosphate adenylyltransferase | 3nd7 | |||||||||||||||||||||
3ndc | COBM_RHOCB | O68100 | K05936 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Precorrin-4 C11-methyltransferase | 3ndc | |||||||||||||||||||||
3nef | PYL1_ARATH | Q8VZS8 | KO_id not found | Others | Others | Others | Others | Others | 3nef | |||||||||||||||||||||
3nf6 | Q76353_9HIV1 | Q76353 | KO_id not found | Others | Others | Others | Others | Others | 3nf6 | |||||||||||||||||||||
3ngn | CNO6L_HUMAN | Q96LI5 | KO_id not found | Others | Others | Others | Others | Others | 3ngn | |||||||||||||||||||||
3ni5 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3ni5 | |||||||||||||||||||||
3njo | PYR1_ARATH | O49686 | K11540 | Enzymes | Transferases | Transferring one-carbon groups | Carboxy- and carbamoyltransferases | Aspartate carbamoyltransferase | 3njo | |||||||||||||||||||||
3nls | POL_HV1BR | P03367 | KO_id not found | Others | Others | Others | Others | Others | 3nls | |||||||||||||||||||||
3nmh | PYL2_ARATH | O80992 | KO_id not found | Others | Others | Others | Others | Others | 3nmh | |||||||||||||||||||||
3ns9 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3ns9 | |||||||||||||||||||||
3nun | Q9UPJ8_HUMAN | Q9UPJ8 | KO_id not found | Others | Others | Others | Others | Others | 3nun | |||||||||||||||||||||
3nut | O68097_RHOCA | O68097 | K05934 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Precorrin-3B C17-methyltransferase | 3nut | |||||||||||||||||||||
3nvw | XDH_BOVIN | P80457 | K00106 | Enzymes | Oxidoreductases | Acting on CH or CH2 groups | With oxygen as acceptor | Xanthine oxidase | 3nvw | |||||||||||||||||||||
3nwb | COMT_RAT | P22734 | K00545 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Catechol O-methyltransferase | 3nwb | |||||||||||||||||||||
3nxt | DYR_HUMAN | P00374 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3nxt | |||||||||||||||||||||
3ny6 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ny6 | |||||||||||||||||||||
3nyn | GRK6_HUMAN | P43250 | K08291 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | G-protein-coupled receptor kinase | 3nyn | |||||||||||||||||||||
3nzi | HTRA1_HUMAN | Q92743 | K08784 | Chaperones and folding catalysts | Other chaperones and cochaperones | DegP - HtrA | HTRA1, PRSS11; HtrA serine peptidase 1 Cytoplasm | Others | 3nzi | |||||||||||||||||||||
3nzt | Q5NHS8_FRATT | Q5NHS8 | K01919 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Glutamate---cysteine ligase | 3nzt | |||||||||||||||||||||
3nzu | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3nzu | |||||||||||||||||||||
3o0g | CDK5_HUMAN | Q00535 | K02090 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3o0g | |||||||||||||||||||||
3o1x | HINT1_RABIT | P80912 | KO_id not found | Others | Others | Others | Others | Others | 3o1x | |||||||||||||||||||||
3o56 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3o56 | |||||||||||||||||||||
3o64 | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3o64 | |||||||||||||||||||||
3o6d | PDXJ_CAMJE | Q9PN59 | K03474 | Enzymes | Transferases | Transferring nitrogenous groups | Transferring other nitrogenous groups | Pyridoxine 5'-phosphate synthase | 3o6d | |||||||||||||||||||||
3o82 | B2HVG8_ACIBC | B2HVG8 | K02363 | Polyketide biosynthesis proteins | Nonribosomal peptide synthetase (NRPS) | Iterative NRPS | Enterobactin synthetase | Peptide arylation enzyme | 3o82 | 405416 | ||||||||||||||||||||
3oaw | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3oaw | |||||||||||||||||||||
3od0 | KGP1_HUMAN | Q13976 | K07376 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CGMP-dependent protein kinase | 3od0 | |||||||||||||||||||||
3of1 | KAPR_YEAST | P07278 | K04739 | Others | Organismal Systems | Endocrine system | Insulin signaling pathway | PRKAR; cAMP-dependent protein kinase regulator | 3of1 | |||||||||||||||||||||
3ogs | Q70SY0_HYPJE | Q70SY0 | KO_id not found | Others | Others | Others | Others | Others | 3ogs | |||||||||||||||||||||
3ogv | Q70SY0_HYPJE | Q70SY0 | KO_id not found | Others | Others | Others | Others | Others | 3ogv | |||||||||||||||||||||
3ohl | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 3ohl | |||||||||||||||||||||
3oho | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 3oho | |||||||||||||||||||||
3oik | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oik | |||||||||||||||||||||
3oil | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oil | |||||||||||||||||||||
3oix | Q8DVA1_STRMU | Q8DVA1 | K00226 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With other, known, acceptors | Dihydroorotate dehydrogenase (fumarate) | 3oix | |||||||||||||||||||||
3ojl | P95708_STAAU | P95708 | KO_id not found | Others | Others | Others | Others | Others | 3ojl | |||||||||||||||||||||
3okv | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3okv | |||||||||||||||||||||
3omo | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 3omo | |||||||||||||||||||||
3omp | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 3omp | |||||||||||||||||||||
3ooi | NSD1_HUMAN | Q96L73 | K15588 | Chromosome | Eukaryotic Type | Histone modification proteins | HMTs (histone methyltransferases) | HKMTs (histone lysine methyltransferases) | 3ooi | |||||||||||||||||||||
3orf | DHPR_DICDI | Q86A17 | K00357 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | 6,7-dihydropteridine reductase | 3orf | |||||||||||||||||||||
3osh | PA2A3_NAJSG | P60045 | KO_id not found | Others | Others | Others | Others | Others | 3osh | |||||||||||||||||||||
3otg | Q8KNF2_MICEC | Q8KNF2 | KO_id not found | Others | Others | Others | Others | Others | 3otg | |||||||||||||||||||||
3oti | Q8KND7_MICEC | Q8KND7 | KO_id not found | Others | Others | Others | Others | Others | 3oti | |||||||||||||||||||||
3ou2 | D7PC21_9ACTO | D7PC21 | KO_id not found | Others | Others | Others | Others | Others | 3ou2 | |||||||||||||||||||||
3ou6 | D7PC21_9ACTO | D7PC21 | KO_id not found | Others | Others | Others | Others | Others | 3ou6 | |||||||||||||||||||||
3ox1 | NQO2_HUMAN | P16083 | K08071 | Enzymes | Oxidoreductases | Acting on diphenols and related substances as donors | With other acceptors | Ribosyldihydronicotinamide dehydrogenase (quinone) | 3ox1 | |||||||||||||||||||||
3oxf | SMYD3_HUMAN | Q9H7B4 | K11426 | Chromosome | Eukaryotic Type | Histone modification proteins | HMTs (histone methyltransferases) | SMYD; SET and MYND domain-containing protein | 3oxf | |||||||||||||||||||||
3oy4 | POL_HV1A2 | P03369 | KO_id not found | Others | Others | Others | Others | Others | 3oy4 | |||||||||||||||||||||
3ozo | Q06GJ0_OSTFU | Q06GJ0 | KO_id not found | Others | Others | Others | Others | Others | 3ozo | |||||||||||||||||||||
3ozp | Q06GJ0_OSTFU | Q06GJ0 | KO_id not found | Others | Others | Others | Others | Others | 3ozp | |||||||||||||||||||||
3p0e | UPP2_HUMAN | O95045 | K00757 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Uridine phosphorylase | 3p0e | |||||||||||||||||||||
3p17 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3p17 | |||||||||||||||||||||
3p1f | CBP_HUMAN | Q92793 | K04498 | Chromosome | Eukaryotic Type | Histone modification proteins | HATs (histone acetyltransferases) | EP300, CREBBP, KAT3; E1A-CREB-binding protein | 3p1f | |||||||||||||||||||||
3p25 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3p25 | |||||||||||||||||||||
3p2v | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3p2v | |||||||||||||||||||||
3p4v | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3p4v | |||||||||||||||||||||
3p86 | CTR1_ARATH | Q05609 | K14510 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3p86 | |||||||||||||||||||||
3pbb | QPCT_HUMAN | Q16769 | K00683 | Enzymes | Transferases | Acyltransferases | Aminoacyltransferases | Glutaminyl-peptide cyclotransferase | 3pbb | |||||||||||||||||||||
3pd5 | SYT_PYRAB | Q9UZ14 | K01868 | Enzymes | Ligases | Forming carbon-oxygen bonds | Ligases forming aminoacyl-tRNA and related compounds | Threonine---tRNA ligase | 3pd5 | |||||||||||||||||||||
3pdc | HYES_HUMAN | P34913 | K08726 | Enzymes | Hydrolases | Acting on ether bonds | Ether hydrolases | Soluble epoxide hydrolase | 3pdc | |||||||||||||||||||||
3pej | Q8I0V4_PLAF7 | Q8I0V4 | KO_id not found | Others | Others | Others | Others | Others | 3pej | |||||||||||||||||||||
3phb | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3phb | |||||||||||||||||||||
3pkb | AMPM2_MYCTU | P0A5J2 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 3pkb | |||||||||||||||||||||
3pkc | AMPM2_MYCTU | P0A5J2 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 3pkc | |||||||||||||||||||||
3pkd | AMPM2_MYCTU | P0A5J2 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 3pkd | |||||||||||||||||||||
3pkg | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3pkg | |||||||||||||||||||||
3plr | C4XAX5_KLEPN | C4XAX5 | K00012 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | UDP-glucose 6-dehydrogenase | 3plr | |||||||||||||||||||||
3pm1 | QACR_STAAM | P0A0N3 | KO_id not found | Others | Others | Others | Others | Others | 3pm1 | |||||||||||||||||||||
3pn1 | DNLJ_HAEIN | P43813 | K01972 | Enzymes | Ligases | Forming phosphoric-ester bonds | Ligases that form phosphoric-ester bonds (only sub-subclass identified to date) | DNA ligase (NAD+) | 3pn1 | |||||||||||||||||||||
3pn4 | DEF1B_ARATH | Q9FUZ2 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3pn4 | |||||||||||||||||||||
3png | NOS1_RAT | P29476 | K13240 | Enzymes | Oxidoreductases | Acting on paired donors, with O2 as oxidant and incorporation or reduction of oxygen. The oxygen incorporated need not be derived from O2 | With NADH or NADPH as one donor, and incorporation of one atom of oxygen into the other donor | Nitric-oxide synthase | 3png | |||||||||||||||||||||
3pnh | NOS3_BOVIN | P29473 | K13242 | Enzymes | Oxidoreductases | Acting on paired donors, with O2 as oxidant and incorporation or reduction of oxygen. The oxygen incorporated need not be derived from O2 | With NADH or NADPH as one donor, and incorporation of one atom of oxygen into the other donor | Nitric-oxide synthase | 3pnh | |||||||||||||||||||||
3pnl | DHAK_ECOLI | P76015 | K05878 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | - | 3pnl | |||||||||||||||||||||
3po6 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3po6 | |||||||||||||||||||||
3po7 | AOFB_HUMAN | P27338 | K00274 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With oxygen as acceptor | Monoamine oxidase | 3po7 | |||||||||||||||||||||
3poo | KAPCA_HUMAN | P17612 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 3poo | |||||||||||||||||||||
3pre | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3pre | |||||||||||||||||||||
3prz | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3prz | |||||||||||||||||||||
3ps6 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ps6 | |||||||||||||||||||||
3ptq | Q01KB2_ORYSA | Q01KB2 | KO_id not found | Others | Others | Others | Others | Others | 3ptq | |||||||||||||||||||||
3pxy | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3pxy | |||||||||||||||||||||
3pye | ISPE_MYCTU | P65178 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 3pye | |||||||||||||||||||||
3pz1 | PGTA_MOUSE | Q9JHK4 | K14050 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Protein geranylgeranyltransferase type II | 3pz1 | |||||||||||||||||||||
3q2f | BAZ2B_HUMAN | Q9UIF8 | KO_id not found | Others | Others | Others | Others | Others | 3q2f | |||||||||||||||||||||
3q2m | O06916_LEGPN | O06916 | KO_id not found | Others | Others | Others | Others | Others | 3q2m | |||||||||||||||||||||
3q4t | AVR2A_HUMAN | P27037 | K04670 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Receptor protein serine-threonine kinase | 3q4t | |||||||||||||||||||||
3q6w | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3q6w | |||||||||||||||||||||
3q70 | CARP2_CANAL | P0DJ06 | K06005 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Candidapepsin | 3q70 | |||||||||||||||||||||
3q71 | PAR14_HUMAN | Q460N5 | K15261 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3q71 | |||||||||||||||||||||
3qak | AA2AR_HUMAN | P29274 | K04266 | G protein-coupled receptors | Class A. Rhodopsin family | Base and nucleoside | Adenosine | ADORA2A; adenosine receptor A2a | 3qak | |||||||||||||||||||||
3qar | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3qar | |||||||||||||||||||||
3qbc | Q99W87_STAAM | Q99W87 | K00950 | Enzymes | Transferases | Transferring phosphorus-containing groups | Diphosphotransferases | 2-amino-4-hydroxy-6-hydroxymethyldihydropteridine diphosphokinase | 3qbc | |||||||||||||||||||||
3qbw | ANMK_PSEAE | Q9I5Q5 | K09001 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Anhydro-N-acetylmuramic acid kinase | 3qbw | |||||||||||||||||||||
3qcq | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3qcq | |||||||||||||||||||||
3qcs | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3qcs | |||||||||||||||||||||
3qcx | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3qcx | |||||||||||||||||||||
3qcy | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3qcy | |||||||||||||||||||||
3qd0 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3qd0 | |||||||||||||||||||||
3qfv | Q86XZ8_HUMAN | Q86XZ8 | K16307 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3qfv | |||||||||||||||||||||
3qfx | DRTS_TRYBB | Q27783 | KO_id not found | Others | Others | Others | Others | Others | 3qfx | |||||||||||||||||||||
3qgz | HINT1_RABIT | P80912 | KO_id not found | Others | Others | Others | Others | Others | 3qgz | |||||||||||||||||||||
3qk0 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3qk0 | |||||||||||||||||||||
3qp2 | D3W065_CHRVL | D3W065 | KO_id not found | Others | Others | Others | Others | Others | 3qp2 | |||||||||||||||||||||
3qqg | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qqg | |||||||||||||||||||||
3qqh | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qqh | |||||||||||||||||||||
3qqj | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qqj | |||||||||||||||||||||
3qqp | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3qqp | |||||||||||||||||||||
3qrt | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qrt | |||||||||||||||||||||
3qru | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qru | |||||||||||||||||||||
3qsa | TRPD_MYCTU | P66992 | K00766 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Anthranilate phosphoribosyltransferase | 3qsa | |||||||||||||||||||||
3qui | HFQ_PSEAE | Q9HUM0 | KO_id not found | Others | Others | Others | Others | Others | 3qui | |||||||||||||||||||||
3qwi | O93874_COCLU | O93874 | KO_id not found | Others | Others | Others | Others | Others | 3qwi | |||||||||||||||||||||
3qwj | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qwj | |||||||||||||||||||||
3qwk | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qwk | |||||||||||||||||||||
3qx2 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qx2 | |||||||||||||||||||||
3qx4 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qx4 | |||||||||||||||||||||
3qzf | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzf | |||||||||||||||||||||
3qzg | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzg | |||||||||||||||||||||
3qzh | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzh | |||||||||||||||||||||
3qzi | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzi | |||||||||||||||||||||
3r0f | E7E815_9ENTO | E7E815 | KO_id not found | Others | Others | Others | Others | Others | 3r0f | |||||||||||||||||||||
3r0y | Q000H7_9HIV1 | Q000H7 | KO_id not found | Others | Others | Others | Others | Others | 3r0y | |||||||||||||||||||||
3r1s | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r1s | |||||||||||||||||||||
3r1y | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r1y | |||||||||||||||||||||
3r21 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3r21 | |||||||||||||||||||||
3r22 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3r22 | |||||||||||||||||||||
3r28 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r28 | |||||||||||||||||||||
3r58 | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3r58 | |||||||||||||||||||||
3r71 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r71 | |||||||||||||||||||||
3r73 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r73 | |||||||||||||||||||||
3r7o | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3r7o | |||||||||||||||||||||
3r7v | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r7v | |||||||||||||||||||||
3r7y | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r7y | |||||||||||||||||||||
3r83 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r83 | |||||||||||||||||||||
3r8l | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r8l | |||||||||||||||||||||
3r8p | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r8p | |||||||||||||||||||||
3r96 | Q47510_ECOLX | Q47510 | KO_id not found | Others | Others | Others | Others | Others | 3r96 | |||||||||||||||||||||
3r9g | Q47510_ECOLX | Q47510 | KO_id not found | Others | Others | Others | Others | Others | 3r9g | |||||||||||||||||||||
3rdp | KITH_HHV11 | P03176 | K00857 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Thymidine kinase | 3rdp | |||||||||||||||||||||
3rdq | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 3rdq | |||||||||||||||||||||
3rfx | Q7CRQ0_AGRT5 | Q7CRQ0 | KO_id not found | Others | Others | Others | Others | Others | 3rfx | |||||||||||||||||||||
3rga | LSD19_STRLS | B6ZK72 | KO_id not found | Others | Others | Others | Others | Others | 3rga | |||||||||||||||||||||
3rhx | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 3rhx | |||||||||||||||||||||
3ri1 | FGFR2_HUMAN | P21802 | K05093 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR2; fibroblast growth factor receptor 2 Mitogenesis | Others | Others | 3ri1 | |||||||||||||||||||||
3rk0 | Q8U2K6_PYRFU | Q8U2K6 | KO_id not found | Others | Others | Others | Others | Others | 3rk0 | |||||||||||||||||||||
3rl7 | DLG1_HUMAN | Q12959 | KO_id not found | Others | Others | Others | Others | Others | 3rl7 | |||||||||||||||||||||
3rm7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3rm7 | |||||||||||||||||||||
3roe | NNRE_MOUSE | Q8K4Z3 | KO_id not found | Others | Others | Others | Others | Others | 3roe | |||||||||||||||||||||
3rog | NNRE_MOUSE | Q8K4Z3 | KO_id not found | Others | Others | Others | Others | Others | 3rog | |||||||||||||||||||||
3roy | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3roy | |||||||||||||||||||||
3rq4 | SV422_HUMAN | Q86Y97 | K11429 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 3rq4 | |||||||||||||||||||||
3rr4 | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 3rr4 | |||||||||||||||||||||
3rsv | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3rsv | |||||||||||||||||||||
3rtn | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3rtn | |||||||||||||||||||||
3rts | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3rts | |||||||||||||||||||||
3rtt | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3rtt | |||||||||||||||||||||
3rtu | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3rtu | |||||||||||||||||||||
3rwp | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3rwp | |||||||||||||||||||||
3rwq | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3rwq | |||||||||||||||||||||
3s1d | CKX1_MAIZE | Q9T0N8 | K00279 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With other acceptors | Cytokinin dehydrogenase | 3s1d | |||||||||||||||||||||
3s2a | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3s2a | |||||||||||||||||||||
3s2o | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3s2o | |||||||||||||||||||||
3s2p | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3s2p | |||||||||||||||||||||
3s3g | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3s3g | |||||||||||||||||||||
3s71 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s71 | |||||||||||||||||||||
3s72 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s72 | |||||||||||||||||||||
3s73 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s73 | |||||||||||||||||||||
3s74 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s74 | |||||||||||||||||||||
3s76 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s76 | |||||||||||||||||||||
3s7l | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3s7l | |||||||||||||||||||||
3s89 | Q8AAN6_BACTN | Q8AAN6 | K01912 | Enzymes | Ligases | Forming carbon-sulfur bonds | Acid-thiol ligases | Phenylacetate---CoA ligase | 3s89 | |||||||||||||||||||||
3s9t | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s9t | |||||||||||||||||||||
3sax | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3sax | |||||||||||||||||||||
3say | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3say | |||||||||||||||||||||
3sc1 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3sc1 | |||||||||||||||||||||
3scs | BGL07_ORYSJ | Q75I93 | K05350 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Beta-glucosidase | 3scs | |||||||||||||||||||||
3shr | KGP1_BOVIN | P00516 | K07376 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CGMP-dependent protein kinase | 3shr | |||||||||||||||||||||
3si3 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3si3 | |||||||||||||||||||||
3si4 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3si4 | |||||||||||||||||||||
3sl8 | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3sl8 | |||||||||||||||||||||
3smi | PAR14_HUMAN | Q460N5 | K15261 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3smi | |||||||||||||||||||||
3smj | PAR14_HUMAN | Q460N5 | K15261 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3smj | |||||||||||||||||||||
3soc | AVR2A_HUMAN | P27037 | K04670 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Receptor protein serine-threonine kinase | 3soc | |||||||||||||||||||||
3sp1 | SYC_BORBU | O51545 | K01883 | Enzymes | Ligases | Forming carbon-oxygen bonds | Ligases forming aminoacyl-tRNA and related compounds | Cysteine---tRNA ligase | 3sp1 | |||||||||||||||||||||
3spl | APTX_SCHPO | O74859 | K10863 | DNA repair and recombination proteins | Eukaryotic Type | DSBR (double strand breaks repair) | NHEJ (non-homologous end-joining) | Other NHEJ factors | 3spl | |||||||||||||||||||||
3srz | Q189K5_CLOD6 | Q189K5 | K11063 | Bacterial toxins | Type III toxins- Intracellular toxins | Others | Toxin A-B | TcdAB; toxin A-B | 3srz | |||||||||||||||||||||
3sxs | BMX_HUMAN | P51813 | K08896 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3sxs | |||||||||||||||||||||
3szl | ISPH_ECOLI | P62623 | K03527 | Enzymes | Oxidoreductases | Acting on CH or CH2 groups | With NAD+ or NADP+ as acceptor | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | 3szl | |||||||||||||||||||||
3t4l | AHK4_ARATH | Q9C5U0 | K14489 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3t4l | |||||||||||||||||||||
3t4n | SNF1_YEAST | P06782 | K12761 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3t4n | |||||||||||||||||||||
3t4o | AHK4_ARATH | Q9C5U0 | K14489 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3t4o | |||||||||||||||||||||
3t4s | AHK4_ARATH | Q9C5U0 | K14489 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3t4s | |||||||||||||||||||||
3t4t | AHK4_ARATH | Q9C5U0 | K14489 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3t4t | |||||||||||||||||||||
3t5u | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3t5u | |||||||||||||||||||||
3t5z | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3t5z | |||||||||||||||||||||
3t70 | Q8II92_PLAF7 | Q8II92 | K01520 | Enzymes | Hydrolases | Acting on acid anhydrides | In phosphorus-containing anhydrides | DUTP diphosphatase | 3t70 | |||||||||||||||||||||
3t80 | ISPF_SALTY | Q8ZMF7 | K01770 | Enzymes | Lyases | Phosphorus-oxygen lyases | Phosphorus-oxygen lyases (only sub-subclass identified to date) | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | 3t80 | |||||||||||||||||||||
3t82 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3t82 | |||||||||||||||||||||
3t84 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3t84 | |||||||||||||||||||||
3t85 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3t85 | |||||||||||||||||||||
3t94 | MTAP_SULSO | Q97W94 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 3t94 | |||||||||||||||||||||
3t9v | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3t9v | |||||||||||||||||||||
3tax | OGT1_HUMAN | O15294 | K09667 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | - | 3tax | |||||||||||||||||||||
3tb9 | RIR1_YEAST | P21524 | K10807 | DNA repair and recombination proteins | Eukaryotic Type | Other factors with a suspected DNA repair function | Modulation of nucleotide pools | RRM1; ribonucleoside-diphosphate reductase subunit M1 | 3tb9 | |||||||||||||||||||||
3tdh | SNF1_YEAST | P06782 | K12761 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3tdh | |||||||||||||||||||||
3te5 | SNF1_YEAST | P06782 | K12761 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3te5 | |||||||||||||||||||||
3tfq | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3tfq | |||||||||||||||||||||
3tfu | BIOA_MYCTU | P0A4X6 | K00833 | Enzymes | Transferases | Transferring nitrogenous groups | Transaminases | Adenosylmethionine---8-amino-7-oxononanoate transaminase | 3tfu | |||||||||||||||||||||
3thr | GNMT_RAT | P13255 | K00552 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Glycine N-methyltransferase | 3thr | |||||||||||||||||||||
3tl5 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3tl5 | |||||||||||||||||||||
3tlh | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 3tlh | |||||||||||||||||||||
3tn8 | CDK9_HUMAN | P50750 | K02211 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3tn8 | |||||||||||||||||||||
3tnw | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3tnw | |||||||||||||||||||||
3tr9 | Q83BY6_COXBU | Q83BY6 | K00796 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Dihydropteroate synthase | 3tr9 | |||||||||||||||||||||
3tsd | Q81W29_BACAN | Q81W29 | K00088 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | IMP dehydrogenase | 3tsd | |||||||||||||||||||||
3tv1 | RTCA_ECOLI | P46849 | K01974 | Enzymes | Ligases | Forming phosphoric-ester bonds | Ligases that form phosphoric-ester bonds (only sub-subclass identified to date) | RNA-3'-phosphate cyclase | 3tv1 | |||||||||||||||||||||
3tyc | Q81VW8_BACAN | Q81VW8 | K00796 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Dihydropteroate synthase | 3tyc | |||||||||||||||||||||
3tye | Q81VW8_BACAN | Q81VW8 | K00796 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Dihydropteroate synthase | 3tye | |||||||||||||||||||||
3tyu | Q7CKJ1_YERPE | Q7CKJ1 | K00796 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Dihydropteroate synthase | 3tyu | |||||||||||||||||||||
3tzm | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 3tzm | |||||||||||||||||||||
3u04 | Q2GI30_EHRCR | Q2GI30 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3u04 | |||||||||||||||||||||
3u2c | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3u2c | |||||||||||||||||||||
3u40 | C4LXG4_ENTHI | C4LXG4 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3u40 | |||||||||||||||||||||
3u4u | CSK21_HUMAN | P68400 | K03097 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3u4u | |||||||||||||||||||||
3u7k | DEF_STAAC | Q5HGZ3 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3u7k | |||||||||||||||||||||
3u7l | DEF_STAAC | Q5HGZ3 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3u7l | |||||||||||||||||||||
3u7n | DEF_STAAC | Q5HGZ3 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3u7n | |||||||||||||||||||||
3ua8 | GRIA2_HUMAN | P42262 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3ua8 | |||||||||||||||||||||
3uaw | DEOD_BACCE | Q5EEL8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3uaw | |||||||||||||||||||||
3uay | DEOD_BACCE | Q5EEL8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3uay | |||||||||||||||||||||
3uaz | DEOD_BACCE | Q5EEL8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3uaz | |||||||||||||||||||||
3uel | PARG_RAT | Q9QYM2 | K07759 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Poly(ADP-ribose) glycohydrolase | 3uel | |||||||||||||||||||||
3uh2 | TNKS1_HUMAN | O95271 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3uh2 | |||||||||||||||||||||
3ujh | B6KMQ4_TOXGO | B6KMQ4 | K01810 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting aldoses and ketoses, and related compounds | Glucose-6-phosphate isomerase | 3ujh | |||||||||||||||||||||
3uk2 | PANC_BURTA | Q2T095 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3uk2 | |||||||||||||||||||||
3usb | Q81W29_BACAN | Q81W29 | K00088 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | IMP dehydrogenase | 3usb | |||||||||||||||||||||
3ut6 | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3ut6 | |||||||||||||||||||||
3uu7 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3uu7 | |||||||||||||||||||||
3uuc | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3uuc | |||||||||||||||||||||
3uwe | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3uwe | |||||||||||||||||||||
3uwp | DOT1L_HUMAN | Q8TEK3 | K11427 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 3uwp | |||||||||||||||||||||
3uxj | C3LTF1_VIBCM | C3LTF1 | K06879 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With NAD+ or NADP+ as acceptor | PreQ1 synthase | 3uxj | |||||||||||||||||||||
3v0y | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 3v0y | |||||||||||||||||||||
3v80 | PPNK1_LISMO | Q8Y8D7 | K00858 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | NAD+ kinase | 3v80 | |||||||||||||||||||||
3v8m | PPNK1_LISMO | Q8Y8D7 | K00858 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | NAD+ kinase | 3v8m | |||||||||||||||||||||
3v9b | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3v9b | |||||||||||||||||||||
3vc4 | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3vc4 | |||||||||||||||||||||
3vd4 | BGAL_ECOLI | P00722 | K12309 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Beta-galactosidase | 3vd4 | |||||||||||||||||||||
3vd7 | BGAL_ECOLI | P00722 | K12309 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Beta-galactosidase | 3vd7 | |||||||||||||||||||||
3vey | HXK4_HUMAN | P35557 | K12407 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Glucokinase | 3vey | |||||||||||||||||||||
3vf9 | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3vf9 | |||||||||||||||||||||
3vhv | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 3vhv | |||||||||||||||||||||
3vid | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3vid | |||||||||||||||||||||
3vqu | TTK_HUMAN | P33981 | K08866 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 3vqu | |||||||||||||||||||||
3vrt | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 3vrt | |||||||||||||||||||||
3vru | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 3vru | |||||||||||||||||||||
3vsc | CYSO_AERPE | Q9YBL2 | K10150 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Cysteine synthase | 3vsc | |||||||||||||||||||||
3zrm | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3zrm | |||||||||||||||||||||
3zs5 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3zs5 | |||||||||||||||||||||
3ztc | ELOB_HUMAN | Q15370 | K03873 | DNA repair and recombination proteins | Eukaryotic Type | SSBR (single strand breaks repair) | NER (nucleotide excision repair) | TCEB2; transcription elongation factor B, polypeptide 2 | 3ztc | |||||||||||||||||||||
3zw3 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3zw3 | |||||||||||||||||||||
3zwx | NADA_APLCA | P29241 | K03517 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Quinolinate synthase | 3zwx | |||||||||||||||||||||
3zzn | LDH_THET8 | Q5SJA1 | K00016 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | L-lactate dehydrogenase | 3zzn | |||||||||||||||||||||
4a0m | BADH_SPIOL | P17202 | K00130 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Betaine-aldehyde dehydrogenase | 4a0m | |||||||||||||||||||||
4a16 | ACES_MOUSE | P21836 | K01049 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Acetylcholinesterase | 4a16 | |||||||||||||||||||||
4a7i | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 4a7i | |||||||||||||||||||||
4aa0 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 4aa0 | |||||||||||||||||||||
4acc | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 4acc | |||||||||||||||||||||
4acg | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 4acg | |||||||||||||||||||||
4acm | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 4acm | |||||||||||||||||||||
4af3 | AURKB_HUMAN | Q96GD4 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4af3 | |||||||||||||||||||||
4aic | DXR_MYCTU | P64012 | K00099 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 1-deoxy-D-xylulose-5-phosphate reductoisomerase | 4aic | |||||||||||||||||||||
4aiu | OGA_BACTN | Q89ZI2 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 4aiu | |||||||||||||||||||||
4ajw | PK3CD_MOUSE | O35904 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4ajw | |||||||||||||||||||||
4anx | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4anx | |||||||||||||||||||||
4at5 | NTRK2_HUMAN | Q16620 | K04360 | Cytokine receptors | Receptor tyrosine kinase | RTK class VII (TRK receptor family) | NTRK2, TRKB; neurotrophic tyrosine kinase receptor type 2 | Others | 4at5 | |||||||||||||||||||||
4avu | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 4avu | |||||||||||||||||||||
4avw | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 4avw | |||||||||||||||||||||
4aw5 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 4aw5 | |||||||||||||||||||||
4dbs | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 4dbs | |||||||||||||||||||||
4dch | HXK4_HUMAN | P35557 | K12407 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Glucokinase | 4dch | |||||||||||||||||||||
4dfn | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4dfn | |||||||||||||||||||||
4dhf | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4dhf | |||||||||||||||||||||
4djy | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 4djy | |||||||||||||||||||||
4dma | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 4dma | |||||||||||||||||||||
4drq | FKBP5_HUMAN | Q13451 | K09571 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 4drq | |||||||||||||||||||||
4dz3 | Q3JK38_BURP1 | Q3JK38 | K01802 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 4dz3 | |||||||||||||||||||||
4e3f | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 4e3f | |||||||||||||||||||||
4eg2 | CDD_VIBCH | Q9KSM5 | K01489 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Cytidine deaminase | 4eg2 | |||||||||||||||||||||
4egb | Q81TP0_BACAN | Q81TP0 | K01710 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | DTDP-glucose 4,6-dehydratase | 4egb | |||||||||||||||||||||
4ei4 | JAK1_HUMAN | P23458 | K11217 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4ei4 | |||||||||||||||||||||
4emd | B1MKD5_MYCA9 | B1MKD5 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 4emd | |||||||||||||||||||||
4eqz | DOT1L_HUMAN | Q8TEK3 | K11427 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 4eqz | |||||||||||||||||||||
4er3 | DOT1L_HUMAN | Q8TEK3 | K11427 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 4er3 | |||||||||||||||||||||
4erk | MK01_RAT | P63086 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 4erk | |||||||||||||||||||||
4ez3 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 4ez3 | |||||||||||||||||||||
4f0r | Q7NZ90_CHRVO | Q7NZ90 | K05394 | Enzymes | Hydrolases | Acting on halide bonds | In carbon-halide compounds | Atrazine chlorohydrolase | 4f0r | |||||||||||||||||||||
4f0s | Q7NZ90_CHRVO | Q7NZ90 | K05394 | Enzymes | Hydrolases | Acting on halide bonds | In carbon-halide compounds | Atrazine chlorohydrolase | 4f0s | |||||||||||||||||||||
4f1s | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4f1s | |||||||||||||||||||||
4f2d | ARAA_ECOLI | P08202 | K01804 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting aldoses and ketoses, and related compounds | L-arabinose isomerase | 4f2d | |||||||||||||||||||||
4f32 | A4JL30_BURVG | A4JL30 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 4f32 | |||||||||||||||||||||
4fak | RLMH_STAAU | P0C1V0 | K00783 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 23S rRNA (pseudouridine1915-N3)-methyltransferase | 4fak | |||||||||||||||||||||
4fev | B0VD92_ACIBY | B0VD92 | K00897 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Kanamycin kinase | 4fev | |||||||||||||||||||||
4few | B0VD92_ACIBY | B0VD92 | K00897 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Kanamycin kinase | 4few | |||||||||||||||||||||
4fgc | QUEF_BACSU | O31678 | K09457 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With NAD+ or NADP+ as acceptor | PreQ1 synthase | 4fgc | |||||||||||||||||||||
4fhd | A4IQU1_GEOTN | A4IQU1 | K03716 | Enzymes | Lyases | Carbon-carbon lyases | Other carbon-carbon lyases | Spore photoproduct lyase | 4fhd | |||||||||||||||||||||
4fo4 | Q9KTW3_VIBCH | Q9KTW3 | K00088 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | IMP dehydrogenase | 4fo4 | |||||||||||||||||||||
4frs | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 4frs | |||||||||||||||||||||
4fsw | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsw | |||||||||||||||||||||
4fsy | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsy | |||||||||||||||||||||
4fsz | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsz | |||||||||||||||||||||
4ft9 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ft9 | |||||||||||||||||||||
4ftt | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftt | |||||||||||||||||||||
4g3e | M3K14_MOUSE | Q9WUL6 | K04466 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase kinase kinase | 4g3e | |||||||||||||||||||||
4g55 | CLH1_HUMAN | Q00610 | K08099 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Chlorophyllase | 4g55 | |||||||||||||||||||||
4gcx | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 4gcx | |||||||||||||||||||||
4gef | Q6FXA8_CANGA | Q6FXA8 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 4gef | |||||||||||||||||||||
6cox | PGH2_MOUSE | Q05769 | K11987 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 6cox | |||||||||||||||||||||
7upj | POL_HV1BR | P03367 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 7upj |