| pharmacophore.Pharma-ID | pharmacophore/metadata/Gene-Name | pharmacophore/metadata/Uniprot-AC | pharmacophore/metadata/Kegg-Identifier | pharmacophore/metadata/Target-Class | pharmacophore/metadata/Target-Class-A | pharmacophore/metadata/Target-Class-B | pharmacophore/metadata/Target-Class-C | pharmacophore/metadata/Target-Class-D | pharmacophore/metadata/pdb.complex_id | pharmacophore/metadata/Taxonomic-ID | pharmacophore.name | pharmacophore.selectivity_index | pharmacophore/metadata/drug-classification | pharmacophore/metadata/target | pharmacophore/metadata/target-subclass | pharmacophore/metadata/target-family | pharmacophore/metadata/target-acronym | pharmacophore/metadata/therapeutic-classification | pharmacophore/metadata/mode-of-action | pharmacophore/metadata/pdb.ligand_id | pharmacophore/metadata/pdb.resolution | pharmacophore/actives/molecule.name | pharmacophore/actives/molecule.smiles | pharmacophore/actives/molecule.registry | pharmacophore/actives/molecule.regtype | pharmacophore/bibliography/reference.title | pharmacophore/bibliography/reference.author | pharmacophore/bibliography/reference.source | pharmacophore/bibliography/reference.year | pharmacophore/bibliography/reference.doi |
| 1a42 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1a42 | |||||||||||||||||||||
| 1a9s | PNPH_BOVIN | P55859 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1a9s | |||||||||||||||||||||
| 1afq | CTRA_BOVIN | P00766 | KO_id not found | Others | Others | Others | Others | Others | 1afq | |||||||||||||||||||||
| 1ag9 | FLAV_ECOLI | P61949 | K03839 | Others | Others | Others | Others | Others | 1ag9 | 83333 | ||||||||||||||||||||
| 1agw | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 1agw | |||||||||||||||||||||
| 1b3d | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1b3d | |||||||||||||||||||||
| 1b8y | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1b8y | |||||||||||||||||||||
| 1bfd | MDLC_PSEPU | P20906 | KO_id not found | Others | Others | Others | Others | Others | 1bfd | |||||||||||||||||||||
| 1bmk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1bmk | |||||||||||||||||||||
| 1bn1 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1bn1 | |||||||||||||||||||||
| 1bn3 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1bn3 | |||||||||||||||||||||
| 1bnn | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1bnn | |||||||||||||||||||||
| 1bnt | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1bnt | |||||||||||||||||||||
| 1bnu | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1bnu | |||||||||||||||||||||
| 1bnv | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1bnv | |||||||||||||||||||||
| 1byg | CSK_HUMAN | P41240 | K05728 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1byg | |||||||||||||||||||||
| Enzymes | 1bzj | 1bzj-pic-2.25-h-1 | 1674 | endocrine | protein tyrosine phosphatase 1B | EC3.- (hydrolases) | phosphatases | PTP 1B | diabetes obesity |
dephosphorylation of insulin receptor and insulin receptor substrate tyrosine residues prevention of insulin resistance |
pic | 2.25 | 219316-39-9 | OC(=O)c1ccc2cc(ccc2c1)C(F)(F)P(=O)(O)O | 219316-39-9 | CAS | Structural basis for inhibition of the protein tyrosine phosphatase 1B by phosphotyrosine peptide mimetics | Groves MR, Yao ZJ, Roller PP, Burke TR Jr, Barford D | Biochemistry 37(51):17773-83 | 1998 | - | |||||||||
| 1bzs | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1bzs | |||||||||||||||||||||
| 1c1c | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1c1c | |||||||||||||||||||||
| 1c3x | PUNA_CELSP | P81989 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1c3x | |||||||||||||||||||||
| 1cg6 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1cg6 | |||||||||||||||||||||
| 1cgk | CHS2_MEDSA | P30074 | K00698 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Chitin synthase | 1cgk | |||||||||||||||||||||
| 1coy | CHOD_BREST | P22637 | K10078 (inferred by homologyHUMAN) | Glycan Binding Proteins | C-Type lectin | Group 8 Layilin and related receptors | CHODL; chondrolectin | Cholesterol oxidase | 1coy | 1702 | ||||||||||||||||||||
| 1cw2 | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1cw2 | |||||||||||||||||||||
| 1cx4 | KAP3_RAT | P12369 | K04739 | Others | Organismal Systems | Endocrine system | Insulin signaling pathway | PRKAR; cAMP-dependent protein kinase regulator | 1cx4 | |||||||||||||||||||||
| 1d2s | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1d2s | |||||||||||||||||||||
| Enzymes | 1d5l | 1d5l-cyn-1.90-x-1 | 841 | immunologic | myeloperoxidase | EC1.- (oxydo-reductases) | peroxydases | myeloperoxidase | cognitive defects cardiovascular diseases cancer multiple sclerosis COPD inflammation |
modulation of HOCl generation at sites of inflammation | cyn | 1.90 | salicylhydroxamic acid | ONC(=O)c1ccccc1O | 89-73-6 | cas | Human myeloperoxidase: structure of a cyanide complex and its interaction with bromide and thiocyanate substrates at 1.9 A resolution | Blair-Johnson M, Fiedler T, Fenna R | Biochemistry 40(46):13990-7 | 2001 | 10.1021/bi0111808 | |||||||||
| 1d7u | DGDA_BURCE | P16932 | KO_id not found | Enzymes | 4. Lyases | decarboxylases | DGD (bacterial) | Others | 1d7u | |||||||||||||||||||||
| 1d7x | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1d7x | |||||||||||||||||||||
| Receptors | 1db1 | 1db1-vdx-1.80-h-1 | 1081 | metabolic oncolytic immunologic dermatologic |
vitamin D3 receptor | Transduction factor receptors | nuclear hormone receptors | VDR | cancer skin diseases osteoporosis autoimmune suppression |
Nuclear hormone receptor. VDR mediates the action of vitamin D3 by controlling the expression of hormone sensitive genes. VDR regulates calcium and phosphate metabolism and has immunosuppressive effects. | vdx | 1.80 | 32222-06-3 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2/C(=C/C=C\3/C[C@@H](O)C[C@H](O)C3=C)/CCC[C@]12C | 32222-06-3 | CAS | The crystal structure of the nuclear receptor for vitamin D bound to its natural ligand | Rochel N, Wurtz JM, Mitschler A, Klaholz B, Moras D | Mol Cell 5(1):173-9 | 2000 | 10.1016/S1097-2765(00)80413-X | |||||||||
| 1dht | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1dht | |||||||||||||||||||||
| 1di8 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1di8 | |||||||||||||||||||||
| 1dig | C1TC_HUMAN | P11586 | K00288 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Formate---tetrahydrofolate ligase | 1dig | |||||||||||||||||||||
| 1e1x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1e1x | |||||||||||||||||||||
| 1e2n | KITH_HHV11 | P03176 | K00857 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Thymidine kinase | 1e2n | |||||||||||||||||||||
| Enzymes | 1e7w | 1e7w-mtx-1.75-d-1 | 1576 | antiinfective | leishmania major pteridine reductase | EC1.- (oxydo-reductases) | pteridine reductases | PTR1 (L.major) | parasitic infection | inhibition of parasitic pteridine reductase salvage of pterins |
mtx | 1.75 | methotrexate | CN(Cc1cnc2nc(N)nc(N)c2n1)c3ccc(cc3)C(=O)NC(CCC(O)=O)C(O)=O | 59-05-2 | cas | Pteridine reductase mechanism correlates pterin metabolism with drug resistance in trypanosomatid parasites | Gourley DG, Schuttelkopf AW, Leonard GA, Luba J, Hardy LW, Beverley SM, Hunter WN | Nat Struct Biol 8(6):521-5 | 2001 | 10.1038/88584 | |||||||||
| 1e8m | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1e8m | |||||||||||||||||||||
| 1e90 | PK3CG_PIG | O02697 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 1e90 | |||||||||||||||||||||
| Enzymes | 1e9h | 1e9h-inr-2.50-h-1 | 10.07159 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | inr | 2.50 | 478283-10-2 | [C=1C=CC2=C(C1)C(=O)\C(=C\3/C=4C=C(C=CC4NC3=O)S(=O)(=O)O)\N2] | 478283-10-2 | CAS | Inhibitor binding to active and inactive CDK2: the crystal structure of CDK2-cyclin A/indirubin-5-sulphonate. | Davies TG, Tunnah P, Meijer L, Marko D, Eisenbrand G, Endicott JA, Noble ME. | Structure 9(5):389-97 | 2001 | 10.1016/S0969-2126(01)00598-6 | |||||||||
| 1ee9 | MTD1_YEAST | Q02046 | K00295 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Methylenetetrahydrofolate dehydrogenase (NAD+) | 1ee9 | |||||||||||||||||||||
| Enzymes | 1eet | 1eet-bfu-2.73-d-1-s | 1657 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
bfu | 2.73 | 231957-56-5 | CCC(=O)c1ccc(F)c([C@@H]2C[C@@H]2NC(=O)Nc3ccc(Br)cn3)c1O | 231957-56-5 | CAS | Urea-PETT compounds as a new class of HIV-1 reverse transcriptase inhibitors. 3. Synthesis and further structure-activity relationship studies of PETT analogues | Hogberg M, Sahlberg C, Engelhardt P, Noreen R, Kangasmetsa J, Johansson NG, Oberg B, Vrang L, Zhang H, Sahlberg BL, Unge T, Lovgren S, Fridborg K, Backbro K | J Med Chem 43(2):304 | 2000 | 10.1021/jm990572y | |||||||||
| 1eet | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1eet | |||||||||||||||||||||
| 1efy | PARP1_CHICK | P26446 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 1efy | |||||||||||||||||||||
| 1eh4 | CKI1_SCHPO | P40233 | K02218 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1eh4 | |||||||||||||||||||||
| 1ej3 | AEQ2_AEQVI | P02592 | KO_id not found | Others | Others | Others | Others | Others | 1ej3 | |||||||||||||||||||||
| 1el3 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 1el3 | |||||||||||||||||||||
| 1el4 | OBL_OBELO | Q27709 | KO_id not found | Others | Others | Others | Others | Others | 1el4 | |||||||||||||||||||||
| 1eno | FABI_BRANA | P80030 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 1eno | |||||||||||||||||||||
| 1eou | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1eou | |||||||||||||||||||||
| 1equ | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1equ | |||||||||||||||||||||
| 1f0s | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1f0s | |||||||||||||||||||||
| 1f17 | HCDH_HUMAN | Q16836 | K00022 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3-hydroxyacyl-CoA dehydrogenase | 1f17 | |||||||||||||||||||||
| Receptors | 1fm6 | 1fm6-brl-2.10-p-1 | 1813 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | obesity | activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
brl | 2.10 | rosiglitazone | CN(CCOc1ccc(C[C@@H]2SC(=O)NC2=O)cc1)c3ccccn3 | 163860-15-9 | CAS | Asymmetry in the PPARgamma/RXRalpha crystal structure reveals the molecular basis of heterodimerization among nuclear receptors | Gampe RT Jr, Montana VG, Lambert MH, Miller AB, Bledsoe RK, Milburn MV, Kliewer SA, Willson TM, Xu HE | Mol Cell 5(3):545-55 | 2000 | 10.1016/S1097-2765(00)80448-7 | |||||||||
| 1fm7 | CFI1_MEDSA | P28012 | K01859 | Enzymes | Isomerases | Intramolecular lyases | Intramolecular lyases (only sub-subclass identified to date) | Chalcone isomerase | 1fm7 | |||||||||||||||||||||
| Receptors | 1fm9 | 1fm9-570-2.10-x-1 | 617 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | metabolic syndrome diabetes cardiovascular diseases obesity |
activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
570 | 2.10 | farglitazar | Cc1oc(nc1CCOc2ccc(C[C@H](Nc3ccccc3C(=O)c4ccccc4)C(=O)O)cc2)c5ccccc5 | 196808-45-4 | CAS | Asymmetry in the PPARgamma/RXRalpha crystal structure reveals the molecular basis of heterodimerization among nuclear receptors | Gampe RT Jr, Montana VG, Lambert MH, Miller AB, Bledsoe RK, Milburn MV, Kliewer SA, Willson TM, Xu HE | Mol Cell 5(3):545-55 | 2000 | 10.1016/S1097-2765(00)80448-7 | |||||||||
| Receptors | 1fm9 | 1fm9-570-2.10-x-2 | 276 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | metabolic syndrome diabetes cardiovascular diseases obesity |
activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
570 | 2.10 | farglitazar | Cc1oc(nc1CCOc2ccc(C[C@H](Nc3ccccc3C(=O)c4ccccc4)C(=O)O)cc2)c5ccccc5 | 196808-45-4 | CAS | Asymmetry in the PPARgamma/RXRalpha crystal structure reveals the molecular basis of heterodimerization among nuclear receptors | Gampe RT Jr, Montana VG, Lambert MH, Miller AB, Bledsoe RK, Milburn MV, Kliewer SA, Willson TM, Xu HE | Mol Cell 5(3):545-55 | 2000 | 10.1016/S1097-2765(00)80448-7 | |||||||||
| 1ftl | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 1ftl | |||||||||||||||||||||
| 1g9s | HPRT_ECOLI | P0A9M2 | K00760 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Hypoxanthine phosphoribosyltransferase | 1g9s | |||||||||||||||||||||
| 1gg5 | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1gg5 | |||||||||||||||||||||
| Enzymes | 1gih | 1gih-1pu-2.80-h-1 | 4.74422 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | 1pu | 2.80 | 391937-50-1 | [C1=CC=NC(=C1)NC(=O)NC=2C=CC=C3C2[C@H]4CCCN4C3=O] | 391937-50-1 | CAS | Crystallographic approach to identification of cyclin-dependent kinase 4 (CDK4)-specific inhibitors by using CDK4 mimic CDK2 protein | Ikuta M, Kamata K, Fukasawa K, Honma T, Machida T, Hirai H, Suzuki-Takahashi I, Hayama T, Nishimura S | J Biol Chem 276(29):27548-27554 | 2001 | 10.1074/jbc.M102060200 | |||||||||
| 1gii | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1gii | |||||||||||||||||||||
| 1gs4 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1gs4 | |||||||||||||||||||||
| 1gx1 | ISPF_ECO57 | P62618 | K01770 | Enzymes | Lyases | Phosphorus-oxygen lyases | Phosphorus-oxygen lyases (only sub-subclass identified to date) | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | 1gx1 | |||||||||||||||||||||
| Enzymes | 1h00 | 1h00-fap-1.60-h-1 | 0.81730 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | fap | 1.60 | 620629-44-9 | [CN(C)C[C@@H](COC1=CC=C(C=C1)NC2=CC(=NC=N2)NC3=C(C=CC=C3F)F)O] | 620629-44-9 | CAS | Cyclin-dependent kinase 4 inhibitors as a treatment for cancer. Part 1: identification and optimisation of substituted 4,6-bis anilino pyrimidines | Beattie, J.F., Breault, G.A., Ellston, R.P., Green, S., Jewsbury, P.J., Midgley, C.J., Naven, R.T., Minshull, C.A., Pauptit, R.A., Tucker, J.A., Pease, J.E. | Bioorg Med Chem Lett 13:2955-2960 | 2003 | 10.1016/S0960-894X(03)00202-6 | |||||||||
| Enzymes | 1h08 | 1h08-byp-1.80-h-1 | 100 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | byp | 1.80 | 280578-83-8 | CN(C)C[C@@H](O)COc1ccc(Nc2ncc(Br)c(Nc3ccccc3)n2)cc1 | 280578-83-8 | CAS | Cyclin-dependent kinase 4 inhibitors as a treatment for cancer. Part 1: identification and optimisation of substituted 4,6-bis anilino pyrimidines | Beattie JF, Breault GA, Ellston RP, Green S, Jewsbury PJ, Midgley CJ, Naven RT, Minshull CA, Pauptit RA, Tucker JA, Pease JE | Bioorg Med Chem Lett 13(18):2955-60 | 2003 | 10.1016/S0960-894X(03)00202-6 | |||||||||
| 1h23 | ACES_TORCA | P04058 | K01049 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Acetylcholinesterase | 1h23 | |||||||||||||||||||||
| 1h69 | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1h69 | |||||||||||||||||||||
| Transport proteins | 1h9z | 1h9z-rwf-2.50-h-1 | 13576 | immunologic | Serum albumin | extracellular proteins | serum proteins | HSA | inflammation | Serum albumin, the main protein of plasma, has a good binding capacity for water, Ca(2+), Na(+), K(+), fatty acids, hormones, bilirubin and drugs. Its main function is the regulation of the colloidal osmotic pressure of blood. | rwf | 2.50 | (S)-Warfarin | CC(=O)C[C@H](c1ccccc1)c2c(O)c3ccccc3oc2=O | 5543-57-7 | CAS | Crystal structure analysis of warfarin binding to human serum albumin: anatomy of drug site I | Petitpas I, Bhattacharya AA, Twine S, East M, Curry S | J Biol Chem 276(25):22804-9 | 2001 | 10.1074/jbc.M100575200 | |||||||||
| Transport proteins | 1ha2 | 1ha2-swf-2.50-h-1 | 12247 | immunologic | Serum albumin | extracellular proteins | serum proteins | HSA | inflammation | Serum albumin, the main protein of plasma, has a good binding capacity for water, Ca(2+), Na(+), K(+), fatty acids, hormones, bilirubin and drugs. Its main function is the regulation of the colloidal osmotic pressure of blood. | swf | 2.50 | (R)-Warfarin | CC(=O)C[C@@H](c1ccccc1)c2c(O)c3ccccc3oc2=O | 5543-58-8 | CAS | Crystal structure analysis of warfarin binding to human serum albumin: anatomy of drug site I | Petitpas I, Bhattacharya AA, Twine S, East M, Curry S | J Biol Chem 276(25):22804-9 | 2001 | 10.1074/jbc.M100575200 | |||||||||
| 1hon | PURA_ECOLI | P0A7D4 | K01939 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Adenylosuccinate synthase | 1hon | |||||||||||||||||||||
| 1hy7 | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1hy7 | |||||||||||||||||||||
| 1i8z | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1i8z | |||||||||||||||||||||
| 1i90 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1i90 | |||||||||||||||||||||
| 1if9 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1if9 | |||||||||||||||||||||
| 1ij8 | AVID_CHICK | P02701 | KO_id not found | Others | Others | Others | Others | Others | 1ij8 | |||||||||||||||||||||
| 1ikx | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1ikx | |||||||||||||||||||||
| 1iky | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1iky | |||||||||||||||||||||
| 1isj | BST1_HUMAN | Q10588 | K01242 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | NAD+ nucleosidase | 1isj | |||||||||||||||||||||
| 1jla | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1jla | |||||||||||||||||||||
| 1jlc | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1jlc | |||||||||||||||||||||
| 1jm6 | PDK2_RAT | Q64536 | K00898 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 1jm6 | |||||||||||||||||||||
| Enzymes | 1jvp | 1jvp-lig-1.53-h-1 | 8.57867 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | lig | 1.5 | 54714-78-2 | [C=1C=CC2=C(C1)CC3=C2NN=C3C4=CC=NC=C4] | 54714-78-2 | CAS | Structure-based design and protein X-ray analysis of a protein kinase inhibitor | Furet, P., Meyer, T., Strauss, A., Raccuglia, S., Rondeau, J.M. | Bioorg Med Chem Lett 12:221-224 | 2002 | 10.1016/S0960-894X(01)00715-6 | |||||||||
| Enzymes | 1jwt | 1jwt-bli-2.50-h-1 | 81 | thrombotic diseases cardiovascular |
thrombin coagulation factor II |
EC3.- (hydrolases) | proteases (serine) | thrombin | cardiovascular diseases thrombosis |
Thrombin, which cleaves bonds after Arg and Lys, converts fibrinogen to fibrin and activates factors V, VII, VIII, XIII, and, in complex with thrombomodulin, protein C anticoagulant inhibition of selective cleavage of Arg-Gly bonds in fibrinogen to form fibrin and release fibrinopeptides A and B |
bli | 2.50 | 401947-05-5 | ONC(=N)N1CCC(CNC(=O)[C@@H]2CC[C@H]3CN(CC(=O)[N@H]23)S(=O)(=O)Cc4ccccc4)CC1 | 401947-05-5 | CAS | Novel bicyclic lactam inhibitors of thrombin: potency and selectivity optimization through P1 residues | Levesque S, St-Denis Y, Bachand B, Preville P, Leblond L, Winocour PD, Edmunds JJ, Rubin JR, Siddiqui MA | Bioorg Med Chem Lett 11(24):3161-4 | 2001 | 10.1016/S0960-894X(01)00661-8 | |||||||||
| 1k3u | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1k3u | |||||||||||||||||||||
| 1k7f | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1k7f | |||||||||||||||||||||
| 1kbq | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1kbq | |||||||||||||||||||||
| Enzymes | 1ke5 | 1ke5-ls1-2.20-h-1 | 8.68158 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | ls1 | 2.2 | 388627-55-2 | [CNS(=O)(=O)C1=CC=C(C=C1)NC=C2C=3C=CC=CC3NC2=O] | 388627-55-2 | CAS | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem 44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
| 1ke5 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ke5 | |||||||||||||||||||||
| Enzymes | 1ke6 | 1ke6-ls2-2.00-d-1 | 765 | oncolytic | cyclin-dependent kinase 2 CDK2 |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer | inhibition of cell cycle controlling enzyme CDK2 apoptosis in tumour cells |
ls2 | 2.00 | 388627-68-7 | CNS(=O)(=O)Cc1ccc(N/N=C/2\C(=O)Nc3ccc4ncsc4c23)cc1 | 388627-68-7 | cas | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem ;44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
| 1ke6 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ke6 | |||||||||||||||||||||
| 1ke7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ke7 | |||||||||||||||||||||
| 1kie | Q9GPQ4_TRYVI | Q9GPQ4 | KO_id not found | Others | Others | Others | Others | Others | 1kie | |||||||||||||||||||||
| 1klm | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 1klm | |||||||||||||||||||||
| 1kui | VM2T3_PROMU | O57413 | KO_id not found | Others | Others | Others | Others | Others | 1kui | |||||||||||||||||||||
| 1kv1 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1kv1 | |||||||||||||||||||||
| 1l2j | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1l2j | |||||||||||||||||||||
| 1l2s | AMPC_ECOLI | P00811 | K01467 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amides | Beta-lactamase | 1l2s | |||||||||||||||||||||
| 1lcw | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 1lcw | |||||||||||||||||||||
| 1lho | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1lho | |||||||||||||||||||||
| 1lhr | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1lhr | |||||||||||||||||||||
| 1lhv | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1lhv | |||||||||||||||||||||
| 1lkd | BPHC_BURXL | P47228 | K00462 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | Biphenyl-2,3-diol 1,2-dioxygenase | 1lkd | |||||||||||||||||||||
| 1llq | MAOM_ASCSU | P27443 | K00027 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Malate dehydrogenase (oxaloacetate-decarboxylating) | 1llq | |||||||||||||||||||||
| 1lp6 | PYRF_METTH | O26232 | K01591 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Orotidine-5'-phosphate decarboxylase | 1lp6 | |||||||||||||||||||||
| 1lvw | O27819_METTH | O27819 | KO_id not found | Others | Others | Others | Others | Others | 1lvw | |||||||||||||||||||||
| 1ly3 | DYR_PNECA | P16184 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 1ly3 | |||||||||||||||||||||
| 1ly4 | DYR_PNECA | P16184 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 1ly4 | |||||||||||||||||||||
| Enzymes | 1m17 | 1m17-aq4-2.60-h-1 | 2.81133 | oncolytic neurological |
epidermal growth factor receptor ErbB1 | EC2.- (transferases) | kinases (tyrosine) | EGFR | cancer | inhibition (enzyme); | aq4 | 2.60 | 183321-74-6 | [COCCOC=1C=C2C(=CC1OCCOC)N=CN=C2NC=3C=CC=C(C3)C#C] | 183321-74-6 | CAS | Structure of the epidermal growth factor receptor kinase domain alone and in complex with a 4-anilinoquinazoline inhibitor | Stamos J, Sliwkowski MX, Eigenbrot C | J Biol Chem 277(48):46265-72 | 2002 | 10.1074/jbc.M207135200 | |||||||||
| 1m2r | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 1m2r | |||||||||||||||||||||
| 1mvn | HAL3A_ARATH | Q9SWE5 | K01598 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Phosphopantothenoylcysteine decarboxylase | 1mvn | |||||||||||||||||||||
| 1mvt | DYR_HUMAN | P00374 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 1mvt | |||||||||||||||||||||
| 1mxi | TRML_HAEIN | P44868 | K03216 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | TRNA (cytidine34-2'-O)-methyltransferase | 1mxi | |||||||||||||||||||||
| 1n2i | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 1n2i | |||||||||||||||||||||
| 1ndy | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1ndy | |||||||||||||||||||||
| Enzymes | 1nf7 | 1nf7-myd-2.60-d-1 | 1293 | antiinfective oncolytic immunologic |
IMP dehydrogenase | EC1.- (oxydo-reductases) | IMP dehydrogenases | IMPDH | cancer viral infection autoimmune suppression herpes infection fundamental research |
inhibition of conversion of IMP to XMP and consequently of de novo guanine nucleotide biosynthesis depletion of the guanylate (GMP, GDP, GTP and dGTP) pools inhibition of growth and differentiation of human lymphocytes (suppression of T and B lyphocyte proliferation) |
myd | 2.60 | 244242-36-2 | COc1c(C)c2COC(=O)c2c(O)c1CCO[P@](=O)(O)C[P@](=O)(O)OC[C@H]3O[C@H]([C@H](O)[C@@H]3O)n4cnc5c(N)ncnc45 | 244242-36-2 | CAS | Crystal Structure of Human Inosine Monophosphate Dehydrogenase type II complexed with the MPA/NAD analog C2-MAD | Risal D, Strickler MD, Goldstein BM | to be published | 2002 | - | |||||||||
| 1nhz | GCR_HUMAN | P04150 | K05771 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C1, GR; glucocorticoid receptor | Others | 1nhz | |||||||||||||||||||||
| 1nlu | PICP_PSESR | P42790 | KO_id not found | Others | Others | Others | Others | Others | 1nlu | |||||||||||||||||||||
| 1nnu | Q9BH77_PLAFA | Q9BH77 | KO_id not found | Enzymes | 1. Oxidoreductases | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (P.falciparum) | Others | 1nnu | |||||||||||||||||||||
| 1nup | NMNA3_HUMAN | Q96T66 | K06210 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Nicotinamide-nucleotide adenylyltransferase | 1nup | |||||||||||||||||||||
| 1nwk | ACTS_RABIT | P68135 | K10354 | Others | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actins | Actins | 1nwk | |||||||||||||||||||||
| 1o5r | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1o5r | |||||||||||||||||||||
| 1o6g | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1o6g | |||||||||||||||||||||
| 1o6y | PKNB_MYCTU | P0A5S4 | K08884 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1o6y | |||||||||||||||||||||
| 1o6z | MDH_HALMA | Q07841 | K00024 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Malate dehydrogenase | 1o6z | |||||||||||||||||||||
| 1ocn | GUX6_HUMIN | Q9C1S9 | KO_id not found | Others | Others | Others | Others | Others | 1ocn | |||||||||||||||||||||
| 1odc | ACES_TORCA | P04058 | K01049 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Acetylcholinesterase | 1odc | |||||||||||||||||||||
| 1of1 | KITH_HHV11 | P03176 | K00857 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Thymidine kinase | 1of1 | |||||||||||||||||||||
| 1ogu | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ogu | |||||||||||||||||||||
| 1oiq | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1oiq | |||||||||||||||||||||
| 1oq5 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1oq5 | |||||||||||||||||||||
| Enzymes | 1os5 | 1os5-nh1-2.20-d-1 | 2889 | antiinfective | RNA-dependent RNA polymerase (NS5B) from hepatitic C virus | EC2.- (transferases) | RNA polymerases | NS5B (HCV) | hepatitis C virus infection | inhibition of viral replication inhibition of transcription of viral genomic RNA and consequently of viral genome replication |
nh1 | 2.20 | INT-239804-71-8-art-1-d | Cc1cc(SC2=C(O)C[C@](CCc3ccc(O)cc3)(OC2=O)C4CCCC4)c(cc1N)C(C)(C)C | INT-239804-71-8-art-1-d | INT | Crystallographic identification of a noncompetitive inhibitor binding site on the hepatitis C virus NS5B RNA polymerase enzyme | Love RA, Parge HE, Yu X, Hickey MJ, Diehl W, Gao J, Wriggers H, Ekker A, Wang L, Thomson JA, Dragovich PS, Fuhrman SA | J Virol 77(13):7575-81 | 2003 | 10.1128/JVI.77.13.7575-7581.2003 | |||||||||
| Enzymes | 1os5 | 1os5-nh1-2.20-d-2 | 498 | antiinfective | RNA-dependent RNA polymerase (NS5B) from hepatitic C virus | EC2.- (transferases) | RNA polymerases | NS5B (HCV) | hepatitis C virus infection | inhibition of viral replication inhibition of transcription of viral genomic RNA and consequently of viral genome replication |
nh1 | 2.20 | INT-239804-71-8-art-1-d | Cc1cc(SC2=C(O)C[C@](CCc3ccc(O)cc3)(OC2=O)C4CCCC4)c(cc1N)C(C)(C)C | INT-239804-71-8-art-1-d | INT | Crystallographic identification of a noncompetitive inhibitor binding site on the hepatitis C virus NS5B RNA polymerase enzyme | Love RA, Parge HE, Yu X, Hickey MJ, Diehl W, Gao J, Wriggers H, Ekker A, Wang L, Thomson JA, Dragovich PS, Fuhrman SA | J Virol 77(13):7575-81 | 2003 | 10.1128/JVI.77.13.7575-7581.2003 | |||||||||
| 1oum | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1oum | |||||||||||||||||||||
| 1ov6 | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1ov6 | |||||||||||||||||||||
| 1ovg | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1ovg | |||||||||||||||||||||
| 1oxl | PA2B8_DABRR | P59071 | KO_id not found | Others | Others | Others | Others | Others | 1oxl | |||||||||||||||||||||
| Enzymes | 1p2a | 1p2a-5bn-2.5-h-1 | 6.85309 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | sbn | 2.5 | 444099-54-1 | [C=1C=C(NC1)C=2C=C(C=3C(=CC=C4C3C2C(=O)N4)F)NCCN] | 444099-54-1 | CAS | 3,5,6-Trisubstituted Naphthostyrils as CDK2 Inhibitors | Liu, J.-J., Dermatakis, A., Lukacs, C.M., Konzelmann, F., Chen, Y., Kammlott, U., Depinto, W., Yang, H., Yin, X., Chen, Y., Schutt, A., Simcox, M.E., Luk, K.-C. | Bioorg Med Chem 13:2465-2468 | 2003 | 10.1016/S0960-894X(03)00488-8 | |||||||||
| 1p33 | PTR1_LEITA | P42556 | KO_id not found | Enzymes | 1. Oxidoreductases | pteridine reductases | PTR1 (L.tarantolae) | Others | 1p33 | |||||||||||||||||||||
| 1p91 | RLMA_ECOLI | P36999 | K00563 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 23S rRNA (guanine745-N1)-methyltransferase | 1p91 | |||||||||||||||||||||
| Enzymes | 1pbk | 1pbk-rap-2.50-d-1 | 186 | immunologic | 25 kDa FK506 binding protein C-terminal domain peptidyl-prolyl isomerase | EC5.- (isomerases) | peptidyl-prolyl cis-trans isomerases | FKBP | autoimmune suppression | blockage of T-cell activation | rap | 2.50 | rapamycin | CO[C@@H]1C[C@H](C[C@@H](C)[C@@H]2CC(=O)[C@H](C)/C=C(\C)/[C@@H](O)[C@@H](OC)C(=O)[C@H](C)C[C@H](C)/C=C/C=C/C=C(\C)/[C@H](C[C@@H]3CC[C@@H](C)[C@@](O)(O3)C(=O)C(=O)N4CCCC[C@H]4C(=O)O2)OC)CC[C@H]1O | 53123-88-9 | cas | Structure of the human 25 kDa FK506 binding protein complexed with rapamycin | Liang J, Hung DT, Schreiber SL, Clardy J | Am Chem Soc 118 pp. 1231 | 1996 | 10.1021/ja953139w | |||||||||
| 1pj7 | Q9AGP8_ARTGO | Q9AGP8 | KO_id not found | Others | Others | Others | Others | Others | 1pj7 | |||||||||||||||||||||
| 1pjq | CYSG_SALTY | P25924 | K02302 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Precorrin-2 dehydrogenase | 1pjq | |||||||||||||||||||||
| 1pk7 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pk7 | |||||||||||||||||||||
| 1pk9 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pk9 | |||||||||||||||||||||
| 1pke | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pke | |||||||||||||||||||||
| 1pr0 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pr0 | |||||||||||||||||||||
| 1pr4 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pr4 | |||||||||||||||||||||
| 1pr6 | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pr6 | |||||||||||||||||||||
| 1pwm | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 1pwm | |||||||||||||||||||||
| 1pxm | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1pxm | |||||||||||||||||||||
| 1pxn | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1pxn | |||||||||||||||||||||
| 1pye | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1pye | |||||||||||||||||||||
| 1q23 | CAT_ECOLX | P62577 | KO_id not found | Others | Others | Others | Others | Others | 1q23 | |||||||||||||||||||||
| 1q3d | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 1q3d | |||||||||||||||||||||
| 1q5k | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 1q5k | |||||||||||||||||||||
| 1q66 | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 1q66 | |||||||||||||||||||||
| 1q6z | MDLC_PSEPU | P20906 | KO_id not found | Others | Others | Others | Others | Others | 1q6z | |||||||||||||||||||||
| 1qcf | HCK_HUMAN | P08631 | K08893 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1qcf | |||||||||||||||||||||
| 1qjj | ASTA_ASTFL | P07584 | K00673 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Arginine N-succinyltransferase | 1qjj | |||||||||||||||||||||
| 1qk4 | HGXR_TOXGO | Q26997 | KO_id not found | Enzymes | 2. Transferases | phosphoribosyl transferases | HGPRTase (T.gondii) | Others | 1qk4 | |||||||||||||||||||||
| 1qon | ACES_DROME | P07140 | K01049 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Acetylcholinesterase | 1qon | |||||||||||||||||||||
| 1qpe | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 1qpe | |||||||||||||||||||||
| 1qv0 | OBL_OBELO | Q27709 | KO_id not found | Others | Others | Others | Others | Others | 1qv0 | |||||||||||||||||||||
| 1qy5 | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 1qy5 | |||||||||||||||||||||
| 1qy8 | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 1qy8 | |||||||||||||||||||||
| 1qyx | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1qyx | |||||||||||||||||||||
| Enzymes | 1r0p | 1r0p-ksa-1.80-d-1 | 1187 | oncolytic | protein-tyrosine kinase (hepatocyte growth factor receptor tyrosine kinase) | EC2.- (transferases) | kinases (tyrosine) | c-Met | cancer | inhibition of enzyme activation via autophosphorylation inhibition of cell proliferation |
ksa | 1.80 | K-252A | COC(=O)[C@@]1(O)C[C@H]2O[C@]1(C)n3c4ccccc4c5c6CNC(=O)c6c7c8ccccc8n2c7c35 | 99533-80-9 | cas | Crystal structure of the tyrosine kinase domain of the hepatocyte growth factor receptor c-Met and its complex with the microbial alkaloid K-252a | Schiering N, Knapp S, Marconi M, Flocco MM, Cui J, Perego R, Rusconi L, Cristiani C | Proc Natl Acad Sci U S A 100(22):12654-9 | 2003 | 10.1073/pnas.1734128100 | |||||||||
| 1rct | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1rct | |||||||||||||||||||||
| 1rd4 | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 1rd4 | |||||||||||||||||||||
| 1rev | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rev | |||||||||||||||||||||
| 1rfg | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1rfg | |||||||||||||||||||||
| 1rft | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1rft | |||||||||||||||||||||
| 1rjk | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 1rjk | |||||||||||||||||||||
| 1rkd | RBSK_ECOLI | P0A9J6 | K00852 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Ribokinase | 1rkd | |||||||||||||||||||||
| 1rkg | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 1rkg | |||||||||||||||||||||
| 1rmh | PPIA_CHLAE | P62938 | K03767 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 1rmh | |||||||||||||||||||||
| 1rq9 | Q5RTL1_9HIV1 | Q5RTL1 | KO_id not found | Others | Others | Others | Others | Others | 1rq9 | |||||||||||||||||||||
| 1rrv | Q9AFC7_AMYOR | Q9AFC7 | KO_id not found | Others | Others | Others | Others | Others | 1rrv | |||||||||||||||||||||
| 1rt1 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rt1 | |||||||||||||||||||||
| 1rt6 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rt6 | |||||||||||||||||||||
| 1rxj | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 1rxj | |||||||||||||||||||||
| 1ry0 | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 1ry0 | |||||||||||||||||||||
| 1s2c | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 1s2c | |||||||||||||||||||||
| 1s64 | FNTA_RAT | Q04631 | K05955 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Protein farnesyltransferase | 1s64 | |||||||||||||||||||||
| 1s9d | ARF1_BOVIN | P84080 | K07937 | GTP-binding proteins | Small (Monomeric) G-proteins | Arf-Sar Family | Arf-Arl1 | ARF1; ADP-ribosylation factor 1 | 1s9d | |||||||||||||||||||||
| 1s9p | ERR3_MOUSE | P62509 | K01689 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Phosphopyruvate hydratase | 1s9p | |||||||||||||||||||||
| 1sbr | YKOF_BACSU | O34911 | KO_id not found | Others | Others | Others | Others | Others | 1sbr | |||||||||||||||||||||
| 1sd1 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1sd1 | |||||||||||||||||||||
| 1sd2 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1sd2 | |||||||||||||||||||||
| 1sjw | Q9RN59_STRNO | Q9RN59 | KO_id not found | Others | Others | Others | Others | Others | 1sjw | |||||||||||||||||||||
| 1srg | SAV_STRAV | P22629 | KO_id not found | Other proteins | Bacterial proteins | binding proteins | streptavidin | Others | 1srg | 1895 | ||||||||||||||||||||
| 1srj | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 1srj | |||||||||||||||||||||
| 1szm | KAPCA_BOVIN | P00517 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 1szm | |||||||||||||||||||||
| 1t2w | Q9S446_STAAU | Q9S446 | KO_id not found | Others | Others | Others | Others | Others | 1t2w | |||||||||||||||||||||
| 1t47 | HPPD_STRAW | Q53586 | K00457 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | 4-hydroxyphenylpyruvate dioxygenase | 1t47 | |||||||||||||||||||||
| 1t7j | POL_HV1Y2 | P35963 | KO_id not found | Others | Others | Others | Others | Others | 1t7j | |||||||||||||||||||||
| 1t7k | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 1t7k | |||||||||||||||||||||
| 1t90 | IOLA_BACSU | P42412 | K00140 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Malonate-semialdehyde dehydrogenase (acetylating) | 1t90 | |||||||||||||||||||||
| 1tbb | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1tbb | |||||||||||||||||||||
| 1tbf | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 1tbf | |||||||||||||||||||||
| 1tez | PHR_SYNP6 | P05327 | K01669 | Enzymes | Lyases | Carbon-carbon lyases | Other carbon-carbon lyases | Deoxyribodipyrimidine photo-lyase | 1tez | |||||||||||||||||||||
| 1th8 | SP2AB_GEOSE | O32727 | K06379 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1th8 | |||||||||||||||||||||
| 1tka | TKT1_YEAST | P23254 | K00615 | Enzymes | Transferases | Transferring aldehyde or ketonic groups | Transketolases and transaldolases | Transketolase | 1tka | |||||||||||||||||||||
| 1tkt | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tkt | |||||||||||||||||||||
| 1tkx | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tkx | |||||||||||||||||||||
| 1tkz | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tkz | |||||||||||||||||||||
| 1tl1 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tl1 | |||||||||||||||||||||
| 1tou | FABP4_HUMAN | P15090 | KO_id not found | Others | Others | Others | Others | Others | 1tou | |||||||||||||||||||||
| 1tqf | BACE1_HUMAN | P56817 | K04521 | Peptidases | Aspartic Peptidase | Family A1 pepsin family | Beta-secretase 1 | Others | 1tqf | 9606 | ||||||||||||||||||||
| 1trk | TKT1_YEAST | P23254 | K00615 | Enzymes | Transferases | Transferring aldehyde or ketonic groups | Transketolases and transaldolases | Transketolase | 1trk | |||||||||||||||||||||
| 1tv6 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 1tv6 | |||||||||||||||||||||
| 1tvo | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1tvo | |||||||||||||||||||||
| 1tz8 | TTHY_HUMAN | P02766 | KO_id not found | Others | Others | Others | Others | Others | 1tz8 | |||||||||||||||||||||
| 1u3r | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1u3r | |||||||||||||||||||||
| 1u3s | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1u3s | |||||||||||||||||||||
| 1u59 | ZAP70_HUMAN | P43403 | K07360 | Cellular antigens | Non-CD molecules | ZAP70; zeta-chain (TCR) associated protein kinase 70kDa | Others | Others | 1u59 | |||||||||||||||||||||
| 1u71 | DYR_HUMAN | P00374 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 1u71 | |||||||||||||||||||||
| 1u9z | KPRS_METJA | Q58761 | K00948 | Enzymes | Transferases | Transferring phosphorus-containing groups | Diphosphotransferases | Ribose-phosphate diphosphokinase | 1u9z | |||||||||||||||||||||
| 1uho | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 1uho | |||||||||||||||||||||
| Enzymes | 1ung | 1ung-alh-2.30-h-1 | 1.92692 | oncolytic neurological |
cdk5 cell division kinase 5 pssalre cyclin-dependent kinase 5 pdpk proline-directed protein kinase 33kDa subunit Proline-directed protein kinase F(A) serine/threonine protein kinase pssalre tpk II catalytic subunit tau protein kinase II catalytic subunit |
EC2.- (transferases) | kinases (serine-threonine) | CDK5 | cognitive defects cancer |
inhibition (enzyme); competitive | alh | 2.30 | 496864-16-5 | [CCCCC=1C2=C(NC1C3=CC=C(C=C3)O)N=CC=N2] | 496864-16-5 | CAS | Mechanism of CDK5/p25 binding by CDK inhibitors | Mapelli M, Massimiliano L, Crovace C, Seeliger MA, Tsai LH, Meijer L, Musacchio A | J Med Chem 48(3):671-9 | 2005 | 10.1021/jm049323m | |||||||||
| Enzymes | 1unl | 1unl-rrc-2.20-h-1 | 2.63982 | oncolytic neurological |
cdk5 cell division kinase 5 pssalre cyclin-dependent kinase 5 pdpk proline-directed protein kinase 33kDa subunit Proline-directed protein kinase F(A) serine/threonine protein kinase pssalre tpk II catalytic subunit tau protein kinase II catalytic subunit |
EC2.- (transferases) | kinases (serine-threonine) | CDK5 | cognitive defects cancer |
inhibition (enzyme); competitive | rrc | 2.20 | 186692-46-6 | [CC[C@H](CO)NC1=NC(=C2C(=N1)N(C=N2)C(C)C)NCC3=CC=CC=C3] | 186692-46-6 | CAS | Mechanism of CDK5/p25 binding by CDK inhibitors | Mapelli M, Massimiliano L, Crovace C, Seeliger MA, Tsai LH, Meijer L, Musacchio A | J Med Chem 48(3):671-9 | 2005 | 10.1021/jm049323m | |||||||||
| 1unl | CDK5_HUMAN | Q00535 | K02090 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1unl | |||||||||||||||||||||
| 1uoo | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1uoo | |||||||||||||||||||||
| 1uop | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1uop | |||||||||||||||||||||
| 1uoq | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1uoq | |||||||||||||||||||||
| 1upb | Q9LCV9_STRCL | Q9LCV9 | KO_id not found | Others | Others | Others | Others | Others | 1upb | |||||||||||||||||||||
| Enzymes | 1urw | 1urw-i1p-1.60-h-1 | 10.45488 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | i1p | 1.60 | 453547-81-4 | [CN(C)CCCNS(=O)(=O)C1=CC=C(C=C1)NC=2N=CC=C(N2)C3=CN=C4N3N=CC=C4] | 453547-81-4 | CAS | Imidazo[1,2-b]pyridazines: a potent and selective class of cyclin-dependent kinase inhibitors | Byth, K.F., Cooper, N., Culshaw, J.D., Heaton, D.W., Oakes, S.E., Minshull, C.A., Norman, R.A., Pauptit, R.A., Tucker, J.A., Breed, J., Pannifer, A., Rowsell, S., Stanway, J.J., Valentine, A.L., Thomas, A.P. | Bioorg Med Chem Lett 14:2249-2252 | 2004 | 10.1016/j.bmcl.2004.02.008 | |||||||||
| 1uu3 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1uu3 | |||||||||||||||||||||
| 1uu7 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1uu7 | |||||||||||||||||||||
| 1v1k | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1v1k | |||||||||||||||||||||
| 1vkg | HDAC8_HUMAN | Q9BY41 | K11405 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Histone deacetylase | 1vkg | |||||||||||||||||||||
| 1vwe | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 1vwe | |||||||||||||||||||||
| Enzymes | 1w0g | 1w0g-myt-2.74-x-1 | 13889 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | myt | 2.74 | metyrapone | CC(C)(C(=O)c1cccnc1)c2cccnc2 | 54-36-4 | cas | Crystal structures of human cytochrome P450 3A4 bound to metyrapone and progesterone | Williams PA, Cosme J, Vinkovic DM, Ward A, Angove HC, Day PJ, Vonrhein C, Tickle IJ, Jhoti H | Science 305(5684):683-6 | 2004 | 10.1126/science.1099736 | |||||||||
| 1w0x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1w0x | |||||||||||||||||||||
| Enzymes | 1w1y | 1w1y-typ-1.90-d-1 | 1365 | antiinfective | Serratia marcescens chitinase | EC3.- (hydrolases) | glycosidases | chitinase (S.marcescens) | bacterial infection | inhibition of bacterial chitinase | typ | 1.90 | maculosin | Oc1ccc(C[C@@H]2NC(=O)[C@@H]3CCCN3C2=O)cc1 | 4549-02-4 | CAS | Structure-based exploration of cyclic dipeptide chitinase inhibitors | Houston DR, Synstad B, Eijsink VG, Stark MJ, Eggleston IM, van Aalten DM | J Med Chem 47(23):5713-20 | 2004 | 10.1021/jm049940a | |||||||||
| 1w2h | KTHY_MYCTU | O05891 | K00943 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with a phosphate group as acceptor | DTMP kinase | 1w2h | |||||||||||||||||||||
| 1wbv | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wbv | |||||||||||||||||||||
| 1wbw | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wbw | |||||||||||||||||||||
| 1wl4 | THIC_HUMAN | Q9BWD1 | K00626 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Acetyl-CoA C-acetyltransferase | 1wl4 | |||||||||||||||||||||
| 1wok | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 1wok | |||||||||||||||||||||
| 1wsv | GCST_HUMAN | P48728 | K00605 | Enzymes | Transferases | Transferring one-carbon groups | Hydroxymethyl-, formyl- and related transferases | Aminomethyltransferase | 1wsv | |||||||||||||||||||||
| 1wxz | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1wxz | |||||||||||||||||||||
| 1x76 | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1x76 | |||||||||||||||||||||
| 1x78 | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1x78 | |||||||||||||||||||||
| 1x7b | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1x7b | |||||||||||||||||||||
| 1x7e | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 1x7e | |||||||||||||||||||||
| 1x97 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 1x97 | |||||||||||||||||||||
| 1xan | GSHR_HUMAN | P00390 | K00383 | Enzymes | Oxidoreductases | Acting on a sulfur group of donors | With NAD+ or NADP+ as acceptor | Glutathione-disulfide reductase | 1xan | |||||||||||||||||||||
| 1xbc | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1xbc | |||||||||||||||||||||
| 1xlx | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xlx | |||||||||||||||||||||
| 1xnn | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1xnn | |||||||||||||||||||||
| 1xom | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xom | |||||||||||||||||||||
| 1xow | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1xow | |||||||||||||||||||||
| Enzymes | 1xoz | 1xoz-cia-1.37-x-1 | 4.298284862 | cardiovascular | phosphodiesterase 5A | EC3.- (hydrolases) | phosphodiesterases | PDE 5A | cardiovascular diseases | inhibition of cGMP degradation | cia | 1.37 | tadalafil | CN1CC(=O)N2[C@@H](C1=O)CC=3C4=CC=CC=C4NC3[C@H]2C5=CC=C6C(=C5)OCO6 | 171596-29-5 | CAS | Structural basis for the activity of drugs that inhibit phosphodiesterases | Card GL, England BP, Suzuki Y, Fong D, Powell B, Lee B, Luu C, Tabrizizad M, Gillette S, Ibrahim PN, Artis DR, Bollag G, Milburn MV, Kim SH, Schlessinger J, Zhang KY | Structure 12(12):2233-47 | 2004 | 10.1016/j.str.2004.10.004 | |||||||||
| 1xp0 | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 1xp0 | |||||||||||||||||||||
| 1xqp | AGOG_PYRAE | Q8ZVK6 | K01741 | Enzymes | Lyases | Carbon-oxygen lyases | Other carbon-oxygen lyases | DNA-(apurinic or apyrimidinic site) lyase | 1xqp | |||||||||||||||||||||
| 1y2e | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1y2e | |||||||||||||||||||||
| 1y2g | ZIPA_ECOLI | P77173 | KO_id not found | Others | Others | Others | Others | Others | 1y2g | |||||||||||||||||||||
| 1y2h | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1y2h | |||||||||||||||||||||
| 1y2k | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1y2k | |||||||||||||||||||||
| Enzymes | 1y57 | 1y57-mpz-1.91-h-1 | 249 | oncolytic | proto-oncogene tyrosine-protein kinase SRC c-src tyrosine kinase Pp60(src) src tyrosine kinase tyrosine kinase p60-src c-src tk |
EC2.- (transferases) | kinases (tyrosine) | c-Src | cancer osteoporosis |
no info | mpz | 1.91 | 152459-93-3 | CN1CCN(Cc2ccc(cc2)C(=O)Nc3cccc(Nc4nccc(n4)c5cccnc5)c3)CC1 | 152459-93-3 | CAS | The crystal structure of a c-Src complex in an active conformation suggests possible steps in c-Src activation | Cowan-Jacob SW, Fendrich G, Manley PW, Jahnke W, Fabbro D, Liebetanz J, Meyer T | Structure (Camb) 13(6):861-71 | 2005 | 10.1016/j.str.2005.03.012 | |||||||||
| 1y5x | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 1y5x | |||||||||||||||||||||
| 1y6a | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 1y6a | |||||||||||||||||||||
| 1y8j | NEP_HUMAN | P08473 | K01389 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neprilysin | 1y8j | |||||||||||||||||||||
| Enzymes | 1y8y | 1y8y-ct7-2.00-h-1 | 8.64877 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | ct7 | 2.00 | 771498-73-8 | [CS(=O)(=O)C1=CC=C(C=C1)NC2=CC(=NC=3N2N=CC3)Cl] | 771498-73-8 | CAS | Structure-guided design of pyrazolo[1,5-a]pyrimidines as inhibitors of human cyclin-dependent kinase 2 | Williamson, D.S., Parratt, M.J., Bower, J.F., Moore, J.D., Richardson, C.M., Dokurno, P., Cansfield, A.D., Francis, G.L., Hebdon, R.J., Howes, R., Jackson, P.S., Lockie, A.M., Murray, J.B., Nunns, C.L., Powles, J., Robertson, A., Surgenor, A.E., Torrance, C.J. | Bioorg Med Chem Lett 15:863-867 | 2005 | 10.1016/j.bmcl.2004.12.073 | |||||||||
| 1y8y | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1y8y | |||||||||||||||||||||
| 1ygk | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1ygk | |||||||||||||||||||||
| 1yhj | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1yhj | |||||||||||||||||||||
| 1ykd | P94182_9NOST | P94182 | KO_id not found | Others | Others | Others | Others | Others | 1ykd | |||||||||||||||||||||
| 1ysz | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 1ysz | |||||||||||||||||||||
| 1yw2 | MK14_MOUSE | P47811 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1yw2 | |||||||||||||||||||||
| 1yw9 | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 1yw9 | |||||||||||||||||||||
| Enzymes | 1z4r | 1z4r-aco-1.74-t-2 | 2445 | oncolytic | general control of amino acid synthesis protein 5-like 2 (histone acetyltransferase GCN5L2) | EC2.- (transferases) | acyltransferases | GCN5 | cancer | GCN5L2 inhibition influences transcription and is suggested to moderate other DNA-based mechanisms as well (e.g. cell-cycle progression, DNA recombination, DNA repair, and apoptosis). | aco | 1.74 | acetyl coenzyme A | CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)CO[P@@](=O)(O)O[P@@](=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)O | 72-89-9 | cas | Crystal Structure of Human Acetyltransferase GCN5 | Bernstein G, Dong A, Schuetz A, Antoshenko T, Wu H, Loppnau P, Bochkarev A, Plotnikov A | to be published | 2006 | ||||||||||
| 1z5m | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1z5m | |||||||||||||||||||||
| 1z5o | MTNN_ECO57 | P0AF14 | K01243 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | Adenosylhomocysteine nucleosidase | 1z5o | |||||||||||||||||||||
| 1z5v | TBG1_HUMAN | P23258 | K10389 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulins | TUBG; tubulin gamma | 1z5v | |||||||||||||||||||||
| 1zaf | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1zaf | |||||||||||||||||||||
| 1zdp | THER_BACTH | P00800 | KO_id not found | Others | Others | Others | Others | Others | 1zdp | |||||||||||||||||||||
| 1zfj | IMDH_STRPY | P0C0H6 | K00088 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | IMP dehydrogenase | 1zfj | |||||||||||||||||||||
| 1zgi | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1zgi | |||||||||||||||||||||
| 1zht | KES1_YEAST | P35844 | KO_id not found | Others | Others | Others | Others | Others | 1zht | |||||||||||||||||||||
| 1zhx | KES1_YEAST | P35844 | KO_id not found | Others | Others | Others | Others | Others | 1zhx | |||||||||||||||||||||
| 1zhz | KES1_YEAST | P35844 | KO_id not found | Others | Others | Others | Others | Others | 1zhz | |||||||||||||||||||||
| 1zkk | SETD8_HUMAN | Q9NQR1 | K11428 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 1zkk | |||||||||||||||||||||
| 1zp5 | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1zp5 | |||||||||||||||||||||
| 2a0c | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2a0c | |||||||||||||||||||||
| 2a3i | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 2a3i | |||||||||||||||||||||
| 2a7x | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 2a7x | |||||||||||||||||||||
| 2ab2 | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 2ab2 | |||||||||||||||||||||
| Enzymes | 2aia | 2aia-sb8-1.70-d-1 | 1.47651007 | antiinfective | bacterial peptide deformylase | EC3.- (hydrolases) | amidases | PDF (S.pneumoniae) | bacterial infection | interference with bacterial protein maturation | sb8 | 1.70 | SB-543668 | C1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)OCCN(C=O)O | 372951-18-3 | cas | Structural variation and inhibitor binding in polypeptide deformylase from four different bacterial species | Smith KJ, Petit CM, Aubart K, Smyth M, McManus E, Jones J, Fosberry A, Lewis C, Lonetto M, Christensen SB | Protein Sci 12(2):349-60 | 2003 | 10.1110/ps.0229303 | |||||||||
| 2aio | BLA1_STEMA | P52700 | K06479 (inferred by homologyHUMAN) | CAM ligands | 1. Immunoglobulin Superfamily | Immune system | CD2 family | Metallo-beta-lactamase L1 | 2aio | 40324 | ||||||||||||||||||||
| 2ax6 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax6 | |||||||||||||||||||||
| 2ax8 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax8 | |||||||||||||||||||||
| 2ax9 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax9 | |||||||||||||||||||||
| 2axr | Q6PW77_ACRST | Q6PW77 | KO_id not found | Others | Others | Others | Others | Others | 2axr | |||||||||||||||||||||
| 2b54 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2b54 | |||||||||||||||||||||
| 2bfr | Y1521_ARCFU | O28751 | KO_id not found | Others | Others | Others | Others | Others | 2bfr | |||||||||||||||||||||
| 2bfy | AUKBA_XENLA | Q6DE08 | K11479 | Chromosome | Eukaryotic Type | Centromeric chromatin formation proteins | Kinetochore proteins | Serine-threonine-protein kinase 12-A | 2bfy | 8355 | ||||||||||||||||||||
| 2bgd | PTN1_HUMAN | P18031 | K05696 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-monoester hydrolases | Protein-tyrosine-phosphatase | 2bgd | |||||||||||||||||||||
| 2bhe | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2bhe | |||||||||||||||||||||
| Enzymes | 2bhh | 2bhh-ryu-2.60-h-1 | 2.43102 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | ryu | 2.60 | 860817-52-3 | [C[C@@]1(C2=CC=CC=C2NC1=C3C=4C=C(C=CC4NC3=O)S(=O)(=O)N5CCC(CC5)O)O] | 860817-52-3 | CAS | From the insoluble dye indirubin towards highly active, soluble CDK2-inhibitors | Jautelat, R., Brumby, T., Schafer, M., Briem, H., Eisenbrand, G., Schwahn, S., Kruger, M., Lucking, U., Prien, O., Siemeister, G. | Chembiochem 6:531-540 | 2005 | 10.1002/cbic.200400108 | |||||||||
| 2bik | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bik | |||||||||||||||||||||
| 2bmc | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bmc | |||||||||||||||||||||
| 2boh | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2boh | |||||||||||||||||||||
| 2bpm | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2bpm | |||||||||||||||||||||
| 2br1 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2br1 | |||||||||||||||||||||
| 2brb | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brb | |||||||||||||||||||||
| 2brm | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brm | |||||||||||||||||||||
| 2brn | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brn | |||||||||||||||||||||
| 2bro | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bro | |||||||||||||||||||||
| 2bsx | Q8T9Z7_PLAFA | Q8T9Z7 | KO_id not found | Others | Others | Others | Others | Others | 2bsx | |||||||||||||||||||||
| 2btr | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2btr | |||||||||||||||||||||
| 2buj | STK16_HUMAN | O75716 | K08856 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2buj | |||||||||||||||||||||
| 2c31 | OXC_OXAFO | P40149 | K01577 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Oxalyl-CoA decarboxylase | 2c31 | |||||||||||||||||||||
| 2c3m | P94692_DESAF | P94692 | KO_id not found | Others | Others | Others | Others | Others | 2c3m | |||||||||||||||||||||
| 2c5n | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c5n | |||||||||||||||||||||
| 2c5x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c5x | |||||||||||||||||||||
| 2c69 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c69 | |||||||||||||||||||||
| 2cgw | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2cgw | |||||||||||||||||||||
| 2chw | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2chw | |||||||||||||||||||||
| 2cmf | ACES_TORCA | P04058 | K01049 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Acetylcholinesterase | 2cmf | |||||||||||||||||||||
| 2d3s | LEC1_PSOTE | O24313 | KO_id not found | Others | Others | Others | Others | Others | 2d3s | |||||||||||||||||||||
| 2dq7 | FYN_HUMAN | P06241 | K05703 | CAM ligands | 1. Immunoglobulin Superfamily | Immune system | CD2 family | Tyrosine-protein kinase Fyn | 2dq7 | 9606 | ||||||||||||||||||||
| 2ds1 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2ds1 | |||||||||||||||||||||
| 2e1w | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 2e1w | |||||||||||||||||||||
| 2e9u | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2e9u | |||||||||||||||||||||
| 2e9v | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2e9v | |||||||||||||||||||||
| 2egh | DXR_ECOLI | P45568 | K00099 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 1-deoxy-D-xylulose-5-phosphate reductoisomerase | 2egh | |||||||||||||||||||||
| 2egv | RSME_AQUAE | O66552 | K09761 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 16S rRNA (uracil1498-N3)-methyltransferase | 2egv | |||||||||||||||||||||
| 2ekp | Q53W82_THET8 | Q53W82 | K00065 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 2-deoxy-D-gluconate 3-dehydrogenase | 2ekp | |||||||||||||||||||||
| 2euf | CGH2_SHV21 | Q01043 | KO_id not found | Others | Others | Others | Others | Others | 2euf | |||||||||||||||||||||
| Enzymes | 2ew6 | 2ew6-y13-2.20-d-1 | 0.09246831 | antiinfective | bacterial peptide deformylase | EC3.- (hydrolases) | amidases | PDF (H.pylori) | bacterial infection | interference with bacterial protein maturation | y13 | 2.20 | N-trans-caffeoyltyramine | C=1C=C(C=CC1CCNC(=O)C=CC=2C=CC(=C(C2)O)O)O | 103188-48-3 | cas | Peptide deformylase is a potential target for anti-Helicobacter pylori drugs: reverse docking, enzymatic assay, and X-ray crystallography validation | Cai J, Han C, Hu T, Zhang J, Wu D, Wang F, Liu Y, Ding J, Chen K, Yue J, Shen X, Jiang H | Protein Sci 15(9):2071-81 | 2006 | 10.1110/ps.062238406 | |||||||||
| 2ez4 | POXB_LACPL | P37063 | K00158 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With oxygen as acceptor | Pyruvate oxidase | 2ez4 | |||||||||||||||||||||
| 2f1o | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 2f1o | |||||||||||||||||||||
| 2gmv | PCKGC_HUMAN | P35558 | K01596 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Phosphoenolpyruvate carboxykinase (GTP) | 2gmv | |||||||||||||||||||||
| 2h44 | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 2h44 | |||||||||||||||||||||
| 2hbh | VDRA_DANRE | Q9PTN2 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 2hbh | |||||||||||||||||||||
| 2hc4 | VDRA_DANRE | Q9PTN2 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 2hc4 | |||||||||||||||||||||
| 2hct | CD38_HUMAN | P28907 | K01242 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | NAD+ nucleosidase | 2hct | |||||||||||||||||||||
| 2hkj | TOP6B_SULSH | O05207 | KO_id not found | Others | Others | Others | Others | Others | 2hkj | |||||||||||||||||||||
| 2hl2 | SYT_PYRAB | Q9UZ14 | K01868 | Enzymes | Ligases | Forming carbon-oxygen bonds | Ligases forming aminoacyl-tRNA and related compounds | Threonine---tRNA ligase | 2hl2 | |||||||||||||||||||||
| 2hoc | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2hoc | |||||||||||||||||||||
| 2hog | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2hog | |||||||||||||||||||||
| 2hxl | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2hxl | |||||||||||||||||||||
| 2hxm | UNG_HUMAN | P13051 | K03648 | DNA repair and recombination proteins | Prokaryotic Type | SSBR (single strand breaks repair) | BER (base exicision repair) | DNA glycosylases | 2hxm | |||||||||||||||||||||
| 2hxz | CATS_HUMAN | P25774 | K01368 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Cysteine endopeptidases | Cathepsin S | 2hxz | |||||||||||||||||||||
| 2i0g | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2i0g | |||||||||||||||||||||
| 2i0j | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2i0j | |||||||||||||||||||||
| 2i1m | CSF1R_HUMAN | P07333 | K05090 | Cellular antigens | CD (clusters of differentiation) molecules | CD115; colony stimulating factor 1 receptor (macrophage) | Others | Others | 2i1m | |||||||||||||||||||||
| 2i2d | PPNK1_LISMO | Q8Y8D7 | K00858 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | NAD+ kinase | 2i2d | |||||||||||||||||||||
| 2igq | EHMT1_HUMAN | Q9H9B1 | K11420 | Chromosome | Eukaryotic Type | Histone modification proteins | HMTs (histone methyltransferases) | HKMTs (histone lysine methyltransferases) | 2igq | |||||||||||||||||||||
| 2ihq | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ihq | |||||||||||||||||||||
| 2iht | Q9LCV9_STRCL | Q9LCV9 | KO_id not found | Others | Others | Others | Others | Others | 2iht | |||||||||||||||||||||
| 2ihv | Q9LCV9_STRCL | Q9LCV9 | KO_id not found | Others | Others | Others | Others | Others | 2ihv | |||||||||||||||||||||
| 2ikg | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2ikg | |||||||||||||||||||||
| 2ikh | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2ikh | |||||||||||||||||||||
| 2ilt | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 2ilt | |||||||||||||||||||||
| 2in6 | WEE1_HUMAN | P30291 | K06632 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2in6 | |||||||||||||||||||||
| 2io6 | WEE1_HUMAN | P30291 | K06632 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2io6 | |||||||||||||||||||||
| 2ipf | AK1CL_MOUSE | Q91WR5 | KO_id not found | Others | Others | Others | Others | Others | 2ipf | |||||||||||||||||||||
| 2ivs | RET_HUMAN | P07949 | K05126 | Cytokine receptors | Receptor tyrosine kinase | RTK class XIV (RET receptor family) | RET; proto-oncogene tyrosine-protein kinase Ret | Others | 2ivs | |||||||||||||||||||||
| Other proteins | 2izl | 2izl-imi-1.48-d-2 | 108 | antiinfective | streptavidin | Bacterial proteins | binding proteins | streptavidin | fundamental research | stabilisation of streptavidin tool for universal test systems in immunology and molecular diagnostics system for analysis of intermolecular interactions of the tight binding of the small molecule ligand biotin to the protein |
imi | 1.48 | iminobiotin | OC(=O)CCCC[C@@H]1SC[C@@H]2NC(=N)N[C@H]12 | 13395-35-2 | CAS | Binding of biotin to streptavidin stabilizes intersubunit salt bridges between Asp61 and His87 at low pH | Katz BA | J Mol Biol 274(5):776-800 | 1997 | 10.1006/jmbi.1997.1444 | |||||||||
| 2izu | KC1G3_HUMAN | Q9Y6M4 | K08958 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2izu | |||||||||||||||||||||
| 2j07 | PHR_THET8 | P61497 | K01669 | Enzymes | Lyases | Carbon-carbon lyases | Other carbon-carbon lyases | Deoxyribodipyrimidine photo-lyase | 2j07 | |||||||||||||||||||||
| 2j50 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2j50 | |||||||||||||||||||||
| 2j7y | ESR2_RAT | Q62986 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2j7y | |||||||||||||||||||||
| 2j9m | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2j9m | |||||||||||||||||||||
| 2jc6 | KCC1D_HUMAN | Q8IU85 | K08794 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2jc6 | |||||||||||||||||||||
| 2jib | OXC_OXAFO | P40149 | K01577 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Oxalyl-CoA decarboxylase | 2jib | |||||||||||||||||||||
| 2jj3 | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2jj3 | |||||||||||||||||||||
| 2jj8 | DNK_DROME | Q9XZT6 | K05961 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Deoxynucleoside kinase | 2jj8 | |||||||||||||||||||||
| 2jla | MEND_ECOLI | P17109 | K02551 | Enzymes | Transferases | Transferring aldehyde or ketonic groups | Transketolases and transaldolases | 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylic-acid synthase | 2jla | |||||||||||||||||||||
| 2jle | Q72547_9HIV1 | Q72547 | KO_id not found | Others | Others | Others | Others | Others | 2jle | |||||||||||||||||||||
| 2kzz | DPO1_ECOLI | P00582 | K02335 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | DNA-directed DNA polymerase | 2kzz | |||||||||||||||||||||
| 2nnl | P93799_VITVI | P93799 | KO_id not found | Others | Others | Others | Others | Others | 2nnl | |||||||||||||||||||||
| 2nq6 | AMPM1_HUMAN | P53582 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 2nq6 | |||||||||||||||||||||
| 2nv7 | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2nv7 | |||||||||||||||||||||
| 2nvc | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2nvc | |||||||||||||||||||||
| 2o1u | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 2o1u | |||||||||||||||||||||
| 2o4j | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 2o4j | |||||||||||||||||||||
| 2o4r | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 2o4r | |||||||||||||||||||||
| 2o7o | TETR4_ECOLX | P0ACT4 | KO_id not found | Others | Others | Others | Others | Others | 2o7o | |||||||||||||||||||||
| 2o8h | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2o8h | |||||||||||||||||||||
| 2o9r | BGLB_PAEPO | P22505 | K01223 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | 6-phospho-beta-glucosidase | 2o9r | |||||||||||||||||||||
| 2oaz | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 2oaz | |||||||||||||||||||||
| 2obx | RISB2_RHILO | Q986N2 | K00794 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | 6,7-dimethyl-8-ribityllumazine synthase | 2obx | |||||||||||||||||||||
| 2oi0 | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 2oi0 | |||||||||||||||||||||
| 2ojg | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2ojg | |||||||||||||||||||||
| 2on6 | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 2on6 | |||||||||||||||||||||
| 2ops | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 2ops | |||||||||||||||||||||
| 2our | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2our | |||||||||||||||||||||
| 2ovh | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 2ovh | |||||||||||||||||||||
| 2ow3 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 2ow3 | |||||||||||||||||||||
| 2owb | PLK1_HUMAN | P53350 | K06631 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Polo kinase | 2owb | |||||||||||||||||||||
| 2p2h | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 2p2h | |||||||||||||||||||||
| 2pan | GCL_ECOLI | P0AEP7 | K01608 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Tartronate-semialdehyde synthase | 2pan | |||||||||||||||||||||
| 2pdg | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2pdg | |||||||||||||||||||||
| 2pdw | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2pdw | |||||||||||||||||||||
| 2pe2 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2pe2 | |||||||||||||||||||||
| 2pnu | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2pnu | |||||||||||||||||||||
| 2pog | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2pog | |||||||||||||||||||||
| Receptors | 2prg | 2prg-brl-2.30-p-1 | 872 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | obesity | activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
brl | 2.30 | rosiglitazone | CN(CCOc1ccc(C[C@@H]2SC(=O)NC2=O)cc1)c3ccccn3 | 163860-15-9 | CAS | Ligand binding and co-activator assembly of the peroxisome proliferator-activated receptor-gamma | Nolte RT, Wisely GB, Westin S, Cobb JE, Lambert MH, Kurokawa R, Rosenfeld MG, Willson TM, Glass CK, Milburn MV | Nature 395(6698):137-43 | 1998 | 10.1038/25931 | |||||||||
| 2psj | LUCI_RENRE | P27652 | KO_id not found | Others | Others | Others | Others | Others | 2psj | |||||||||||||||||||||
| 2pvh | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2pvh | |||||||||||||||||||||
| 2pvj | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2pvj | |||||||||||||||||||||
| 2pvn | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2pvn | |||||||||||||||||||||
| 2pw3 | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2pw3 | |||||||||||||||||||||
| 2pza | NADE_BACAN | Q81RP3 | K01916 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-ammonia (or amine) ligases (amide synthases) | NAD+ synthase | 2pza | |||||||||||||||||||||
| 2pzi | PKNG_MYCTU | P65728 | K14949 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2pzi | |||||||||||||||||||||
| 2q11 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 2q11 | |||||||||||||||||||||
| 2q15 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 2q15 | |||||||||||||||||||||
| 2q29 | OXC_ECOLI | P0AFI0 | K01577 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Oxalyl-CoA decarboxylase | 2q29 | |||||||||||||||||||||
| 2q4h | GALT_ARATH | Q9FK51 | K00965 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | UDP-glucose---hexose-1-phosphate uridylyltransferase | 2q4h | |||||||||||||||||||||
| 2q5q | DCIP_AZOBR | P51852 | KO_id not found | Others | Others | Others | Others | Others | 2q5q | |||||||||||||||||||||
| 2q7o | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 2q7o | |||||||||||||||||||||
| 2q8g | PDK1_HUMAN | Q15118 | K12077 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2q8g | |||||||||||||||||||||
| 2q8i | PDK3_HUMAN | Q15120 | K00898 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2q8i | |||||||||||||||||||||
| 2q8s | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 2q8s | |||||||||||||||||||||
| 2q95 | AMPM_ECOLI | P0AE18 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 2q95 | |||||||||||||||||||||
| 2qab | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qab | |||||||||||||||||||||
| 2qe4 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qe4 | |||||||||||||||||||||
| 2qgt | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qgt | |||||||||||||||||||||
| 2qgw | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qgw | |||||||||||||||||||||
| 2qhx | PTR1_LEIMA | Q01782 | KO_id not found | Others | Others | Others | Others | Others | 2qhx | |||||||||||||||||||||
| 2qi3 | O38732_9HIV1 | O38732 | KO_id not found | Others | Others | Others | Others | Others | 2qi3 | |||||||||||||||||||||
| 2qi5 | O38732_9HIV1 | O38732 | KO_id not found | Others | Others | Others | Others | Others | 2qi5 | |||||||||||||||||||||
| 2qkm | DCP1_SCHPO | Q9P805 | K12611 | Enzymes | Hydrolases | - | -.- | -.-.- | 2qkm | |||||||||||||||||||||
| 2qm9 | FABP4_MOUSE | P04117 | KO_id not found | Others | Others | Others | Others | Others | 2qm9 | |||||||||||||||||||||
| 2qtn | Q6HT60_BACAN | Q6HT60 | K00969 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Nicotinate-nucleotide adenylyltransferase | 2qtn | |||||||||||||||||||||
| 2qtu | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2qtu | |||||||||||||||||||||
| 2qvn | A5KE01_PLAVS | A5KE01 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 2qvn | |||||||||||||||||||||
| 2qzr | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 2qzr | |||||||||||||||||||||
| 2r2l | Q5RKJ4_RAT | Q5RKJ4 | KO_id not found | Others | Others | Others | Others | Others | 2r2l | |||||||||||||||||||||
| 2r3i | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3i | |||||||||||||||||||||
| 2r3k | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3k | |||||||||||||||||||||
| 2r3p | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3p | |||||||||||||||||||||
| 2r3r | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3r | |||||||||||||||||||||
| 2r5n | TKT1_ECOLI | P27302 | K00615 | Enzymes | Transferases | Transferring aldehyde or ketonic groups | Transketolases and transaldolases | Transketolase | 2r5n | |||||||||||||||||||||
| 2r64 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r64 | |||||||||||||||||||||
| 2rbe | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 2rbe | |||||||||||||||||||||
| 2rcw | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 2rcw | |||||||||||||||||||||
| 2rhr | ACT3_STRCO | P16544 | K12420 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | - | 2rhr | |||||||||||||||||||||
| 2rki | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 2rki | |||||||||||||||||||||
| 2tsr | TYSY_RAT | P45352 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 2tsr | |||||||||||||||||||||
| 2usn | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 2usn | |||||||||||||||||||||
| 2uue | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2uue | |||||||||||||||||||||
| 2uv2 | SLK_HUMAN | Q9H2G2 | K08836 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2uv2 | |||||||||||||||||||||
| 2uxh | TTGR_PSEPU | Q9AIU0 | KO_id not found | Others | Others | Others | Others | Others | 2uxh | |||||||||||||||||||||
| 2uz1 | Q9F4L3_PSEFL | Q9F4L3 | KO_id not found | Others | Others | Others | Others | Others | 2uz1 | |||||||||||||||||||||
| 2uzd | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2uzd | |||||||||||||||||||||
| 2uzh | A0R559_MYCS2 | A0R559 | K01770 | Enzymes | Lyases | Phosphorus-oxygen lyases | Phosphorus-oxygen lyases (only sub-subclass identified to date) | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | 2uzh | |||||||||||||||||||||
| 2uzo | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2uzo | |||||||||||||||||||||
| 2v2q | ISPE_AQUAE | O67060 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 2v2q | |||||||||||||||||||||
| 2v3w | MDLC_PSEPU | P20906 | KO_id not found | Others | Others | Others | Others | Others | 2v3w | |||||||||||||||||||||
| 2v4l | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2v4l | |||||||||||||||||||||
| 2v57 | Q58L87_MYCSM | Q58L87 | KO_id not found | Others | Others | Others | Others | Others | 2v57 | |||||||||||||||||||||
| 2v5a | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2v5a | |||||||||||||||||||||
| 2v7p | LDH_THET8 | Q5SJA1 | K00016 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | L-lactate dehydrogenase | 2v7p | |||||||||||||||||||||
| 2v95 | CBG_RAT | P31211 | KO_id not found | Others | Others | Others | Others | Others | 2v95 | |||||||||||||||||||||
| 2va6 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 2va6 | |||||||||||||||||||||
| 2va7 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 2va7 | |||||||||||||||||||||
| 2vf3 | ISPE_AQUAE | O67060 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 2vf3 | |||||||||||||||||||||
| 2vg5 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2vg5 | |||||||||||||||||||||
| 2vg7 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2vg7 | |||||||||||||||||||||
| 2vgo | AUKBA_XENLA | Q6DE08 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2vgo | |||||||||||||||||||||
| 2vig | ACADS_HUMAN | P16219 | K00248 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a flavin as acceptor | Short-chain acyl-CoA dehydrogenase | 2vig | |||||||||||||||||||||
| 2vk8 | PDC1_YEAST | P06169 | K01568 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Pyruvate decarboxylase | 2vk8 | |||||||||||||||||||||
| 2vn9 | KCC2D_HUMAN | Q13557 | K04515 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2vn9 | |||||||||||||||||||||
| 2vpr | Q799E2_PASMD | Q799E2 | KO_id not found | Others | Others | Others | Others | Others | 2vpr | |||||||||||||||||||||
| 2vqo | HDAC4_HUMAN | P56524 | K11406 | Chromosome | Eukaryotic Type | Histone modification proteins | HDACs (histone deacetylases) | Class II HDACs | 2vqo | |||||||||||||||||||||
| 2vqs | DNK_DROME | Q9XZT6 | K05961 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Deoxynucleoside kinase | 2vqs | |||||||||||||||||||||
| 2vrx | AUKBA_XENLA | Q6DE08 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2vrx | |||||||||||||||||||||
| 2vto | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2vto | |||||||||||||||||||||
| 2vvt | MURI_ENTFA | Q836J0 | K01776 | Enzymes | Isomerases | Racemases and epimerases | Acting on amino acids and derivatives | Glutamate racemase | 2vvt | |||||||||||||||||||||
| 2vwx | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vwx | |||||||||||||||||||||
| 2vwy | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vwy | |||||||||||||||||||||
| 2vwz | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vwz | |||||||||||||||||||||
| 2vx0 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vx0 | |||||||||||||||||||||
| 2vx1 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vx1 | |||||||||||||||||||||
| 2vz6 | KCC2A_HUMAN | Q9UQM7 | K04515 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2vz6 | |||||||||||||||||||||
| 2w1e | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2w1e | |||||||||||||||||||||
| 2w1h | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2w1h | |||||||||||||||||||||
| 2w3s | O54050_RHOCA | O54050 | KO_id not found | Others | Others | Others | Others | Others | 2w3s | |||||||||||||||||||||
| 2w3v | O30463_MYCAV | O30463 | KO_id not found | Others | Others | Others | Others | Others | 2w3v | |||||||||||||||||||||
| 2w3w | O30463_MYCAV | O30463 | KO_id not found | Others | Others | Others | Others | Others | 2w3w | |||||||||||||||||||||
| 2w4i | MURI_HELPJ | Q9ZLT0 | K01776 | Enzymes | Isomerases | Racemases and epimerases | Acting on amino acids and derivatives | Glutamate racemase | 2w4i | |||||||||||||||||||||
| 2w4o | KCC4_HUMAN | Q16566 | K05869 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2w4o | |||||||||||||||||||||
| 2w6m | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2w6m | |||||||||||||||||||||
| 2w71 | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2w71 | |||||||||||||||||||||
| 2w8r | SSDH_HUMAN | P51649 | K00139 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Succinate-semialdehyde dehydrogenase (NAD+) | 2w8r | |||||||||||||||||||||
| 2w98 | PTGR2_HUMAN | Q8N8N7 | K13949 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | 15-oxoprostaglandin 13-oxidase | 2w98 | |||||||||||||||||||||
| 2wa9 | CLPS_ECOLI | P0A8Q6 | KO_id not found | Others | Others | Others | Others | Others | 2wa9 | |||||||||||||||||||||
| 2wd1 | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 2wd1 | |||||||||||||||||||||
| 2wd7 | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 2wd7 | |||||||||||||||||||||
| 2weh | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2weh | |||||||||||||||||||||
| 2wgs | GLNA1_MYCTU | P0A590 | K01915 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-ammonia (or amine) ligases (amide synthases) | Glutamate---ammonia ligase | 2wgs | |||||||||||||||||||||
| 2wks | AROQ_HELPY | Q48255 | K03786 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | 3-dehydroquinate dehydratase | 2wks | |||||||||||||||||||||
| 2wkt | THIL_ZOORA | P07097 | K00626 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Acetyl-CoA C-acetyltransferase | 2wkt | |||||||||||||||||||||
| 2wmd | NMRL1_HUMAN | Q9HBL8 | KO_id not found | Others | Others | Others | Others | Others | 2wmd | |||||||||||||||||||||
| 2wmr | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2wmr | |||||||||||||||||||||
| 2wms | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2wms | |||||||||||||||||||||
| 2wn9 | Q8WSF8_APLCA | Q8WSF8 | KO_id not found | Others | Others | Others | Others | Others | 2wn9 | |||||||||||||||||||||
| 2won | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 2won | |||||||||||||||||||||
| 2wqb | TIE2_HUMAN | Q02763 | K05121 | Cellular antigens | CD (clusters of differentiation) molecules | CD202b; TEK tyrosine kinase, endothelial | Others | Others | 2wqb | |||||||||||||||||||||
| 2wtc | CHK2_HUMAN | O96017 | K06641 | DNA repair and recombination proteins | Eukaryotic Type | Check point factors | Other check point factors | CHK2; serine-threonine-protein kinase Chk2 | 2wtc | |||||||||||||||||||||
| 2wtd | CHK2_HUMAN | O96017 | K06641 | DNA repair and recombination proteins | Eukaryotic Type | Check point factors | Other check point factors | CHK2; serine-threonine-protein kinase Chk2 | 2wtd | |||||||||||||||||||||
| 2wuf | HSAD_MYCTU | P96851 | K16050 | Enzymes | Hydrolases | Acting on carbon-carbon bonds | In ketonic substances | 4,5-9,10-diseco-3-hydroxy-5,9,17-trioxoandrosta-1(10),2-diene-4-oate hydrolase | 2wuf | |||||||||||||||||||||
| 2wvg | PDC_ZYMMO | P06672 | K04103 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Indolepyruvate decarboxylase | 2wvg | |||||||||||||||||||||
| 2wxf | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxf | |||||||||||||||||||||
| 2wxg | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxg | |||||||||||||||||||||
| 2wxh | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxh | |||||||||||||||||||||
| 2wxm | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxm | |||||||||||||||||||||
| 2wxn | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxn | |||||||||||||||||||||
| 2wxo | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxo | |||||||||||||||||||||
| 2wxp | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxp | |||||||||||||||||||||
| 2wxq | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxq | |||||||||||||||||||||
| 2wxv | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2wxv | |||||||||||||||||||||
| 2wyv | Q5SLI9_THET8 | Q5SLI9 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 2wyv | |||||||||||||||||||||
| 2x0y | OGA_CLOP1 | Q0TR53 | K01197 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | Hya; hyaluronoglucosaminidase | Others | Others | 2x0y | |||||||||||||||||||||
| 2x1n | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2x1n | |||||||||||||||||||||
| 2x2l | RET_HUMAN | P07949 | K05126 | Cytokine receptors | Receptor tyrosine kinase | RTK class XIV (RET receptor family) | RET; proto-oncogene tyrosine-protein kinase Ret | Others | 2x2l | |||||||||||||||||||||
| 2x38 | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2x38 | |||||||||||||||||||||
| 2x7e | KIF11_HUMAN | P52732 | K10398 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulin-binding proteins | KIF11; kinesin family member 11 | 2x7e | |||||||||||||||||||||
| 2x7t | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2x7t | |||||||||||||||||||||
| 2x9f | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2x9f | |||||||||||||||||||||
| 2x9n | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 2x9n | |||||||||||||||||||||
| 2xck | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2xck | |||||||||||||||||||||
| 2xiq | MUTA_HUMAN | P22033 | K01847 | Enzymes | Isomerases | Intramolecular transferases | Transferring other groups | Methylmalonyl-CoA mutase | 2xiq | |||||||||||||||||||||
| 2xng | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2xng | |||||||||||||||||||||
| 2xov | GLPG_ECOLI | P09391 | KO_id not found | Others | Others | Others | Others | Others | 2xov | |||||||||||||||||||||
| 2xpu | TETR4_ECOLX | P0ACT4 | KO_id not found | Others | Others | Others | Others | Others | 2xpu | |||||||||||||||||||||
| 2xrl | TETR4_ECOLX | P0ACT4 | KO_id not found | Others | Others | Others | Others | Others | 2xrl | |||||||||||||||||||||
| 2xtb | Q584S0_TRYB2 | Q584S0 | K00856 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Adenosine kinase | 2xtb | |||||||||||||||||||||
| 2xtk | B0Y2Y2_ASPFC | B0Y2Y2 | KO_id not found | Others | Others | Others | Others | Others | 2xtk | |||||||||||||||||||||
| 2xvd | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2xvd | |||||||||||||||||||||
| 2xyu | EPHA4_MOUSE | Q03137 | K05105 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2xyu | |||||||||||||||||||||
| 2y05 | PTGR1_HUMAN | Q14914 | K13948 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | 15-oxoprostaglandin 13-oxidase | 2y05 | |||||||||||||||||||||
| 2y0j | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2y0j | |||||||||||||||||||||
| 2ybo | P95417_PSEAI | P95417 | K02303 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Uroporphyrinogen-III C-methyltransferase | 2ybo | |||||||||||||||||||||
| 2ybu | CHIA_HUMAN | Q9BZP6 | K01183 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Chitinase | 2ybu | |||||||||||||||||||||
| 2ydo | AA2AR_HUMAN | P29274 | K04266 | G Protein-Coupled Receptors | Class A. Rhodopsin family | Base and nucleoside | Adenosine | Adenosine receptor A2a | 2ydo | 9606 | ||||||||||||||||||||
| 2yiw | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2yiw | |||||||||||||||||||||
| 2yjd | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2yjd | |||||||||||||||||||||
| 2ykm | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2ykm | |||||||||||||||||||||
| 2yxu | PDXK_HUMAN | O00764 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 2yxu | |||||||||||||||||||||
| 2z2w | WEE1_HUMAN | P30291 | K06632 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2z2w | |||||||||||||||||||||
| 2z4b | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2z4b | |||||||||||||||||||||
| 2z6r | DPHB_PYRHO | O58456 | K00586 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Diphthine synthase | 2z6r | |||||||||||||||||||||
| 2zdx | PDK4_HUMAN | Q16654 | K00898 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2zdx | |||||||||||||||||||||
| 2zjw | CSK21_HUMAN | P68400 | K03097 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2zjw | |||||||||||||||||||||
| 2zm1 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 2zm1 | |||||||||||||||||||||
| 2zm3 | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 2zm3 | |||||||||||||||||||||
| 2zmh | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 2zmh | |||||||||||||||||||||
| 2zoq | MK03_HUMAN | P27361 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2zoq | |||||||||||||||||||||
| 2zoz | Q8NMG3_CORGL | Q8NMG3 | KO_id not found | Others | Others | Others | Others | Others | 2zoz | |||||||||||||||||||||
| 2zv9 | LYN_MOUSE | P25911 | K05854 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 2zv9 | |||||||||||||||||||||
| 3a2j | VDR_HUMAN | P11473 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 3a2j | |||||||||||||||||||||
| 3a3w | Q93LD7_RHIRD | Q93LD7 | KO_id not found | Others | Others | Others | Others | Others | 3a3w | |||||||||||||||||||||
| 3a3z | VDR_HUMAN | P11473 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 3a3z | |||||||||||||||||||||
| 3ac1 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ac1 | |||||||||||||||||||||
| 3ac3 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ac3 | |||||||||||||||||||||
| 3ad6 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ad6 | |||||||||||||||||||||
| 3adt | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3adt | |||||||||||||||||||||
| 3amb | KAPCA_HUMAN | P17612 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 3amb | |||||||||||||||||||||
| 3anx | SPEE_THET8 | Q5SK28 | K00797 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Spermidine synthase | 3anx | |||||||||||||||||||||
| 3avp | COAA_MYCTU | P63810 | K00867 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pantothenate kinase | 3avp | |||||||||||||||||||||
| 3avq | COAA_MYCTU | P63810 | K00867 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pantothenate kinase | 3avq | |||||||||||||||||||||
| 3ax8 | VDR_HUMAN | P11473 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 3ax8 | |||||||||||||||||||||
| 3aza | Q965D7_PLAFA | Q965D7 | KO_id not found | Others | Others | Others | Others | Others | 3aza | |||||||||||||||||||||
| 3b0q | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3b0q | |||||||||||||||||||||
| 3b2s | Q9HDE2_GIBZA | Q9HDE2 | KO_id not found | Others | Others | Others | Others | Others | 3b2s | |||||||||||||||||||||
| 3b4f | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3b4f | |||||||||||||||||||||
| 3b66 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 3b66 | |||||||||||||||||||||
| 3b67 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 3b67 | |||||||||||||||||||||
| 3b68 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 3b68 | |||||||||||||||||||||
| 3bab | DNLJ_ENTFA | Q837V6 | K01972 | Enzymes | Ligases | Forming phosphoric-ester bonds | Ligases that form phosphoric-ester bonds (only sub-subclass identified to date) | DNA ligase (NAD+) | 3bab | |||||||||||||||||||||
| 3bac | DNLJ_HAEIN | P43813 | K01972 | Enzymes | Ligases | Forming phosphoric-ester bonds | Ligases that form phosphoric-ester bonds (only sub-subclass identified to date) | DNA ligase (NAD+) | 3bac | |||||||||||||||||||||
| 3be9 | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 3be9 | |||||||||||||||||||||
| 3bea | CSF1R_HUMAN | P07333 | K05090 | Cellular antigens | CD (clusters of differentiation) molecules | CD115; colony stimulating factor 1 receptor (macrophage) | Others | Others | 3bea | |||||||||||||||||||||
| 3bet | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3bet | |||||||||||||||||||||
| 3bgp | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3bgp | |||||||||||||||||||||
| 3bhh | KCC2B_HUMAN | Q13554 | K04515 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 3bhh | |||||||||||||||||||||
| 3bhj | CBR1_HUMAN | P16152 | K00079 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Carbonyl reductase (NADPH) | 3bhj | |||||||||||||||||||||
| 3bhm | CBR1_HUMAN | P16152 | K00079 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Carbonyl reductase (NADPH) | 3bhm | |||||||||||||||||||||
| 3bhu | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3bhu | |||||||||||||||||||||
| 3bhv | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3bhv | |||||||||||||||||||||
| 3bjh | Q9U9J6_APIME | Q9U9J6 | KO_id not found | Others | Others | Others | Others | Others | 3bjh | |||||||||||||||||||||
| 3bll | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 3bll | |||||||||||||||||||||
| 3blo | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 3blo | |||||||||||||||||||||
| 3bmc | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 3bmc | |||||||||||||||||||||
| 3bo5 | SETMR_HUMAN | Q53H47 | K11433 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 3bo5 | |||||||||||||||||||||
| 3bpr | MERTK_HUMAN | Q12866 | K05117 | Cytokine receptors | Receptor tyrosine kinase | RTK class IX (AXL receptor family) | MERTK, MER; c-mer proto-oncogene tyrosine kinase | Others | 3bpr | |||||||||||||||||||||
| 3bqm | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 3bqm | |||||||||||||||||||||
| 3bqn | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 3bqn | |||||||||||||||||||||
| 3bqz | QACR_STAAM | P0A0N3 | KO_id not found | Others | Others | Others | Others | Others | 3bqz | |||||||||||||||||||||
| 3bw2 | Q9FDD4_9ACTO | Q9FDD4 | KO_id not found | Others | Others | Others | Others | Others | 3bw2 | |||||||||||||||||||||
| 3bxs | POL_HV1A2 | P03369 | KO_id not found | Others | Others | Others | Others | Others | 3bxs | |||||||||||||||||||||
| 3bz8 | MYS2_DICDI | P08799 | K10352 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actin-binding proteins | Myosins | 3bz8 | |||||||||||||||||||||
| 3bz9 | MYS2_DICDI | P08799 | K10352 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actin-binding proteins | Myosins | 3bz9 | |||||||||||||||||||||
| 3bzu | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3bzu | |||||||||||||||||||||
| 3c06 | TYSY_LACCA | P00469 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 3c06 | |||||||||||||||||||||
| 3c79 | Q8WSF8_APLCA | Q8WSF8 | KO_id not found | Others | Others | Others | Others | Others | 3c79 | |||||||||||||||||||||
| 3c7p | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3c7p | |||||||||||||||||||||
| 3ch6 | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3ch6 | |||||||||||||||||||||
| 3cjf | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3cjf | |||||||||||||||||||||
| 3clb | DRTS_TRYCR | Q27793 | KO_id not found | Others | Others | Others | Others | Others | 3clb | |||||||||||||||||||||
| 3coy | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3coy | |||||||||||||||||||||
| 3cp9 | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3cp9 | |||||||||||||||||||||
| 3cpb | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3cpb | |||||||||||||||||||||
| 3cqe | WEE1_HUMAN | P30291 | K06632 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3cqe | |||||||||||||||||||||
| 3csj | GSTP1_HUMAN | P09211 | K00799 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Glutathione transferase | 3csj | |||||||||||||||||||||
| 3ctj | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3ctj | |||||||||||||||||||||
| 3cy3 | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3cy3 | |||||||||||||||||||||
| 3d28 | POLG_HCVBK | P26663 | KO_id not found | Others | Others | Others | Others | Others | 3d28 | |||||||||||||||||||||
| 3d2i | AURKA_MOUSE | P97477 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3d2i | |||||||||||||||||||||
| 3d3e | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3d3e | |||||||||||||||||||||
| 3d4b | NPD_THEMA | Q9WYW0 | K12410 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | - | 3d4b | |||||||||||||||||||||
| 3d4n | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3d4n | |||||||||||||||||||||
| 3d8w | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3d8w | |||||||||||||||||||||
| 3d9z | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3d9z | |||||||||||||||||||||
| 3daj | AURKA_MOUSE | P97477 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3daj | |||||||||||||||||||||
| 3dbs | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3dbs | |||||||||||||||||||||
| 3dbu | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3dbu | |||||||||||||||||||||
| 3dcc | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3dcc | |||||||||||||||||||||
| 3dcv | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3dcv | |||||||||||||||||||||
| 3ddu | PPCE_HUMAN | P48147 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3ddu | |||||||||||||||||||||
| 3dh7 | Q53W52_THET8 | Q53W52 | K01823 | Enzymes | Isomerases | Intramolecular oxidoreductases | Transposing C=C bonds | Isopentenyl-diphosphate Delta-isomerase | 3dh7 | |||||||||||||||||||||
| 3dhe | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 3dhe | |||||||||||||||||||||
| 3di6 | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3di6 | |||||||||||||||||||||
| 3djl | AIDB_ECOLI | P33224 | KO_id not found | Others | Others | Others | Others | Others | 3djl | |||||||||||||||||||||
| 3dn5 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3dn5 | |||||||||||||||||||||
| 3dox | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3dox | |||||||||||||||||||||
| 3dpk | CSF1R_HUMAN | P07333 | K05090 | Cellular antigens | CD (clusters of differentiation) molecules | CD115; colony stimulating factor 1 receptor (macrophage) | Others | Others | 3dpk | |||||||||||||||||||||
| 3drw | K6PF_PYRHO | O59355 | K00850 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 6-phosphofructokinase | 3drw | |||||||||||||||||||||
| 3dsl | VM3BP_BOTJA | O93523 | KO_id not found | Others | Others | Others | Others | Others | 3dsl | |||||||||||||||||||||
| 3dt3 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3dt3 | |||||||||||||||||||||
| 3dtc | M3K9_HUMAN | P80192 | K04417 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase kinase kinase | 3dtc | |||||||||||||||||||||
| 3e2m | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 3e2m | |||||||||||||||||||||
| 3e3u | DEF_MYCTU | P96275 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3e3u | |||||||||||||||||||||
| 3e5a | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3e5a | |||||||||||||||||||||
| 3e6n | NOS2_MOUSE | P29477 | K13241 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | With NADH or NADPH as one donor, and incorporation of one atom of oxygen into the other donor | Nitric-oxide synthase (NADPH dependent) | 3e6n | |||||||||||||||||||||
| 3e7v | HASP_HUMAN | Q8TF76 | K16315 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3e7v | |||||||||||||||||||||
| 3e9z | Q9BMI9_SCHMA | Q9BMI9 | KO_id not found | Others | Others | Others | Others | Others | 3e9z | |||||||||||||||||||||
| 3efl | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3efl | |||||||||||||||||||||
| 3elz | Q6IMW5_DANRE | Q6IMW5 | KO_id not found | Others | Others | Others | Others | Others | 3elz | |||||||||||||||||||||
| 3ene | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ene | |||||||||||||||||||||
| 3eou | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 3eou | |||||||||||||||||||||
| 3eq7 | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3eq7 | |||||||||||||||||||||
| 3eq8 | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3eq8 | |||||||||||||||||||||
| 3erd | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3erd | |||||||||||||||||||||
| 3et1 | PPARA_HUMAN | Q07869 | K07294 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C1, PPARA; peroxisome proliferator-activated receptor alpha | Others | 3et1 | |||||||||||||||||||||
| 3et7 | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3et7 | |||||||||||||||||||||
| 3ewj | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3ewj | |||||||||||||||||||||
| 3eyg | JAK1_HUMAN | P23458 | K11217 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3eyg | |||||||||||||||||||||
| 3f0u | Q2YY41_STAAB | Q2YY41 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3f0u | |||||||||||||||||||||
| 3f10 | Q97FM4_CLOAB | Q97FM4 | K03660 | Enzymes | Lyases | Carbon-oxygen lyases | Other carbon-oxygen lyases | DNA-(apurinic or apyrimidinic site) lyase | 3f10 | |||||||||||||||||||||
| 3f16 | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3f16 | |||||||||||||||||||||
| 3f1q | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3f1q | |||||||||||||||||||||
| 3f3z | Q5CYL9_CRYPI | Q5CYL9 | K13412 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3f3z | |||||||||||||||||||||
| 3f4x | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3f4x | |||||||||||||||||||||
| 3f7z | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3f7z | |||||||||||||||||||||
| 3f88 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3f88 | |||||||||||||||||||||
| 3f8p | Q97W27_SULSO | Q97W27 | K00384 | Enzymes | Oxidoreductases | Acting on a sulfur group of donors | With NAD+ or NADP+ as acceptor | Thioredoxin-disulfide reductase | 3f8p | |||||||||||||||||||||
| 3faz | Q9BMI9_SCHMA | Q9BMI9 | KO_id not found | Others | Others | Others | Others | Others | 3faz | |||||||||||||||||||||
| 3fcf | UNG_HUMAN | P13051 | K03648 | DNA repair and recombination proteins | Prokaryotic Type | SSBR (single strand breaks repair) | BER (base exicision repair) | DNA glycosylases | 3fcf | |||||||||||||||||||||
| 3fci | UNG_HUMAN | P13051 | K03648 | DNA repair and recombination proteins | Prokaryotic Type | SSBR (single strand breaks repair) | BER (base exicision repair) | DNA glycosylases | 3fci | |||||||||||||||||||||
| 3fco | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3fco | |||||||||||||||||||||
| 3fhx | PDXK_HUMAN | O00764 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 3fhx | |||||||||||||||||||||
| 3fiu | Q2A4B6_FRATH | Q2A4B6 | K01916 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-ammonia (or amine) ligases (amide synthases) | NAD+ synthase | 3fiu | |||||||||||||||||||||
| 3fl8 | Q81R22_BACAN | Q81R22 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3fl8 | |||||||||||||||||||||
| 3fls | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fls | |||||||||||||||||||||
| 3flw | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3flw | |||||||||||||||||||||
| 3fly | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fly | |||||||||||||||||||||
| 3flz | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3flz | |||||||||||||||||||||
| 3fmh | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmh | |||||||||||||||||||||
| 3fmk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmk | |||||||||||||||||||||
| 3fml | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fml | |||||||||||||||||||||
| 3fmn | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmn | |||||||||||||||||||||
| 3frg | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3frg | |||||||||||||||||||||
| 3frq | Q9EVJ6_ECOLX | Q9EVJ6 | KO_id not found | Others | Others | Others | Others | Others | 3frq | |||||||||||||||||||||
| 3fsk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fsk | |||||||||||||||||||||
| 3ftv | LKHA4_HUMAN | P09960 | K01254 | Enzymes | Hydrolases | Acting on ether bonds | Ether hydrolases | Leukotriene-A4 hydrolase | 3ftv | |||||||||||||||||||||
| 3fuj | LKHA4_HUMAN | P09960 | K01254 | Enzymes | Hydrolases | Acting on ether bonds | Ether hydrolases | Leukotriene-A4 hydrolase | 3fuj | |||||||||||||||||||||
| 3fxw | MAPK3_HUMAN | Q16644 | K04444 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3fxw | |||||||||||||||||||||
| 3fxx | EPHA3_HUMAN | P29320 | K05104 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 3fxx | |||||||||||||||||||||
| 3fzn | MDLC_PSEPU | P20906 | KO_id not found | Others | Others | Others | Others | Others | 3fzn | |||||||||||||||||||||
| 3fzr | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fzr | |||||||||||||||||||||
| 3fzs | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fzs | |||||||||||||||||||||
| 3g0e | KIT_HUMAN | P10721 | K05091 | Cellular antigens | CD (clusters of differentiation) molecules | CD117; v-kit Hardy-Zuckerman 4 feline sarcoma viral oncogene homolog | Others | Others | 3g0e | |||||||||||||||||||||
| 3g11 | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3g11 | |||||||||||||||||||||
| 3g3e | OXDA_HUMAN | P14920 | K00273 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With oxygen as acceptor | D-amino-acid oxidase | 3g3e | |||||||||||||||||||||
| 3g4k | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3g4k | |||||||||||||||||||||
| 3g9e | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3g9e | |||||||||||||||||||||
| 3gc0 | A8BZ95_GIAIC | A8BZ95 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3gc0 | |||||||||||||||||||||
| 3gcu | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3gcu | |||||||||||||||||||||
| 3gcv | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3gcv | |||||||||||||||||||||
| 3ggf | MST4_HUMAN | Q9P289 | K16314 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ggf | |||||||||||||||||||||
| 3gid | ACACB_HUMAN | O00763 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 3gid | |||||||||||||||||||||
| 3gki | NPC1_HUMAN | O15118 | K12385 | Others | Cellular Processes | Transport and catabolism | Lysosome | NPC1; Niemann-Pick C1 protein | 3gki | |||||||||||||||||||||
| 3gko | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3gko | |||||||||||||||||||||
| 3glv | RIBL_THEVO | Q979C2 | KO_id not found | Others | Others | Others | Others | Others | 3glv | |||||||||||||||||||||
| 3gvh | MDH_BRUA2 | Q2YLR9 | K00024 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Malate dehydrogenase | 3gvh | |||||||||||||||||||||
| 3gx9 | Q51990_PSEPU | Q51990 | KO_id not found | Others | Others | Others | Others | Others | 3gx9 | |||||||||||||||||||||
| 3h0b | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3h0b | |||||||||||||||||||||
| 3h0y | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3h0y | |||||||||||||||||||||
| 3h0z | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3h0z | |||||||||||||||||||||
| 3h1v | HXK4_HUMAN | P35557 | K12407 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Glucokinase | 3h1v | |||||||||||||||||||||
| 3h3c | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3h3c | |||||||||||||||||||||
| 3h6v | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3h6v | |||||||||||||||||||||
| 3h98 | POLG_HCVBK | P26663 | KO_id not found | Others | Others | Others | Others | Others | 3h98 | |||||||||||||||||||||
| 3h9o | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3h9o | |||||||||||||||||||||
| 3ha6 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ha6 | |||||||||||||||||||||
| 3hfw | ADPRH_HUMAN | P54922 | K01245 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | [protein ADP-ribosylarginine] hydrolase | 3hfw | |||||||||||||||||||||
| 3hgy | Q7B8P6_CAMJU | Q7B8P6 | KO_id not found | Others | Others | Others | Others | Others | 3hgy | |||||||||||||||||||||
| 3hlj | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3hlj | |||||||||||||||||||||
| 3hlv | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3hlv | |||||||||||||||||||||
| 3hmi | ABL2_HUMAN | P42684 | K08887 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3hmi | |||||||||||||||||||||
| 3ho2 | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3ho2 | |||||||||||||||||||||
| 3ho9 | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3ho9 | |||||||||||||||||||||
| 3hqy | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3hqy | |||||||||||||||||||||
| 3hrb | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3hrb | |||||||||||||||||||||
| 3hs4 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3hs4 | |||||||||||||||||||||
| 3hth | Q79SH7_STRLI | Q79SH7 | KO_id not found | Others | Others | Others | Others | Others | 3hth | |||||||||||||||||||||
| 3huc | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3huc | |||||||||||||||||||||
| 3i4b | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3i4b | |||||||||||||||||||||
| 3i52 | Q4W2K4_VITVI | Q4W2K4 | KO_id not found | Others | Others | Others | Others | Others | 3i52 | |||||||||||||||||||||
| 3i60 | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3i60 | |||||||||||||||||||||
| 3i6r | PYRD_PLAF7 | Q08210 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3i6r | |||||||||||||||||||||
| 3i73 | VATA_PYRHO | O57728 | K02117 | Enzymes | Hydrolases | Acting on acid anhydrides | Acting on acid anhydrides to catalyse transmembrane movement of substances | H+-transporting two-sector ATPase | 3i73 | |||||||||||||||||||||
| 3i81 | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 3i81 | |||||||||||||||||||||
| 3i8a | DYR_STAAU | P0A017 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3i8a | |||||||||||||||||||||
| 3i9l | NADA_APLCA | P29241 | K03517 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Quinolinate synthase | 3i9l | |||||||||||||||||||||
| 3iad | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3iad | |||||||||||||||||||||
| 3iai | CAH9_HUMAN | Q16790 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3iai | |||||||||||||||||||||
| 3iar | ADA_HUMAN | P00813 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 3iar | |||||||||||||||||||||
| 3iej | CATS_HUMAN | P25774 | K01368 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Cysteine endopeptidases | Cathepsin S | 3iej | |||||||||||||||||||||
| 3iem | RNSE_THET8 | Q5SLP1 | KO_id not found | Others | Others | Others | Others | Others | 3iem | |||||||||||||||||||||
| 3ig7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3ig7 | |||||||||||||||||||||
| 3igg | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3igg | |||||||||||||||||||||
| 3ihg | Q54530_9ACTO | Q54530 | KO_id not found | Others | Others | Others | Others | Others | 3ihg | |||||||||||||||||||||
| 3ik6 | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3ik6 | |||||||||||||||||||||
| 3ilu | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3ilu | |||||||||||||||||||||
| 3imx | Q53Y25_HUMAN | Q53Y25 | K12407 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Glucokinase | 3imx | |||||||||||||||||||||
| 3in3 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3in3 | |||||||||||||||||||||
| 3in4 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3in4 | |||||||||||||||||||||
| 3iob | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3iob | |||||||||||||||||||||
| 3ioq | Q84XA1_CARCN | Q84XA1 | KO_id not found | Others | Others | Others | Others | Others | 3ioq | |||||||||||||||||||||
| 3iph | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3iph | |||||||||||||||||||||
| 3iq7 | HASP_HUMAN | Q8TF76 | K16315 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3iq7 | |||||||||||||||||||||
| 3itl | Q75WH8_PSEST | Q75WH8 | KO_id not found | Others | Others | Others | Others | Others | 3itl | |||||||||||||||||||||
| 3ivm | Q9X6R4_AERPU | Q9X6R4 | KO_id not found | Others | Others | Others | Others | Others | 3ivm | |||||||||||||||||||||
| 3ivx | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3ivx | |||||||||||||||||||||
| 3jq7 | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jq7 | |||||||||||||||||||||
| 3jq8 | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jq8 | |||||||||||||||||||||
| 3jqg | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jqg | |||||||||||||||||||||
| 3jsu | A7UD79_PLAFA | A7UD79 | KO_id not found | Others | Others | Others | Others | Others | 3jsu | |||||||||||||||||||||
| 3jtk | NMT1_HUMAN | P30419 | K00671 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Glycylpeptide N-tetradecanoyltransferase | 3jtk | |||||||||||||||||||||
| 3jwf | Q81R22_BACAN | Q81R22 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3jwf | |||||||||||||||||||||
| 3jwk | Q81R22_BACAN | Q81R22 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3jwk | |||||||||||||||||||||
| 3k31 | Q2GKM8_ANAPZ | Q2GKM8 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 3k31 | |||||||||||||||||||||
| 3k35 | SIR6_HUMAN | Q8N6T7 | K11416 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+---protein-arginine ADP-ribosyltransferase | 3k35 | |||||||||||||||||||||
| 3k3j | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3k3j | |||||||||||||||||||||
| 3k6b | A4_CAEEL | Q10651 | K04520 | Heparan sulfate-heparin binding proteins | Others | APP; amyloid beta A4 proteinPlaque formation | Others | Others | 3k6b | |||||||||||||||||||||
| 3k8t | RIR1_YEAST | P21524 | K10807 | DNA repair and recombination proteins | Eukaryotic Type | Other factors with a suspected DNA repair function | Modulation of nucleotide pools | RRM1; ribonucleoside-diphosphate reductase subunit M1 | 3k8t | |||||||||||||||||||||
| 3kfy | DYR_ECOLI | P0ABQ4 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3kfy | |||||||||||||||||||||
| 3khj | Q5CPK7_CRYPI | Q5CPK7 | K00088 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | IMP dehydrogenase | 3khj | |||||||||||||||||||||
| 3ki3 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki3 | |||||||||||||||||||||
| 3ki4 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki4 | |||||||||||||||||||||
| 3ki5 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki5 | |||||||||||||||||||||
| 3ki6 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki6 | |||||||||||||||||||||
| 3kig | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3kig | |||||||||||||||||||||
| 3kjs | Q8T5T8_TRYCR | Q8T5T8 | KO_id not found | Others | Others | Others | Others | Others | 3kjs | |||||||||||||||||||||
| 3kk6 | PGH1_SHEEP | P05979 | K00509 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 3kk6 | |||||||||||||||||||||
| 3kkt | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3kkt | |||||||||||||||||||||
| 3kn0 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3kn0 | |||||||||||||||||||||
| 3kne | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3kne | |||||||||||||||||||||
| 3ko5 | Q8IIS0_PLAF7 | Q8IIS0 | KO_id not found | Others | Others | Others | Others | Others | 3ko5 | |||||||||||||||||||||
| 3kti | CLPP_BACSU | P80244 | K01358 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Endopeptidase Clp | 3kti | |||||||||||||||||||||
| 3ku2 | Q9BJF5_TOXGO | Q9BJF5 | KO_id not found | Others | Others | Others | Others | Others | 3ku2 | |||||||||||||||||||||
| 3l03 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3l03 | |||||||||||||||||||||
| 3l0v | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3l0v | |||||||||||||||||||||
| 3l13 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l13 | |||||||||||||||||||||
| 3l14 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3l14 | |||||||||||||||||||||
| 3l16 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l16 | |||||||||||||||||||||
| 3l17 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l17 | |||||||||||||||||||||
| 3l30 | PA21B_PIG | P00592 | K01047 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Phospholipase A2 | 3l30 | |||||||||||||||||||||
| 3l3l | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3l3l | |||||||||||||||||||||
| 3l54 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l54 | |||||||||||||||||||||
| 3l5c | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3l5c | |||||||||||||||||||||
| 3l5d | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3l5d | |||||||||||||||||||||
| 3l5r | MIF_HUMAN | P14174 | K07253 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting keto- and enol-groups | Phenylpyruvate tautomerase | 3l5r | |||||||||||||||||||||
| 3l5u | MIF_HUMAN | P14174 | K07253 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting keto- and enol-groups | Phenylpyruvate tautomerase | 3l5u | |||||||||||||||||||||
| 3l8v | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3l8v | |||||||||||||||||||||
| 3l8w | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3l8w | |||||||||||||||||||||
| 3lak | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3lak | |||||||||||||||||||||
| 3lal | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3lal | |||||||||||||||||||||
| 3ld4 | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3ld4 | |||||||||||||||||||||
| 3le6 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3le6 | |||||||||||||||||||||
| 3lfn | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3lfn | |||||||||||||||||||||
| 3lfs | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3lfs | |||||||||||||||||||||
| 3lk8 | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3lk8 | |||||||||||||||||||||
| 3lka | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3lka | |||||||||||||||||||||
| 3lkh | POLG_HCVJ4 | O92972 | KO_id not found | Others | Others | Others | Others | Others | 3lkh | |||||||||||||||||||||
| 3lm5 | ST17B_HUMAN | O94768 | K08804 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3lm5 | |||||||||||||||||||||
| 3lsb | Q6SJY7_ARTAU | Q6SJY7 | KO_id not found | Others | Others | Others | Others | Others | 3lsb | |||||||||||||||||||||
| 3lu8 | ALBU_HUMAN | P02768 | KO_id not found | Others | Others | Others | Others | Others | 3lu8 | |||||||||||||||||||||
| 3lxe | CAH1_HUMAN | P00915 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3lxe | |||||||||||||||||||||
| 3lxg | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3lxg | |||||||||||||||||||||
| 3m2p | Q814Z6_BACCR | Q814Z6 | KO_id not found | Others | Others | Others | Others | Others | 3m2p | |||||||||||||||||||||
| 3m2w | MAPK2_HUMAN | P49137 | K04443 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3m2w | |||||||||||||||||||||
| 3m3l | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3m3l | |||||||||||||||||||||
| 3m5e | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m5e | |||||||||||||||||||||
| 3m67 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m67 | |||||||||||||||||||||
| 3m7u | PRLA_LYSEN | P00778 | KO_id not found | Others | Others | Others | Others | Others | 3m7u | |||||||||||||||||||||
| 3m8q | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3m8q | |||||||||||||||||||||
| 3m96 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m96 | |||||||||||||||||||||
| 3mcv | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 3mcv | |||||||||||||||||||||
| 3me3 | KPYM_HUMAN | P14618 | K00873 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyruvate kinase | 3me3 | |||||||||||||||||||||
| 3mhc | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3mhc | |||||||||||||||||||||
| 3mhj | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3mhj | |||||||||||||||||||||
| 3mhk | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3mhk | |||||||||||||||||||||
| 3mhl | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3mhl | |||||||||||||||||||||
| 3mhm | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3mhm | |||||||||||||||||||||
| 3mjw | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3mjw | |||||||||||||||||||||
| 3ml5 | CAH7_HUMAN | P43166 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3ml5 | |||||||||||||||||||||
| 3ml8 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ml8 | |||||||||||||||||||||
| 3msl | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3msl | |||||||||||||||||||||
| 3mtl | CDK16_HUMAN | Q00536 | K08820 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3mtl | |||||||||||||||||||||
| 3my0 | ACVL1_HUMAN | P37023 | K13594 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | ACVRL1; activin receptor-like kinase 1 | Others | 3my0 | |||||||||||||||||||||
| 3myq | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3myq | |||||||||||||||||||||
| 3mz6 | HDAC8_HUMAN | Q9BY41 | K11405 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Histone deacetylase | 3mz6 | |||||||||||||||||||||
| 3n1s | HINT_ECOLI | P0ACE7 | KO_id not found | Others | Others | Others | Others | Others | 3n1s | |||||||||||||||||||||
| 3n2u | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3n2u | |||||||||||||||||||||
| 3n83 | ALDH2_HUMAN | P05091 | K00128 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Aldehyde dehydrogenase (NAD+) | 3n83 | |||||||||||||||||||||
| 3ncg | A3FQ16_CRYPI | A3FQ16 | K13412 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ncg | |||||||||||||||||||||
| 3nd1 | O68102_RHOCA | O68102 | K02228 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Precorrin-6A synthase (deacetylating) | 3nd1 | |||||||||||||||||||||
| 3nef | PYL1_ARATH | Q8VZS8 | KO_id not found | Others | Others | Others | Others | Others | 3nef | |||||||||||||||||||||
| 3nf6 | Q76353_9HIV1 | Q76353 | KO_id not found | Others | Others | Others | Others | Others | 3nf6 | |||||||||||||||||||||
| 3ni5 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3ni5 | |||||||||||||||||||||
| 3njo | PYR1_ARATH | O49686 | K11540 | Enzymes | Transferases | Transferring one-carbon groups | Carboxy- and carbamoyltransferases | Aspartate carbamoyltransferase | 3njo | |||||||||||||||||||||
| 3nmn | PYL1_ARATH | Q8VZS8 | KO_id not found | Others | Others | Others | Others | Others | 3nmn | |||||||||||||||||||||
| 3nwb | COMT_RAT | P22734 | K00545 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Catechol O-methyltransferase | 3nwb | |||||||||||||||||||||
| 3nwe | COMT_RAT | P22734 | K00545 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Catechol O-methyltransferase | 3nwe | |||||||||||||||||||||
| 3nxt | DYR_HUMAN | P00374 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3nxt | |||||||||||||||||||||
| 3ny6 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ny6 | |||||||||||||||||||||
| 3nzi | HTRA1_HUMAN | Q92743 | K08784 | Chaperones and folding catalysts | Other chaperones and cochaperones | DegP - HtrA | HTRA1, PRSS11; HtrA serine peptidase 1 Cytoplasm | Others | 3nzi | |||||||||||||||||||||
| 3nzt | Q5NHS8_FRATT | Q5NHS8 | K01919 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Glutamate---cysteine ligase | 3nzt | |||||||||||||||||||||
| 3nzu | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3nzu | |||||||||||||||||||||
| 3o0g | CDK5_HUMAN | Q00535 | K02090 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3o0g | |||||||||||||||||||||
| 3o1x | HINT1_RABIT | P80912 | KO_id not found | Others | Others | Others | Others | Others | 3o1x | |||||||||||||||||||||
| 3o23 | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 3o23 | |||||||||||||||||||||
| 3o56 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3o56 | |||||||||||||||||||||
| 3oaw | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3oaw | |||||||||||||||||||||
| 3oew | INHA_MYCTU | P0A5Y6 | K05500 | Lipid biosynthesis proteins | TGF-beta family | Distant members | INHA; inhibin, alpha | Others | 3oew | |||||||||||||||||||||
| 3ohl | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 3ohl | |||||||||||||||||||||
| 3oho | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 3oho | |||||||||||||||||||||
| 3oik | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oik | |||||||||||||||||||||
| 3oil | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oil | |||||||||||||||||||||
| 3oku | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oku | |||||||||||||||||||||
| 3okv | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3okv | |||||||||||||||||||||
| 3omo | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 3omo | |||||||||||||||||||||
| 3omp | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 3omp | |||||||||||||||||||||
| 3oom | ACVR1_HUMAN | Q04771 | K04675 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | ACVR1; activin receptor type-1 | Others | 3oom | |||||||||||||||||||||
| 3oq1 | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3oq1 | |||||||||||||||||||||
| 3osa | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3osa | |||||||||||||||||||||
| 3osh | PA2A3_NAJSG | P60045 | KO_id not found | Others | Others | Others | Others | Others | 3osh | |||||||||||||||||||||
| 3otg | Q8KNF2_MICEC | Q8KNF2 | KO_id not found | Others | Others | Others | Others | Others | 3otg | |||||||||||||||||||||
| 3oti | Q8KND7_MICEC | Q8KND7 | KO_id not found | Others | Others | Others | Others | Others | 3oti | |||||||||||||||||||||
| 3ox1 | NQO2_HUMAN | P16083 | K08071 | Enzymes | Oxidoreductases | Acting on diphenols and related substances as donors | With other acceptors | Ribosyldihydronicotinamide dehydrogenase (quinone) | 3ox1 | |||||||||||||||||||||
| 3p0e | UPP2_HUMAN | O95045 | K00757 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Uridine phosphorylase | 3p0e | |||||||||||||||||||||
| 3p0n | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3p0n | |||||||||||||||||||||
| 3p17 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3p17 | |||||||||||||||||||||
| 3p1f | CBP_HUMAN | Q92793 | K04498 | Chromosome | Eukaryotic Type | Histone modification proteins | HATs (histone acetyltransferases) | EP300, CREBBP, KAT3; E1A-CREB-binding protein | 3p1f | |||||||||||||||||||||
| 3p25 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3p25 | |||||||||||||||||||||
| 3p2v | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3p2v | |||||||||||||||||||||
| 3p4v | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3p4v | |||||||||||||||||||||
| 3p86 | CTR1_ARATH | Q05609 | K14510 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3p86 | |||||||||||||||||||||
| 3pbb | QPCT_HUMAN | Q16769 | K00683 | Enzymes | Transferases | Acyltransferases | Aminoacyltransferases | Glutaminyl-peptide cyclotransferase | 3pbb | |||||||||||||||||||||
| 3pd5 | SYT_PYRAB | Q9UZ14 | K01868 | Enzymes | Ligases | Forming carbon-oxygen bonds | Ligases forming aminoacyl-tRNA and related compounds | Threonine---tRNA ligase | 3pd5 | |||||||||||||||||||||
| 3pej | Q8I0V4_PLAF7 | Q8I0V4 | KO_id not found | Others | Others | Others | Others | Others | 3pej | |||||||||||||||||||||
| 3pj8 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3pj8 | |||||||||||||||||||||
| 3pkg | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3pkg | |||||||||||||||||||||
| 3pkj | SIR6_HUMAN | Q8N6T7 | K11416 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+---protein-arginine ADP-ribosyltransferase | 3pkj | |||||||||||||||||||||
| 3plr | C4XAX5_KLEPN | C4XAX5 | K00012 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | UDP-glucose 6-dehydrogenase | 3plr | |||||||||||||||||||||
| 3pm1 | QACR_STAAM | P0A0N3 | KO_id not found | Others | Others | Others | Others | Others | 3pm1 | |||||||||||||||||||||
| 3pn4 | DEF1B_ARATH | Q9FUZ2 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3pn4 | |||||||||||||||||||||
| 3po6 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3po6 | |||||||||||||||||||||
| 3po7 | AOFB_HUMAN | P27338 | K00274 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With oxygen as acceptor | Monoamine oxidase | 3po7 | |||||||||||||||||||||
| 3poo | KAPCA_HUMAN | P17612 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 3poo | |||||||||||||||||||||
| 3pre | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3pre | |||||||||||||||||||||
| 3prz | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3prz | |||||||||||||||||||||
| 3ps6 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ps6 | |||||||||||||||||||||
| 3ptq | Q01KB2_ORYSA | Q01KB2 | KO_id not found | Others | Others | Others | Others | Others | 3ptq | |||||||||||||||||||||
| 3pxy | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3pxy | |||||||||||||||||||||
| 3pz1 | PGTA_MOUSE | Q9JHK4 | K14050 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Protein geranylgeranyltransferase type II | 3pz1 | |||||||||||||||||||||
| 3q2f | BAZ2B_HUMAN | Q9UIF8 | KO_id not found | Others | Others | Others | Others | Others | 3q2f | |||||||||||||||||||||
| 3q2m | O06916_LEGPN | O06916 | KO_id not found | Others | Others | Others | Others | Others | 3q2m | |||||||||||||||||||||
| 3q3c | Q9I5I6_PSEAE | Q9I5I6 | K00020 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3-hydroxyisobutyrate dehydrogenase | 3q3c | |||||||||||||||||||||
| 3q4t | AVR2A_HUMAN | P27037 | K04670 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Receptor protein serine-threonine kinase | 3q4t | |||||||||||||||||||||
| 3q6w | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3q6w | |||||||||||||||||||||
| 3q71 | PAR14_HUMAN | Q460N5 | K15261 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3q71 | |||||||||||||||||||||
| 3q9b | APHA_MYCRA | Q48935 | K03788 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-monoester hydrolases | Acid phosphatase | 3q9b | |||||||||||||||||||||
| 3qak | AA2AR_HUMAN | P29274 | K04266 | G protein-coupled receptors | Class A. Rhodopsin family | Base and nucleoside | Adenosine | ADORA2A; adenosine receptor A2a | 3qak | |||||||||||||||||||||
| 3qaq | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3qaq | |||||||||||||||||||||
| 3qar | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3qar | |||||||||||||||||||||
| 3qcs | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3qcs | |||||||||||||||||||||
| 3qfv | Q86XZ8_HUMAN | Q86XZ8 | K16307 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3qfv | |||||||||||||||||||||
| 3qfx | DRTS_TRYBB | Q27783 | KO_id not found | Others | Others | Others | Others | Others | 3qfx | |||||||||||||||||||||
| 3qjz | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3qjz | |||||||||||||||||||||
| 3qk0 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3qk0 | |||||||||||||||||||||
| 3qlw | Q5A5E0_CANAL | Q5A5E0 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3qlw | |||||||||||||||||||||
| 3qlz | Q6FPH0_CANGA | Q6FPH0 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3qlz | |||||||||||||||||||||
| 3qqh | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qqh | |||||||||||||||||||||
| 3qqj | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qqj | |||||||||||||||||||||
| 3qqp | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3qqp | |||||||||||||||||||||
| 3qru | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qru | |||||||||||||||||||||
| 3qsa | TRPD_MYCTU | P66992 | K00766 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Anthranilate phosphoribosyltransferase | 3qsa | |||||||||||||||||||||
| 3qti | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3qti | |||||||||||||||||||||
| 3qui | HFQ_PSEAE | Q9HUM0 | KO_id not found | Others | Others | Others | Others | Others | 3qui | |||||||||||||||||||||
| 3qwi | O93874_COCLU | O93874 | KO_id not found | Others | Others | Others | Others | Others | 3qwi | |||||||||||||||||||||
| 3qwj | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qwj | |||||||||||||||||||||
| 3qwk | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qwk | |||||||||||||||||||||
| 3qx2 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qx2 | |||||||||||||||||||||
| 3qx4 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qx4 | |||||||||||||||||||||
| 3qzf | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzf | |||||||||||||||||||||
| 3qzg | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzg | |||||||||||||||||||||
| 3qzh | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzh | |||||||||||||||||||||
| 3qzi | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzi | |||||||||||||||||||||
| 3r0y | Q000H7_9HIV1 | Q000H7 | KO_id not found | Others | Others | Others | Others | Others | 3r0y | |||||||||||||||||||||
| 3r1q | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r1q | |||||||||||||||||||||
| 3r1s | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r1s | |||||||||||||||||||||
| 3r1y | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r1y | |||||||||||||||||||||
| 3r21 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3r21 | |||||||||||||||||||||
| 3r22 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3r22 | |||||||||||||||||||||
| 3r28 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r28 | |||||||||||||||||||||
| 3r43 | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3r43 | |||||||||||||||||||||
| 3r58 | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3r58 | |||||||||||||||||||||
| 3r71 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r71 | |||||||||||||||||||||
| 3r73 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r73 | |||||||||||||||||||||
| 3r7o | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3r7o | |||||||||||||||||||||
| 3r7r | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3r7r | |||||||||||||||||||||
| 3r7v | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r7v | |||||||||||||||||||||
| 3r7y | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r7y | |||||||||||||||||||||
| 3r83 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r83 | |||||||||||||||||||||
| 3r8l | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r8l | |||||||||||||||||||||
| 3r8p | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r8p | |||||||||||||||||||||
| 3rdp | KITH_HHV11 | P03176 | K00857 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Thymidine kinase | 3rdp | |||||||||||||||||||||
| 3rfx | Q7CRQ0_AGRT5 | Q7CRQ0 | KO_id not found | Others | Others | Others | Others | Others | 3rfx | |||||||||||||||||||||
| 3rhx | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 3rhx | |||||||||||||||||||||
| 3ri1 | FGFR2_HUMAN | P21802 | K05093 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR2; fibroblast growth factor receptor 2 Mitogenesis | Others | Others | 3ri1 | |||||||||||||||||||||
| 3rim | TKT_MYCTU | O06811 | K00615 | Enzymes | Transferases | Transferring aldehyde or ketonic groups | Transketolases and transaldolases | Transketolase | 3rim | |||||||||||||||||||||
| 3rlj | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 3rlj | |||||||||||||||||||||
| 3rm7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3rm7 | |||||||||||||||||||||
| 3roe | NNRE_MOUSE | Q8K4Z3 | KO_id not found | Others | Others | Others | Others | Others | 3roe | |||||||||||||||||||||
| 3roy | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3roy | |||||||||||||||||||||
| 3rsv | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3rsv | |||||||||||||||||||||
| 3rtn | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3rtn | |||||||||||||||||||||
| 3rts | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3rts | |||||||||||||||||||||
| 3rtu | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3rtu | |||||||||||||||||||||
| 3rwp | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3rwp | |||||||||||||||||||||
| 3rwq | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3rwq | |||||||||||||||||||||
| 3s1d | CKX1_MAIZE | Q9T0N8 | K00279 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With other acceptors | Cytokinin dehydrogenase | 3s1d | |||||||||||||||||||||
| 3s2a | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3s2a | |||||||||||||||||||||
| 3s2o | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3s2o | |||||||||||||||||||||
| 3s2p | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3s2p | |||||||||||||||||||||
| 3s3g | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3s3g | |||||||||||||||||||||
| 3s71 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s71 | |||||||||||||||||||||
| 3s72 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s72 | |||||||||||||||||||||
| 3s73 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s73 | |||||||||||||||||||||
| 3s74 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s74 | |||||||||||||||||||||
| 3s76 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s76 | |||||||||||||||||||||
| 3s7l | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3s7l | |||||||||||||||||||||
| 3s9t | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s9t | |||||||||||||||||||||
| 3s9u | Q81R22_BACAN | Q81R22 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3s9u | |||||||||||||||||||||
| 3sax | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3sax | |||||||||||||||||||||
| 3say | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3say | |||||||||||||||||||||
| 3sc1 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3sc1 | |||||||||||||||||||||
| 3scs | BGL07_ORYSJ | Q75I93 | K05350 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Beta-glucosidase | 3scs | |||||||||||||||||||||
| 3shr | KGP1_BOVIN | P00516 | K07376 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CGMP-dependent protein kinase | 3shr | |||||||||||||||||||||
| 3shz | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3shz | |||||||||||||||||||||
| 3sl8 | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3sl8 | |||||||||||||||||||||
| 3smi | PAR14_HUMAN | Q460N5 | K15261 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3smi | |||||||||||||||||||||
| 3smj | PAR14_HUMAN | Q460N5 | K15261 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3smj | |||||||||||||||||||||
| 3srw | DYR_STAAU | P0A017 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3srw | |||||||||||||||||||||
| 3sw4 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3sw4 | |||||||||||||||||||||
| 3sxs | BMX_HUMAN | P51813 | K08896 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3sxs | |||||||||||||||||||||
| 3t4l | AHK4_ARATH | Q9C5U0 | K14489 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3t4l | |||||||||||||||||||||
| 3t4o | AHK4_ARATH | Q9C5U0 | K14489 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3t4o | |||||||||||||||||||||
| 3t4s | AHK4_ARATH | Q9C5U0 | K14489 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3t4s | |||||||||||||||||||||
| 3t4t | AHK4_ARATH | Q9C5U0 | K14489 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3t4t | |||||||||||||||||||||
| 3t70 | Q8II92_PLAF7 | Q8II92 | K01520 | Enzymes | Hydrolases | Acting on acid anhydrides | In phosphorus-containing anhydrides | DUTP diphosphatase | 3t70 | |||||||||||||||||||||
| 3t82 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3t82 | |||||||||||||||||||||
| 3t85 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3t85 | |||||||||||||||||||||
| 3t94 | MTAP_SULSO | Q97W94 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 3t94 | |||||||||||||||||||||
| 3t9v | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3t9v | |||||||||||||||||||||
| 3tfq | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3tfq | |||||||||||||||||||||
| 3thr | GNMT_RAT | P13255 | K00552 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Glycine N-methyltransferase | 3thr | |||||||||||||||||||||
| 3tiz | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3tiz | |||||||||||||||||||||
| 3tjp | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3tjp | |||||||||||||||||||||
| 3tkc | VDR_HUMAN | P11473 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 3tkc | |||||||||||||||||||||
| 3tl5 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3tl5 | |||||||||||||||||||||
| 3tn8 | CDK9_HUMAN | P50750 | K02211 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3tn8 | |||||||||||||||||||||
| 3tnw | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3tnw | |||||||||||||||||||||
| 3tq8 | Q83AB2_COXBU | Q83AB2 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3tq8 | |||||||||||||||||||||
| 3tv1 | RTCA_ECOLI | P46849 | K01974 | Enzymes | Ligases | Forming phosphoric-ester bonds | Ligases that form phosphoric-ester bonds (only sub-subclass identified to date) | RNA-3'-phosphate cyclase | 3tv1 | |||||||||||||||||||||
| 3tyu | Q7CKJ1_YERPE | Q7CKJ1 | K00796 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Dihydropteroate synthase | 3tyu | |||||||||||||||||||||
| 3tzm | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 3tzm | |||||||||||||||||||||
| 3u2c | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3u2c | |||||||||||||||||||||
| 3u40 | C4LXG4_ENTHI | C4LXG4 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3u40 | |||||||||||||||||||||
| 3u4u | CSK21_HUMAN | P68400 | K03097 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3u4u | |||||||||||||||||||||
| 3ua8 | GRIA2_HUMAN | P42262 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3ua8 | |||||||||||||||||||||
| 3uaw | DEOD_BACCE | Q5EEL8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3uaw | |||||||||||||||||||||
| 3uay | DEOD_BACCE | Q5EEL8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3uay | |||||||||||||||||||||
| 3uaz | DEOD_BACCE | Q5EEL8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 3uaz | |||||||||||||||||||||
| 3uh2 | TNKS1_HUMAN | O95271 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3uh2 | |||||||||||||||||||||
| 3uhm | LPXC_PSEAE | P47205 | K02535 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | UDP-3-O-acyl-N-acetylglucosamine deacetylase | 3uhm | |||||||||||||||||||||
| 3uu7 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3uu7 | |||||||||||||||||||||
| 3uuc | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3uuc | |||||||||||||||||||||
| 3uwe | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3uwe | |||||||||||||||||||||
| 3uxj | C3LTF1_VIBCM | C3LTF1 | K06879 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With NAD+ or NADP+ as acceptor | PreQ1 synthase | 3uxj | |||||||||||||||||||||
| 3v80 | PPNK1_LISMO | Q8Y8D7 | K00858 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | NAD+ kinase | 3v80 | |||||||||||||||||||||
| 3v8m | PPNK1_LISMO | Q8Y8D7 | K00858 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | NAD+ kinase | 3v8m | |||||||||||||||||||||
| 3v9b | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3v9b | |||||||||||||||||||||
| 3vbd | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3vbd | |||||||||||||||||||||
| 3vc4 | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3vc4 | |||||||||||||||||||||
| 3vf9 | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3vf9 | |||||||||||||||||||||
| 3vhv | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 3vhv | |||||||||||||||||||||
| 3vid | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3vid | |||||||||||||||||||||
| 3vrt | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 3vrt | |||||||||||||||||||||
| 3vru | VDR_RAT | P13053 | K08539 | Nuclear receptors | Thyroid hormone like | I. Vitamin D3 like receptor | NR1I1, VDR; vitamin D3 receptor | Others | 3vru | |||||||||||||||||||||
| 3zr7 | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 3zr7 | |||||||||||||||||||||
| 3zrm | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3zrm | |||||||||||||||||||||
| 3zs5 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3zs5 | |||||||||||||||||||||
| 3ztc | ELOB_HUMAN | Q15370 | K03873 | DNA repair and recombination proteins | Eukaryotic Type | SSBR (single strand breaks repair) | NER (nucleotide excision repair) | TCEB2; transcription elongation factor B, polypeptide 2 | 3ztc | |||||||||||||||||||||
| 3zxz | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3zxz | |||||||||||||||||||||
| 3zy5 | OFUT1_CAEEL | Q18014 | K03691 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Peptide-O-fucosyltransferase | 3zy5 | |||||||||||||||||||||
| 4a16 | ACES_MOUSE | P21836 | K01049 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Acetylcholinesterase | 4a16 | |||||||||||||||||||||
| 4a2j | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 4a2j | |||||||||||||||||||||
| 4a30 | Q4Q5S8_LEIMA | Q4Q5S8 | K00671 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Glycylpeptide N-tetradecanoyltransferase | 4a30 | |||||||||||||||||||||
| 4aa0 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 4aa0 | |||||||||||||||||||||
| 4acc | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 4acc | |||||||||||||||||||||
| 4acg | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 4acg | |||||||||||||||||||||
| 4acm | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 4acm | |||||||||||||||||||||
| 4af3 | AURKB_HUMAN | Q96GD4 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4af3 | |||||||||||||||||||||
| 4ajw | PK3CD_MOUSE | O35904 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4ajw | |||||||||||||||||||||
| 4anx | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4anx | |||||||||||||||||||||
| 4avu | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 4avu | |||||||||||||||||||||
| 4avw | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 4avw | |||||||||||||||||||||
| 4aw5 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 4aw5 | |||||||||||||||||||||
| 4dbs | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 4dbs | |||||||||||||||||||||
| 4dch | HXK4_HUMAN | P35557 | K12407 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Glucokinase | 4dch | |||||||||||||||||||||
| 4deh | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 4deh | |||||||||||||||||||||
| 4dfn | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4dfn | |||||||||||||||||||||
| 4dhf | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4dhf | |||||||||||||||||||||
| 4djy | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 4djy | |||||||||||||||||||||
| 4dma | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 4dma | |||||||||||||||||||||
| 4drn | FKBP5_HUMAN | Q13451 | K09571 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 4drn | |||||||||||||||||||||
| 4drp | FKBP5_HUMAN | Q13451 | K09571 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 4drp | |||||||||||||||||||||
| 4drq | FKBP5_HUMAN | Q13451 | K09571 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 4drq | |||||||||||||||||||||
| 4dz3 | Q3JK38_BURP1 | Q3JK38 | K01802 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 4dz3 | |||||||||||||||||||||
| 4e3f | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 4e3f | |||||||||||||||||||||
| 4ebw | FAK1_HUMAN | Q05397 | K05725 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4ebw | |||||||||||||||||||||
| 4efs | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 4efs | |||||||||||||||||||||
| 4ei4 | JAK1_HUMAN | P23458 | K11217 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4ei4 | |||||||||||||||||||||
| 4emd | B1MKD5_MYCA9 | B1MKD5 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 4emd | |||||||||||||||||||||
| 4erk | MK01_RAT | P63086 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 4erk | |||||||||||||||||||||
| 4ez3 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 4ez3 | |||||||||||||||||||||
| 4f0r | Q7NZ90_CHRVO | Q7NZ90 | K05394 | Enzymes | Hydrolases | Acting on halide bonds | In carbon-halide compounds | Atrazine chlorohydrolase | 4f0r | |||||||||||||||||||||
| 4f1s | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4f1s | |||||||||||||||||||||
| 4f63 | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 4f63 | |||||||||||||||||||||
| 4fai | Q86PD7_DROME | Q86PD7 | K00683 | Enzymes | Transferases | Acyltransferases | Aminoacyltransferases | Glutaminyl-peptide cyclotransferase | 4fai | |||||||||||||||||||||
| 4fev | B0VD92_ACIBY | B0VD92 | K00897 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Kanamycin kinase | 4fev | |||||||||||||||||||||
| 4few | B0VD92_ACIBY | B0VD92 | K00897 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Kanamycin kinase | 4few | |||||||||||||||||||||
| 4fhj | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4fhj | |||||||||||||||||||||
| 4fsw | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsw | |||||||||||||||||||||
| 4fsz | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsz | |||||||||||||||||||||
| 4ftr | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftr | |||||||||||||||||||||
| 4ftt | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftt | |||||||||||||||||||||
| 4fvt | SIR3_HUMAN | Q9NTG7 | K11413 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | - | 4fvt | |||||||||||||||||||||
| 4g3e | M3K14_MOUSE | Q9WUL6 | K04466 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase kinase kinase | 4g3e | |||||||||||||||||||||
| 4g55 | CLH1_HUMAN | Q00610 | K08099 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Chlorophyllase | 4g55 | |||||||||||||||||||||
| 4gcx | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 4gcx | |||||||||||||||||||||
| 6cox | PGH2_MOUSE | Q05769 | K11987 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 6cox | |||||||||||||||||||||
| 7upj | POL_HV1BR | P03367 | KO_id not found | Enzymes | 3. Hydrolases | proteases (aspartic) | protease (HIV-1) | Others | 7upj |