| pharmacophore.Pharma-ID | pharmacophore/metadata/Gene-Name | pharmacophore/metadata/Uniprot-AC | pharmacophore/metadata/Kegg-Identifier | pharmacophore/metadata/Target-Class | pharmacophore/metadata/Target-Class-A | pharmacophore/metadata/Target-Class-B | pharmacophore/metadata/Target-Class-C | pharmacophore/metadata/Target-Class-D | pharmacophore/metadata/pdb.complex_id | pharmacophore.name | pharmacophore.selectivity_index | pharmacophore/metadata/drug-classification | pharmacophore/metadata/target | pharmacophore/metadata/target-subclass | pharmacophore/metadata/target-family | pharmacophore/metadata/target-acronym | pharmacophore/metadata/therapeutic-classification | pharmacophore/metadata/mode-of-action | pharmacophore/metadata/pdb.ligand_id | pharmacophore/metadata/pdb.resolution | pharmacophore/actives/molecule.name | pharmacophore/actives/molecule.smiles | pharmacophore/actives/molecule.registry | pharmacophore/actives/molecule.regtype | pharmacophore/bibliography/reference.title | pharmacophore/bibliography/reference.author | pharmacophore/bibliography/reference.source | pharmacophore/bibliography/reference.year | pharmacophore/bibliography/reference.doi | pharmacophore/metadata/Taxonomic-ID |
| 1a42 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1a42 | |||||||||||||||||||||
| 1afq | CTRA_BOVIN | P00766 | KO_id not found | Others | Others | Others | Others | Others | 1afq | |||||||||||||||||||||
| 1agw | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 1agw | |||||||||||||||||||||
| Enzymes | 1aq1 | 1aq1-stu-2.00-d-1-s | 172 | oncolytic | cyclin-dependent kinase 2 CDK2 |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer | inhibition of cell cycle controlling enzyme CDK2 apoptosis in tumour cells |
stu | 2.00 | staurosporine | [H][C@]15C[C@@H](NC)[C@@H](OC)[C@](C)(O1)n8c2ccccc2c7c3CNC(=O)c3c6c4ccccc4n5c6c78 | 62996-74-1 | cas | Protein kinase inhibition by staurosporine revealed in details of the molecular interaction with CDK2 | Lawrie AM, Noble ME, Tunnah P, Brown NR, Johnson LN, Endicott JA | Nat Struct Biol 4(10):796-801 | 1997 | 10.1038/nsb1097-796 | |||||||||
| Enzymes | 1aq1 | 1aq1-stu-2.00-d-1 | 2548 | oncolytic | cyclin-dependent kinase 2 CDK2 |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer | inhibition of cell cycle controlling enzyme CDK2 apoptosis in tumour cells |
stu | 2.00 | staurosporine | [H][C@]15C[C@@H](NC)[C@@H](OC)[C@](C)(O1)n8c2ccccc2c7c3CNC(=O)c3c6c4ccccc4n5c6c78 | 62996-74-1 | cas | Protein kinase inhibition by staurosporine revealed in details of the molecular interaction with CDK2 | Lawrie AM, Noble ME, Tunnah P, Brown NR, Johnson LN, Endicott JA | Nat Struct Biol 4(10):796-801 | 1997 | 10.1038/nsb1097-796 | |||||||||
| 1b3d | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1b3d | |||||||||||||||||||||
| Enzymes | 1bcu | 1bcu-prl-2.00-h-1 | 662 | thrombotic diseases cardiovascular |
thrombin coagulation factor II |
EC3.- (hydrolases) | proteases (serine) | thrombin | cardiovascular diseases thrombosis |
Thrombin, which cleaves bonds after Arg and Lys, converts fibrinogen to fibrin and activates factors V, VII, VIII, XIII, and, in complex with thrombomodulin, protein C anticoagulant inhibition of selective cleavage of Arg-Gly bonds in fibrinogen to form fibrin and release fibrinopeptides A and B |
prl | 2.00 | Proflavine | Nc1ccc2cc3ccc(N)cc3nc2c1 | 92-62-6 | CAS | X-ray and spectrophotometric studies of the binding of proflavin to the S1 specificity pocket of human alpha-thrombin | Conti E, Rivetti C, Wonacott A, Brick P | FEBS Lett 425(2):229-33 | 1998 | 10.1016/S0014-5793(98)00235-X | |||||||||
| 1bmk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1bmk | |||||||||||||||||||||
| Enzymes | 1bqn | 1bqn-hby-3.30-d-1-s | 76 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
hby | 3.30 | talviraline | COc1ccc2NC(=S)[C@H](CSC)N(C(=O)OC(C)C)c2c1 | 163451-80-7 | cas | Structures of Tyr188Leu mutant and wild-type HIV-1 reverse transcriptase complexed with the non-nucleoside inhibitor HBY 097: inhibitor flexibility is a useful design feature for reducing drug resistance | Hsiou Y, Das K, Ding J, Clark AD Jr, Kleim JP, Rosner M, Winkler I, Riess G, Hughes SH, Arnold E | J Mol Biol 284(2):313-23 | 1998 | 10.1006/jmbi.1998.2171 | |||||||||
| Enzymes | 1bqn | 1bqn-hby-3.30-d-1 | 985 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
hby | 3.30 | talviraline | COc1ccc2NC(=S)[C@H](CSC)N(C(=O)OC(C)C)c2c1 | 163451-80-7 | cas | Structures of Tyr188Leu mutant and wild-type HIV-1 reverse transcriptase complexed with the non-nucleoside inhibitor HBY 097: inhibitor flexibility is a useful design feature for reducing drug resistance | Hsiou Y, Das K, Ding J, Clark AD Jr, Kleim JP, Rosner M, Winkler I, Riess G, Hughes SH, Arnold E | J Mol Biol 284(2):313-23 | 1998 | 10.1006/jmbi.1998.2171 | |||||||||
| Enzymes | 1byg | 1byg-stu-2.40-h-1 | 216 | oncolytic | proto-oncogene tyrosine-protein kinase SRC c-src tyrosine kinase Pp60(src) src tyrosine kinase tyrosine kinase p60-src c-src tk |
EC2.- (transferases) | kinases (tyrosine) | c-Src | cancer osteoporosis |
no info | stu | 2.40 | Staurosporine | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)[N@H]3c4ccccc4-c5c6CNC(=O)c6c7-c8ccccc8[N@@H]2c7c35 | 62996-74-1 | CAS | Structure of the protein tyrosine kinase domain of C-terminal Src kinase (CSK) in complex with staurosporine | Lamers MB, Antson AA, Hubbard RE, Scott RK, Williams DH | J Mol Biol 285(2):713-25 | 1999 | 10.1006/jmbi.1998.2369 | |||||||||
| 1byg | CSK_HUMAN | P41240 | K05728 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1byg | |||||||||||||||||||||
| 1bzs | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1bzs | |||||||||||||||||||||
| 1c1c | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1c1c | |||||||||||||||||||||
| 1cg6 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1cg6 | |||||||||||||||||||||
| 1cgk | CHS2_MEDSA | P30074 | K00698 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Chitin synthase | 1cgk | |||||||||||||||||||||
| 1coy | CHOD_BREST | P22637 | K10078 (inferred by homologyHUMAN) | Glycan Binding Proteins | C-Type lectin | Group 8 Layilin and related receptors | CHODL; chondrolectin | Cholesterol oxidase | 1coy | 1702 | ||||||||||||||||||||
| 1cqp | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 1cqp | |||||||||||||||||||||
| 1crb | RET1_RAT | P02696 | KO_id not found | Others | Others | Others | Others | Others | 1crb | |||||||||||||||||||||
| 1d2s | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1d2s | |||||||||||||||||||||
| 1d3d | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1d3d | |||||||||||||||||||||
| 1d7u | DGDA_BURCE | P16932 | KO_id not found | Enzymes | 4. Lyases | decarboxylases | DGD (bacterial) | Others | 1d7u | |||||||||||||||||||||
| 1d7x | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1d7x | |||||||||||||||||||||
| 1dht | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1dht | |||||||||||||||||||||
| 1di8 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1di8 | |||||||||||||||||||||
| 1dig | C1TC_HUMAN | P11586 | K00288 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Formate---tetrahydrofolate ligase | 1dig | |||||||||||||||||||||
| 1e1x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1e1x | |||||||||||||||||||||
| 1e3k | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 1e3k | |||||||||||||||||||||
| 1e3v | SDIS_PSEPU | P07445 | KO_id not found | Enzymes | 5. Isomerases | steroid delta-isomerases | KSI (bacterial) | Others | 1e3v | |||||||||||||||||||||
| 1e8m | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1e8m | |||||||||||||||||||||
| Enzymes | 1e9h | 1e9h-inr-2.50-h-1 | 10.07159 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | inr | 2.50 | 478283-10-2 | [C=1C=CC2=C(C1)C(=O)\C(=C\3/C=4C=C(C=CC4NC3=O)S(=O)(=O)O)\N2] | 478283-10-2 | CAS | Inhibitor binding to active and inactive CDK2: the crystal structure of CDK2-cyclin A/indirubin-5-sulphonate. | Davies TG, Tunnah P, Meijer L, Marko D, Eisenbrand G, Endicott JA, Noble ME. | Structure 9(5):389-97 | 2001 | 10.1016/S0969-2126(01)00598-6 | |||||||||
| Enzymes | 1eet | 1eet-bfu-2.73-d-1-s | 1657 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
bfu | 2.73 | 231957-56-5 | CCC(=O)c1ccc(F)c([C@@H]2C[C@@H]2NC(=O)Nc3ccc(Br)cn3)c1O | 231957-56-5 | CAS | Urea-PETT compounds as a new class of HIV-1 reverse transcriptase inhibitors. 3. Synthesis and further structure-activity relationship studies of PETT analogues | Hogberg M, Sahlberg C, Engelhardt P, Noreen R, Kangasmetsa J, Johansson NG, Oberg B, Vrang L, Zhang H, Sahlberg BL, Unge T, Lovgren S, Fridborg K, Backbro K | J Med Chem 43(2):304 | 2000 | 10.1021/jm990572y | |||||||||
| 1eet | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1eet | |||||||||||||||||||||
| 1efy | PARP1_CHICK | P26446 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 1efy | |||||||||||||||||||||
| 1eh4 | CKI1_SCHPO | P40233 | K02218 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1eh4 | |||||||||||||||||||||
| 1ek2 | HYES_MOUSE | P34914 | K08726 | Enzymes | Hydrolases | Acting on ether bonds | Ether hydrolases | Soluble epoxide hydrolase | 1ek2 | |||||||||||||||||||||
| 1el3 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 1el3 | |||||||||||||||||||||
| 1eou | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1eou | |||||||||||||||||||||
| 1equ | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1equ | |||||||||||||||||||||
| 1erb | RET4_BOVIN | P18902 | KO_id not found | Others | Others | Others | Others | Others | 1erb | |||||||||||||||||||||
| 1f0r | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1f0r | |||||||||||||||||||||
| 1f0s | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1f0s | |||||||||||||||||||||
| Enzymes | 1f28 | 1f28-f89-1.90-d-1 | 1147 | antiinfective | pneumocystis carinii thymidylate synthase | EC2.- (transferases) | methyltransferases | TS (P.carinii) | fungal infection | inhibition of thymidylate synthase (DNA replication) | f89 | 1.9 | BW-1843U89 | Cc1nc(=O)c2c(ccc3ccc(CNc4ccc5C(=O)N(Cc5c4)[C@@H](CCC(=O)O)C(=O)O)cc32)[nH]1 | 139987-54-5 | cas | Approaches to Solving the Rigid Receptor Problem by Identifying a Minimal Set of Flexible Residues During Ligand Docking | Anderson, A. C., O'Neil, R. H., Surti, T. S., Stroud, R. M. | Chem.Biol. 8 pp. 445 | 2001 | ||||||||||
| 1f4e | TYSY_ECOLI | P0A884 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 1f4e | |||||||||||||||||||||
| 1fds | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1fds | |||||||||||||||||||||
| Enzymes | 1fgi | 1fgi-su1-2.50-h-1-s | 0.02983 | oncolytic | fibroblast growth factor receptor 1 | EC2.- (transferases) | kinases (tyrosine) | FGFR1 | diabetic retinopathy cardiovascular diseases cancer |
inhibition (enzyme); | su1 | 2.50 | 210303-49-4 | [CC1=CNC(=C1CCC(=O)O)C=C/2C3=CC=CC=C3NC2=O] | 210303-49-4 | CAS | Structures of the tyrosine kinase domain of fibroblast growth factor receptor in complex with inhibitors | Mohammadi, M., McMahon, G., Sun, L., Tang, C., Hirth, P., Yeh, B.K., Hubbard, S.R., Schlessinger, J. | Science 276:955-960 | 1997 | 10.1126/science.276.5314.955 | |||||||||
| Enzymes | 1fgi | 1fgi-su1-2.50-h-1 | 0.07457 | oncolytic | fibroblast growth factor receptor 1 | EC2.- (transferases) | kinases (tyrosine) | FGFR1 | diabetic retinopathy cardiovascular diseases cancer |
inhibition (enzyme); | su1 | 2.50 | 210303-49-4 | [CC1=CNC(=C1CCC(=O)O)C=C/2C3=CC=CC=C3NC2=O] | 210303-49-4 | CAS | Structures of the tyrosine kinase domain of fibroblast growth factor receptor in complex with inhibitors | Mohammadi, M., McMahon, G., Sun, L., Tang, C., Hirth, P., Yeh, B.K., Hubbard, S.R., Schlessinger, J. | Science 276:955-960 | 1997 | 10.1126/science.276.5314.955 | |||||||||
| 1fgi | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 1fgi | |||||||||||||||||||||
| 1fk9 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1fk9 | |||||||||||||||||||||
| 1fkh | FKB1A_HUMAN | P62942 | K09568 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 1fkh | |||||||||||||||||||||
| Enzymes | 1fko | 1fko-efz-2.90-d-1 | 1425 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 2.90 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural basis for the resilience of efavirenz (DMP-266) to drug resistance mutations in HIV-1 reverse transcriptase | Ren J, Milton J, Weaver KL, Short SA, Stuart DI, Stammers DK | Structure Fold Des 8(10):1089-94 | 2000 | 10.1016/S0969-2126(00)00513-X | |||||||||
| 1fm7 | CFI1_MEDSA | P28012 | K01859 | Enzymes | Isomerases | Intramolecular lyases | Intramolecular lyases (only sub-subclass identified to date) | Chalcone isomerase | 1fm7 | |||||||||||||||||||||
| 1ftl | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 1ftl | |||||||||||||||||||||
| Enzymes | 1fvt | 1fvt-106-2.20-h-1-s | 0.19538 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | 106 | 2.20 | 222035-13-4 | [C=1C=C(C=CC1NN=C2C3=CC(=CC=C3NC2=O)Br)S(=O)(=O)N] | 222035-13-4 | CAS | Prevention of chemotherapy-induced alopecia in rats by CDK inhibitors | Davis, S.T., Benson, B.G., Bramson, H.N., Chapman, D.E., Dickerson, S.H., Dold, K.M., Eberwein, D.J., Edelstein, M., Frye, S.V., Gampe Jr, R.T., Griffin, R.J., Harris, P.A., Hassell, A.M., Holmes, W.D., Hunter, R.N., Knick, V.B., Lackey, K., Lovejoy, B., Luzzio, M.J., Murray, D., Parker, P., Rocque, W.J., Shewchuk, L., Veal, J.M., Walker, D.H., Kuyper, L.F. | Science 291:134-137 | 2001 | 10.1126/science.291.5501.134 | |||||||||
| Enzymes | 1fvt | 1fvt-106-2.20-h-1 | 0.88441 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | 106 | 2.20 | 222035-13-4 | [C=1C=C(C=CC1NN=C2C3=CC(=CC=C3NC2=O)Br)S(=O)(=O)N] | 222035-13-4 | CAS | Prevention of chemotherapy-induced alopecia in rats by CDK inhibitors | Davis, S.T., Benson, B.G., Bramson, H.N., Chapman, D.E., Dickerson, S.H., Dold, K.M., Eberwein, D.J., Edelstein, M., Frye, S.V., Gampe Jr, R.T., Griffin, R.J., Harris, P.A., Hassell, A.M., Holmes, W.D., Hunter, R.N., Knick, V.B., Lackey, K., Lovejoy, B., Luzzio, M.J., Murray, D., Parker, P., Rocque, W.J., Shewchuk, L., Veal, J.M., Walker, D.H., Kuyper, L.F. | Science 291:134-137 | 2001 | 10.1126/science.291.5501.134 | |||||||||
| 1fvt | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1fvt | |||||||||||||||||||||
| 1fvv | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1fvv | |||||||||||||||||||||
| Enzymes | 1g5s | 1g5s-i17-2.60-h-1 | 4.25652 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | i17 | 2.60 | 714963-24-3 | [C=1C=CC(=CC1)CNC=2C3=C(N=C(N2)NC4CCC(CC4)N)N(C=N3)C5CCCC5] | 714963-24-3 | CAS | Crystal structure of human cyclin-dependent kinase 2 in complex with the adenine-derived inhibitor H717 | Dreyer MK, Borcherding DR, Dumont JA, Peet NP, Tsay JT, Wright PS, Bitonti AJ, Shen J, Kim SH | J Med Chem 44(4):524-530 | 2001 | 10.1021/jm001043t | |||||||||
| Enzymes | 1gcz | 1gcz-yz9-1.58-h-1-s | 409 | immunologic | Macrophage migration inhibitory factor GIF Glycosylation-inhibiting factor Phenylpyruvate tautomerase MIF |
EC5.- (isomerases) | phenylpyruvate tautomerases | MIF | inflammation cardiovascular diseases autoimmune suppression skin diseases |
The expression of MIF at sites of inflammation suggest a role for the mediator in regulating the function of macrophage in host defense. Also acts as a phenylpyruvate tautomerase | yz9 | 1.58 | 6093-71-6 | CCOC(=O)c1cc2ccc(O)cc2oc1=O | 6093-71-6 | CAS | Coumarin and chromen-4-one analogues as tautomerase inhibitors of macrophage migration inhibitory factor: discovery and X-ray crystallography | Orita M, Yamamoto S, Katayama N, Aoki M, Takayama K, Yamagiwa Y, Seki N, Suzuki H, Kurihara H, Sakashita H, Takeuchi M, Fujita S, Yamada T, Tanaka A | J Med Chem 44(4):540-7 | 2001 | 10.1021/jm000386o | |||||||||
| 1gg5 | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1gg5 | |||||||||||||||||||||
| Enzymes | 1gih | 1gih-1pu-2.80-h-1-s | 0.90380 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | 1pu | 2.80 | 391937-50-1 | [C1=CC=NC(=C1)NC(=O)NC=2C=CC=C3C2[C@H]4CCCN4C3=O] | 391937-50-1 | CAS | Crystallographic approach to identification of cyclin-dependent kinase 4 (CDK4)-specific inhibitors by using CDK4 mimic CDK2 protein | Ikuta M, Kamata K, Fukasawa K, Honma T, Machida T, Hirai H, Suzuki-Takahashi I, Hayama T, Nishimura S | J Biol Chem 276(29):27548-27554 | 2001 | 10.1074/jbc.M102060200 | |||||||||
| Enzymes | 1gih | 1gih-1pu-2.80-h-1 | 4.74422 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | 1pu | 2.80 | 391937-50-1 | [C1=CC=NC(=C1)NC(=O)NC=2C=CC=C3C2[C@H]4CCCN4C3=O] | 391937-50-1 | CAS | Crystallographic approach to identification of cyclin-dependent kinase 4 (CDK4)-specific inhibitors by using CDK4 mimic CDK2 protein | Ikuta M, Kamata K, Fukasawa K, Honma T, Machida T, Hirai H, Suzuki-Takahashi I, Hayama T, Nishimura S | J Biol Chem 276(29):27548-27554 | 2001 | 10.1074/jbc.M102060200 | |||||||||
| 1gii | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1gii | |||||||||||||||||||||
| 1gs4 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1gs4 | |||||||||||||||||||||
| Receptors | 1gwq | 1gwq-ztw-2.45-x-1-s | 153 | metabolic oncolytic endocrine |
estrogen receptor alpha | Transduction factor receptors | nuclear hormone receptors | ER-alpha | brain injury cancer cardiovascular diseases cognitive defects osteoporosis postmenopausal symptoms |
ER is a nuclear receptor, activation (e.g. with estradiol) causes proliferative effects. Inhibitors act anti-proliferative. | ztw | 2.45 | 63676-22-2 | Oc1ccc(cc1)c2cc3ccc(O)cc3s2 | 63676-22-2 | cas | Interaction of transcriptional intermediary factor 2 nuclear receptor box peptides with the coactivator binding site of estrogen receptor alpha | Warnmark A, Treuter E, Gustafsson JA, Hubbard RE, Brzozowski AM, Pike AC | J Biol Chem 277(24):21862-8 | 2002 | 10.1074/jbc.M200764200 | |||||||||
| 1gx8 | LACB_BOVIN | P02754 | KO_id not found | Others | Others | Others | Others | Others | 1gx8 | |||||||||||||||||||||
| 1h69 | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1h69 | |||||||||||||||||||||
| 1h8d | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1h8d | |||||||||||||||||||||
| Transport proteins | 1h9z | 1h9z-rwf-2.50-h-1 | 13576 | immunologic | Serum albumin | extracellular proteins | serum proteins | HSA | inflammation | Serum albumin, the main protein of plasma, has a good binding capacity for water, Ca(2+), Na(+), K(+), fatty acids, hormones, bilirubin and drugs. Its main function is the regulation of the colloidal osmotic pressure of blood. | rwf | 2.50 | (S)-Warfarin | CC(=O)C[C@H](c1ccccc1)c2c(O)c3ccccc3oc2=O | 5543-57-7 | CAS | Crystal structure analysis of warfarin binding to human serum albumin: anatomy of drug site I | Petitpas I, Bhattacharya AA, Twine S, East M, Curry S | J Biol Chem 276(25):22804-9 | 2001 | 10.1074/jbc.M100575200 | |||||||||
| Transport proteins | 1ha2 | 1ha2-swf-2.50-h-1-s | 1310 | immunologic | Serum albumin | extracellular proteins | serum proteins | HSA | inflammation | Serum albumin, the main protein of plasma, has a good binding capacity for water, Ca(2+), Na(+), K(+), fatty acids, hormones, bilirubin and drugs. Its main function is the regulation of the colloidal osmotic pressure of blood. | swf | 2.50 | (R)-Warfarin | CC(=O)C[C@@H](c1ccccc1)c2c(O)c3ccccc3oc2=O | 5543-58-8 | CAS | Crystal structure analysis of warfarin binding to human serum albumin: anatomy of drug site I | Petitpas I, Bhattacharya AA, Twine S, East M, Curry S | J Biol Chem 276(25):22804-9 | 2001 | 10.1074/jbc.M100575200 | |||||||||
| Transport proteins | 1ha2 | 1ha2-swf-2.50-h-1 | 12247 | immunologic | Serum albumin | extracellular proteins | serum proteins | HSA | inflammation | Serum albumin, the main protein of plasma, has a good binding capacity for water, Ca(2+), Na(+), K(+), fatty acids, hormones, bilirubin and drugs. Its main function is the regulation of the colloidal osmotic pressure of blood. | swf | 2.50 | (R)-Warfarin | CC(=O)C[C@@H](c1ccccc1)c2c(O)c3ccccc3oc2=O | 5543-58-8 | CAS | Crystal structure analysis of warfarin binding to human serum albumin: anatomy of drug site I | Petitpas I, Bhattacharya AA, Twine S, East M, Curry S | J Biol Chem 276(25):22804-9 | 2001 | 10.1074/jbc.M100575200 | |||||||||
| 1hpz | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1hpz | |||||||||||||||||||||
| Structuring proteins | 1hrv | 1hrv-sdz-3.00-d-2-s | 598 | antiinfective | HRV coat protein | Cellular level | viral coat proteins | VP1-4 (HRV) | common cold | inhibition of viral entry into host cell and/or uncoating occupation of a hydrophobic pocket and consequent stabilisation of viral capsid |
sdz | 3.00 | INT-SDZ 35-682-art-1-d | O[C@H](COc1ccc(cc1)C2CCCCC2)CN3CCN(CC3)c4ccccn4 | INT-SDZ 35-682-art-1-d | INT | SDZ 35-682, a new picornavirus capsid-binding agent with potent antiviral activity | Rosenwirth B, Oren DA, Arnold E, Kis ZL, Eggers HJ | Antiviral Res 26(1):65-82 | 1995 | 10.1016/0166-3542(94)00066-H | |||||||||
| 1i33 | G3PG_LEIME | Q27890 | KO_id not found | Enzymes | 1. Oxidoreductases | aldehyde dehydrogenases | GAPDH (L.mexicana) | Others | 1i33 | |||||||||||||||||||||
| 1i38 | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1i38 | |||||||||||||||||||||
| 1i73 | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1i73 | |||||||||||||||||||||
| 1i8z | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1i8z | |||||||||||||||||||||
| 1i90 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1i90 | |||||||||||||||||||||
| Enzymes | 1ia2 | 1ia2-tq4-1.82-d-1-s | 2024 | antiinfective | candida albicans dihydrofolate reductase | EC1.- (oxydo-reductases) | dihydrofolate reductases | DHFR (C.albicans) | fungal infection | inhibition of fungal dihydrofolate reductase reduction of tetrahydrofolate |
tq4 | 1.82 | 168910-32-5 | Cc1ccc(Sc2cccc3nc(N)nc(N)c23)cc1 | 168910-32-5 | cas | X-Ray crystal structures of Candida albicans dihydrofolate reductase: high resolution ternary complexes in which the dihydronicotinamide moiety of NADPH is displaced by an inhibitor | Whitlow M, Howard AJ, Stewart D, Hardman KD, Chan JH, Baccanari DP, Tansik RL, Hong JS, Kuyper LF | J Med Chem 44(18):2928-32 | 2001 | 10.1021/jm0101444 | |||||||||
| 1if9 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1if9 | |||||||||||||||||||||
| 1ihi | AK1C2_HUMAN | P52895 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 1ihi | |||||||||||||||||||||
| 1ij8 | AVID_CHICK | P02701 | KO_id not found | Others | Others | Others | Others | Others | 1ij8 | |||||||||||||||||||||
| Enzymes | 1ikv | 1ikv-efz-3.00-d-1-s | 1202 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 3.00 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural basis for the inhibitory efficacy of efavirenz (DMP-266), MSC194 and PNU142721 towards the HIV-1 RT K103N mutant | Lindberg J, Sigurdsson S, Lowgren S, Andersson HO, Sahlberg C, Noreen R, Fridborg K, Zhang H, Unge T | Eur J Biochem 269(6):1670-7 | 2002 | 10.1046/j.1432-1327.2002.02811.x | |||||||||
| Enzymes | 1ikw | 1ikw-efz-3.00-d-1-s | 1148 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 3.00 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural basis for the inhibitory efficacy of efavirenz (DMP-266), MSC194 and PNU142721 towards the HIV-1 RT K103N mutant | Lindberg J, Sigurdsson S, Lowgren S, Andersson HO, Sahlberg C, Noreen R, Fridborg K, Zhang H, Unge T | Eur J Biochem 269(6):1670-7 | 2002 | 10.1046/j.1432-1327.2002.02811.x | |||||||||
| 1iky | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1iky | |||||||||||||||||||||
| 1j4i | FKB1A_HUMAN | P62942 | K09568 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 1j4i | |||||||||||||||||||||
| 1jg0 | TYSY_ECOLI | P0A884 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 1jg0 | |||||||||||||||||||||
| 1jiz | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 1jiz | |||||||||||||||||||||
| Enzymes | 1jla | 1jla-tnk-2.50-d-1-s | 1169 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
tnk | 2.50 | TNK-651 | CC(C)c1c(Cc2ccccc2)n(COCc3ccccc3)c(=O)[nH]c1=O | 175739-42-1 | cas | Structural mechanisms of drug resistance for mutations at codons 181 and 188 in HIV-1 reverse transcriptase and the improved resilience of second generation non-nucleoside inhibitors | Ren J, Nichols C, Bird L, Chamberlain P, Weaver K, Short S, Stuart DI, Stammers DK | J Mol Biol 312(4):795-805 | 2001 | 10.1006/jmbi.2001.4988 | |||||||||
| 1jla | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1jla | |||||||||||||||||||||
| Enzymes | 1jlc | 1jlc-ftc-3.00-d-1-s | 1001 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
ftc | 3.00 | PETT-2 | CCOc1ccnc(CCNC(=S)Nc2ccc(Cl)cn2)c1F | 265672-03-5 | cas | Structural mechanisms of drug resistance for mutations at codons 181 and 188 in HIV-1 reverse transcriptase and the improved resilience of second generation non-nucleoside inhibitors | Ren J, Nichols C, Bird L, Chamberlain P, Weaver K, Short S, Stuart DI, Stammers DK | J Mol Biol 312(4):795-805 | 2001 | 10.1006/jmbi.2001.4988 | |||||||||
| 1jlq | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1jlq | |||||||||||||||||||||
| 1jtv | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1jtv | |||||||||||||||||||||
| Enzymes | 1jvp | 1jvp-lig-1.53-h-1 | 8.57867 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | lig | 1.5 | 54714-78-2 | [C=1C=CC2=C(C1)CC3=C2NN=C3C4=CC=NC=C4] | 54714-78-2 | CAS | Structure-based design and protein X-ray analysis of a protein kinase inhibitor | Furet, P., Meyer, T., Strauss, A., Raccuglia, S., Rondeau, J.M. | Bioorg Med Chem Lett 12:221-224 | 2002 | 10.1016/S0960-894X(01)00715-6 | |||||||||
| 1k7f | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 1k7f | |||||||||||||||||||||
| 1kbq | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1kbq | |||||||||||||||||||||
| Enzymes | 1ke5 | 1ke5-ls1-2.20-h-1-s | 0.93065 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | ls1 | 2.2 | 388627-55-2 | [CNS(=O)(=O)C1=CC=C(C=C1)NC=C2C=3C=CC=CC3NC2=O] | 388627-55-2 | CAS | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem 44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
| Enzymes | 1ke5 | 1ke5-ls1-2.20-h-1 | 8.68158 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | ls1 | 2.2 | 388627-55-2 | [CNS(=O)(=O)C1=CC=C(C=C1)NC=C2C=3C=CC=CC3NC2=O] | 388627-55-2 | CAS | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem 44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
| 1ke5 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ke5 | |||||||||||||||||||||
| Enzymes | 1ke6 | 1ke6-ls2-2.00-d-1-s | 51 | oncolytic | cyclin-dependent kinase 2 CDK2 |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer | inhibition of cell cycle controlling enzyme CDK2 apoptosis in tumour cells |
ls2 | 2.00 | 388627-68-7 | CNS(=O)(=O)Cc1ccc(N/N=C/2\C(=O)Nc3ccc4ncsc4c23)cc1 | 388627-68-7 | cas | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem ;44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
| Enzymes | 1ke6 | 1ke6-ls2-2.00-d-1 | 765 | oncolytic | cyclin-dependent kinase 2 CDK2 |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer | inhibition of cell cycle controlling enzyme CDK2 apoptosis in tumour cells |
ls2 | 2.00 | 388627-68-7 | CNS(=O)(=O)Cc1ccc(N/N=C/2\C(=O)Nc3ccc4ncsc4c23)cc1 | 388627-68-7 | cas | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem ;44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
| 1ke6 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ke6 | |||||||||||||||||||||
| Enzymes | 1ke8 | 1ke8-ls4-2.00-d-1-s | 50 | oncolytic | cyclin-dependent kinase 2 CDK2 |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer | inhibition of cell cycle controlling enzyme CDK2 apoptosis in tumour cells |
ls4 | 2.00 | 388627-59-6 | O=C/1Nc2ccccc2\C1=C\Nc3ccc(cc3)S(=O)(=O)Nc4nccs4 | 388627-59-6 | cas | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem ;44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
| Enzymes | 1ke8 | 1ke8-ls4-2.00-d-1 | 1264 | oncolytic | cyclin-dependent kinase 2 CDK2 |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer | inhibition of cell cycle controlling enzyme CDK2 apoptosis in tumour cells |
ls4 | 2.00 | 388627-59-6 | O=C/1Nc2ccccc2\C1=C\Nc3ccc(cc3)S(=O)(=O)Nc4nccs4 | 388627-59-6 | cas | Oxindole-based inhibitors of cyclin-dependent kinase 2 (CDK2): design, synthesis, enzymatic activities, and X-ray crystallographic analysis | Bramson HN, Corona J, Davis ST, Dickerson SH, Edelstein M, Frye SV, Gampe RT Jr, Harris PA, Hassell A, Holmes WD, Hunter RN, Lackey KE, Lovejoy B, Luzzio MJ, Montana V, Rocque WJ, Rusnak D, Shewchuk L, Veal JM, Walker DH, Kuyper LF | J Med Chem ;44(25):4339-58 | 2001 | 10.1021/jm010117d | |||||||||
| 1ke8 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1ke8 | |||||||||||||||||||||
| 1klm | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 1klm | |||||||||||||||||||||
| 1kui | VM2T3_PROMU | O57413 | KO_id not found | Others | Others | Others | Others | Others | 1kui | |||||||||||||||||||||
| 1l2s | AMPC_ECOLI | P00811 | K01467 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amides | Beta-lactamase | 1l2s | |||||||||||||||||||||
| 1lhn | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1lhn | |||||||||||||||||||||
| 1lho | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1lho | |||||||||||||||||||||
| 1lhu | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1lhu | |||||||||||||||||||||
| 1lhv | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1lhv | |||||||||||||||||||||
| 1lkd | BPHC_BURXL | P47228 | K00462 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | Biphenyl-2,3-diol 1,2-dioxygenase | 1lkd | |||||||||||||||||||||
| 1lox | LOX15_RABIT | P12530 | K00460 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | Arachidonate 15-lipoxygenase | 1lox | |||||||||||||||||||||
| 1lp6 | PYRF_METTH | O26232 | K01591 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Orotidine-5'-phosphate decarboxylase | 1lp6 | |||||||||||||||||||||
| Enzymes | 1lx6 | 1lx6-zam-2.40-d-1-s | 0.68605518 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (e.coli) | bacterial infection | inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
zam | 2.40 | 334999-42-7 | CC(=O)N(C)Cc3cc(C(=O)N(C)Cc2cc1ccccc1n2C)ccc3N | 334999-42-7 | cas | Discovery of aminopyridine-based inhibitors of bacterial enoyl-ACP reductase (FabI) | Miller WH, Seefeld MA, Newlander KA, Uzinskas IN, Burgess WJ, Heerding DA, Yuan CC, Head MS, Payne DJ, Rittenhouse SF, Moore TD, Pearson SC, Berry V, DeWolf WE Jr, Keller PM, Polizzi BJ, Qiu X, Janson CA, Huffman WF | J Med Chem 45(15):3246-56 | 2002 | 10.1021/jm020050+ | |||||||||
| Enzymes | 1lxc | 1lxc-aym-2.40-d-1-s | 1.70618941 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (e.coli) | bacterial infection | inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
aym | 2.40 | 335027-53-7 | CN(Cc2cc1ccccc1n2C)C(=O)C=Cc3ccc(N)nc3 | 335027-53-7 | cas | Discovery of aminopyridine-based inhibitors of bacterial enoyl-ACP reductase (FabI) | Miller WH, Seefeld MA, Newlander KA, Uzinskas IN, Burgess WJ, Heerding DA, Yuan CC, Head MS, Payne DJ, Rittenhouse SF, Moore TD, Pearson SC, Berry V, DeWolf WE Jr, Keller PM, Polizzi BJ, Qiu X, Janson CA, Huffman WF | J Med Chem 45(15):3246-56 | 2002 | 10.1021/jm020050+ | |||||||||
| Enzymes | 1m17 | 1m17-aq4-2.60-h-1 | 2.81133 | oncolytic neurological |
epidermal growth factor receptor ErbB1 | EC2.- (transferases) | kinases (tyrosine) | EGFR | cancer | inhibition (enzyme); | aq4 | 2.60 | 183321-74-6 | [COCCOC=1C=C2C(=CC1OCCOC)N=CN=C2NC=3C=CC=C(C3)C#C] | 183321-74-6 | CAS | Structure of the epidermal growth factor receptor kinase domain alone and in complex with a 4-anilinoquinazoline inhibitor | Stamos J, Sliwkowski MX, Eigenbrot C | J Biol Chem 277(48):46265-72 | 2002 | 10.1074/jbc.M207135200 | |||||||||
| 1m2r | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 1m2r | |||||||||||||||||||||
| Enzymes | 1mfp | 1mfp-idn-2.33-d-1-s | 0.98881432 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (e.coli) | bacterial infection | inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
idn | 2.33 | 335029-32-8 | CN(Cc1cn(C)c2ccccc12)C(=O)C=Cc4c[nH]c3=NC(=O)CCc3c4 | 335029-32-8 | cas | Indole naphthyridinones as inhibitors of bacterial enoyl-ACP reductases FabI and FabK | Seefeld MA, Miller WH, Newlander KA, Burgess WJ, DeWolf WE Jr, Elkins PA, Head MS, Jakas DR, Janson CA, Keller PM, Manley PJ, Moore TD, Payne DJ, Pearson S, Polizzi BJ, Qiu X, Rittenhouse SF, Uzinskas IN, Wallis NG, Huffman WF | J Med Chem 46(9):1627-35 | 2003 | 10.1021/jm0204035 | |||||||||
| 1mu6 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1mu6 | |||||||||||||||||||||
| 1mu8 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1mu8 | |||||||||||||||||||||
| 1mvn | HAL3A_ARATH | Q9SWE5 | K01598 | Enzymes | Lyases | Carbon-carbon lyases | Carboxy-lyases | Phosphopantothenoylcysteine decarboxylase | 1mvn | |||||||||||||||||||||
| 1ndy | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1ndy | |||||||||||||||||||||
| 1nfu | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1nfu | |||||||||||||||||||||
| Enzymes | 1nfw | 1nfw-rrr-2.10-h-1 | 308 | Cardiovascular disease | coagulation factor Xa Factor Xa Fxa activated coagulation factor X |
EC3.- (hydrolases) | proteases (serine) | FXa | cardiovascular diseases thrombosis |
no info | rrr | 2.10 | RPR 209685 | Clc1ccc(/C=C/S(=O)(=O)N2CCN(Cc3cc4cnccc4[nH]3)C(=O)C2)s1 | 502936-46-1 | CAS | Molecular structures of human factor Xa complexed with ketopiperazine inhibitors: preference for a neutral group in the S1 pocket | Maignan S, Guilloteau JP, Choi-Sledeski YM, Becker MR, Ewing WR, Pauls HW, Spada AP, Mikol V | J Med Chem 46(5):685-90. | 2003 | 10.1021/jm0203837 | |||||||||
| 1nfw | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1nfw | |||||||||||||||||||||
| Enzymes | 1nfx | 1nfx-rdr-2.15-h-1 | 1481 | Cardiovascular disease | coagulation factor Xa Factor Xa Fxa activated coagulation factor X |
EC3.- (hydrolases) | proteases (serine) | FXa | cardiovascular diseases thrombosis |
no info | rdr | 2.15 | RPR 208944 | OCCn1c(CN2CCN(CC2=O)S(=O)(=O)c3cc4ccc(Cl)cc4s3)cc5cnccc15 | 234100-47-1 | CAS | Molecular structures of human factor Xa complexed with ketopiperazine inhibitors: preference for a neutral group in the S1 pocket | Maignan S, Guilloteau JP, Choi-Sledeski YM, Becker MR, Ewing WR, Pauls HW, Spada AP, Mikol V | J Med Chem 46(5):685-90. | 2003 | 10.1021/jm0203837 | |||||||||
| 1nfx | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1nfx | |||||||||||||||||||||
| Enzymes | 1nhu | 1nhu-153-2.00-d-2 | 1602 | antiinfective | RNA-dependent RNA polymerase (NS5B) from hepatitic C virus | EC2.- (transferases) | RNA polymerases | NS5B (HCV) | hepatitis C virus infection | inhibition of viral replication inhibition of transcription of viral genomic RNA and consequently of viral genome replication |
153 | 2.00 | 478295-62-4 | OC(=O)[C@H](Cc1ccccc1)N(Cc2cccc(c2)C(F)(F)F)C(=O)c3ccc(Cl)cc3Cl | 478295-62-4 | CAS | Non-nucleoside analogue inhibitors bind to an allosteric site on HCV NS5B polymerase. Crystal structures and mechanism of inhibition | Wang M, Ng KK, Cherney MM, Chan L, Yannopoulos CG, Bedard J, Morin N, Nguyen-Ba N, Alaoui-Ismaili MH, Bethell RC, James MN | J Biol Chem 278(11):9489-95 | 2003 | 10.1074/jbc.M209397200 | |||||||||
| Enzymes | 1nhv | 1nhv-154-2.90-d-2 | 2302 | antiinfective | RNA-dependent RNA polymerase (NS5B) from hepatitic C virus | EC2.- (transferases) | RNA polymerases | NS5B (HCV) | hepatitis C virus infection | inhibition of viral replication inhibition of transcription of viral genomic RNA and consequently of viral genome replication |
154 | 2.90 | 478295-04-4 | OC(=O)[C@H](Cc1ccccc1)N(Cc2ccc(s2)c3cc4ccccc4o3)C(=O)c5ccc(Cl)cc5Cl | 478295-04-4 | CAS | Non-nucleoside analogue inhibitors bind to an allosteric site on HCV NS5B polymerase. Crystal structures and mechanism of inhibition | Wang M, Ng KK, Cherney MM, Chan L, Yannopoulos CG, Bedard J, Morin N, Nguyen-Ba N, Alaoui-Ismaili MH, Bethell RC, James MN | J Biol Chem 278(11):9489-95 | 2003 | 10.1074/jbc.M209397200 | |||||||||
| 1nhz | GCR_HUMAN | P04150 | K05771 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C1, GR; glucocorticoid receptor | Others | 1nhz | |||||||||||||||||||||
| 1nlu | PICP_PSESR | P42790 | KO_id not found | Others | Others | Others | Others | Others | 1nlu | |||||||||||||||||||||
| 1nnu | Q9BH77_PLAFA | Q9BH77 | KO_id not found | Enzymes | 1. Oxidoreductases | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (P.falciparum) | Others | 1nnu | |||||||||||||||||||||
| 1nup | NMNA3_HUMAN | Q96T66 | K06210 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Nicotinamide-nucleotide adenylyltransferase | 1nup | |||||||||||||||||||||
| Enzymes | 1nvr | 1nvr-stu-1.80-d-1 | 927 | oncolytic | serine/threonine-protein kinase Chk1 (checkpoint kinase) | EC2.- (transferases) | kinases (serine-threonine) | Chk1 | cancer | prevention of cell cycle delays that provide opportunities for cells to repair DNA damage interference with G(2)/M cell cycle control |
stu | 1.80 | staurosporine | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n3c4ccccc4c5c6CNC(=O)c6c7c8ccccc8n2c7c35 | 62996-74-1 | cas | Structural basis for Chk1 inhibition by UCN-01 | Zhao B, Bower MJ, McDevitt PJ, Zhao H, Davis ST, Johanson KO, Green SM, Concha NO, Zhou BB | J Biol Chem 277(48):46609-15 | 2002 | 10.1074/jbc.M201233200 | |||||||||
| Enzymes | 1nvs | 1nvs-ucm-1.80-d-1-s | 1784 | oncolytic | serine/threonine-protein kinase Chk1 (checkpoint kinase) | EC2.- (transferases) | kinases (serine-threonine) | Chk1 | cancer | prevention of cell cycle delays that provide opportunities for cells to repair DNA damage interference with G(2)/M cell cycle control |
ucm | 1.80 | SB-218078 | O=C1NC(=O)c2c1c3c4ccccc4n5[C@H]6CC[C@H](O6)n7c8ccccc8c2c7c53 | 135897-06-2 | cas | Structural basis for Chk1 inhibition by UCN-01 | Zhao B, Bower MJ, McDevitt PJ, Zhao H, Davis ST, Johanson KO, Green SM, Concha NO, Zhou BB | J Biol Chem 277(48):46609-15 | 2002 | 10.1074/jbc.M201233200 | |||||||||
| 1nwk | ACTS_RABIT | P68135 | K10354 | Others | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actins | Actins | 1nwk | |||||||||||||||||||||
| Enzymes | 1nxk | 1nxk-stu-2.70-h-1 | 609 | no info | map kap kinase 2 mitogen-activated protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | MAP kinase 2 | cancer | no info | stu | 2.70 | Staurosporine | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)[N@H]3c4ccccc4-c5c6CNC(=O)c6c7-c8ccccc8[N@H]2c7c35 | 62996-74-1 | CAS | Catalytically active MAP KAP kinase 2 structures in complex with staurosporine and ADP reveal differences with the autoinhibited enzyme | Underwood KW, Parris KD, Federico E, Mosyak L, Czerwinski RM, Shane T, Taylor M, Svenson K, Liu Y, Hsiao CL, Wolfrom S, Maguire M, Malakian K, Telliez JB, Lin LL, Kriz RW, Seehra J, Somers WS, Stahl ML | Structure (Camb) 11(6):627-36 | 2003 | 10.1016/S0969-2126(03)00092-3 | |||||||||
| 1nyx | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 1nyx | |||||||||||||||||||||
| 1o6g | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1o6g | |||||||||||||||||||||
| 1of1 | KITH_HHV11 | P03176 | K00857 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Thymidine kinase | 1of1 | |||||||||||||||||||||
| 1oiq | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1oiq | |||||||||||||||||||||
| 1opb | RET2_RAT | P06768 | KO_id not found | Others | Others | Others | Others | Others | 1opb | |||||||||||||||||||||
| 1oq5 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1oq5 | |||||||||||||||||||||
| Enzymes | 1os5 | 1os5-nh1-2.20-d-1 | 2889 | antiinfective | RNA-dependent RNA polymerase (NS5B) from hepatitic C virus | EC2.- (transferases) | RNA polymerases | NS5B (HCV) | hepatitis C virus infection | inhibition of viral replication inhibition of transcription of viral genomic RNA and consequently of viral genome replication |
nh1 | 2.20 | INT-239804-71-8-art-1-d | Cc1cc(SC2=C(O)C[C@](CCc3ccc(O)cc3)(OC2=O)C4CCCC4)c(cc1N)C(C)(C)C | INT-239804-71-8-art-1-d | INT | Crystallographic identification of a noncompetitive inhibitor binding site on the hepatitis C virus NS5B RNA polymerase enzyme | Love RA, Parge HE, Yu X, Hickey MJ, Diehl W, Gao J, Wriggers H, Ekker A, Wang L, Thomson JA, Dragovich PS, Fuhrman SA | J Virol 77(13):7575-81 | 2003 | 10.1128/JVI.77.13.7575-7581.2003 | |||||||||
| 1oum | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1oum | |||||||||||||||||||||
| 1ov6 | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1ov6 | |||||||||||||||||||||
| 1ovg | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1ovg | |||||||||||||||||||||
| 1oxl | PA2B8_DABRR | P59071 | KO_id not found | Others | Others | Others | Others | Others | 1oxl | |||||||||||||||||||||
| Enzymes | 1p2a | 1p2a-5bn-2.5-h-1 | 6.85309 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | sbn | 2.5 | 444099-54-1 | [C=1C=C(NC1)C=2C=C(C=3C(=CC=C4C3C2C(=O)N4)F)NCCN] | 444099-54-1 | CAS | 3,5,6-Trisubstituted Naphthostyrils as CDK2 Inhibitors | Liu, J.-J., Dermatakis, A., Lukacs, C.M., Konzelmann, F., Chen, Y., Kammlott, U., Depinto, W., Yang, H., Yin, X., Chen, Y., Schutt, A., Simcox, M.E., Luk, K.-C. | Bioorg Med Chem 13:2465-2468 | 2003 | 10.1016/S0960-894X(03)00488-8 | |||||||||
| 1pke | DEOD_ECO57 | P0ABP9 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1pke | |||||||||||||||||||||
| 1pxl | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1pxl | |||||||||||||||||||||
| 1pxm | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1pxm | |||||||||||||||||||||
| 1pxo | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1pxo | |||||||||||||||||||||
| 1pxx | PGH2_MOUSE | Q05769 | K11987 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 1pxx | |||||||||||||||||||||
| 1py5 | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 1py5 | |||||||||||||||||||||
| Enzymes | 1pye | 1pye-pm1-2.00-h-1-s | 773 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | pm1 | 2.00 | 490038-61-4 | Nc1nc2ccc(cn2c1C(=O)c3ccccc3)C(=O)c4c(F)cccc4F | 490038-61-4 | CAS | The discovery of a new structural class of cyclin-dependent kinase inhibitors, aminoimidazo[1,2-a]pyridines | Hamdouchi C, Keyser H, Collins E, Jaramillo C, De Diego JE, Spencer CD, Dempsey JA, Anderson BD, Leggett T, Stamm NB, Schultz RM, Watkins SA, Cocke K, Lemke S, Burke TF, Beckmann RP, Dixon JT, Gurganus TM, Rankl NB, Houck KA, Zhang F, Vieth M, Espinosa J, Timm DE, Campbell RM, Patel BK, Brooks HB | Mol Cancer Ther 3(1):1-9 | 2004 | ||||||||||
| 1pye | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1pye | |||||||||||||||||||||
| 1pzo | BLAT_ECOLX | P62593 | KO_id not found | Others | Others | Others | Others | Others | 1pzo | |||||||||||||||||||||
| 1q23 | CAT_ECOLX | P62577 | KO_id not found | Others | Others | Others | Others | Others | 1q23 | |||||||||||||||||||||
| 1q3a | MMP10_HUMAN | P09238 | K01396 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 2 | 1q3a | |||||||||||||||||||||
| 1q3d | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 1q3d | |||||||||||||||||||||
| 1q41 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 1q41 | |||||||||||||||||||||
| Enzymes | 1qcf | 1qcf-pp1-2.00-h-1-s | 1349 | oncolytic | hck | EC2.- (transferases) | kinases (tyrosine) | Hck | cancer | no info | pp1 | 2.00 | 0 | Cc1ccc(cc1)[C@H]2NN(c3ncnc(N)c23)C(C)(C)C | 0 | CAS | Crystal structure of Hck in complex with a Src family-selective tyrosine kinase inhibitor | Schindler T, Sicheri F, Pico A, Gazit A, Levitzki A, Kuriyan J | Mol Cell 3(5):639-48 | 1999 | 10.1016/S1097-2765(00)80357-3 | |||||||||
| 1qcf | HCK_HUMAN | P08631 | K08893 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1qcf | |||||||||||||||||||||
| 1qjj | ASTA_ASTFL | P07584 | K00673 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Arginine N-succinyltransferase | 1qjj | |||||||||||||||||||||
| Enzymes | 1qpd | 1qpd-stu-2.00-h-1 | 1404 | no info | Lymphocyte-specific kinase LCK | EC2.- (transferases) | kinases (tyrosine) | Lck | autoimmune suppression | no info | stu | 2.00 | Staurosporine | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)[N@H]3c4ccccc4-c5c6CNC(=O)c6c7-c8ccccc8[N@H]2c7c35 | 62996-74-1 | CAS | Structural analysis of the lymphocyte-specific kinase Lck in complex with non-selective and Src family selective kinase inhibitors | Zhu X, Kim JL, Newcomb JR, Rose PE, Stover DR, Toledo LM, Zhao H, Morgenstern KA | Structure Fold Des 7(6):651-61 | 1999 | ||||||||||
| 1qpe | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 1qpe | |||||||||||||||||||||
| Enzymes | 1qpj | 1qpj-stu-2.20-h-1-s | 127 | no info | Lymphocyte-specific kinase LCK | EC2.- (transferases) | kinases (tyrosine) | Lck | autoimmune suppression | no info | stu | 2.20 | Staurosporine | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)[N@H]3c4ccccc4-c5c6CNC(=O)c6c7-c8ccccc8[N@@H]2c7c35 | 62996-74-1 | CAS | Structural analysis of the lymphocyte-specific kinase Lck in complex with non-selective and Src family selective kinase inhibitors | Zhu X, Kim JL, Newcomb JR, Rose PE, Stover DR, Toledo LM, Zhao H, Morgenstern KA | Structure Fold Des 7(6):651-61 | 1999 | ||||||||||
| Enzymes | 1qpj | 1qpj-stu-2.20-h-1 | 963 | no info | Lymphocyte-specific kinase LCK | EC2.- (transferases) | kinases (tyrosine) | Lck | autoimmune suppression | no info | stu | 2.20 | Staurosporine | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)[N@H]3c4ccccc4-c5c6CNC(=O)c6c7-c8ccccc8[N@@H]2c7c35 | 62996-74-1 | CAS | Structural analysis of the lymphocyte-specific kinase Lck in complex with non-selective and Src family selective kinase inhibitors | Zhu X, Kim JL, Newcomb JR, Rose PE, Stover DR, Toledo LM, Zhao H, Morgenstern KA | Structure Fold Des 7(6):651-61 | 1999 | ||||||||||
| 1qy8 | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 1qy8 | |||||||||||||||||||||
| Enzymes | 1qyx | 1qyx-asd-1.89-x-1-s | 1294 | endocrine | 17beta-hydroxysteroid dehydrogenase type 1 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 17beta-HSD 1 | cancer | reduction of estrogens and androgens | asd | 1.89 | androstenedione | C[C@@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]2CCC1=O | 63-05-8 | cas | Cofactor hydrogen bonding onto the protein main chain is conserved in the short chain dehydrogenase/reductase family and contributes to nicotinamide orientation | Shi R, Lin SX | J Biol Chem 279(16):16778-85 | 2004 | 10.1074/jbc.M313156200 | |||||||||
| 1qyx | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1qyx | |||||||||||||||||||||
| Structuring proteins | 1r09 | 1r09-jen-2.90-d-1-s | 1003 | antiinfective | HRV coat protein | Cellular level | viral coat proteins | VP1-4 (HRV) | common cold | inhibition of viral entry into host cell and/or uncoating occupation of a hydrophobic pocket and consequent stabilisation of viral capsid |
jen | 2.90 | R 61837 | COc1ccc(nn1)N2CCN(CC2)c3cccc(C)c3 | 100241-46-1 | CAS | Human rhinovirus 14 complexed with antiviral compound R 61837 | Chapman MS, Minor I, Rossmann MG, Diana GD, Andries K | J Mol Biol ;217(3):455-63 | 1991 | 10.1016/0022-2836(91)90749-V | |||||||||
| Enzymes | 1r0p | 1r0p-ksa-1.80-d-1 | 1187 | oncolytic | protein-tyrosine kinase (hepatocyte growth factor receptor tyrosine kinase) | EC2.- (transferases) | kinases (tyrosine) | c-Met | cancer | inhibition of enzyme activation via autophosphorylation inhibition of cell proliferation |
ksa | 1.80 | K-252A | COC(=O)[C@@]1(O)C[C@H]2O[C@]1(C)n3c4ccccc4c5c6CNC(=O)c6c7c8ccccc8n2c7c35 | 99533-80-9 | cas | Crystal structure of the tyrosine kinase domain of the hepatocyte growth factor receptor c-Met and its complex with the microbial alkaloid K-252a | Schiering N, Knapp S, Marconi M, Flocco MM, Cui J, Perego R, Rusconi L, Cristiani C | Proc Natl Acad Sci U S A 100(22):12654-9 | 2003 | 10.1073/pnas.1734128100 | |||||||||
| Enzymes | 1r9o | 1r9o-flp-2.00-x-2 | 22264 | metabolism | cytochrome P450 2C9 | EC1.- (oxydo-reductases) | monooxygenases | CYP 2C9 | ADMET | ligand is a substrate of P450 2C9; drug-drug interactions possible | flp | 2.00 | flurbiprofen | CC(C(=O)O)c1ccc(c(F)c1)c2ccccc2 | 5104-49-4 | cas | The structure of human cytochrome P450 2C9 complexed with flurbiprofen at 2.0-A resolution | Wester MR, Yano JK, Schoch GA, Yang C, Griffin KJ, Stout CD, Johnson EF | J Biol Chem 279(34):35630-7 | 2004 | 10.1074/jbc.M405427200 | |||||||||
| 1rd4 | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 1rd4 | |||||||||||||||||||||
| Enzymes | 1rev | 1rev-trb-2.60-d-1-s | 390 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
trb | 2.60 | 9-chloro-TIBO | C[C@H]1C[N@H]2C(=S)Nc3cc(Cl)cc(CN1CC=C(C)C)c23 | 126347-69-1 | CAS | The structure of HIV-1 reverse transcriptase complexed with 9-chloro-TIBO: lessons for inhibitor design | Ren J, Esnouf R, Hopkins A, Ross C, Jones Y, Stammers D, Stuart D | Structure 3(9):915-26 | 1995 | 10.1016/S0969-2126(01)00226-X | |||||||||
| Enzymes | 1rev | 1rev-trb-2.60-d-1 | 2128 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
trb | 2.60 | 9-chloro-TIBO | C[C@H]1C[N@H]2C(=S)Nc3cc(Cl)cc(CN1CC=C(C)C)c23 | 126347-69-1 | CAS | The structure of HIV-1 reverse transcriptase complexed with 9-chloro-TIBO: lessons for inhibitor design | Ren J, Esnouf R, Hopkins A, Ross C, Jones Y, Stammers D, Stuart D | Structure 3(9):915-26 | 1995 | 10.1016/S0969-2126(01)00226-X | |||||||||
| 1rev | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rev | |||||||||||||||||||||
| Enzymes | 1rkp | 1rkp-ibm-2.05-x-1-s | 3.818046234 | cardiovascular | phosphodiesterase 5A | EC3.- (hydrolases) | phosphodiesterases | PDE 5A | cardiovascular diseases | inhibition of cGMP degradation | ibm | 2.05 | 3-isobutyl-1-methylxanthine | CC(C)CN1C2=C(C(=O)N(C1=O)C)N=CN2 | 28822-58-4 | CAS | Crystal structures of phosphodiesterases 4 and 5 in complex with inhibitor 3-isobutyl-1-methylxanthine suggest a conformation determinant of inhibitor selectivity | Huai Q, Liu Y, Francis SH, Corbin JD, Ke H | J Biol Chem 279(13):13095-101 | 2004 | 10.1074/jbc.M311556200 | |||||||||
| 1ro6 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1ro6 | |||||||||||||||||||||
| 1rq9 | Q5RTL1_9HIV1 | Q5RTL1 | KO_id not found | Others | Others | Others | Others | Others | 1rq9 | |||||||||||||||||||||
| Enzymes | 1rt1 | 1rt1-mkc-2.55-d-1-s | 1042 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
mkc | 2.55 | emivirine | CCOCn1c(Cc2ccccc2)c(C(C)C)c(=O)[nH]c1=O | 149950-60-7 | cas | Complexes of HIV-1 reverse transcriptase with inhibitors of the HEPT series reveal conformational changes relevant to the design of potent non-nucleoside inhibitors | Hopkins AL, Ren J, Esnouf RM, Willcox BE, Jones EY, Ross C, Miyasaka T, Walker RT, Tanaka H, Stammers DK, Stuart DI | J Med Chem 39(8):1589-600 | 1996 | 10.1021/jm960056x | |||||||||
| 1rt1 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rt1 | |||||||||||||||||||||
| Enzymes | 1rt4 | 1rt4-uc1-2.90-d-2 | 1934 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
uc1 | 2.90 | UC-781 | CC(=CCOc1cc(NC(=S)c2ccoc2C)ccc1Cl)C | 178870-32-1 | cas | 3'-Azido-3'-deoxythymidine drug resistance mutations in HIV-1 reverse transcriptase can induce long range conformational changes | Ren J, Esnouf RM, Hopkins AL, Jones EY, Kirby I, Keeling J, Ross CK, Larder BA, Stuart DI, Stammers DK | Proc Natl Acad Sci U S A 95(16):9518-23 | 1998 | - | |||||||||
| 1rt5 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rt5 | |||||||||||||||||||||
| 1rt6 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rt6 | |||||||||||||||||||||
| Enzymes | 1rti | 1rti-hef-3.00-d-1-s | 1159 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
hef | 3.00 | HEPT | CC1=C(Sc2ccccc2)N(COCCO)C(=O)NC1=O | 123027-56-5 | CAS | High resolution structures of HIV-1 RT from four RT-inhibitor complexes | Ren J, Esnouf R, Garman E, Somers D, Ross C, Kirby I, Keeling J, Darby G, Jones Y, Stuart D, et al | Nat Struct Biol 2(4):293-302 | 1995 | 10.1038/nsb0495-293 | |||||||||
| 1rw8 | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 1rw8 | |||||||||||||||||||||
| 1ry0 | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 1ry0 | |||||||||||||||||||||
| 1s1t | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1s1t | |||||||||||||||||||||
| Enzymes | 1s2c | 1s2c-flf-1.80-x-2-s | 2059 | endocrine | 17beta-hydroxysteroid dehydrogenase type 5 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 17beta-HSD 5 | contraception (male) cancer |
17beta-HSD 5 is a labile enzyme that catalyzes the transformation of 4-androstene-3, 17-dione into testosterone (like 17beta-HSD 3) and also exerts high 20alpha-dihydroprogesterone activity thereby inactivating progesterone. | flf | 1.80 | flufenamic acid | OC(=O)c1ccccc1Nc2cccc(c2)C(F)(F)F | 530-78-9 | cas | Crystal structure of human prostaglandin F synthase (AKR1C3) | Komoto J, Yamada T, Watanabe K, Takusagawa F | Biochemistry 43(8):2188-98 | 2004 | 10.1021/bi036046x | |||||||||
| 1s2c | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 1s2c | |||||||||||||||||||||
| 1s64 | FNTA_RAT | Q04631 | K05955 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Protein farnesyltransferase | 1s64 | |||||||||||||||||||||
| Enzymes | 1s6q | 1s6q-tpb-3.00-d-1-s | 221 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
tpb | 3.00 | dapivirine | Cc1cc(C)c(Nc2ccnc(Nc3ccc(C#N)cc3)n2)c(C)c1 | 244767-67-7 | cas | Roles of conformational and positional adaptability in structure-based design of TMC125-R165335 (etravirine) and related non-nucleoside reverse transcriptase inhibitors that are highly potent and effective against wild-type and drug-resistant HIV-1 variants | Das K, Clark AD Jr, Lewi PJ, Heeres J, De Jonge MR, Koymans LM, Vinkers HM, Daeyaert F, Ludovici DW, Kukla MJ, De Corte B, Kavash RW, Ho CY, Ye H, Lichtenstein MA, Andries K, Pauwels R, De Bethune MP, Boyer PL, Clark P, Hughes SH, Janssen PA, Arnold E | J Med Chem 47(10):2550-60 | 2004 | 10.1021/jm030558s | |||||||||
| Enzymes | 1s6q | 1s6q-tpb-3.00-d-1 | 1293 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
tpb | 3.00 | dapivirine | Cc1cc(C)c(Nc2ccnc(Nc3ccc(C#N)cc3)n2)c(C)c1 | 244767-67-7 | cas | Roles of conformational and positional adaptability in structure-based design of TMC125-R165335 (etravirine) and related non-nucleoside reverse transcriptase inhibitors that are highly potent and effective against wild-type and drug-resistant HIV-1 variants | Das K, Clark AD Jr, Lewi PJ, Heeres J, De Jonge MR, Koymans LM, Vinkers HM, Daeyaert F, Ludovici DW, Kukla MJ, De Corte B, Kavash RW, Ho CY, Ye H, Lichtenstein MA, Andries K, Pauwels R, De Bethune MP, Boyer PL, Clark P, Hughes SH, Janssen PA, Arnold E | J Med Chem 47(10):2550-60 | 2004 | 10.1021/jm030558s | |||||||||
| 1s9d | ARF1_BOVIN | P84080 | K07937 | GTP-binding proteins | Small (Monomeric) G-proteins | Arf-Sar Family | Arf-Arl1 | ARF1; ADP-ribosylation factor 1 | 1s9d | |||||||||||||||||||||
| Enzymes | 1s9i | 1s9i-5ea-3.20-h-1-s | 0.04922 | oncolytic | mitogen-activated protein kinase kinase 1 | EC2.- (transferases) | kinases (serine-threonine) | MEK1 | anticancer | inhibition (enzyme); non-competitive | 5ea | 3.20 | 548756-68-9 | [C=1C=C(C(=CC1I)F)NC=2C(=CC=C(C2F)F)C3=NN=C(O3)NCCN4CCOCC4] | 548756-68-9 | CAS | Structures of human MAP kinase kinase 1 (MEK1) and MEK2 describe novel noncompetitive kinase inhibition | Ohren JF, Chen H, Pavlovsky A, Whitehead C, Zhang E, Kuffa P, Yan C, McConnell P, Spessard C, Banotai C, Mueller WT, Delaney A, Omer C, Sebolt-Leopold J, Dudley DT, Leung IK, Flamme C, Warmus J, Kaufman M, Barrett S, Tecle H, Hasemann CA | Nat Struct Mol Biol 11(12):1192-7 | 2004 | 10.1038/nsmb859 | |||||||||
| Enzymes | 1s9i | 1s9i-5ea-3.20-h-1 | 1.10515 | oncolytic | mitogen-activated protein kinase kinase 1 | EC2.- (transferases) | kinases (serine-threonine) | MEK1 | anticancer | inhibition (enzyme); non-competitive | 5ea | 3.20 | 548756-68-9 | [C=1C=C(C(=CC1I)F)NC=2C(=CC=C(C2F)F)C3=NN=C(O3)NCCN4CCOCC4] | 548756-68-9 | CAS | Structures of human MAP kinase kinase 1 (MEK1) and MEK2 describe novel noncompetitive kinase inhibition | Ohren JF, Chen H, Pavlovsky A, Whitehead C, Zhang E, Kuffa P, Yan C, McConnell P, Spessard C, Banotai C, Mueller WT, Delaney A, Omer C, Sebolt-Leopold J, Dudley DT, Leung IK, Flamme C, Warmus J, Kaufman M, Barrett S, Tecle H, Hasemann CA | Nat Struct Mol Biol 11(12):1192-7 | 2004 | 10.1038/nsmb859 | |||||||||
| 1sbr | YKOF_BACSU | O34911 | KO_id not found | Others | Others | Others | Others | Others | 1sbr | |||||||||||||||||||||
| 1sd1 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1sd1 | |||||||||||||||||||||
| 1sd2 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1sd2 | |||||||||||||||||||||
| 1sjw | Q9RN59_STRNO | Q9RN59 | KO_id not found | Others | Others | Others | Others | Others | 1sjw | |||||||||||||||||||||
| 1sqn | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 1sqn | |||||||||||||||||||||
| Other proteins | 1srg | 1srg-mhb-1.80-d-1-s | 899 | antiinfective | streptavidin | Bacterial proteins | binding proteins | streptavidin | fundamental research | stabilisation of streptavidin tool for universal test systems in immunology and molecular diagnostics system for analysis of intermolecular interactions of the tight binding of the small molecule ligand biotin to the protein |
mhb | 1.80 | 78733-41-2 | Cc1cc(ccc1O)N=Nc2ccccc2C(O)=O | 78733-41-2 | CAS | Structure-Based Design of Synthetic Azobenzene Ligands for Streptavidin | Weber PC, Pantoliano MW, Simons DM, Salemme FR | J.Am.Chem.Soc v116 pp.2717 | 1994 | 10.1021/ja00086a004 | |||||||||
| 1srg | SAV_STRAV | P22629 | KO_id not found | Other proteins | Bacterial proteins | binding proteins | streptavidin | Others | 1srg | 1895 | ||||||||||||||||||||
| Other proteins | 1sri | 1sri-dmb-1.65-d-1-s | 899 | antiinfective | streptavidin | Bacterial proteins | binding proteins | streptavidin | fundamental research | stabilisation of streptavidin tool for universal test systems in immunology and molecular diagnostics system for analysis of intermolecular interactions of the tight binding of the small molecule ligand biotin to the protein |
dmb | 1.65 | 78733-42-3 | Cc1cc(cc(C)c1O)N=Nc2ccccc2C(O)=O | 78733-42-3 | CAS | Structure-Based Design of Synthetic Azobenzene Ligands for Streptavidin | Weber PC, Pantoliano MW, Simons DM, Salemme FR | J.Am.Chem.Soc v116 pp.2717 | 1994 | 10.1021/ja00086a004 | |||||||||
| 1srj | SAV_STRAV | P22629 | KO_id not found | Others | Others | Others | Others | Others | 1srj | |||||||||||||||||||||
| 1szm | KAPCA_BOVIN | P00517 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 1szm | |||||||||||||||||||||
| 1t2w | Q9S446_STAAU | Q9S446 | KO_id not found | Others | Others | Others | Others | Others | 1t2w | |||||||||||||||||||||
| 1t47 | HPPD_STRAW | Q53586 | K00457 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | 4-hydroxyphenylpyruvate dioxygenase | 1t47 | |||||||||||||||||||||
| 1t4j | PTN1_HUMAN | P18031 | K05696 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-monoester hydrolases | Protein-tyrosine-phosphatase | 1t4j | |||||||||||||||||||||
| 1t64 | HDAC8_HUMAN | Q9BY41 | K11405 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Histone deacetylase | 1t64 | |||||||||||||||||||||
| 1ta6 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1ta6 | |||||||||||||||||||||
| 1tbb | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1tbb | |||||||||||||||||||||
| 1tbf | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 1tbf | |||||||||||||||||||||
| 1tkt | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tkt | |||||||||||||||||||||
| 1tkx | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tkx | |||||||||||||||||||||
| 1tkz | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tkz | |||||||||||||||||||||
| Enzymes | 1tl1 | 1tl1-h18-2.90-d-1-s | 427 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
h18 | 2.90 | GW-451211 | CCCc1c(S(=O)C2CCCCC2)c3cc(Cl)ccc3[nH]c1=O | 345913-10-2 | cas | Design of non-nucleoside inhibitors of HIV-1 reverse transcriptase with improved drug resistance properties. 1 | Hopkins AL, Ren J, Milton J, Hazen RJ, Chan JH, Stuart DI, Stammers DK | J Med Chem 47(24):5912-22 | 2004 | 10.1021/jm040071z | |||||||||
| 1tl1 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tl1 | |||||||||||||||||||||
| 1tou | FABP4_HUMAN | P15090 | KO_id not found | Others | Others | Others | Others | Others | 1tou | |||||||||||||||||||||
| 1tz8 | TTHY_HUMAN | P02766 | KO_id not found | Others | Others | Others | Others | Others | 1tz8 | |||||||||||||||||||||
| 1u3r | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1u3r | |||||||||||||||||||||
| 1u3s | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1u3s | |||||||||||||||||||||
| Enzymes | 1u59 | 1u59-sto-2.30-h-1 | 674 | no info | aky-related tyrosine kinase Protein tyrosine kinase zap 70 zap 70 zeta-associated protein 70-kd |
EC2.- (transferases) | kinases (tyrosine) | zap 70 | cancer | no info | sto | 2.30 | Staurosporine | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)[N@H]3c4ccccc4-c5c6CNC(=O)c6c7-c8ccccc8[N@H]2c7c35 | 62996-74-1 | CAS | The three-dimensional structure of the ZAP-70 kinase domain in complex with staurosporine: implications for the design of selective inhibitors | Jin L, Pluskey S, Petrella EC, Cantin SM, Gorga JC, Rynkiewicz MJ, Pandey P, Strickler JE, Babine RE, Weaver DT, Seidl KJ | J Biol Chem 279(41):42818-25 | 2004 | 10.1074/jbc.M407096200 | |||||||||
| 1u59 | ZAP70_HUMAN | P43403 | K07360 | Cellular antigens | Non-CD molecules | ZAP70; zeta-chain (TCR) associated protein kinase 70kDa | Others | Others | 1u59 | |||||||||||||||||||||
| 1u9z | KPRS_METJA | Q58761 | K00948 | Enzymes | Transferases | Transferring phosphorus-containing groups | Diphosphotransferases | Ribose-phosphate diphosphokinase | 1u9z | |||||||||||||||||||||
| 1uho | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 1uho | |||||||||||||||||||||
| 1unh | CDK5_HUMAN | Q00535 | K02090 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1unh | |||||||||||||||||||||
| 1uoo | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1uoo | |||||||||||||||||||||
| 1uop | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1uop | |||||||||||||||||||||
| 1uoq | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 1uoq | |||||||||||||||||||||
| Enzymes | 1urw | 1urw-i1p-1.60-h-1 | 10.45488 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | i1p | 1.60 | 453547-81-4 | [CN(C)CCCNS(=O)(=O)C1=CC=C(C=C1)NC=2N=CC=C(N2)C3=CN=C4N3N=CC=C4] | 453547-81-4 | CAS | Imidazo[1,2-b]pyridazines: a potent and selective class of cyclin-dependent kinase inhibitors | Byth, K.F., Cooper, N., Culshaw, J.D., Heaton, D.W., Oakes, S.E., Minshull, C.A., Norman, R.A., Pauptit, R.A., Tucker, J.A., Breed, J., Pannifer, A., Rowsell, S., Stanway, J.J., Valentine, A.L., Thomas, A.P. | Bioorg Med Chem Lett 14:2249-2252 | 2004 | 10.1016/j.bmcl.2004.02.008 | |||||||||
| 1uu3 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1uu3 | |||||||||||||||||||||
| 1uv5 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 1uv5 | |||||||||||||||||||||
| 1v1k | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1v1k | |||||||||||||||||||||
| 1v79 | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1v79 | |||||||||||||||||||||
| 1v7a | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1v7a | |||||||||||||||||||||
| 1vjy | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 1vjy | |||||||||||||||||||||
| 1vru | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1vru | |||||||||||||||||||||
| Enzymes | 1vyw | 1vyw-292-2.30-d-1 | 1608 | oncolytic | cyclin-dependent kinase 2 CDK2 |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer | inhibition of cell cycle controlling enzyme CDK2 apoptosis in tumour cells |
292 | 2.30 | PNU-292137 | O=C(Cc1ccc2ccccc2c1)Nc3cc([nH]n3)C4CC4 | 326823-27-2 | cas | 3-Aminopyrazole inhibitors of CDK2/cyclin A as antitumor agents. 1. Lead finding | Pevarello P, Brasca MG, Amici R, Orsini P, Traquandi G, Corti L, Piutti C, Sansonna P, Villa M, Pierce BS, Pulici M, Giordano P, Martina K, Fritzen EL, Nugent RA, Casale E, Cameron A, Ciomei M, Roletto F, Isacchi A, Fogliatto G, Pesenti E, Pastori W, Marsiglio A, Leach KL, Clare PM, Fiorentini F, Varasi M, Vulpetti A, Warpehoski MA | J Med Chem 47(13):3367-80 | 2004 | 10.1021/jm031145u | |||||||||
| Enzymes | 1w0g | 1w0g-myt-2.74-x-1 | 13889 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | myt | 2.74 | metyrapone | CC(C)(C(=O)c1cccnc1)c2cccnc2 | 54-36-4 | cas | Crystal structures of human cytochrome P450 3A4 bound to metyrapone and progesterone | Williams PA, Cosme J, Vinkovic DM, Ward A, Angove HC, Day PJ, Vonrhein C, Tickle IJ, Jhoti H | Science 305(5684):683-6 | 2004 | 10.1126/science.1099736 | |||||||||
| 1w0x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1w0x | |||||||||||||||||||||
| Enzymes | 1w1y | 1w1y-typ-1.90-d-1-s | 125 | antiinfective | Serratia marcescens chitinase | EC3.- (hydrolases) | glycosidases | chitinase (S.marcescens) | bacterial infection | inhibition of bacterial chitinase | typ | 1.90 | maculosin | Oc1ccc(C[C@@H]2NC(=O)[C@@H]3CCCN3C2=O)cc1 | 4549-02-4 | CAS | Structure-based exploration of cyclic dipeptide chitinase inhibitors | Houston DR, Synstad B, Eijsink VG, Stark MJ, Eggleston IM, van Aalten DM | J Med Chem 47(23):5713-20 | 2004 | 10.1021/jm049940a | |||||||||
| Enzymes | 1w1y | 1w1y-typ-1.90-d-1 | 1365 | antiinfective | Serratia marcescens chitinase | EC3.- (hydrolases) | glycosidases | chitinase (S.marcescens) | bacterial infection | inhibition of bacterial chitinase | typ | 1.90 | maculosin | Oc1ccc(C[C@@H]2NC(=O)[C@@H]3CCCN3C2=O)cc1 | 4549-02-4 | CAS | Structure-based exploration of cyclic dipeptide chitinase inhibitors | Houston DR, Synstad B, Eijsink VG, Stark MJ, Eggleston IM, van Aalten DM | J Med Chem 47(23):5713-20 | 2004 | 10.1021/jm049940a | |||||||||
| 1w2h | KTHY_MYCTU | O05891 | K00943 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with a phosphate group as acceptor | DTMP kinase | 1w2h | |||||||||||||||||||||
| 1wbv | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wbv | |||||||||||||||||||||
| 1wbw | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wbw | |||||||||||||||||||||
| 1wok | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 1wok | |||||||||||||||||||||
| 1wxy | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1wxy | |||||||||||||||||||||
| 1wxz | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1wxz | |||||||||||||||||||||
| 1wzy | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wzy | |||||||||||||||||||||
| 1x76 | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1x76 | |||||||||||||||||||||
| 1x78 | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1x78 | |||||||||||||||||||||
| Receptors | 1x7b | 1x7b-041-2.30-r-1-s | 1.19165 | endocrine, metabolic, oncolytic | estrogen receptor beta | Transduction factor receptors | nuclear hormone receptors | ER-beta | cancer cardiovascular diseases cognitive defects vascular injury response |
antagonism (receptor); full | 041 | 2.30 | ERB 041 | [C=CC=1C=C(C=C2C1OC(=N2)C=3C=CC(=C(C3)F)O)O] | 524684-52-4 | CAS | Structure-based design of estrogen receptor-beta selective ligands | Manas ES, Unwalla RJ, Xu ZB, Malamas MS, Miller CP, Harris HA, Hsiao C, Akopian T, Hum WT, Malakian K, Wolfrom S, Bapat A, Bhat RA, Stahl ML, Somers WS, Alvarez JC | J Am Chem Soc 126(46):15106-19 | 2004 | 10.1021/ja047633o | |||||||||
| 1x7b | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1x7b | |||||||||||||||||||||
| 1x7e | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 1x7e | |||||||||||||||||||||
| 1xan | GSHR_HUMAN | P00390 | K00383 | Enzymes | Oxidoreductases | Acting on a sulfur group of donors | With NAD+ or NADP+ as acceptor | Glutathione-disulfide reductase | 1xan | |||||||||||||||||||||
| Enzymes | 1xbb | 1xbb-sti-1.57-h-1 | 6.4012 | no info | syk spleen tyrosine kinase protein-tyrosine kinase syk |
EC2.- (transferases) | kinases (tyrosine) | Syk | cancer | no info | sti | 1.57 | Imatinib | CN1CCN(Cc2ccc(cc2)C(=O)Nc3ccc(C)c(Nc4nccc(n4)c5cccnc5)c3)CC1 | 152459-95-5 | CAS | A novel mode of Gleevec binding is revealed by the structure of spleen tyrosine kinase | Atwell S, Adams JM, Badger J, Buchanan MD, Feil IK, Froning KJ, Gao X, Hendle J, Keegan K, Leon BC, Muller-Dieckmann HJ, Nienaber VL, Noland BW, Post K, Rajashankar KR, Ramos A, Russell M, Burley SK, Buchanan SG | J Biol Chem 279(53):55827-32 | 2004 | 10.1074/jbc.M409792200 | |||||||||
| Enzymes | 1xbc | 1xbc-sto-2.00-h-1 | 196 | no info | syk spleen tyrosine kinase protein-tyrosine kinase syk |
EC2.- (transferases) | kinases (tyrosine) | Syk | cancer | no info | sto | 2.00 | Staurosporine | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)[N@H]3c4ccccc4-c5c6CNC(=O)c6c7-c8ccccc8[N@H]2c7c35 | 62996-74-1 | CAS | A novel mode of Gleevec binding is revealed by the structure of spleen tyrosine kinase | Atwell S, Adams JM, Badger J, Buchanan MD, Feil IK, Froning KJ, Gao X, Hendle J, Keegan K, Leon BC, Muller-Dieckmann HJ, Nienaber VL, Noland BW, Post K, Rajashankar KR, Ramos A, Russell M, Burley SK, Buchanan SG | J Biol Chem 279(53):55827-32 | 2004 | 10.1074/jbc.M409792200 | |||||||||
| Enzymes | 1xbc | 1xbc-stu-2.00-h-1 | 0.1685 | no info | syk spleen tyrosine kinase protein-tyrosine kinase syk |
EC2.- (transferases) | kinases (tyrosine) | Syk | cancer | no info | sto | 2.00 | Staurosporine | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)[N@H]3c4ccccc4-c5c6CNC(=O)c6c7-c8ccccc8[N@H]2c7c35 | 62996-74-1 | CAS | A novel mode of Gleevec binding is revealed by the structure of spleen tyrosine kinase | Atwell S, Adams JM, Badger J, Buchanan MD, Feil IK, Froning KJ, Gao X, Hendle J, Keegan K, Leon BC, Muller-Dieckmann HJ, Nienaber VL, Noland BW, Post K, Rajashankar KR, Ramos A, Russell M, Burley SK, Buchanan SG | J Biol Chem 279(53):55827-32 | 2004 | 10.1074/jbc.M409792200 | |||||||||
| 1xbc | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1xbc | |||||||||||||||||||||
| 1xlx | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xlx | |||||||||||||||||||||
| 1xlz | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xlz | |||||||||||||||||||||
| 1xm4 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xm4 | |||||||||||||||||||||
| 1xm6 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xm6 | |||||||||||||||||||||
| 1xmu | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xmu | |||||||||||||||||||||
| 1xnn | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1xnn | |||||||||||||||||||||
| 1xom | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xom | |||||||||||||||||||||
| 1xoq | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xoq | |||||||||||||||||||||
| 1xor | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xor | |||||||||||||||||||||
| 1xow | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1xow | |||||||||||||||||||||
| Enzymes | 1xoz | 1xoz-cia-1.37-x-1 | 4.298284862 | cardiovascular | phosphodiesterase 5A | EC3.- (hydrolases) | phosphodiesterases | PDE 5A | cardiovascular diseases | inhibition of cGMP degradation | cia | 1.37 | tadalafil | CN1CC(=O)N2[C@@H](C1=O)CC=3C4=CC=CC=C4NC3[C@H]2C5=CC=C6C(=C5)OCO6 | 171596-29-5 | CAS | Structural basis for the activity of drugs that inhibit phosphodiesterases | Card GL, England BP, Suzuki Y, Fong D, Powell B, Lee B, Luu C, Tabrizizad M, Gillette S, Ibrahim PN, Artis DR, Bollag G, Milburn MV, Kim SH, Schlessinger J, Zhang KY | Structure 12(12):2233-47 | 2004 | 10.1016/j.str.2004.10.004 | |||||||||
| 1xp0 | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 1xp0 | |||||||||||||||||||||
| 1xuo | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 1xuo | |||||||||||||||||||||
| 1y2e | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1y2e | |||||||||||||||||||||
| 1y2g | ZIPA_ECOLI | P77173 | KO_id not found | Others | Others | Others | Others | Others | 1y2g | |||||||||||||||||||||
| 1y2h | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1y2h | |||||||||||||||||||||
| 1y2k | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1y2k | |||||||||||||||||||||
| 1y6a | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 1y6a | |||||||||||||||||||||
| 1y8j | NEP_HUMAN | P08473 | K01389 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neprilysin | 1y8j | |||||||||||||||||||||
| 1ygj | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1ygj | |||||||||||||||||||||
| 1ygk | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1ygk | |||||||||||||||||||||
| 1yhj | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1yhj | |||||||||||||||||||||
| Enzymes | 1yhs | 1yhs-sto-2.15-h-1 | 1640 | no info | pim1 proto oncogene kinase |
EC2.- (transferases) | kinases (serine-threonine) | Pim-1 | cancer | no info | sto | 2.15 | Staurosporine | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)[N@@H]3c4ccccc4-c5c6CNC(=O)c6c7-c8ccccc8[N@@H]2c7c35 | 62996-74-1 | CAS | Pim-1 ligand-bound structures reveal the mechanism of serine/threonine kinase inhibition by LY294002 | Jacobs MD, Black J, Futer O, Swenson L, Hare B, Fleming M, Saxena K | J Biol Chem 280(14):13728-34 | 2005 | 10.1074/jbc.M413155200 | |||||||||
| 1yrs | KIF11_HUMAN | P52732 | K10398 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulin-binding proteins | KIF11; kinesin family member 11 | 1yrs | |||||||||||||||||||||
| 1ysz | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 1ysz | |||||||||||||||||||||
| 1yw2 | MK14_MOUSE | P47811 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1yw2 | |||||||||||||||||||||
| 1yw7 | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 1yw7 | |||||||||||||||||||||
| 1yw8 | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 1yw8 | |||||||||||||||||||||
| 1yw9 | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 1yw9 | |||||||||||||||||||||
| 1yye | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1yye | |||||||||||||||||||||
| Enzymes | 1z4r | 1z4r-aco-1.74-t-2 | 2445 | oncolytic | general control of amino acid synthesis protein 5-like 2 (histone acetyltransferase GCN5L2) | EC2.- (transferases) | acyltransferases | GCN5 | cancer | GCN5L2 inhibition influences transcription and is suggested to moderate other DNA-based mechanisms as well (e.g. cell-cycle progression, DNA recombination, DNA repair, and apoptosis). | aco | 1.74 | acetyl coenzyme A | CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)CO[P@@](=O)(O)O[P@@](=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)O | 72-89-9 | cas | Crystal Structure of Human Acetyltransferase GCN5 | Bernstein G, Dong A, Schuetz A, Antoshenko T, Wu H, Loppnau P, Bochkarev A, Plotnikov A | to be published | 2006 | ||||||||||
| 1z5o | MTNN_ECO57 | P0AF14 | K01243 | Enzymes | Hydrolases | Glycosylases | Hydrolysing N-glycosyl compounds | Adenosylhomocysteine nucleosidase | 1z5o | |||||||||||||||||||||
| 1z95 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1z95 | |||||||||||||||||||||
| 1zaf | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1zaf | |||||||||||||||||||||
| 1zdp | THER_BACTH | P00800 | KO_id not found | Others | Others | Others | Others | Others | 1zdp | |||||||||||||||||||||
| 1zgi | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1zgi | |||||||||||||||||||||
| 1zht | KES1_YEAST | P35844 | KO_id not found | Others | Others | Others | Others | Others | 1zht | |||||||||||||||||||||
| 1zhx | KES1_YEAST | P35844 | KO_id not found | Others | Others | Others | Others | Others | 1zhx | |||||||||||||||||||||
| 1zhz | KES1_YEAST | P35844 | KO_id not found | Others | Others | Others | Others | Others | 1zhz | |||||||||||||||||||||
| 1zkk | SETD8_HUMAN | Q9NQR1 | K11428 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 1zkk | |||||||||||||||||||||
| 1zky | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 1zky | |||||||||||||||||||||
| 1zp5 | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1zp5 | |||||||||||||||||||||
| 1zrb | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1zrb | |||||||||||||||||||||
| 1zs0 | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1zs0 | |||||||||||||||||||||
| 1zyj | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1zyj | |||||||||||||||||||||
| 1zzl | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1zzl | |||||||||||||||||||||
| 2a0c | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2a0c | |||||||||||||||||||||
| 2aa6 | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 2aa6 | |||||||||||||||||||||
| 2ab2 | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 2ab2 | |||||||||||||||||||||
| 2aia | DEF_STRR6 | Q8DP79 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 2aia | |||||||||||||||||||||
| 2aio | BLA1_STEMA | P52700 | K06479 (inferred by homologyHUMAN) | CAM ligands | 1. Immunoglobulin Superfamily | Immune system | CD2 family | Metallo-beta-lactamase L1 | 2aio | 40324 | ||||||||||||||||||||
| 2ax6 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax6 | |||||||||||||||||||||
| 2ax8 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax8 | |||||||||||||||||||||
| 2ax9 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax9 | |||||||||||||||||||||
| 2ayp | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2ayp | |||||||||||||||||||||
| Enzymes | 2b36 | 2b36-5pp-2.80-d-1 | 0.64578673 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (M.tuberculosis) | tuberculosis bacterial infection |
inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
5pp | 2.80 | 877206-68-3 | CCCCCc2ccc(Oc1ccccc1)c(O)c2 | 877206-68-3 | cas | High Affinity InhA Inhibitors with Activity against Drug-Resistant Strains of Mycobacterium tuberculosis | Sullivan TJ, Truglio JJ, Boyne ME, Novichenok P, Zhang X, Stratton C, Li HJ, Kaur T, Amin A, Johnson F, Slayden RA, Kisker C, Tonge PJ | ACS Chem Biol, 1, 43-53 | 2006 | 10.1021/cb0500042 | |||||||||
| 2b37 | INHA_MYCTU | P0A5Y6 | K05500 | Lipid biosynthesis proteins | TGF-beta family | Distant members | INHA; inhibin, alpha | Others | 2b37 | |||||||||||||||||||||
| 2b54 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2b54 | |||||||||||||||||||||
| 2bfy | AUKBA_XENLA | Q6DE08 | K11479 | Chromosome | Eukaryotic Type | Centromeric chromatin formation proteins | Kinetochore proteins | Serine-threonine-protein kinase 12-A | 2bfy | 8355 | ||||||||||||||||||||
| 2bhe | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2bhe | |||||||||||||||||||||
| 2bik | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bik | |||||||||||||||||||||
| 2bmc | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bmc | |||||||||||||||||||||
| 2boh | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2boh | |||||||||||||||||||||
| 2br1 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2br1 | |||||||||||||||||||||
| 2brb | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brb | |||||||||||||||||||||
| 2brm | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brm | |||||||||||||||||||||
| 2brn | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brn | |||||||||||||||||||||
| 2bro | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bro | |||||||||||||||||||||
| 2bsx | Q8T9Z7_PLAFA | Q8T9Z7 | KO_id not found | Others | Others | Others | Others | Others | 2bsx | |||||||||||||||||||||
| 2btr | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2btr | |||||||||||||||||||||
| 2bu7 | PDK2_HUMAN | Q15119 | K00898 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2bu7 | |||||||||||||||||||||
| 2buj | STK16_HUMAN | O75716 | K08856 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2buj | |||||||||||||||||||||
| 2bxf | ALBU_HUMAN | P02768 | KO_id not found | Others | Others | Others | Others | Others | 2bxf | |||||||||||||||||||||
| 2c5n | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c5n | |||||||||||||||||||||
| 2c5x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c5x | |||||||||||||||||||||
| 2chw | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2chw | |||||||||||||||||||||
| 2chz | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2chz | |||||||||||||||||||||
| 2dq7 | FYN_HUMAN | P06241 | K05703 | CAM ligands | 1. Immunoglobulin Superfamily | Immune system | CD2 family | Tyrosine-protein kinase Fyn | 2dq7 | 9606 | ||||||||||||||||||||
| 2ds1 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2ds1 | |||||||||||||||||||||
| 2e1w | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 2e1w | |||||||||||||||||||||
| 2e9u | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2e9u | |||||||||||||||||||||
| 2e9v | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2e9v | |||||||||||||||||||||
| 2ea2 | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 2ea2 | |||||||||||||||||||||
| 2egv | RSME_AQUAE | O66552 | K09761 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | 16S rRNA (uracil1498-N3)-methyltransferase | 2egv | |||||||||||||||||||||
| 2ei6 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2ei6 | |||||||||||||||||||||
| 2ei8 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2ei8 | |||||||||||||||||||||
| 2euf | CGH2_SHV21 | Q01043 | KO_id not found | Others | Others | Others | Others | Others | 2euf | |||||||||||||||||||||
| Enzymes | 2ew5 | 2ew5-y12-2.20-d-1 | 3.0797912 | antiinfective | bacterial peptide deformylase | EC3.- (hydrolases) | amidases | PDF (H.pylori) | bacterial infection | interference with bacterial protein maturation | y12 | 2.20 | 913283-06-4 | CC(=O)OC1=CC=C(C=C1OC(=O)C)C=CC(=O)NCCC=2C=CC=CC2 | 913283-06-4 | cas | Peptide deformylase is a potential target for anti-Helicobacter pylori drugs: reverse docking, enzymatic assay, and X-ray crystallography validation | Cai J, Han C, Hu T, Zhang J, Wu D, Wang F, Liu Y, Ding J, Chen K, Yue J, Shen X, Jiang H | Protein Sci 15(9):2071-81 | 2006 | 10.1110/ps.062238406 | |||||||||
| Enzymes | 2ew6 | 2ew6-y13-2.20-d-2-s | 0.10589113 | antiinfective | bacterial peptide deformylase | EC3.- (hydrolases) | amidases | PDF (H.pylori) | bacterial infection | interference with bacterial protein maturation | y13 | 2.20 | N-trans-caffeoyltyramine | C=1C=C(C=CC1CCNC(=O)C=CC=2C=CC(=C(C2)O)O)O | 103188-48-3 | cas | Peptide deformylase is a potential target for anti-Helicobacter pylori drugs: reverse docking, enzymatic assay, and X-ray crystallography validation | Cai J, Han C, Hu T, Zhang J, Wu D, Wang F, Liu Y, Ding J, Chen K, Yue J, Shen X, Jiang H | Protein Sci 15(9):2071-81 | 2006 | 10.1110/ps.062238406 | |||||||||
| Enzymes | 2ew6 | 2ew6-y13-2.20-d-2 | 0.33407905 | antiinfective | bacterial peptide deformylase | EC3.- (hydrolases) | amidases | PDF (H.pylori) | bacterial infection | interference with bacterial protein maturation | y13 | 2.20 | N-trans-caffeoyltyramine | C=1C=C(C=CC1CCNC(=O)C=CC=2C=CC(=C(C2)O)O)O | 103188-48-3 | cas | Peptide deformylase is a potential target for anti-Helicobacter pylori drugs: reverse docking, enzymatic assay, and X-ray crystallography validation | Cai J, Han C, Hu T, Zhang J, Wu D, Wang F, Liu Y, Ding J, Chen K, Yue J, Shen X, Jiang H | Protein Sci 15(9):2071-81 | 2006 | 10.1110/ps.062238406 | |||||||||
| 2f1o | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 2f1o | |||||||||||||||||||||
| 2f8p | OBL_OBELO | Q27709 | KO_id not found | Others | Others | Others | Others | Others | 2f8p | |||||||||||||||||||||
| 2g97 | NAMPT_RAT | Q80Z29 | K03462 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Nicotinamide phosphoribosyltransferase | 2g97 | |||||||||||||||||||||
| 2gpp | ERR3_HUMAN | P62508 | K01689 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Phosphopyruvate hydratase | 2gpp | |||||||||||||||||||||
| Receptors | 2gtk | 2gtk-208-2.10-p-1-s | 2.71140939597315 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | obesity | activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
208 | 2.10 | 671215-78-4 | CCO[C@@H](CC1=CC=C2C(=C1)C=CN2CC3=C(OC(=N3)C4=CC=CC=C4Cl)C)C(=O)O | 671215-78-4 | CAS | Structure-based design of indole propionic acids as novel PPARalpha/gamma co-agonists | Kuhn B, Hilpert H, Benz J, Binggeli A, Grether U, Humm R, Marki HP, Meyer M, Mohr P | Bioorg Med Chem Lett 16(15):4016-20 | 2006 | 10.1016/j.bmcl.2006.05.007 | |||||||||
| 2h44 | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 2h44 | |||||||||||||||||||||
| Enzymes | 2h7i | 2h7i-566-1.62-d-1-s | 1.40939597 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (M.tuberculosis) | tuberculosis bacterial infection |
inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
566 | 1.62 | INT-333351-95-4-art-1-d | O=C2C[C@H](C(=O)Nc1ccccc1)CN2C3CCCCC3 | INT-333351-95-4-art-1-d | int | Pyrrolidine carboxamides as a novel class of inhibitors of enoyl acyl carrier protein reductase from Mycobacterium tuberculosis | He X, Alian A, Stroud R, Ortiz de Montellano PR | J Med Chem 49(21):6308-23 | 2006 | 10.1021/jm060715y | |||||||||
| Enzymes | 2h7l | 2h7l-665-1.73-d-1-s | 0.4295302 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (M.tuberculosis) | tuberculosis bacterial infection |
inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
665 | 1.73 | INT-356795-86-3-art-1-d | O=C2C[C@H](C(=O)Nc1cccc(Br)c1)CN2C3CCCCC3 | INT-356795-86-3-art-1-d | int | Pyrrolidine carboxamides as a novel class of inhibitors of enoyl acyl carrier protein reductase from Mycobacterium tuberculosis | He X, Alian A, Stroud R, Ortiz de Montellano PR | J Med Chem 49(21):6308-23 | 2006 | 10.1021/jm060715y | |||||||||
| 2h8m | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 2h8m | |||||||||||||||||||||
| Enzymes | 2hai | 2hai-pfi-1.58-d-1-s | 0.12975391 | antiinfective | RNA-dependent RNA polymerase (NS5B) from hepatitic C virus | EC2.- (transferases) | RNA polymerases | NS5B (HCV) | hepatitis C virus infection | inhibition of viral replication inhibition of transcription of viral genomic RNA and consequently of viral genome replication |
pfi | 1.58 | INT-625446-41-5-art-1-d | CC(C)Oc3ccc(CC[C@@]2(C1CCCC1)CC(O)=CC(=O)O2)cc3F | INT-625446-41-5-art-1-d | int | Identification and structure-based optimization of novel dihydropyrones as potent HCV RNA polymerase inhibitors | Li H, Tatlock J, Linton A, Gonzalez J, Borchardt A, Dragovich P, Jewell T, Prins T, Zhou R, Blazel J, Parge H, Love R, Hickey M, Doan C, Shi S, Duggal R, Lewis C, Fuhrman S | Bioorg Med Chem Lett. 2006 Sep 15;16(18):4834-8 | 2006 | 10.1016/j.bmcl.2006.06.065 | |||||||||
| Enzymes | 2hai | 2hai-pfi-1.58-d-1 | 0.5891126 | antiinfective | RNA-dependent RNA polymerase (NS5B) from hepatitic C virus | EC2.- (transferases) | RNA polymerases | NS5B (HCV) | hepatitis C virus infection | inhibition of viral replication inhibition of transcription of viral genomic RNA and consequently of viral genome replication |
pfi | 1.58 | INT-625446-41-5-art-1-d | CC(C)Oc3ccc(CC[C@@]2(C1CCCC1)CC(O)=CC(=O)O2)cc3F | INT-625446-41-5-art-1-d | int | Identification and structure-based optimization of novel dihydropyrones as potent HCV RNA polymerase inhibitors | Li H, Tatlock J, Linton A, Gonzalez J, Borchardt A, Dragovich P, Jewell T, Prins T, Zhou R, Blazel J, Parge H, Love R, Hickey M, Doan C, Shi S, Duggal R, Lewis C, Fuhrman S | Bioorg Med Chem Lett. 2006 Sep 15;16(18):4834-8 | 2006 | 10.1016/j.bmcl.2006.06.065 | |||||||||
| 2hb3 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2hb3 | |||||||||||||||||||||
| Receptors | 2hfp | 2hfp-nsi-2.00-p-1-s | 1.61222967934377 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | obesity | activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
nsi | 2.00 | 412005-98-2 | COC=1C=CC(=CC1)C=2C3=CC=CC=C3N(C2C(=O)NS(=O)(=O)C=4C=CC=CC4)CC=5C=CC=C(C5)C(F)(F)F | 412005-98-2 | CAS | Design and synthesis of novel N-sulfonyl-2-indole carboxamides as potent PPAR-gamma binding agents with potential application to the treatment of osteoporosis | Hopkins CR, O'neil SV, Laufersweiler MC, Wang Y, Pokross M, Mekel M, Evdokimov A, Walter R, Kontoyianni M, Petrey ME, Sabatakos G, Roesgen JT, Richardson E, Demuth TP Jr | Bioorg Med Chem Lett 16(21):5659-63 | 2006 | 10.1016/j.bmcl.2006.08.003 | |||||||||
| Enzymes | 2hh5 | 2hh5-gnq-1.80-p-1-s | 1.23042505592841 | metabolic | cathepsin S Ctss |
EC3.- (hydrolases) | proteases (cysteine) | CatS | obesity | takes part in the development of atherosclerosis and is necessary for preadipocyte differentiation | gnq | 1.80 | INT-2hh5-gnq-art-1-p | C[C@@H](CNC=1C=CC=CC1)NC(=O)[C@H](CS(=O)(=O)CC=2C=CC=CC2)NC(=O)N3CCOCC3 | INT-2hh5-gnq-art-1-p | INT | Synthesis and SAR of arylaminoethyl amides as noncovalent inhibitors of cathepsin S: P3 cyclic ethers | Tully DC, Liu H, Chatterjee AK, Alper PB, Epple R, Williams JA, Roberts MJ, Woodmansee DH, Masick BT, Tumanut C, Li J, Spraggon G, Hornsby M, Chang J, Tuntland T, Hollenbeck T, Gordon P, Harris JL, Karanewsky DS | Bioorg Med Chem Lett 16(19):5112-7 | 2006 | 10.1016/j.bmcl.2006.07.033 | |||||||||
| 2hkj | TOP6B_SULSH | O05207 | KO_id not found | Others | Others | Others | Others | Others | 2hkj | |||||||||||||||||||||
| 2hpy | OPSD_BOVIN | P02699 | K04250 | G protein-coupled receptors | Class A. Rhodopsin family | Vision | Opsin | RHO, OPN2; rhodopsin | 2hpy | |||||||||||||||||||||
| 2hvc | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2hvc | |||||||||||||||||||||
| 2hxl | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2hxl | |||||||||||||||||||||
| 2hxq | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2hxq | |||||||||||||||||||||
| 2hxz | CATS_HUMAN | P25774 | K01368 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Cysteine endopeptidases | Cathepsin S | 2hxz | |||||||||||||||||||||
| 2hy0 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2hy0 | |||||||||||||||||||||
| 2i0g | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2i0g | |||||||||||||||||||||
| 2i0j | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2i0j | |||||||||||||||||||||
| 2i0v | CSF1R_HUMAN | P07333 | K05090 | Cellular antigens | CD (clusters of differentiation) molecules | CD115; colony stimulating factor 1 receptor (macrophage) | Others | Others | 2i0v | |||||||||||||||||||||
| 2i1m | CSF1R_HUMAN | P07333 | K05090 | Cellular antigens | CD (clusters of differentiation) molecules | CD115; colony stimulating factor 1 receptor (macrophage) | Others | Others | 2i1m | |||||||||||||||||||||
| Enzymes | 2i80 | 2i80-g1l-2.19-d-1 | 0.43698732 | antiinfective | staphylococcus aureus D-alanine-D-alanine ligase | EC6.- (ligases) | alanine-alanine ligases | DDl (S.aureus) | bacterial infection | inhibition of bacterial D-alanine-D-alanine ligase interference with bacterial cell wall biosynthesis |
g1l | 2.19 | 339015-90-6 | CC(C)(CCl)C(=O)Nc1ccc(C(F)(F)F)cc1 | 339015-90-6 | cas | Allosteric inhibition of Staphylococcus aureus D-alanine:D-alanine ligase revealed by crystallographic studies | Liu S, Chang JS, Herberg JT, Horng MM, Tomich PK, Lin AH, Marotti KR | Proc Natl Acad Sci U S A 103(41):15178-83 | 2006 | 10.1073/pnas.0604905103 | |||||||||
| 2i80 | DDL_STAAC | Q5HEB7 | K01921 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | D-alanine---D-alanine ligase | 2i80 | |||||||||||||||||||||
| 2ic3 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2ic3 | |||||||||||||||||||||
| 2ihq | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ihq | |||||||||||||||||||||
| 2ikg | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2ikg | |||||||||||||||||||||
| 2ikh | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2ikh | |||||||||||||||||||||
| 2ilt | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 2ilt | |||||||||||||||||||||
| 2ipf | AK1CL_MOUSE | Q91WR5 | KO_id not found | Others | Others | Others | Others | Others | 2ipf | |||||||||||||||||||||
| Enzymes | 2irw | 2irw-nn4-3.10-x-1-s | 0.721849366144 | endocrine, metabolic | 11beta-hydroxysteroid dehydrogenase type 1 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 11beta-HSD 1 | non-insulin dependent diabetes mellitus obesity neurodegenerative diseases cognitive defects (age- and dementia-associated) metabolic disorders |
inhibition of the conversion of inactive cortison into acitve cortisol | nn4 | 3.10 | 898264-92-1 | CC(C)(C(=O)NC1[C@H]2CC3C[C@@H]1CC(C3)(C2)C(=O)N)OC=4C=CC(=CC4)OC | 898264-92-1 | cas | Discovery of adamantane ethers as inhibitors of 11beta-HSD-1: Synthesis and biological evaluation | Patel JR, Shuai Q, Dinges J, Winn M, Pliushchev M, Fung S, Monzon K, Chiou W, Wang J, Pan L, Wagaw S, Engstrom K, Kerdesky FA, Longenecker K, Judge R, Qin W, Imade HM, Stolarik D, Beno DW, Brune M, Chovan LE, Sham HL, Jacobson P, Link JT | Bioorg Med Chem Lett 17(3):750-5 | 2007 | 10.1016/j.bmcl.2006.10.074 | |||||||||
| Enzymes | 2irw | 2irw-nn4-3.10-x-1 | 2.751677852 | endocrine, metabolic | 11beta-hydroxysteroid dehydrogenase type 1 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 11beta-HSD 1 | non-insulin dependent diabetes mellitus obesity neurodegenerative diseases cognitive defects (age- and dementia-associated) metabolic disorders |
inhibition of the conversion of inactive cortison into acitve cortisol | nn4 | 3.10 | 898264-92-1 | CC(C)(C(=O)NC1[C@H]2CC3C[C@@H]1CC(C3)(C2)C(=O)N)OC=4C=CC(=CC4)OC | 898264-92-1 | cas | Discovery of adamantane ethers as inhibitors of 11beta-HSD-1: Synthesis and biological evaluation | Patel JR, Shuai Q, Dinges J, Winn M, Pliushchev M, Fung S, Monzon K, Chiou W, Wang J, Pan L, Wagaw S, Engstrom K, Kerdesky FA, Longenecker K, Judge R, Qin W, Imade HM, Stolarik D, Beno DW, Brune M, Chovan LE, Sham HL, Jacobson P, Link JT | Bioorg Med Chem Lett 17(3):750-5 | 2007 | 10.1016/j.bmcl.2006.10.074 | |||||||||
| Enzymes | 2irw | 2irw-nn4-3.10-x-2-s | 3.33386201427 | endocrine, metabolic | 11beta-hydroxysteroid dehydrogenase type 1 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 11beta-HSD 1 | non-insulin dependent diabetes mellitus obesity neurodegenerative diseases cognitive defects (age- and dementia-associated) metabolic disorders |
inhibition of the conversion of inactive cortison into acitve cortisol | nn4 | 3.10 | 898264-92-1 | CC(C)(C(=O)NC1[C@H]2CC3C[C@@H]1CC(C3)(C2)C(=O)N)OC=4C=CC(=CC4)OC | 898264-92-1 | cas | Discovery of adamantane ethers as inhibitors of 11beta-HSD-1: Synthesis and biological evaluation | Patel JR, Shuai Q, Dinges J, Winn M, Pliushchev M, Fung S, Monzon K, Chiou W, Wang J, Pan L, Wagaw S, Engstrom K, Kerdesky FA, Longenecker K, Judge R, Qin W, Imade HM, Stolarik D, Beno DW, Brune M, Chovan LE, Sham HL, Jacobson P, Link JT | Bioorg Med Chem Lett 17(3):750-5 | 2007 | 10.1016/j.bmcl.2006.10.074 | |||||||||
| Enzymes | 2irw | 2irw-nn4-3.10-x-2 | 3.1841909023117 | endocrine, metabolic | 11beta-hydroxysteroid dehydrogenase type 1 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 11beta-HSD 1 | non-insulin dependent diabetes mellitus obesity neurodegenerative diseases cognitive defects (age- and dementia-associated) metabolic disorders |
inhibition of the conversion of inactive cortison into acitve cortisol | nn4 | 3.10 | 898264-92-1 | CC(C)(C(=O)NC1[C@H]2CC3C[C@@H]1CC(C3)(C2)C(=O)N)OC=4C=CC(=CC4)OC | 898264-92-1 | cas | Discovery of adamantane ethers as inhibitors of 11beta-HSD-1: Synthesis and biological evaluation | Patel JR, Shuai Q, Dinges J, Winn M, Pliushchev M, Fung S, Monzon K, Chiou W, Wang J, Pan L, Wagaw S, Engstrom K, Kerdesky FA, Longenecker K, Judge R, Qin W, Imade HM, Stolarik D, Beno DW, Brune M, Chovan LE, Sham HL, Jacobson P, Link JT | Bioorg Med Chem Lett 17(3):750-5 | 2007 | 10.1016/j.bmcl.2006.10.074 | |||||||||
| 2ivd | PPOX_MYXXA | P56601 | K00231 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With oxygen as acceptor | Protoporphyrinogen oxidase | 2ivd | |||||||||||||||||||||
| 2ivs | RET_HUMAN | P07949 | K05126 | Cytokine receptors | Receptor tyrosine kinase | RTK class XIV (RET receptor family) | RET; proto-oncogene tyrosine-protein kinase Ret | Others | 2ivs | |||||||||||||||||||||
| 2ivv | RET_HUMAN | P07949 | K05126 | Cytokine receptors | Receptor tyrosine kinase | RTK class XIV (RET receptor family) | RET; proto-oncogene tyrosine-protein kinase Ret | Others | 2ivv | |||||||||||||||||||||
| 2izu | KC1G3_HUMAN | Q9Y6M4 | K08958 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2izu | |||||||||||||||||||||
| 2j2u | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2j2u | |||||||||||||||||||||
| 2j4i | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2j4i | |||||||||||||||||||||
| 2j50 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2j50 | |||||||||||||||||||||
| 2j7x | ESR2_RAT | Q62986 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2j7x | |||||||||||||||||||||
| 2j94 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2j94 | |||||||||||||||||||||
| 2jc6 | KCC1D_HUMAN | Q8IU85 | K08794 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2jc6 | |||||||||||||||||||||
| 2jh0 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2jh0 | |||||||||||||||||||||
| 2jh5 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2jh5 | |||||||||||||||||||||
| 2jh6 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2jh6 | |||||||||||||||||||||
| 2jj3 | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2jj3 | |||||||||||||||||||||
| 2jj8 | DNK_DROME | Q9XZT6 | K05961 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Deoxynucleoside kinase | 2jj8 | |||||||||||||||||||||
| 2jko | FAK1_CHICK | Q00944 | K05725 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 2jko | |||||||||||||||||||||
| 2jle | Q72547_9HIV1 | Q72547 | KO_id not found | Others | Others | Others | Others | Others | 2jle | |||||||||||||||||||||
| 2nsd | INHA_MYCTU | P0A5Y6 | K05500 | Lipid biosynthesis proteins | TGF-beta family | Distant members | INHA; inhibin, alpha | Others | 2nsd | |||||||||||||||||||||
| 2nv7 | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2nv7 | |||||||||||||||||||||
| 2nw4 | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2nw4 | |||||||||||||||||||||
| 2o1u | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 2o1u | |||||||||||||||||||||
| 2o7o | TETR4_ECOLX | P0ACT4 | KO_id not found | Others | Others | Others | Others | Others | 2o7o | |||||||||||||||||||||
| 2o8h | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2o8h | |||||||||||||||||||||
| 2ofv | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 2ofv | |||||||||||||||||||||
| 2oi0 | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 2oi0 | |||||||||||||||||||||
| 2oj9 | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 2oj9 | |||||||||||||||||||||
| 2ojg | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2ojg | |||||||||||||||||||||
| 2on6 | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 2on6 | |||||||||||||||||||||
| 2op0 | Q9BH77_PLAFA | Q9BH77 | KO_id not found | Others | Others | Others | Others | Others | 2op0 | |||||||||||||||||||||
| 2op1 | Q9BH77_PLAFA | Q9BH77 | KO_id not found | Others | Others | Others | Others | Others | 2op1 | |||||||||||||||||||||
| 2ops | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 2ops | |||||||||||||||||||||
| 2our | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2our | |||||||||||||||||||||
| 2ovh | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 2ovh | |||||||||||||||||||||
| 2ovv | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2ovv | |||||||||||||||||||||
| 2ovy | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2ovy | |||||||||||||||||||||
| 2ow3 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 2ow3 | |||||||||||||||||||||
| 2oxd | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2oxd | |||||||||||||||||||||
| 2oz7 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2oz7 | |||||||||||||||||||||
| 2p0m | LOX15_RABIT | P12530 | K00460 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | Arachidonate 15-lipoxygenase | 2p0m | |||||||||||||||||||||
| 2p15 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2p15 | |||||||||||||||||||||
| 2p2h | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 2p2h | |||||||||||||||||||||
| 2p2i | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 2p2i | |||||||||||||||||||||
| 2p95 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2p95 | |||||||||||||||||||||
| 2pdg | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2pdg | |||||||||||||||||||||
| 2pdl | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2pdl | |||||||||||||||||||||
| 2pe2 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2pe2 | |||||||||||||||||||||
| 2pog | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2pog | |||||||||||||||||||||
| 2pr3 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2pr3 | |||||||||||||||||||||
| 2psj | LUCI_RENRE | P27652 | KO_id not found | Others | Others | Others | Others | Others | 2psj | |||||||||||||||||||||
| 2pvh | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2pvh | |||||||||||||||||||||
| 2pvj | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2pvj | |||||||||||||||||||||
| 2pvn | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2pvn | |||||||||||||||||||||
| 2pw3 | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2pw3 | |||||||||||||||||||||
| 2pzi | PKNG_MYCTU | P65728 | K14949 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2pzi | |||||||||||||||||||||
| 2q6s | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 2q6s | |||||||||||||||||||||
| 2q7i | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2q7i | |||||||||||||||||||||
| 2q7k | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2q7k | |||||||||||||||||||||
| 2q7o | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 2q7o | |||||||||||||||||||||
| 2q8g | PDK1_HUMAN | Q15118 | K12077 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2q8g | |||||||||||||||||||||
| 2q8i | PDK3_HUMAN | Q15120 | K00898 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2q8i | |||||||||||||||||||||
| 2q8s | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 2q8s | |||||||||||||||||||||
| 2q95 | AMPM_ECOLI | P0AE18 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 2q95 | |||||||||||||||||||||
| 2qab | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qab | |||||||||||||||||||||
| 2qc6 | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2qc6 | |||||||||||||||||||||
| 2qe4 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qe4 | |||||||||||||||||||||
| 2qgt | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qgt | |||||||||||||||||||||
| 2qgw | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qgw | |||||||||||||||||||||
| 2qkr | Q5CRJ8_CRYPI | Q5CRJ8 | K04563 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2qkr | |||||||||||||||||||||
| 2qo8 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2qo8 | |||||||||||||||||||||
| 2qr9 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qr9 | |||||||||||||||||||||
| 2qtn | Q6HT60_BACAN | Q6HT60 | K00969 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Nicotinate-nucleotide adenylyltransferase | 2qtn | |||||||||||||||||||||
| 2qtu | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2qtu | |||||||||||||||||||||
| 2r2l | Q5RKJ4_RAT | Q5RKJ4 | KO_id not found | Others | Others | Others | Others | Others | 2r2l | |||||||||||||||||||||
| 2r3i | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3i | |||||||||||||||||||||
| 2r3j | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3j | |||||||||||||||||||||
| 2r3k | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3k | |||||||||||||||||||||
| 2r3m | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3m | |||||||||||||||||||||
| 2r3p | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3p | |||||||||||||||||||||
| 2r3q | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3q | |||||||||||||||||||||
| 2r3r | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3r | |||||||||||||||||||||
| 2r4b | ERBB4_HUMAN | Q15303 | K05085 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2r4b | |||||||||||||||||||||
| 2r64 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r64 | |||||||||||||||||||||
| 2r7b | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2r7b | |||||||||||||||||||||
| 2rbe | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 2rbe | |||||||||||||||||||||
| 2rct | RET2_HUMAN | P50120 | KO_id not found | Others | Others | Others | Others | Others | 2rct | |||||||||||||||||||||
| 2rcw | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 2rcw | |||||||||||||||||||||
| 2rfs | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 2rfs | |||||||||||||||||||||
| 2rg5 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2rg5 | |||||||||||||||||||||
| 2rg6 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2rg6 | |||||||||||||||||||||
| 2rgp | EGFR_HUMAN | P00533 | K04361 | Cytokine receptors | Receptor tyrosine kinase | RTK class I (EGF receptor family) | EGFR, ERBB1; epidermal growth factor receptor | Others | 2rgp | |||||||||||||||||||||
| 2rhr | ACT3_STRCO | P16544 | K12420 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | - | 2rhr | |||||||||||||||||||||
| 2rki | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 2rki | |||||||||||||||||||||
| 2rkv | Q9HDE2_GIBZA | Q9HDE2 | KO_id not found | Others | Others | Others | Others | Others | 2rkv | |||||||||||||||||||||
| Signaling proteins | 2trt | 2trt-tac-2.50-d-1-s | 1816 | antiinfective | tetracycline repressor protein | Intracellular transduction | DNA repressors | TetR | fundamental research bacterial infection |
resistance to tetracycline antibiotics at the transcriptional level | tac | 2.50 | tetracycline | CN(C)[C@H]1[C@@H]2C[C@H]3C(=C(O)[C@]2(O)C(=O)C(=C1O)C(=O)N)C(=O)c4c(O)cccc4[C@@]3(C)O | 60-54-8 | cas | Structure of the Tet repressor-tetracycline complex and regulation of antibiotic resistance | Hinrichs W, Kisker C, Duvel M, Muller A, Tovar K, Hillen W, Saenger W | Science 264(5157):418-20 | 1994 | - | |||||||||
| 2tsr | TYSY_RAT | P45352 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 2tsr | |||||||||||||||||||||
| 2tys | TRPA_SALTY | P00929 | K01695 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Tryptophan synthase | 2tys | |||||||||||||||||||||
| 2uue | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2uue | |||||||||||||||||||||
| 2uv2 | SLK_HUMAN | Q9H2G2 | K08836 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2uv2 | |||||||||||||||||||||
| 2uwo | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2uwo | |||||||||||||||||||||
| 2uwu | RCEL_RHOSH | P0C0Y8 | KO_id not found | Others | Others | Others | Others | Others | 2uwu | |||||||||||||||||||||
| 2uym | KIF11_HUMAN | P52732 | K10398 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulin-binding proteins | KIF11; kinesin family member 11 | 2uym | |||||||||||||||||||||
| 2uzd | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2uzd | |||||||||||||||||||||
| 2uzo | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2uzo | |||||||||||||||||||||
| Enzymes | 2v0m | 2v0m-kln-3.80-x-1-s | 24.19090 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | kln | 3.80 | ketoconazole | [CC(=O)N1CCN(CC1)c2ccc(OC[C@H]3CO[C@@](Cn4ccnc4)(O3)c5ccc(Cl)cc5Cl)cc2] | 65277-42-1 | CAS | Structural basis for ligand promiscuity in cytochrome P450 3A4 | Ekroos M, Sjogren T | Proc Natl Acad Sci U S A 103(37):13682-7 | 2006 | 10.1073/pnas.0603236103 | |||||||||
| Enzymes | 2v0m | 2v0m-kln-3.80-x-1 | 28.24012 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | kln | 3.80 | ketoconazole | [CC(=O)N1CCN(CC1)c2ccc(OC[C@H]3CO[C@@](Cn4ccnc4)(O3)c5ccc(Cl)cc5Cl)cc2] | 65277-42-1 | CAS | Structural basis for ligand promiscuity in cytochrome P450 3A4 | Ekroos M, Sjogren T | Proc Natl Acad Sci U S A 103(37):13682-7 | 2006 | 10.1073/pnas.0603236103 | |||||||||
| Enzymes | 2v0m | 2v0m-kln-3.80-x-2-s | 26.91126 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | kln | 3.80 | ketoconazole | [CC(=O)N1CCN(CC1)c2ccc(OC[C@H]3CO[C@@](Cn4ccnc4)(O3)c5ccc(Cl)cc5Cl)cc2] | 65277-42-1 | CAS | Structural basis for ligand promiscuity in cytochrome P450 3A4 | Ekroos M, Sjogren T | Proc Natl Acad Sci U S A 103(37):13682-7 | 2006 | 10.1073/pnas.0603236103 | |||||||||
| Enzymes | 2v0m | 2v0m-kln-3.80-x-2 | 31.19761 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | kln | 3.80 | ketoconazole | [CC(=O)N1CCN(CC1)c2ccc(OC[C@H]3CO[C@@](Cn4ccnc4)(O3)c5ccc(Cl)cc5Cl)cc2] | 65277-42-1 | CAS | Structural basis for ligand promiscuity in cytochrome P450 3A4 | Ekroos M, Sjogren T | Proc Natl Acad Sci U S A 103(37):13682-7 | 2006 | 10.1073/pnas.0603236103 | |||||||||
| 2v2q | ISPE_AQUAE | O67060 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 2v2q | |||||||||||||||||||||
| 2v4l | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2v4l | |||||||||||||||||||||
| 2v95 | CBG_RAT | P31211 | KO_id not found | Others | Others | Others | Others | Others | 2v95 | |||||||||||||||||||||
| 2vdy | CBG_HUMAN | P08185 | KO_id not found | Others | Others | Others | Others | Others | 2vdy | |||||||||||||||||||||
| 2ves | LPXC_PSEAE | P47205 | K02535 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | UDP-3-O-acyl-N-acetylglucosamine deacetylase | 2ves | |||||||||||||||||||||
| 2vf3 | ISPE_AQUAE | O67060 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 2vf3 | |||||||||||||||||||||
| 2vg5 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2vg5 | |||||||||||||||||||||
| 2vg7 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2vg7 | |||||||||||||||||||||
| 2vgo | AUKBA_XENLA | Q6DE08 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2vgo | |||||||||||||||||||||
| 2vgp | AUKBA_XENLA | Q6DE08 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2vgp | |||||||||||||||||||||
| 2vn9 | KCC2D_HUMAN | Q13557 | K04515 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2vn9 | |||||||||||||||||||||
| 2vpr | Q799E2_PASMD | Q799E2 | KO_id not found | Others | Others | Others | Others | Others | 2vpr | |||||||||||||||||||||
| 2vqo | HDAC4_HUMAN | P56524 | K11406 | Chromosome | Eukaryotic Type | Histone modification proteins | HDACs (histone deacetylases) | Class II HDACs | 2vqo | |||||||||||||||||||||
| 2vqq | HDAC4_HUMAN | P56524 | K11406 | Chromosome | Eukaryotic Type | Histone modification proteins | HDACs (histone deacetylases) | Class II HDACs | 2vqq | |||||||||||||||||||||
| 2vqs | DNK_DROME | Q9XZT6 | K05961 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Deoxynucleoside kinase | 2vqs | |||||||||||||||||||||
| 2vrx | AUKBA_XENLA | Q6DE08 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2vrx | |||||||||||||||||||||
| 2vvt | MURI_ENTFA | Q836J0 | K01776 | Enzymes | Isomerases | Racemases and epimerases | Acting on amino acids and derivatives | Glutamate racemase | 2vvt | |||||||||||||||||||||
| 2vww | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vww | |||||||||||||||||||||
| 2vwx | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vwx | |||||||||||||||||||||
| 2vwy | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vwy | |||||||||||||||||||||
| 2vwz | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vwz | |||||||||||||||||||||
| 2vx0 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vx0 | |||||||||||||||||||||
| 2vx1 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vx1 | |||||||||||||||||||||
| 2vz6 | KCC2A_HUMAN | Q9UQM7 | K04515 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2vz6 | |||||||||||||||||||||
| 2w1e | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2w1e | |||||||||||||||||||||
| 2w3i | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2w3i | |||||||||||||||||||||
| 2w4i | MURI_HELPJ | Q9ZLT0 | K01776 | Enzymes | Isomerases | Racemases and epimerases | Acting on amino acids and derivatives | Glutamate racemase | 2w4i | |||||||||||||||||||||
| 2w4o | KCC4_HUMAN | Q16566 | K05869 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2w4o | |||||||||||||||||||||
| 2w71 | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2w71 | |||||||||||||||||||||
| 2w8r | SSDH_HUMAN | P51649 | K00139 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Succinate-semialdehyde dehydrogenase (NAD+) | 2w8r | |||||||||||||||||||||
| 2w98 | PTGR2_HUMAN | Q8N8N7 | K13949 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | 15-oxoprostaglandin 13-oxidase | 2w98 | |||||||||||||||||||||
| 2wa9 | CLPS_ECOLI | P0A8Q6 | KO_id not found | Others | Others | Others | Others | Others | 2wa9 | |||||||||||||||||||||
| 2wd1 | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 2wd1 | |||||||||||||||||||||
| 2wd8 | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 2wd8 | |||||||||||||||||||||
| 2wea | PENP_PENJA | P00798 | KO_id not found | Others | Others | Others | Others | Others | 2wea | |||||||||||||||||||||
| 2weh | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2weh | |||||||||||||||||||||
| 2wei | A3FQ16_CRYPI | A3FQ16 | K13412 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2wei | |||||||||||||||||||||
| 2wek | ZADH2_HUMAN | Q8N4Q0 | KO_id not found | Others | Others | Others | Others | Others | 2wek | |||||||||||||||||||||
| 2wel | KCC2D_HUMAN | Q13557 | K04515 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2wel | |||||||||||||||||||||
| 2wge | FAB1_MYCTU | P63454 | K00921 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 1-phosphatidylinositol-3-phosphate 5-kinase | 2wge | |||||||||||||||||||||
| 2wgg | FAB1_MYCTU | P63454 | K00921 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 1-phosphatidylinositol-3-phosphate 5-kinase | 2wgg | |||||||||||||||||||||
| 2wgj | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 2wgj | |||||||||||||||||||||
| 2wmd | NMRL1_HUMAN | Q9HBL8 | KO_id not found | Others | Others | Others | Others | Others | 2wmd | |||||||||||||||||||||
| 2wmr | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2wmr | |||||||||||||||||||||
| 2wms | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2wms | |||||||||||||||||||||
| 2wn9 | Q8WSF8_APLCA | Q8WSF8 | KO_id not found | Others | Others | Others | Others | Others | 2wn9 | |||||||||||||||||||||
| 2wqb | TIE2_HUMAN | Q02763 | K05121 | Cellular antigens | CD (clusters of differentiation) molecules | CD202b; TEK tyrosine kinase, endothelial | Others | Others | 2wqb | |||||||||||||||||||||
| 2wtc | CHK2_HUMAN | O96017 | K06641 | DNA repair and recombination proteins | Eukaryotic Type | Check point factors | Other check point factors | CHK2; serine-threonine-protein kinase Chk2 | 2wtc | |||||||||||||||||||||
| 2wtd | CHK2_HUMAN | O96017 | K06641 | DNA repair and recombination proteins | Eukaryotic Type | Check point factors | Other check point factors | CHK2; serine-threonine-protein kinase Chk2 | 2wtd | |||||||||||||||||||||
| 2wti | Q9HBS5_HUMAN | Q9HBS5 | K06641 | DNA repair and recombination proteins | Eukaryotic Type | Check point factors | Other check point factors | CHK2; serine-threonine-protein kinase Chk2 | 2wti | |||||||||||||||||||||
| 2wu7 | CLK3_HUMAN | P49761 | K08823 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 2wu7 | |||||||||||||||||||||
| 2wuf | HSAD_MYCTU | P96851 | K16050 | Enzymes | Hydrolases | Acting on carbon-carbon bonds | In ketonic substances | 4,5-9,10-diseco-3-hydroxy-5,9,17-trioxoandrosta-1(10),2-diene-4-oate hydrolase | 2wuf | |||||||||||||||||||||
| 2wxf | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxf | |||||||||||||||||||||
| 2wxm | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxm | |||||||||||||||||||||
| 2wxn | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxn | |||||||||||||||||||||
| 2wxo | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxo | |||||||||||||||||||||
| 2wxp | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxp | |||||||||||||||||||||
| 2wxq | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxq | |||||||||||||||||||||
| 2wyg | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2wyg | |||||||||||||||||||||
| 2wyj | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2wyj | |||||||||||||||||||||
| 2x00 | Q8WSF8_APLCA | Q8WSF8 | KO_id not found | Others | Others | Others | Others | Others | 2x00 | |||||||||||||||||||||
| 2x1n | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2x1n | |||||||||||||||||||||
| 2x2k | RET_HUMAN | P07949 | K05126 | Cytokine receptors | Receptor tyrosine kinase | RTK class XIV (RET receptor family) | RET; proto-oncogene tyrosine-protein kinase Ret | Others | 2x2k | |||||||||||||||||||||
| 2x2l | RET_HUMAN | P07949 | K05126 | Cytokine receptors | Receptor tyrosine kinase | RTK class XIV (RET receptor family) | RET; proto-oncogene tyrosine-protein kinase Ret | Others | 2x2l | |||||||||||||||||||||
| 2x38 | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2x38 | |||||||||||||||||||||
| 2x7e | KIF11_HUMAN | P52732 | K10398 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulin-binding proteins | KIF11; kinesin family member 11 | 2x7e | |||||||||||||||||||||
| 2x7s | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2x7s | |||||||||||||||||||||
| 2x7t | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2x7t | |||||||||||||||||||||
| 2x7u | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2x7u | |||||||||||||||||||||
| 2x8e | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2x8e | |||||||||||||||||||||
| 2x8i | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2x8i | |||||||||||||||||||||
| 2x9f | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2x9f | |||||||||||||||||||||
| 2x9n | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 2x9n | |||||||||||||||||||||
| 2xbv | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2xbv | |||||||||||||||||||||
| 2xc0 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2xc0 | |||||||||||||||||||||
| 2xc4 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2xc4 | |||||||||||||||||||||
| 2xc5 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2xc5 | |||||||||||||||||||||
| 2xng | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2xng | |||||||||||||||||||||
| 2xpu | TETR4_ECOLX | P0ACT4 | KO_id not found | Others | Others | Others | Others | Others | 2xpu | |||||||||||||||||||||
| 2xrl | TETR4_ECOLX | P0ACT4 | KO_id not found | Others | Others | Others | Others | Others | 2xrl | |||||||||||||||||||||
| 2xtk | B0Y2Y2_ASPFC | B0Y2Y2 | KO_id not found | Others | Others | Others | Others | Others | 2xtk | |||||||||||||||||||||
| 2xvd | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2xvd | |||||||||||||||||||||
| 2y05 | PTGR1_HUMAN | Q14914 | K13948 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | 15-oxoprostaglandin 13-oxidase | 2y05 | |||||||||||||||||||||
| 2ybu | CHIA_HUMAN | Q9BZP6 | K01183 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Chitinase | 2ybu | |||||||||||||||||||||
| 2yex | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2yex | |||||||||||||||||||||
| 2yfx | B6EXY4_HUMAN | B6EXY4 | KO_id not found | Others | Others | Others | Others | Others | 2yfx | |||||||||||||||||||||
| 2yis | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2yis | |||||||||||||||||||||
| 2yiw | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2yiw | |||||||||||||||||||||
| 2ykm | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2ykm | |||||||||||||||||||||
| 2z4b | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2z4b | |||||||||||||||||||||
| 2z6j | Q9FBC5_STREE | Q9FBC5 | KO_id not found | Others | Others | Others | Others | Others | 2z6j | |||||||||||||||||||||
| 2z7g | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 2z7g | |||||||||||||||||||||
| 2z7l | MK01_RAT | P63086 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2z7l | |||||||||||||||||||||
| 2zaz | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2zaz | |||||||||||||||||||||
| 2zc9 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zc9 | |||||||||||||||||||||
| 2zdv | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zdv | |||||||||||||||||||||
| 2zf0 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zf0 | |||||||||||||||||||||
| 2zff | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zff | |||||||||||||||||||||
| 2zfp | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zfp | |||||||||||||||||||||
| 2zgb | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zgb | |||||||||||||||||||||
| 2zjw | CSK21_HUMAN | P68400 | K03097 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2zjw | |||||||||||||||||||||
| 2zm1 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 2zm1 | |||||||||||||||||||||
| 2zm3 | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 2zm3 | |||||||||||||||||||||
| 2zno | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 2zno | |||||||||||||||||||||
| 2zoq | MK03_HUMAN | P27361 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2zoq | |||||||||||||||||||||
| 2zv9 | LYN_MOUSE | P25911 | K05854 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 2zv9 | |||||||||||||||||||||
| 2zva | LYN_MOUSE | P25911 | K05854 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 2zva | |||||||||||||||||||||
| 3a3w | Q93LD7_RHIRD | Q93LD7 | KO_id not found | Others | Others | Others | Others | Others | 3a3w | |||||||||||||||||||||
| 3ac1 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ac1 | |||||||||||||||||||||
| 3ac3 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ac3 | |||||||||||||||||||||
| 3ack | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ack | |||||||||||||||||||||
| 3ad4 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ad4 | |||||||||||||||||||||
| 3adt | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3adt | |||||||||||||||||||||
| 3adx | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3adx | |||||||||||||||||||||
| 3anq | DYR1A_HUMAN | Q13627 | K08825 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 3anq | |||||||||||||||||||||
| 3anr | DYR1A_HUMAN | Q13627 | K08825 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 3anr | |||||||||||||||||||||
| 3avp | COAA_MYCTU | P63810 | K00867 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pantothenate kinase | 3avp | |||||||||||||||||||||
| 3avq | COAA_MYCTU | P63810 | K00867 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pantothenate kinase | 3avq | |||||||||||||||||||||
| 3az9 | Q965D7_PLAFA | Q965D7 | KO_id not found | Others | Others | Others | Others | Others | 3az9 | |||||||||||||||||||||
| 3aza | Q965D7_PLAFA | Q965D7 | KO_id not found | Others | Others | Others | Others | Others | 3aza | |||||||||||||||||||||
| 3b2s | Q9HDE2_GIBZA | Q9HDE2 | KO_id not found | Others | Others | Others | Others | Others | 3b2s | |||||||||||||||||||||
| 3b3k | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3b3k | |||||||||||||||||||||
| 3b4f | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3b4f | |||||||||||||||||||||
| 3b67 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 3b67 | |||||||||||||||||||||
| 3b8r | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3b8r | |||||||||||||||||||||
| 3b92 | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3b92 | |||||||||||||||||||||
| 3bac | DNLJ_HAEIN | P43813 | K01972 | Enzymes | Ligases | Forming phosphoric-ester bonds | Ligases that form phosphoric-ester bonds (only sub-subclass identified to date) | DNA ligase (NAD+) | 3bac | |||||||||||||||||||||
| 3be9 | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 3be9 | |||||||||||||||||||||
| 3bea | CSF1R_HUMAN | P07333 | K05090 | Cellular antigens | CD (clusters of differentiation) molecules | CD115; colony stimulating factor 1 receptor (macrophage) | Others | Others | 3bea | |||||||||||||||||||||
| 3bet | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3bet | |||||||||||||||||||||
| 3bgp | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3bgp | |||||||||||||||||||||
| 3bgq | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3bgq | |||||||||||||||||||||
| 3bhh | KCC2B_HUMAN | Q13554 | K04515 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 3bhh | |||||||||||||||||||||
| 3bhj | CBR1_HUMAN | P16152 | K00079 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Carbonyl reductase (NADPH) | 3bhj | |||||||||||||||||||||
| 3bhm | CBR1_HUMAN | P16152 | K00079 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Carbonyl reductase (NADPH) | 3bhm | |||||||||||||||||||||
| 3bhu | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3bhu | |||||||||||||||||||||
| 3bhv | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3bhv | |||||||||||||||||||||
| 3bjc | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3bjc | |||||||||||||||||||||
| 3bjh | Q9U9J6_APIME | Q9U9J6 | KO_id not found | Others | Others | Others | Others | Others | 3bjh | |||||||||||||||||||||
| 3bll | TGT_ZYMMO | P28720 | K00773 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | TRNA-guanine transglycosylase | 3bll | |||||||||||||||||||||
| 3bpr | MERTK_HUMAN | Q12866 | K05117 | Cytokine receptors | Receptor tyrosine kinase | RTK class IX (AXL receptor family) | MERTK, MER; c-mer proto-oncogene tyrosine kinase | Others | 3bpr | |||||||||||||||||||||
| 3bqm | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 3bqm | |||||||||||||||||||||
| 3bqn | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 3bqn | |||||||||||||||||||||
| 3bqz | QACR_STAAM | P0A0N3 | KO_id not found | Others | Others | Others | Others | Others | 3bqz | |||||||||||||||||||||
| 3bv3 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3bv3 | |||||||||||||||||||||
| 3bxs | POL_HV1A2 | P03369 | KO_id not found | Others | Others | Others | Others | Others | 3bxs | |||||||||||||||||||||
| 3bym | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3bym | |||||||||||||||||||||
| 3byo | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3byo | |||||||||||||||||||||
| 3byz | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3byz | |||||||||||||||||||||
| 3bz7 | MYS2_DICDI | P08799 | K10352 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actin-binding proteins | Myosins | 3bz7 | |||||||||||||||||||||
| 3bz8 | MYS2_DICDI | P08799 | K10352 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actin-binding proteins | Myosins | 3bz8 | |||||||||||||||||||||
| 3bz9 | MYS2_DICDI | P08799 | K10352 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actin-binding proteins | Myosins | 3bz9 | |||||||||||||||||||||
| 3bzu | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3bzu | |||||||||||||||||||||
| 3c06 | TYSY_LACCA | P00469 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 3c06 | |||||||||||||||||||||
| 3c79 | Q8WSF8_APLCA | Q8WSF8 | KO_id not found | Others | Others | Others | Others | Others | 3c79 | |||||||||||||||||||||
| 3cdp | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3cdp | |||||||||||||||||||||
| 3cds | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3cds | |||||||||||||||||||||
| 3ceh | PYGL_HUMAN | P06737 | K00688 | Enzymes | Transferases | Glycosyltransferases | Hexosyltransferases | Phosphorylase | 3ceh | |||||||||||||||||||||
| 3ch6 | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3ch6 | |||||||||||||||||||||
| 3cjf | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3cjf | |||||||||||||||||||||
| 3cjg | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3cjg | |||||||||||||||||||||
| 3coh | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3coh | |||||||||||||||||||||
| 3cpc | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3cpc | |||||||||||||||||||||
| 3cs7 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 3cs7 | |||||||||||||||||||||
| 3csj | GSTP1_HUMAN | P09211 | K00799 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Glutathione transferase | 3csj | |||||||||||||||||||||
| 3cwd | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3cwd | |||||||||||||||||||||
| 3cy3 | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3cy3 | |||||||||||||||||||||
| 3d28 | POLG_HCVBK | P26663 | KO_id not found | Others | Others | Others | Others | Others | 3d28 | |||||||||||||||||||||
| 3d4n | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3d4n | |||||||||||||||||||||
| 3d7z | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3d7z | |||||||||||||||||||||
| 3d83 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3d83 | |||||||||||||||||||||
| 3d9z | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3d9z | |||||||||||||||||||||
| 3da2 | CAH13_HUMAN | Q8N1Q1 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3da2 | |||||||||||||||||||||
| 3da9 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3da9 | |||||||||||||||||||||
| 3dcc | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3dcc | |||||||||||||||||||||
| 3dcv | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3dcv | |||||||||||||||||||||
| 3ddp | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3ddp | |||||||||||||||||||||
| 3ddq | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3ddq | |||||||||||||||||||||
| 3ddu | PPCE_HUMAN | P48147 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3ddu | |||||||||||||||||||||
| Enzymes | 3dhe | 3dhe-and-2.30-x-1 | 1925 | endocrine | 17beta-hydroxysteroid dehydrogenase type 1 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 17beta-HSD 1 | cancer | conversion of inactive estrone into acitve estradiol | and | 2.30 | dehydroepiandrosterone | C[C@@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@]34C)[C@@H]2CCC1=O | 53-43-0 | cas | Dehydroepiandrosterone and dihydrotestosterone recognition by human estrogenic 17beta-hydroxysteroid dehydrogenase. C-18/c-19 steroid discrimination and enzyme-induced strain | Han Q, Campbell RL, Gangloff A, Huang YW, Lin SX | J Biol Chem 275(2):1105-11 | 2000 | - | |||||||||
| 3dhe | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 3dhe | |||||||||||||||||||||
| 3dhk | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3dhk | |||||||||||||||||||||
| 3di6 | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3di6 | |||||||||||||||||||||
| 3dko | EPHA7_HUMAN | Q15375 | K05108 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 3dko | |||||||||||||||||||||
| 3dn5 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3dn5 | |||||||||||||||||||||
| 3dol | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3dol | |||||||||||||||||||||
| 3dox | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3dox | |||||||||||||||||||||
| 3ds6 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3ds6 | |||||||||||||||||||||
| 3dsl | VM3BP_BOTJA | O93523 | KO_id not found | Others | Others | Others | Others | Others | 3dsl | |||||||||||||||||||||
| 3dt3 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3dt3 | |||||||||||||||||||||
| 3dtc | M3K9_HUMAN | P80192 | K04417 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase kinase kinase | 3dtc | |||||||||||||||||||||
| 3dtw | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3dtw | |||||||||||||||||||||
| 3e2m | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 3e2m | |||||||||||||||||||||
| 3e5a | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3e5a | |||||||||||||||||||||
| 3e7v | HASP_HUMAN | Q8TF76 | K16315 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3e7v | |||||||||||||||||||||
| 3e8r | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3e8r | |||||||||||||||||||||
| 3efl | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3efl | |||||||||||||||||||||
| 3egk | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3egk | |||||||||||||||||||||
| 3ehx | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3ehx | |||||||||||||||||||||
| 3ekn | INSR_HUMAN | P06213 | K04527 | Cellular antigens | CD (clusters of differentiation) molecules | CD220; insulin receptor | Others | Others | 3ekn | |||||||||||||||||||||
| 3elz | Q6IMW5_DANRE | Q6IMW5 | KO_id not found | Others | Others | Others | Others | Others | 3elz | |||||||||||||||||||||
| 3emg | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3emg | |||||||||||||||||||||
| 3ene | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ene | |||||||||||||||||||||
| 3eq7 | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3eq7 | |||||||||||||||||||||
| 3eq8 | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3eq8 | |||||||||||||||||||||
| 3eq9 | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3eq9 | |||||||||||||||||||||
| 3eqr | ACK1_HUMAN | Q07912 | K08886 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 3eqr | |||||||||||||||||||||
| 3erd | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3erd | |||||||||||||||||||||
| 3et1 | PPARA_HUMAN | Q07869 | K07294 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C1, PPARA; peroxisome proliferator-activated receptor alpha | Others | 3et1 | |||||||||||||||||||||
| 3et7 | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3et7 | |||||||||||||||||||||
| 3ete | DHE3_BOVIN | P00366 | K00261 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With NAD+ or NADP+ as acceptor | Glutamate dehydrogenase [NAD(P)+] | 3ete | |||||||||||||||||||||
| 3ewj | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3ewj | |||||||||||||||||||||
| 3eyg | JAK1_HUMAN | P23458 | K11217 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3eyg | |||||||||||||||||||||
| 3f16 | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3f16 | |||||||||||||||||||||
| 3f1q | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3f1q | |||||||||||||||||||||
| 3f4b | Q6TEI5_PLABE | Q6TEI5 | KO_id not found | Others | Others | Others | Others | Others | 3f4b | |||||||||||||||||||||
| 3f4x | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3f4x | |||||||||||||||||||||
| 3f7z | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3f7z | |||||||||||||||||||||
| 3f88 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3f88 | |||||||||||||||||||||
| 3fco | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3fco | |||||||||||||||||||||
| 3fdn | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3fdn | |||||||||||||||||||||
| 3ffi | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3ffi | |||||||||||||||||||||
| 3fi4 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fi4 | |||||||||||||||||||||
| 3fiu | Q2A4B6_FRATH | Q2A4B6 | K01916 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-ammonia (or amine) ligases (amide synthases) | NAD+ synthase | 3fiu | |||||||||||||||||||||
| 3fjl | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3fjl | |||||||||||||||||||||
| 3fkl | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fkl | |||||||||||||||||||||
| 3fkn | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fkn | |||||||||||||||||||||
| 3fko | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fko | |||||||||||||||||||||
| 3fl4 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fl4 | |||||||||||||||||||||
| 3fln | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fln | |||||||||||||||||||||
| 3fls | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fls | |||||||||||||||||||||
| 3flw | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3flw | |||||||||||||||||||||
| 3fly | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fly | |||||||||||||||||||||
| 3flz | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3flz | |||||||||||||||||||||
| 3fma | SMY2_YEAST | P32909 | K11426 | Chromosome | Eukaryotic Type | Histone modification proteins | HMTs (histone methyltransferases) | SMYD; SET and MYND domain-containing protein | 3fma | |||||||||||||||||||||
| 3fmh | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmh | |||||||||||||||||||||
| 3fmk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmk | |||||||||||||||||||||
| 3fml | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fml | |||||||||||||||||||||
| 3fmn | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmn | |||||||||||||||||||||
| 3fne | INHA_MYCTU | P0A5Y6 | K05500 | Lipid biosynthesis proteins | TGF-beta family | Distant members | INHA; inhibin, alpha | Others | 3fne | |||||||||||||||||||||
| 3fnu | Q8IM15_PLAF7 | Q8IM15 | KO_id not found | Others | Others | Others | Others | Others | 3fnu | |||||||||||||||||||||
| 3fqh | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fqh | |||||||||||||||||||||
| 3fqk | POLG_HCVBK | P26663 | KO_id not found | Others | Others | Others | Others | Others | 3fqk | |||||||||||||||||||||
| 3fqs | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fqs | |||||||||||||||||||||
| 3fsf | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fsf | |||||||||||||||||||||
| 3fsk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fsk | |||||||||||||||||||||
| 3fxw | MAPK3_HUMAN | Q16644 | K04444 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3fxw | |||||||||||||||||||||
| 3fzr | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fzr | |||||||||||||||||||||
| 3fzs | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fzs | |||||||||||||||||||||
| 3g0e | KIT_HUMAN | P10721 | K05091 | Cellular antigens | CD (clusters of differentiation) molecules | CD117; v-kit Hardy-Zuckerman 4 feline sarcoma viral oncogene homolog | Others | Others | 3g0e | |||||||||||||||||||||
| 3g0u | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3g0u | |||||||||||||||||||||
| 3g0x | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3g0x | |||||||||||||||||||||
| 3g0y | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3g0y | |||||||||||||||||||||
| 3g11 | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3g11 | |||||||||||||||||||||
| 3g1o | ETHR_MYCTU | P96222 | KO_id not found | Others | Others | Others | Others | Others | 3g1o | |||||||||||||||||||||
| 3g42 | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3g42 | |||||||||||||||||||||
| 3g45 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3g45 | |||||||||||||||||||||
| 3g4k | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3g4k | |||||||||||||||||||||
| 3g7e | C3SLN3_ECOLX | C3SLN3 | KO_id not found | Others | Others | Others | Others | Others | 3g7e | |||||||||||||||||||||
| 3g8o | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 3g8o | |||||||||||||||||||||
| 3gbk | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3gbk | |||||||||||||||||||||
| 3gc0 | A8BZ95_GIAIC | A8BZ95 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3gc0 | |||||||||||||||||||||
| 3gc9 | MK11_HUMAN | Q15759 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3gc9 | |||||||||||||||||||||
| 3gcu | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3gcu | |||||||||||||||||||||
| 3gcv | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3gcv | |||||||||||||||||||||
| 3ggf | MST4_HUMAN | Q9P289 | K16314 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ggf | |||||||||||||||||||||
| 3gid | ACACB_HUMAN | O00763 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 3gid | |||||||||||||||||||||
| 3gkj | NPC1_HUMAN | O15118 | K12385 | Others | Cellular Processes | Transport and catabolism | Lysosome | NPC1; Niemann-Pick C1 protein | 3gkj | |||||||||||||||||||||
| 3gko | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3gko | |||||||||||||||||||||
| 3gob | Q5S3I3_STEMA | Q5S3I3 | KO_id not found | Others | Others | Others | Others | Others | 3gob | |||||||||||||||||||||
| 3gql | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 3gql | |||||||||||||||||||||
| 3gx9 | Q51990_PSEPU | Q51990 | KO_id not found | Others | Others | Others | Others | Others | 3gx9 | |||||||||||||||||||||
| 3gxl | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 3gxl | |||||||||||||||||||||
| 3h0y | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3h0y | |||||||||||||||||||||
| 3h3c | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3h3c | |||||||||||||||||||||
| 3h6k | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3h6k | |||||||||||||||||||||
| 3h6v | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3h6v | |||||||||||||||||||||
| 3h98 | POLG_HCVBK | P26663 | KO_id not found | Others | Others | Others | Others | Others | 3h98 | |||||||||||||||||||||
| 3h9f | TTK_HUMAN | P33981 | K08866 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 3h9f | |||||||||||||||||||||
| 3ha6 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ha6 | |||||||||||||||||||||
| 3hgy | Q7B8P6_CAMJU | Q7B8P6 | KO_id not found | Others | Others | Others | Others | Others | 3hgy | |||||||||||||||||||||
| 3hky | POLG_HCVJ4 | O92972 | KO_id not found | Others | Others | Others | Others | Others | 3hky | |||||||||||||||||||||
| 3hlj | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3hlj | |||||||||||||||||||||
| 3hlv | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3hlv | |||||||||||||||||||||
| 3hmm | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 3hmm | |||||||||||||||||||||
| 3hmp | TTK_HUMAN | P33981 | K08866 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 3hmp | |||||||||||||||||||||
| 3hmv | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3hmv | |||||||||||||||||||||
| 3hng | VGFR1_HUMAN | P17948 | K05096 | Cytokine receptors | Receptor tyrosine kinase | RTK class V (VEGF receptor family) | FLT1, VEGFR1; FMS-like tyrosine kinase 1 | Others | 3hng | |||||||||||||||||||||
| 3hnz | FABF_ECOLI | P0AAI5 | K09458 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase II | 3hnz | |||||||||||||||||||||
| 3ho0 | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3ho0 | |||||||||||||||||||||
| 3hod | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3hod | |||||||||||||||||||||
| 3hp5 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3hp5 | |||||||||||||||||||||
| 3hqy | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3hqy | |||||||||||||||||||||
| 3hqz | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3hqz | |||||||||||||||||||||
| 3hr1 | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3hr1 | |||||||||||||||||||||
| 3hrb | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3hrb | |||||||||||||||||||||
| 3hrr | PKSL1_ASPPA | Q12053 | KO_id not found | Others | Others | Others | Others | Others | 3hrr | |||||||||||||||||||||
| 3hs4 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3hs4 | |||||||||||||||||||||
| 3hzt | Q3HNM6_TOXGO | Q3HNM6 | K13412 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3hzt | |||||||||||||||||||||
| 3i7b | Q9BJF5_TOXGO | Q9BJF5 | KO_id not found | Others | Others | Others | Others | Others | 3i7b | |||||||||||||||||||||
| 3i7c | Q9BJF5_TOXGO | Q9BJF5 | KO_id not found | Others | Others | Others | Others | Others | 3i7c | |||||||||||||||||||||
| 3i81 | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 3i81 | |||||||||||||||||||||
| 3i8v | PDE4A_HUMAN | P27815 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3i8v | |||||||||||||||||||||
| 3i9l | NADA_APLCA | P29241 | K03517 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Quinolinate synthase | 3i9l | |||||||||||||||||||||
| 3iai | CAH9_HUMAN | Q16790 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3iai | |||||||||||||||||||||
| 3iak | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3iak | |||||||||||||||||||||
| 3iej | CATS_HUMAN | P25774 | K01368 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Cysteine endopeptidases | Cathepsin S | 3iej | |||||||||||||||||||||
| 3ig7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3ig7 | |||||||||||||||||||||
| 3igg | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3igg | |||||||||||||||||||||
| 3ihg | Q54530_9ACTO | Q54530 | KO_id not found | Others | Others | Others | Others | Others | 3ihg | |||||||||||||||||||||
| 3ik6 | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3ik6 | |||||||||||||||||||||
| 3il5 | FABH_ENTFA | Q820T1 | K00648 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase III | 3il5 | |||||||||||||||||||||
| 3ilu | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3ilu | |||||||||||||||||||||
| 3imx | Q53Y25_HUMAN | Q53Y25 | K12407 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Glucokinase | 3imx | |||||||||||||||||||||
| 3inj | ALDH2_HUMAN | P05091 | K00128 | Enzymes | Oxidoreductases | Acting on the aldehyde or oxo group of donors | With NAD+ or NADP+ as acceptor | Aldehyde dehydrogenase (NAD+) | 3inj | |||||||||||||||||||||
| 3iob | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3iob | |||||||||||||||||||||
| 3iph | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3iph | |||||||||||||||||||||
| 3iub | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3iub | |||||||||||||||||||||
| 3ivm | Q9X6R4_AERPU | Q9X6R4 | KO_id not found | Others | Others | Others | Others | Others | 3ivm | |||||||||||||||||||||
| 3ix8 | LASR_PSEAE | P25084 | KO_id not found | Others | Others | Others | Others | Others | 3ix8 | |||||||||||||||||||||
| 3jpv | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3jpv | |||||||||||||||||||||
| 3jq8 | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jq8 | |||||||||||||||||||||
| 3jqg | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jqg | |||||||||||||||||||||
| 3jsx | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 3jsx | |||||||||||||||||||||
| 3jtk | NMT1_HUMAN | P30419 | K00671 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Glycylpeptide N-tetradecanoyltransferase | 3jtk | |||||||||||||||||||||
| 3jya | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3jya | |||||||||||||||||||||
| 3jzf | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 3jzf | |||||||||||||||||||||
| 3jzi | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 3jzi | |||||||||||||||||||||
| 3k31 | Q2GKM8_ANAPZ | Q2GKM8 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 3k31 | |||||||||||||||||||||
| 3k3b | KIF11_HUMAN | P52732 | K10398 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulin-binding proteins | KIF11; kinesin family member 11 | 3k3b | |||||||||||||||||||||
| 3k3e | PDE9A_HUMAN | O76083 | K13761 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3k3e | |||||||||||||||||||||
| 3k3h | PDE9A_HUMAN | O76083 | K13761 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3k3h | |||||||||||||||||||||
| 3k3j | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3k3j | |||||||||||||||||||||
| 3k4s | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3k4s | |||||||||||||||||||||
| 3k6b | A4_CAEEL | Q10651 | K04520 | Heparan sulfate-heparin binding proteins | Others | APP; amyloid beta A4 proteinPlaque formation | Others | Others | 3k6b | |||||||||||||||||||||
| 3k6p | ERR1_HUMAN | P11474 | K01689 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Phosphopyruvate hydratase | 3k6p | |||||||||||||||||||||
| 3kba | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 3kba | |||||||||||||||||||||
| 3kcf | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 3kcf | |||||||||||||||||||||
| 3kf7 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3kf7 | |||||||||||||||||||||
| 3kfy | DYR_ECOLI | P0ABQ4 | K00287 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Dihydrofolate reductase | 3kfy | |||||||||||||||||||||
| 3khj | Q5CPK7_CRYPI | Q5CPK7 | K00088 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | IMP dehydrogenase | 3khj | |||||||||||||||||||||
| 3ki3 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki3 | |||||||||||||||||||||
| 3ki4 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki4 | |||||||||||||||||||||
| 3ki5 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki5 | |||||||||||||||||||||
| 3ki6 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki6 | |||||||||||||||||||||
| 3kig | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3kig | |||||||||||||||||||||
| 3kkt | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3kkt | |||||||||||||||||||||
| 3km0 | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 3km0 | |||||||||||||||||||||
| 3kmm | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3kmm | |||||||||||||||||||||
| 3kn0 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3kn0 | |||||||||||||||||||||
| 3kti | CLPP_BACSU | P80244 | K01358 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Endopeptidase Clp | 3kti | |||||||||||||||||||||
| 3ku2 | Q9BJF5_TOXGO | Q9BJF5 | KO_id not found | Others | Others | Others | Others | Others | 3ku2 | |||||||||||||||||||||
| 3l03 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3l03 | |||||||||||||||||||||
| 3l08 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l08 | |||||||||||||||||||||
| 3l14 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3l14 | |||||||||||||||||||||
| 3l16 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l16 | |||||||||||||||||||||
| 3l30 | PA21B_PIG | P00592 | K01047 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Phospholipase A2 | 3l30 | |||||||||||||||||||||
| 3l3l | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3l3l | |||||||||||||||||||||
| 3l54 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l54 | |||||||||||||||||||||
| 3l5f | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3l5f | |||||||||||||||||||||
| 3l5r | MIF_HUMAN | P14174 | K07253 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting keto- and enol-groups | Phenylpyruvate tautomerase | 3l5r | |||||||||||||||||||||
| 3l5u | MIF_HUMAN | P14174 | K07253 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting keto- and enol-groups | Phenylpyruvate tautomerase | 3l5u | |||||||||||||||||||||
| 3l8p | TIE2_HUMAN | Q02763 | K05121 | Cellular antigens | CD (clusters of differentiation) molecules | CD202b; TEK tyrosine kinase, endothelial | Others | Others | 3l8p | |||||||||||||||||||||
| 3l8s | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3l8s | |||||||||||||||||||||
| 3l8w | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3l8w | |||||||||||||||||||||
| 3l9h | KIF11_HUMAN | P52732 | K10398 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulin-binding proteins | KIF11; kinesin family member 11 | 3l9h | |||||||||||||||||||||
| 3lal | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3lal | |||||||||||||||||||||
| 3lcd | CSF1R_HUMAN | P07333 | K05090 | Cellular antigens | CD (clusters of differentiation) molecules | CD115; colony stimulating factor 1 receptor (macrophage) | Others | Others | 3lcd | |||||||||||||||||||||
| 3ld4 | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3ld4 | |||||||||||||||||||||
| 3le6 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3le6 | |||||||||||||||||||||
| 3lfa | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3lfa | |||||||||||||||||||||
| 3lfs | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3lfs | |||||||||||||||||||||
| 3lka | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3lka | |||||||||||||||||||||
| 3lkh | POLG_HCVJ4 | O92972 | KO_id not found | Others | Others | Others | Others | Others | 3lkh | |||||||||||||||||||||
| 3lmp | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3lmp | |||||||||||||||||||||
| 3ln0 | PGH2_MOUSE | Q05769 | K11987 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 3ln0 | |||||||||||||||||||||
| 3lq5 | CDK9_HUMAN | P50750 | K02211 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3lq5 | |||||||||||||||||||||
| 3lt4 | Q9BJJ9_PLAFA | Q9BJJ9 | KO_id not found | Others | Others | Others | Others | Others | 3lt4 | |||||||||||||||||||||
| 3lu8 | ALBU_HUMAN | P02768 | KO_id not found | Others | Others | Others | Others | Others | 3lu8 | |||||||||||||||||||||
| 3lxe | CAH1_HUMAN | P00915 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3lxe | |||||||||||||||||||||
| 3lxg | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3lxg | |||||||||||||||||||||
| 3m14 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m14 | |||||||||||||||||||||
| 3m2p | Q814Z6_BACCR | Q814Z6 | KO_id not found | Others | Others | Others | Others | Others | 3m2p | |||||||||||||||||||||
| 3m2w | MAPK2_HUMAN | P49137 | K04443 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3m2w | |||||||||||||||||||||
| 3m37 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 3m37 | |||||||||||||||||||||
| 3m3l | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3m3l | |||||||||||||||||||||
| 3m42 | MAPK2_HUMAN | P49137 | K04443 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3m42 | |||||||||||||||||||||
| 3m67 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m67 | |||||||||||||||||||||
| 3m7u | PRLA_LYSEN | P00778 | KO_id not found | Others | Others | Others | Others | Others | 3m7u | |||||||||||||||||||||
| 3m8q | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3m8q | |||||||||||||||||||||
| 3m96 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m96 | |||||||||||||||||||||
| 3m98 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m98 | |||||||||||||||||||||
| 3ma6 | Q9BJF5_TOXGO | Q9BJF5 | KO_id not found | Others | Others | Others | Others | Others | 3ma6 | |||||||||||||||||||||
| 3mc5 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3mc5 | |||||||||||||||||||||
| 3mcv | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 3mcv | |||||||||||||||||||||
| 3mdy | BMR1B_HUMAN | O00238 | K13578 | Cellular antigens | CD (clusters of differentiation) molecules | CDw293; bone morphogenetic protein receptor, type IB | Others | Others | 3mdy | |||||||||||||||||||||
| 3mee | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3mee | |||||||||||||||||||||
| 3mhc | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3mhc | |||||||||||||||||||||
| 3mhj | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3mhj | |||||||||||||||||||||
| 3mhk | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3mhk | |||||||||||||||||||||
| 3ml5 | CAH7_HUMAN | P43166 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3ml5 | |||||||||||||||||||||
| 3ml8 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ml8 | |||||||||||||||||||||
| 3mla | NADD_BACAC | C3L5T6 | K00969 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Nicotinate-nucleotide adenylyltransferase | 3mla | |||||||||||||||||||||
| 3mpt | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3mpt | |||||||||||||||||||||
| 3mqe | PGH2_MOUSE | Q05769 | K11987 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 3mqe | |||||||||||||||||||||
| 3mtf | ACVR1_HUMAN | Q04771 | K04675 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | ACVR1; activin receptor type-1 | Others | 3mtf | |||||||||||||||||||||
| 3mtl | CDK16_HUMAN | Q00536 | K08820 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3mtl | |||||||||||||||||||||
| 3my0 | ACVL1_HUMAN | P37023 | K13594 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | ACVRL1; activin receptor-like kinase 1 | Others | 3my0 | |||||||||||||||||||||
| 3my5 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3my5 | |||||||||||||||||||||
| 3myk | MYS2_DICDI | P08799 | K10352 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actin-binding proteins | Myosins | 3myk | |||||||||||||||||||||
| 3myq | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3myq | |||||||||||||||||||||
| 3mz6 | HDAC8_HUMAN | Q9BY41 | K11405 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Histone deacetylase | 3mz6 | |||||||||||||||||||||
| 3mzs | CP11A_BOVIN | P00189 | K00498 | Cytochrome P450 | Cytochrome P450, animal type | CYP11 family | CYP11A subfamily | Cholesterol side-chain cleavage enzyme | 3mzs | 9913 | ||||||||||||||||||||
| 3n2u | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3n2u | |||||||||||||||||||||
| 3n8y | PGH1_SHEEP | P05979 | K00509 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 3n8y | |||||||||||||||||||||
| 3n9y | CP11A_HUMAN | P05108 | K00498 | Cytochrome P450 | Cytochrome P450, animal type | CYP11 family | CYP11A subfamily | Cholesterol side-chain cleavage enzyme | 3n9y | 9606 | ||||||||||||||||||||
| 3na1 | CP11A_HUMAN | P05108 | K00498 | Cytochrome P450 | Cytochrome P450, animal type | CYP11 family | CYP11A subfamily | CYP11A; cytochrome P450, family 11, subfamily A (cholesterol monooxygenase (side-chain-cleaving)) | 3na1 | |||||||||||||||||||||
| 3nbp | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3nbp | |||||||||||||||||||||
| 3ncg | A3FQ16_CRYPI | A3FQ16 | K13412 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ncg | |||||||||||||||||||||
| 3nef | PYL1_ARATH | Q8VZS8 | KO_id not found | Others | Others | Others | Others | Others | 3nef | |||||||||||||||||||||
| 3nf6 | Q76353_9HIV1 | Q76353 | KO_id not found | Others | Others | Others | Others | Others | 3nf6 | |||||||||||||||||||||
| 3ni5 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3ni5 | |||||||||||||||||||||
| 3nj8 | Q6UCJ9_TOXGO | Q6UCJ9 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 3nj8 | |||||||||||||||||||||
| 3njo | PYR1_ARATH | O49686 | K11540 | Enzymes | Transferases | Transferring one-carbon groups | Carboxy- and carbamoyltransferases | Aspartate carbamoyltransferase | 3njo | |||||||||||||||||||||
| 3nmh | PYL2_ARATH | O80992 | KO_id not found | Others | Others | Others | Others | Others | 3nmh | |||||||||||||||||||||
| 3nmn | PYL1_ARATH | Q8VZS8 | KO_id not found | Others | Others | Others | Others | Others | 3nmn | |||||||||||||||||||||
| 3ns2 | PYL2_ARATH | O80992 | KO_id not found | Others | Others | Others | Others | Others | 3ns2 | |||||||||||||||||||||
| 3ns9 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3ns9 | |||||||||||||||||||||
| 3ny6 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ny6 | |||||||||||||||||||||
| 3nzi | HTRA1_HUMAN | Q92743 | K08784 | Chaperones and folding catalysts | Other chaperones and cochaperones | DegP - HtrA | HTRA1, PRSS11; HtrA serine peptidase 1 Cytoplasm | Others | 3nzi | |||||||||||||||||||||
| 3o23 | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 3o23 | |||||||||||||||||||||
| 3o3j | DEF1B_ARATH | Q9FUZ2 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3o3j | |||||||||||||||||||||
| 3o57 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3o57 | |||||||||||||||||||||
| 3o9g | Q90K99_9HIV1 | Q90K99 | KO_id not found | Others | Others | Others | Others | Others | 3o9g | |||||||||||||||||||||
| 3oaw | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3oaw | |||||||||||||||||||||
| 3og7 | Q5IBP5_HUMAN | Q5IBP5 | KO_id not found | Others | Others | Others | Others | Others | 3og7 | |||||||||||||||||||||
| 3ohl | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 3ohl | |||||||||||||||||||||
| 3oho | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 3oho | |||||||||||||||||||||
| 3oik | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oik | |||||||||||||||||||||
| 3oil | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oil | |||||||||||||||||||||
| 3oim | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oim | |||||||||||||||||||||
| 3oku | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oku | |||||||||||||||||||||
| 3okv | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3okv | |||||||||||||||||||||
| 3oll | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 3oll | |||||||||||||||||||||
| 3omo | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 3omo | |||||||||||||||||||||
| 3omp | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 3omp | |||||||||||||||||||||
| 3oom | ACVR1_HUMAN | Q04771 | K04675 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | ACVR1; activin receptor type-1 | Others | 3oom | |||||||||||||||||||||
| 3oq1 | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3oq1 | |||||||||||||||||||||
| 3osa | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3osa | |||||||||||||||||||||
| 3osh | PA2A3_NAJSG | P60045 | KO_id not found | Others | Others | Others | Others | Others | 3osh | |||||||||||||||||||||
| 3osi | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3osi | |||||||||||||||||||||
| 3osw | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3osw | |||||||||||||||||||||
| 3ov4 | SDIS_COMTE | P00947 | KO_id not found | Others | Others | Others | Others | Others | 3ov4 | |||||||||||||||||||||
| 3ovv | KAPCA_HUMAN | P17612 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 3ovv | |||||||||||||||||||||
| 3owk | Q5U5J2_HUMAN | Q5U5J2 | KO_id not found | Others | Others | Others | Others | Others | 3owk | |||||||||||||||||||||
| 3ox1 | NQO2_HUMAN | P16083 | K08071 | Enzymes | Oxidoreductases | Acting on diphenols and related substances as donors | With other acceptors | Ribosyldihydronicotinamide dehydrogenase (quinone) | 3ox1 | |||||||||||||||||||||
| 3ox3 | NQO2_HUMAN | P16083 | K08071 | Enzymes | Oxidoreductases | Acting on diphenols and related substances as donors | With other acceptors | Ribosyldihydronicotinamide dehydrogenase (quinone) | 3ox3 | |||||||||||||||||||||
| 3ozv | HMP_CUPNH | P39662 | K05916 | Enzymes | Oxidoreductases | Acting on paired donors, with O2 as oxidant and incorporation or reduction of oxygen. The oxygen incorporated need not be derived from O2 | With NADH or NADPH as one donor, and incorporation of two atoms of oxygen into the other donor | Nitric oxide dioxygenase | 3ozv | |||||||||||||||||||||
| 3p17 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3p17 | |||||||||||||||||||||
| 3p1f | CBP_HUMAN | Q92793 | K04498 | Chromosome | Eukaryotic Type | Histone modification proteins | HATs (histone acetyltransferases) | EP300, CREBBP, KAT3; E1A-CREB-binding protein | 3p1f | |||||||||||||||||||||
| 3p25 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3p25 | |||||||||||||||||||||
| 3p2v | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3p2v | |||||||||||||||||||||
| 3p4v | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3p4v | |||||||||||||||||||||
| 3p86 | CTR1_ARATH | Q05609 | K14510 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3p86 | |||||||||||||||||||||
| 3pb7 | QPCTL_HUMAN | Q9NXS2 | KO_id not found | Others | Others | Others | Others | Others | 3pb7 | |||||||||||||||||||||
| 3pbb | QPCT_HUMAN | Q16769 | K00683 | Enzymes | Transferases | Acyltransferases | Aminoacyltransferases | Glutaminyl-peptide cyclotransferase | 3pbb | |||||||||||||||||||||
| 3pcu | RXRA_HUMAN | P19793 | K08524 | Nuclear receptors | Hepatocyte nuclear factor 4 like | B. Retinoid X receptor (RXR) | NR2B1, RXRA; retinoid X receptor alpha | Others | 3pcu | |||||||||||||||||||||
| 3pd5 | SYT_PYRAB | Q9UZ14 | K01868 | Enzymes | Ligases | Forming carbon-oxygen bonds | Ligases forming aminoacyl-tRNA and related compounds | Threonine---tRNA ligase | 3pd5 | |||||||||||||||||||||
| 3pej | Q8I0V4_PLAF7 | Q8I0V4 | KO_id not found | Others | Others | Others | Others | Others | 3pej | |||||||||||||||||||||
| 3pfb | D3YEX6_LACJH | D3YEX6 | KO_id not found | Others | Others | Others | Others | Others | 3pfb | |||||||||||||||||||||
| 3pg3 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3pg3 | |||||||||||||||||||||
| 3pj8 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3pj8 | |||||||||||||||||||||
| 3pkg | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3pkg | |||||||||||||||||||||
| 3plr | C4XAX5_KLEPN | C4XAX5 | K00012 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | UDP-glucose 6-dehydrogenase | 3plr | |||||||||||||||||||||
| 3po6 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3po6 | |||||||||||||||||||||
| 3po7 | AOFB_HUMAN | P27338 | K00274 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With oxygen as acceptor | Monoamine oxidase | 3po7 | |||||||||||||||||||||
| 3poo | KAPCA_HUMAN | P17612 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 3poo | |||||||||||||||||||||
| 3ppm | FAAH1_RAT | P97612 | K15528 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Fatty acid amide hydrolase | 3ppm | |||||||||||||||||||||
| 3pre | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3pre | |||||||||||||||||||||
| 3prz | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3prz | |||||||||||||||||||||
| 3ps6 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ps6 | |||||||||||||||||||||
| 3pvu | ARBK1_BOVIN | P21146 | K00910 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Beta-adrenergic-receptor kinase | 3pvu | |||||||||||||||||||||
| 3pvw | ARBK1_BOVIN | P21146 | K00910 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Beta-adrenergic-receptor kinase | 3pvw | |||||||||||||||||||||
| 3q2f | BAZ2B_HUMAN | Q9UIF8 | KO_id not found | Others | Others | Others | Others | Others | 3q2f | |||||||||||||||||||||
| 3q2m | O06916_LEGPN | O06916 | KO_id not found | Others | Others | Others | Others | Others | 3q2m | |||||||||||||||||||||
| 3q3s | ETHR_MYCTU | P96222 | KO_id not found | Others | Others | Others | Others | Others | 3q3s | |||||||||||||||||||||
| 3q4t | AVR2A_HUMAN | P27037 | K04670 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Receptor protein serine-threonine kinase | 3q4t | |||||||||||||||||||||
| 3q6w | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3q6w | |||||||||||||||||||||
| 3q77 | ELNE_HUMAN | P08246 | K01327 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | ELANE; leukocyte elastase Protection from inactivation by serpins | Others | Others | 3q77 | |||||||||||||||||||||
| 3qar | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3qar | |||||||||||||||||||||
| 3qcx | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3qcx | |||||||||||||||||||||
| 3qfv | Q86XZ8_HUMAN | Q86XZ8 | K16307 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3qfv | |||||||||||||||||||||
| 3qfx | DRTS_TRYBB | Q27783 | KO_id not found | Others | Others | Others | Others | Others | 3qfx | |||||||||||||||||||||
| 3qiz | BXA1_CLOBH | A5HZZ9 | K06011 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Bontoxilysin | 3qiz | |||||||||||||||||||||
| 3qj9 | FAAH1_RAT | P97612 | K15528 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Fatty acid amide hydrolase | 3qj9 | |||||||||||||||||||||
| 3qjz | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3qjz | |||||||||||||||||||||
| 3qk0 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3qk0 | |||||||||||||||||||||
| 3qpn | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3qpn | |||||||||||||||||||||
| 3qqp | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3qqp | |||||||||||||||||||||
| 3qqu | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 3qqu | |||||||||||||||||||||
| 3qsa | TRPD_MYCTU | P66992 | K00766 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Anthranilate phosphoribosyltransferase | 3qsa | |||||||||||||||||||||
| 3qti | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3qti | |||||||||||||||||||||
| 3qud | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3qud | |||||||||||||||||||||
| 3qui | HFQ_PSEAE | Q9HUM0 | KO_id not found | Others | Others | Others | Others | Others | 3qui | |||||||||||||||||||||
| 3qwc | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3qwc | |||||||||||||||||||||
| 3qwj | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qwj | |||||||||||||||||||||
| 3qx4 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qx4 | |||||||||||||||||||||
| 3qx5 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3qx5 | |||||||||||||||||||||
| 3qzh | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzh | |||||||||||||||||||||
| 3qzi | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzi | |||||||||||||||||||||
| 3r0w | Q000H7_9HIV1 | Q000H7 | KO_id not found | Others | Others | Others | Others | Others | 3r0w | |||||||||||||||||||||
| 3r0y | Q000H7_9HIV1 | Q000H7 | KO_id not found | Others | Others | Others | Others | Others | 3r0y | |||||||||||||||||||||
| 3r1q | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r1q | |||||||||||||||||||||
| 3r1s | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r1s | |||||||||||||||||||||
| 3r1y | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r1y | |||||||||||||||||||||
| 3r21 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3r21 | |||||||||||||||||||||
| 3r22 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3r22 | |||||||||||||||||||||
| 3r28 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r28 | |||||||||||||||||||||
| 3r43 | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3r43 | |||||||||||||||||||||
| 3r58 | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3r58 | |||||||||||||||||||||
| 3r5m | RXRA_HUMAN | P19793 | K08524 | Nuclear receptors | Hepatocyte nuclear factor 4 like | B. Retinoid X receptor (RXR) | NR2B1, RXRA; retinoid X receptor alpha | Others | 3r5m | |||||||||||||||||||||
| 3r6i | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3r6i | |||||||||||||||||||||
| 3r71 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r71 | |||||||||||||||||||||
| 3r73 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r73 | |||||||||||||||||||||
| 3r7o | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3r7o | |||||||||||||||||||||
| 3r7r | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3r7r | |||||||||||||||||||||
| 3r7v | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r7v | |||||||||||||||||||||
| 3r7y | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r7y | |||||||||||||||||||||
| 3r8l | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r8l | |||||||||||||||||||||
| 3r8p | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r8p | |||||||||||||||||||||
| 3rdp | KITH_HHV11 | P03176 | K00857 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Thymidine kinase | 3rdp | |||||||||||||||||||||
| 3rga | LSD19_STRLS | B6ZK72 | KO_id not found | Others | Others | Others | Others | Others | 3rga | |||||||||||||||||||||
| 3rgz | BRI1_ARATH | O22476 | K13415 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 3rgz | |||||||||||||||||||||
| 3rhx | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 3rhx | |||||||||||||||||||||
| 3ri1 | FGFR2_HUMAN | P21802 | K05093 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR2; fibroblast growth factor receptor 2 Mitogenesis | Others | Others | 3ri1 | |||||||||||||||||||||
| 3rin | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3rin | |||||||||||||||||||||
| 3rlj | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 3rlj | |||||||||||||||||||||
| 3rll | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 3rll | |||||||||||||||||||||
| 3rm7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3rm7 | |||||||||||||||||||||
| 3rmm | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3rmm | |||||||||||||||||||||
| 3rmn | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3rmn | |||||||||||||||||||||
| 3roe | NNRE_MOUSE | Q8K4Z3 | KO_id not found | Others | Others | Others | Others | Others | 3roe | |||||||||||||||||||||
| 3roy | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3roy | |||||||||||||||||||||
| 3rtn | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3rtn | |||||||||||||||||||||
| 3rtu | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3rtu | |||||||||||||||||||||
| 3rz3 | UB2R1_HUMAN | P49427 | K02207 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Ubiquitin---protein ligase | 3rz3 | |||||||||||||||||||||
| 3s2a | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3s2a | |||||||||||||||||||||
| 3s3g | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3s3g | |||||||||||||||||||||
| 3s3i | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3s3i | |||||||||||||||||||||
| 3s71 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s71 | |||||||||||||||||||||
| 3s72 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s72 | |||||||||||||||||||||
| 3s73 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s73 | |||||||||||||||||||||
| 3s74 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s74 | |||||||||||||||||||||
| 3s76 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s76 | |||||||||||||||||||||
| 3s9t | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s9t | |||||||||||||||||||||
| 3sax | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3sax | |||||||||||||||||||||
| 3say | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3say | |||||||||||||||||||||
| 3sc1 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3sc1 | |||||||||||||||||||||
| 3sd0 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3sd0 | |||||||||||||||||||||
| 3sha | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3sha | |||||||||||||||||||||
| 3shc | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3shc | |||||||||||||||||||||
| 3shz | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3shz | |||||||||||||||||||||
| 3si3 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3si3 | |||||||||||||||||||||
| 3si4 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3si4 | |||||||||||||||||||||
| 3sie | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3sie | |||||||||||||||||||||
| 3sl8 | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3sl8 | |||||||||||||||||||||
| 3smi | PAR14_HUMAN | Q460N5 | K15261 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3smi | |||||||||||||||||||||
| 3smj | PAR14_HUMAN | Q460N5 | K15261 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3smj | |||||||||||||||||||||
| 3sn7 | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3sn7 | |||||||||||||||||||||
| 3sni | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3sni | |||||||||||||||||||||
| 3srb | PVDQ_PSEAE | Q9I194 | K07116 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Acyl-homoserine-lactone acylase | 3srb | |||||||||||||||||||||
| 3sw4 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3sw4 | |||||||||||||||||||||
| 3sw7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3sw7 | |||||||||||||||||||||
| 3sxs | BMX_HUMAN | P51813 | K08896 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3sxs | |||||||||||||||||||||
| 3t03 | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3t03 | |||||||||||||||||||||
| 3t4l | AHK4_ARATH | Q9C5U0 | K14489 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3t4l | |||||||||||||||||||||
| 3t4s | AHK4_ARATH | Q9C5U0 | K14489 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-histidine kinases | Histidine kinase | 3t4s | |||||||||||||||||||||
| 3t80 | ISPF_SALTY | Q8ZMF7 | K01770 | Enzymes | Lyases | Phosphorus-oxygen lyases | Phosphorus-oxygen lyases (only sub-subclass identified to date) | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | 3t80 | |||||||||||||||||||||
| 3t94 | MTAP_SULSO | Q97W94 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 3t94 | |||||||||||||||||||||
| 3t9i | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3t9i | |||||||||||||||||||||
| 3t9v | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3t9v | |||||||||||||||||||||
| 3tfq | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3tfq | |||||||||||||||||||||
| 3tge | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3tge | |||||||||||||||||||||
| 3thr | GNMT_RAT | P13255 | K00552 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Glycine N-methyltransferase | 3thr | |||||||||||||||||||||
| 3tiz | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3tiz | |||||||||||||||||||||
| 3tk6 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 3tk6 | |||||||||||||||||||||
| 3tnw | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3tnw | |||||||||||||||||||||
| 3ts4 | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3ts4 | |||||||||||||||||||||
| 3tt4 | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 3tt4 | |||||||||||||||||||||
| 3tvw | ACAC_YEAST | Q00955 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 3tvw | |||||||||||||||||||||
| 3ty0 | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3ty0 | |||||||||||||||||||||
| 3tzm | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 3tzm | |||||||||||||||||||||
| 3u2o | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3u2o | |||||||||||||||||||||
| 3u6h | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3u6h | |||||||||||||||||||||
| 3ua9 | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3ua9 | |||||||||||||||||||||
| 3ugr | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3ugr | |||||||||||||||||||||
| 3uh2 | TNKS1_HUMAN | O95271 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3uh2 | |||||||||||||||||||||
| 3uhm | LPXC_PSEAE | P47205 | K02535 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | UDP-3-O-acyl-N-acetylglucosamine deacetylase | 3uhm | |||||||||||||||||||||
| 3ui7 | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3ui7 | |||||||||||||||||||||
| 3uu7 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3uu7 | |||||||||||||||||||||
| 3uua | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3uua | |||||||||||||||||||||
| 3uuc | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3uuc | |||||||||||||||||||||
| 3uud | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3uud | |||||||||||||||||||||
| 3uuo | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3uuo | |||||||||||||||||||||
| 3v9b | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3v9b | |||||||||||||||||||||
| 3vbd | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3vbd | |||||||||||||||||||||
| 3vc4 | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3vc4 | |||||||||||||||||||||
| 3vf9 | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3vf9 | |||||||||||||||||||||
| 3vi8 | PPARA_HUMAN | Q07869 | K07294 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C1, PPARA; peroxisome proliferator-activated receptor alpha | Others | 3vi8 | |||||||||||||||||||||
| 3vid | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3vid | |||||||||||||||||||||
| 3vjh | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3vjh | |||||||||||||||||||||
| 3vji | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3vji | |||||||||||||||||||||
| 3vnt | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3vnt | |||||||||||||||||||||
| 3zr7 | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 3zr7 | |||||||||||||||||||||
| 3zra | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 3zra | |||||||||||||||||||||
| 3zrl | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3zrl | |||||||||||||||||||||
| 3zrm | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3zrm | |||||||||||||||||||||
| 3zsh | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3zsh | |||||||||||||||||||||
| 3zsi | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3zsi | |||||||||||||||||||||
| 3ztx | AUKBA_XENLA | Q6DE08 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ztx | |||||||||||||||||||||
| 3zws | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3zws | |||||||||||||||||||||
| 3zya | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3zya | |||||||||||||||||||||
| 3zze | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3zze | |||||||||||||||||||||
| 4a2j | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 4a2j | |||||||||||||||||||||
| 4a30 | Q4Q5S8_LEIMA | Q4Q5S8 | K00671 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Glycylpeptide N-tetradecanoyltransferase | 4a30 | |||||||||||||||||||||
| 4a79 | AOFB_HUMAN | P27338 | K00274 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With oxygen as acceptor | Monoamine oxidase | 4a79 | |||||||||||||||||||||
| 4a95 | A5K1A2_PLAVS | A5K1A2 | K00671 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Glycylpeptide N-tetradecanoyltransferase | 4a95 | |||||||||||||||||||||
| 4a9y | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 4a9y | |||||||||||||||||||||
| 4aa0 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 4aa0 | |||||||||||||||||||||
| 4aa4 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 4aa4 | |||||||||||||||||||||
| 4acm | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 4acm | |||||||||||||||||||||
| 4ael | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 4ael | |||||||||||||||||||||
| 4af3 | AURKB_HUMAN | Q96GD4 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4af3 | |||||||||||||||||||||
| 4afj | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 4afj | |||||||||||||||||||||
| 4aid | PNP_CAUCR | Q9AC32 | K00962 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Polyribonucleotide nucleotidyltransferase | 4aid | |||||||||||||||||||||
| 4aj1 | LDHA_RAT | P04642 | K00016 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | L-lactate dehydrogenase | 4aj1 | |||||||||||||||||||||
| 4ajw | PK3CD_MOUSE | O35904 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4ajw | |||||||||||||||||||||
| 4anv | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4anv | |||||||||||||||||||||
| 4anw | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4anw | |||||||||||||||||||||
| 4anx | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4anx | |||||||||||||||||||||
| 4at3 | NTRK2_HUMAN | Q16620 | K04360 | Cytokine receptors | Receptor tyrosine kinase | RTK class VII (TRK receptor family) | NTRK2, TRKB; neurotrophic tyrosine kinase receptor type 2 | Others | 4at3 | |||||||||||||||||||||
| 4at4 | NTRK2_HUMAN | Q16620 | K04360 | Cytokine receptors | Receptor tyrosine kinase | RTK class VII (TRK receptor family) | NTRK2, TRKB; neurotrophic tyrosine kinase receptor type 2 | Others | 4at4 | |||||||||||||||||||||
| 4aw5 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 4aw5 | |||||||||||||||||||||
| 4dbs | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 4dbs | |||||||||||||||||||||
| 4dch | HXK4_HUMAN | P35557 | K12407 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Glucokinase | 4dch | |||||||||||||||||||||
| 4deg | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 4deg | |||||||||||||||||||||
| 4deh | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 4deh | |||||||||||||||||||||
| 4dfn | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4dfn | |||||||||||||||||||||
| 4dhf | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4dhf | |||||||||||||||||||||
| 4dma | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 4dma | |||||||||||||||||||||
| 4drk | FKBP5_HUMAN | Q13451 | K09571 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 4drk | |||||||||||||||||||||
| 4dro | FKBP5_HUMAN | Q13451 | K09571 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 4dro | |||||||||||||||||||||
| 4dz2 | Q3JK38_BURP1 | Q3JK38 | K01802 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 4dz2 | |||||||||||||||||||||
| 4e3f | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 4e3f | |||||||||||||||||||||
| 4e93 | FES_HUMAN | P07332 | K07527 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4e93 | |||||||||||||||||||||
| 4ebw | FAK1_HUMAN | Q05397 | K05725 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4ebw | |||||||||||||||||||||
| 4efs | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 4efs | |||||||||||||||||||||
| 4ei4 | JAK1_HUMAN | P23458 | K11217 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4ei4 | |||||||||||||||||||||
| 4emd | B1MKD5_MYCA9 | B1MKD5 | K00919 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase | 4emd | |||||||||||||||||||||
| 4erk | MK01_RAT | P63086 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 4erk | |||||||||||||||||||||
| 4ez3 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 4ez3 | |||||||||||||||||||||
| 4f4s | ATP9_YEAST | P61829 | K02128 | Enzymes | Hydrolases | Acting on acid anhydrides | Acting on acid anhydrides to catalyse transmembrane movement of substances | H+-transporting two-sector ATPase | 4f4s | |||||||||||||||||||||
| 4f63 | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 4f63 | |||||||||||||||||||||
| 4f65 | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 4f65 | |||||||||||||||||||||
| 4fai | Q86PD7_DROME | Q86PD7 | K00683 | Enzymes | Transferases | Acyltransferases | Aminoacyltransferases | Glutaminyl-peptide cyclotransferase | 4fai | |||||||||||||||||||||
| 4fev | B0VD92_ACIBY | B0VD92 | K00897 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Kanamycin kinase | 4fev | |||||||||||||||||||||
| 4few | B0VD92_ACIBY | B0VD92 | K00897 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Kanamycin kinase | 4few | |||||||||||||||||||||
| 4fhd | A4IQU1_GEOTN | A4IQU1 | K03716 | Enzymes | Lyases | Carbon-carbon lyases | Other carbon-carbon lyases | Spore photoproduct lyase | 4fhd | |||||||||||||||||||||
| 4fhj | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4fhj | |||||||||||||||||||||
| 4fny | ALK_HUMAN | Q9UM73 | K05119 | Cellular antigens | CD (clusters of differentiation) molecules | CD246; anaplastic lymphoma kinase | Others | Others | 4fny | |||||||||||||||||||||
| 4foc | ALK_HUMAN | Q9UM73 | K05119 | Cellular antigens | CD (clusters of differentiation) molecules | CD246; anaplastic lymphoma kinase | Others | Others | 4foc | |||||||||||||||||||||
| 4fsm | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsm | |||||||||||||||||||||
| 4fsq | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsq | |||||||||||||||||||||
| 4fsw | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsw | |||||||||||||||||||||
| 4ft3 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ft3 | |||||||||||||||||||||
| 4ft7 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ft7 | |||||||||||||||||||||
| 4ft9 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ft9 | |||||||||||||||||||||
| 4fta | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fta | |||||||||||||||||||||
| 4fti | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fti | |||||||||||||||||||||
| 4ftj | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftj | |||||||||||||||||||||
| 4ftk | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftk | |||||||||||||||||||||
| 4ftl | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftl | |||||||||||||||||||||
| 4ftm | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftm | |||||||||||||||||||||
| 4ftn | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftn | |||||||||||||||||||||
| 4ftt | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftt | |||||||||||||||||||||
| 4ftu | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftu | |||||||||||||||||||||
| 4g55 | CLH1_HUMAN | Q00610 | K08099 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Chlorophyllase | 4g55 |