pharmacophore.Pharma-ID | pharmacophore/metadata/Gene-Name | pharmacophore/metadata/Uniprot-AC | pharmacophore/metadata/Kegg-Identifier | pharmacophore/metadata/Target-Class | pharmacophore/metadata/Target-Class-A | pharmacophore/metadata/Target-Class-B | pharmacophore/metadata/Target-Class-C | pharmacophore/metadata/Target-Class-D | pharmacophore/metadata/pdb.complex_id | pharmacophore/metadata/Taxonomic-ID | pharmacophore.name | pharmacophore.selectivity_index | pharmacophore/metadata/drug-classification | pharmacophore/metadata/target | pharmacophore/metadata/target-subclass | pharmacophore/metadata/target-family | pharmacophore/metadata/target-acronym | pharmacophore/metadata/therapeutic-classification | pharmacophore/metadata/mode-of-action | pharmacophore/metadata/pdb.ligand_id | pharmacophore/metadata/pdb.resolution | pharmacophore/actives/molecule.name | pharmacophore/actives/molecule.smiles | pharmacophore/actives/molecule.registry | pharmacophore/actives/molecule.regtype | pharmacophore/bibliography/reference.title | pharmacophore/bibliography/reference.author | pharmacophore/bibliography/reference.source | pharmacophore/bibliography/reference.year | pharmacophore/bibliography/reference.doi |
1a42 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1a42 | |||||||||||||||||||||
1afq | CTRA_BOVIN | P00766 | KO_id not found | Others | Others | Others | Others | Others | 1afq | |||||||||||||||||||||
1agw | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 1agw | |||||||||||||||||||||
1ah3 | ALDR_PIG | P80276 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 1ah3 | |||||||||||||||||||||
1aqb | RET4_PIG | P27485 | KO_id not found | Others | Others | Others | Others | Others | 1aqb | |||||||||||||||||||||
1b3d | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1b3d | |||||||||||||||||||||
1bmk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1bmk | |||||||||||||||||||||
1byg | CSK_HUMAN | P41240 | K05728 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1byg | |||||||||||||||||||||
1bzs | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 1bzs | |||||||||||||||||||||
1c1c | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1c1c | |||||||||||||||||||||
1cg6 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1cg6 | |||||||||||||||||||||
1coy | CHOD_BREST | P22637 | K10078 (inferred by homologyHUMAN) | Glycan Binding Proteins | C-Type lectin | Group 8 Layilin and related receptors | CHODL; chondrolectin | Cholesterol oxidase | 1coy | 1702 | ||||||||||||||||||||
1crb | RET1_RAT | P02696 | KO_id not found | Others | Others | Others | Others | Others | 1crb | |||||||||||||||||||||
1d2s | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1d2s | |||||||||||||||||||||
1d3d | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1d3d | |||||||||||||||||||||
1d7o | FABI_BRANA | P80030 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 1d7o | |||||||||||||||||||||
1d7u | DGDA_BURCE | P16932 | KO_id not found | Enzymes | 4. Lyases | decarboxylases | DGD (bacterial) | Others | 1d7u | |||||||||||||||||||||
1d7x | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 1d7x | |||||||||||||||||||||
1dht | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1dht | |||||||||||||||||||||
1di8 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1di8 | |||||||||||||||||||||
1di9 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1di9 | |||||||||||||||||||||
1e3k | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 1e3k | |||||||||||||||||||||
1e3v | SDIS_PSEPU | P07445 | KO_id not found | Enzymes | 5. Isomerases | steroid delta-isomerases | KSI (bacterial) | Others | 1e3v | |||||||||||||||||||||
Enzymes | 1e9h | 1e9h-inr-2.5-h-1-s | 929 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | inr | 2.50 | 244021-67-8 | OS(=O)(=O)c1ccc2NC(=O)/C(=C/3\Nc4ccccc4C3=O)/c2c1 | 244021-67-8 | CAS | Inhibitor binding to active and inactive CDK2: the crystal structure of CDK2-cyclin A/indirubin-5-sulphonate | Davies TG, Tunnah P, Meijer L, Marko D, Eisenbrand G, Endicott JA, Noble ME | Structure (Camb) 9(5):389-97 | 2001 | 10.1016/S0969-2126(01)00598-6 | |||||||||
Enzymes | 1e9h | 1e9h-inr-2.50-h-1-s | 1.50037 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | inr | 2.50 | 478283-10-2 | [C=1C=CC2=C(C1)C(=O)\C(=C\3/C=4C=C(C=CC4NC3=O)S(=O)(=O)O)\N2] | 478283-10-2 | CAS | Inhibitor binding to active and inactive CDK2: the crystal structure of CDK2-cyclin A/indirubin-5-sulphonate. | Davies TG, Tunnah P, Meijer L, Marko D, Eisenbrand G, Endicott JA, Noble ME. | Structure 9(5):389-97 | 2001 | 10.1016/S0969-2126(01)00598-6 | |||||||||
Enzymes | 1e9h | 1e9h-inr-2.50-h-1 | 10.07159 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
inhibition (enzyme); competitive | inr | 2.50 | 478283-10-2 | [C=1C=CC2=C(C1)C(=O)\C(=C\3/C=4C=C(C=CC4NC3=O)S(=O)(=O)O)\N2] | 478283-10-2 | CAS | Inhibitor binding to active and inactive CDK2: the crystal structure of CDK2-cyclin A/indirubin-5-sulphonate. | Davies TG, Tunnah P, Meijer L, Marko D, Eisenbrand G, Endicott JA, Noble ME. | Structure 9(5):389-97 | 2001 | 10.1016/S0969-2126(01)00598-6 | |||||||||
1efy | PARP1_CHICK | P26446 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 1efy | |||||||||||||||||||||
1erb | RET4_BOVIN | P18902 | KO_id not found | Others | Others | Others | Others | Others | 1erb | |||||||||||||||||||||
1f4e | TYSY_ECOLI | P0A884 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 1f4e | |||||||||||||||||||||
1fgi | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 1fgi | |||||||||||||||||||||
Enzymes | 1fk9 | 1fk9-efz-2.50-d-1-s | 194 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 2.50 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural basis for the resilience of efavirenz (DMP-266) to drug resistance mutations in HIV-1 reverse transcriptase | Ren J, Milton J, Weaver KL, Short SA, Stuart DI, Stammers DK | Structure Fold Des 8(10):1089-94 | 2000 | 10.1016/S0969-2126(00)00513-X | |||||||||
Enzymes | 1fk9 | 1fk9-efz-2.50-d-1 | 1314 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 2.50 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural basis for the resilience of efavirenz (DMP-266) to drug resistance mutations in HIV-1 reverse transcriptase | Ren J, Milton J, Weaver KL, Short SA, Stuart DI, Stammers DK | Structure Fold Des 8(10):1089-94 | 2000 | 10.1016/S0969-2126(00)00513-X | |||||||||
1fk9 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1fk9 | |||||||||||||||||||||
1fkh | FKB1A_HUMAN | P62942 | K09568 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 1fkh | |||||||||||||||||||||
Enzymes | 1fko | 1fko-efz-2.90-d-1-s | 201 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 2.90 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural basis for the resilience of efavirenz (DMP-266) to drug resistance mutations in HIV-1 reverse transcriptase | Ren J, Milton J, Weaver KL, Short SA, Stuart DI, Stammers DK | Structure Fold Des 8(10):1089-94 | 2000 | 10.1016/S0969-2126(00)00513-X | |||||||||
Enzymes | 1fko | 1fko-efz-2.90-d-1 | 1425 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 2.90 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural basis for the resilience of efavirenz (DMP-266) to drug resistance mutations in HIV-1 reverse transcriptase | Ren J, Milton J, Weaver KL, Short SA, Stuart DI, Stammers DK | Structure Fold Des 8(10):1089-94 | 2000 | 10.1016/S0969-2126(00)00513-X | |||||||||
1fm7 | CFI1_MEDSA | P28012 | K01859 | Enzymes | Isomerases | Intramolecular lyases | Intramolecular lyases (only sub-subclass identified to date) | Chalcone isomerase | 1fm7 | |||||||||||||||||||||
1fvv | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1fvv | |||||||||||||||||||||
1gg5 | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1gg5 | |||||||||||||||||||||
1gii | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1gii | |||||||||||||||||||||
1gx8 | LACB_BOVIN | P02754 | KO_id not found | Others | Others | Others | Others | Others | 1gx8 | |||||||||||||||||||||
1h69 | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1h69 | |||||||||||||||||||||
Transport proteins | 1h9z | 1h9z-rwf-2.50-h-1 | 13576 | immunologic | Serum albumin | extracellular proteins | serum proteins | HSA | inflammation | Serum albumin, the main protein of plasma, has a good binding capacity for water, Ca(2+), Na(+), K(+), fatty acids, hormones, bilirubin and drugs. Its main function is the regulation of the colloidal osmotic pressure of blood. | rwf | 2.50 | (S)-Warfarin | CC(=O)C[C@H](c1ccccc1)c2c(O)c3ccccc3oc2=O | 5543-57-7 | CAS | Crystal structure analysis of warfarin binding to human serum albumin: anatomy of drug site I | Petitpas I, Bhattacharya AA, Twine S, East M, Curry S | J Biol Chem 276(25):22804-9 | 2001 | 10.1074/jbc.M100575200 | |||||||||
Transport proteins | 1ha2 | 1ha2-swf-2.50-h-1 | 12247 | immunologic | Serum albumin | extracellular proteins | serum proteins | HSA | inflammation | Serum albumin, the main protein of plasma, has a good binding capacity for water, Ca(2+), Na(+), K(+), fatty acids, hormones, bilirubin and drugs. Its main function is the regulation of the colloidal osmotic pressure of blood. | swf | 2.50 | (R)-Warfarin | CC(=O)C[C@@H](c1ccccc1)c2c(O)c3ccccc3oc2=O | 5543-58-8 | CAS | Crystal structure analysis of warfarin binding to human serum albumin: anatomy of drug site I | Petitpas I, Bhattacharya AA, Twine S, East M, Curry S | J Biol Chem 276(25):22804-9 | 2001 | 10.1074/jbc.M100575200 | |||||||||
1he3 | BLVRB_HUMAN | P30043 | K05901 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Biliverdin reductase | 1he3 | |||||||||||||||||||||
Enzymes | 1hnv | 1hnv-tbo-3.00-d-1-s | 2541 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
tbo | 3.00 | tivirapine | C[C@H]1Cn2c(=S)[nH]c3ccc(Cl)c(CN1CC=C(C)C)c23 | 137332-54-8 | cas | Structure of HIV-1 reverse transcriptase in a complex with the non-nucleoside inhibitor alpha-APA R 95845 at 2.8 A resolution | Ding J, Das K, Tantillo C, Zhang W, Clark AD Jr, Jessen S, Lu X, Hsiou Y, Jacobo-Molina A, Andries K, et al. | Structure 3(4):365-79 | 1995 | 10.1016/S0969-2126(01)00168-X | |||||||||
1hpz | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1hpz | |||||||||||||||||||||
Structuring proteins | 1hrv | 1hrv-sdz-3.00-d-2-s | 598 | antiinfective | HRV coat protein | Cellular level | viral coat proteins | VP1-4 (HRV) | common cold | inhibition of viral entry into host cell and/or uncoating occupation of a hydrophobic pocket and consequent stabilisation of viral capsid |
sdz | 3.00 | INT-SDZ 35-682-art-1-d | O[C@H](COc1ccc(cc1)C2CCCCC2)CN3CCN(CC3)c4ccccn4 | INT-SDZ 35-682-art-1-d | INT | SDZ 35-682, a new picornavirus capsid-binding agent with potent antiviral activity | Rosenwirth B, Oren DA, Arnold E, Kis ZL, Eggers HJ | Antiviral Res 26(1):65-82 | 1995 | 10.1016/0166-3542(94)00066-H | |||||||||
1hzx | OPSD_BOVIN | P02699 | K04250 | G protein-coupled receptors | Class A. Rhodopsin family | Vision | Opsin | RHO, OPN2; rhodopsin | 1hzx | |||||||||||||||||||||
Enzymes | 1i2z | 1i2z-654-2.80-d-1-s | 2.03430276 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (e.coli) | bacterial infection | inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
654 | 2.80 | 310465-11-3 | Cc3ccc(Cn2cnc(c1cccs1)c2)cc3 | 310465-11-3 | cas | 1,4-Disubstituted imidazoles are potential antibacterial agents functioning as inhibitors of enoyl acyl carrier protein reductase (FabI) | Heerding DA, Chan G, DeWolf WE, Fosberry AP, Janson CA, Jaworski DD, McManus E, Miller WH, Moore TD, Payne DJ, Qiu X, Rittenhouse SF, Slater-Radosti C, Smith W, Takata DT, Vaidya KS, Yuan CC, Huffman WF | Bioorg Med Chem Lett 11(16):2061-5 | 2001 | 10.1016/S0960-894X(01)00404-8 | |||||||||
1i38 | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1i38 | |||||||||||||||||||||
1i7i | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 1i7i | |||||||||||||||||||||
1i8z | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1i8z | |||||||||||||||||||||
1i90 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1i90 | |||||||||||||||||||||
1if9 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1if9 | |||||||||||||||||||||
1iiu | RET4_CHICK | P41263 | KO_id not found | Others | Others | Others | Others | Others | 1iiu | |||||||||||||||||||||
1ij8 | AVID_CHICK | P02701 | KO_id not found | Others | Others | Others | Others | Others | 1ij8 | |||||||||||||||||||||
Enzymes | 1ikv | 1ikv-efz-3.00-d-1-s | 1202 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 3.00 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural basis for the inhibitory efficacy of efavirenz (DMP-266), MSC194 and PNU142721 towards the HIV-1 RT K103N mutant | Lindberg J, Sigurdsson S, Lowgren S, Andersson HO, Sahlberg C, Noreen R, Fridborg K, Zhang H, Unge T | Eur J Biochem 269(6):1670-7 | 2002 | 10.1046/j.1432-1327.2002.02811.x | |||||||||
Enzymes | 1ikw | 1ikw-efz-3.00-d-1-s | 1148 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 3.00 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural basis for the inhibitory efficacy of efavirenz (DMP-266), MSC194 and PNU142721 towards the HIV-1 RT K103N mutant | Lindberg J, Sigurdsson S, Lowgren S, Andersson HO, Sahlberg C, Noreen R, Fridborg K, Zhang H, Unge T | Eur J Biochem 269(6):1670-7 | 2002 | 10.1046/j.1432-1327.2002.02811.x | |||||||||
1iky | POL_HV1B1 | P03366 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1iky | |||||||||||||||||||||
1iqh | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1iqh | |||||||||||||||||||||
1iqj | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1iqj | |||||||||||||||||||||
1j4i | FKB1A_HUMAN | P62942 | K09568 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 1j4i | |||||||||||||||||||||
1jg0 | TYSY_ECOLI | P0A884 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 1jg0 | |||||||||||||||||||||
1jiz | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 1jiz | |||||||||||||||||||||
Enzymes | 1jkh | 1jkh-efz-2.50-d-1-s | 192 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 2.50 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural mechanisms of drug resistance for mutations at codons 181 and 188 in HIV-1 reverse transcriptase and the improved resilience of second generation non-nucleoside inhibitors | Ren J, Nichols C, Bird L, Chamberlain P, Weaver K, Short S, Stuart DI, Stammers DK | J Mol Biol 312(4):795-805 | 2001 | 10.1006/jmbi.2001.4988 | |||||||||
Enzymes | 1jkh | 1jkh-efz-2.50-d-1 | 1360 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
efz | 2.50 | efavirenz | FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc21)C#CC3CC3 | 154598-52-4 | cas | Structural mechanisms of drug resistance for mutations at codons 181 and 188 in HIV-1 reverse transcriptase and the improved resilience of second generation non-nucleoside inhibitors | Ren J, Nichols C, Bird L, Chamberlain P, Weaver K, Short S, Stuart DI, Stammers DK | J Mol Biol 312(4):795-805 | 2001 | 10.1006/jmbi.2001.4988 | |||||||||
1jla | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1jla | |||||||||||||||||||||
Enzymes | 1jlq | 1jlq-sbn-3.00-d-1-s | 1274 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
sbn | 3.00 | 739W94 | Cc1cc(C)cc(c1)S(=O)(=O)c2cccc(N)c2C#N | 171102-55-9 | cas | 2-Amino-6-arylsulfonylbenzonitriles as non-nucleoside reverse transcriptase inhibitors of HIV-1 | Chan JH, Hong JS, Hunter RN 3rd, Orr GF, Cowan JR, Sherman DB, Sparks SM, Reitter BE, Andrews CW 3rd, Hazen RJ, St Clair M, Boone LR, Ferris RG, Creech KL, Roberts GB, Short SA, Weaver K, Ott RJ, Ren J, Hopkins A, Stuart DI, Stammers DK | J Med Chem 44(12):1866-82 | 2001 | 10.1021/jm0004906 | |||||||||
1jlq | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1jlq | |||||||||||||||||||||
1jtv | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1jtv | |||||||||||||||||||||
1kbq | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 1kbq | |||||||||||||||||||||
1kgj | TTHY_RAT | P02767 | KO_id not found | Others | Others | Others | Others | Others | 1kgj | |||||||||||||||||||||
1klm | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 1klm | |||||||||||||||||||||
1kqw | Q8UVG6_DANRE | Q8UVG6 | KO_id not found | Others | Others | Others | Others | Others | 1kqw | |||||||||||||||||||||
1kt6 | RET4_BOVIN | P18902 | KO_id not found | Others | Others | Others | Others | Others | 1kt6 | |||||||||||||||||||||
1l2s | AMPC_ECOLI | P00811 | K01467 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amides | Beta-lactamase | 1l2s | |||||||||||||||||||||
1lhv | SHBG_HUMAN | P04278 | KO_id not found | Others | Others | Others | Others | Others | 1lhv | |||||||||||||||||||||
1lkd | BPHC_BURXL | P47228 | K00462 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | Biphenyl-2,3-diol 1,2-dioxygenase | 1lkd | |||||||||||||||||||||
1lox | LOX15_RABIT | P12530 | K00460 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | Arachidonate 15-lipoxygenase | 1lox | |||||||||||||||||||||
Enzymes | 1lxc | 1lxc-aym-2.40-d-1-s | 1.70618941 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (e.coli) | bacterial infection | inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
aym | 2.40 | 335027-53-7 | CN(Cc2cc1ccccc1n2C)C(=O)C=Cc3ccc(N)nc3 | 335027-53-7 | cas | Discovery of aminopyridine-based inhibitors of bacterial enoyl-ACP reductase (FabI) | Miller WH, Seefeld MA, Newlander KA, Uzinskas IN, Burgess WJ, Heerding DA, Yuan CC, Head MS, Payne DJ, Rittenhouse SF, Moore TD, Pearson SC, Berry V, DeWolf WE Jr, Keller PM, Polizzi BJ, Qiu X, Janson CA, Huffman WF | J Med Chem 45(15):3246-56 | 2002 | 10.1021/jm020050+ | |||||||||
1m2r | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 1m2r | |||||||||||||||||||||
Enzymes | 1mfp | 1mfp-idn-2.33-d-1-s | 0.98881432 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (e.coli) | bacterial infection | inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
idn | 2.33 | 335029-32-8 | CN(Cc1cn(C)c2ccccc12)C(=O)C=Cc4c[nH]c3=NC(=O)CCc3c4 | 335029-32-8 | cas | Indole naphthyridinones as inhibitors of bacterial enoyl-ACP reductases FabI and FabK | Seefeld MA, Miller WH, Newlander KA, Burgess WJ, DeWolf WE Jr, Elkins PA, Head MS, Jakas DR, Janson CA, Keller PM, Manley PJ, Moore TD, Payne DJ, Pearson S, Polizzi BJ, Qiu X, Rittenhouse SF, Uzinskas IN, Wallis NG, Huffman WF | J Med Chem 46(9):1627-35 | 2003 | 10.1021/jm0204035 | |||||||||
1nfw | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1nfw | |||||||||||||||||||||
Enzymes | 1nfx | 1nfx-rdr-2.15-h-1 | 1481 | Cardiovascular disease | coagulation factor Xa Factor Xa Fxa activated coagulation factor X |
EC3.- (hydrolases) | proteases (serine) | FXa | cardiovascular diseases thrombosis |
no info | rdr | 2.15 | RPR 208944 | OCCn1c(CN2CCN(CC2=O)S(=O)(=O)c3cc4ccc(Cl)cc4s3)cc5cnccc15 | 234100-47-1 | CAS | Molecular structures of human factor Xa complexed with ketopiperazine inhibitors: preference for a neutral group in the S1 pocket | Maignan S, Guilloteau JP, Choi-Sledeski YM, Becker MR, Ewing WR, Pauls HW, Spada AP, Mikol V | J Med Chem 46(5):685-90. | 2003 | 10.1021/jm0203837 | |||||||||
1nfx | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1nfx | |||||||||||||||||||||
1nhg | Q9BH77_PLAFA | Q9BH77 | KO_id not found | Enzymes | 1. Oxidoreductases | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (P.falciparum) | Others | 1nhg | |||||||||||||||||||||
1nhw | Q9BH77_PLAFA | Q9BH77 | KO_id not found | Enzymes | 1. Oxidoreductases | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (P.falciparum) | Others | 1nhw | |||||||||||||||||||||
1nhz | GCR_HUMAN | P04150 | K05771 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C1, GR; glucocorticoid receptor | Others | 1nhz | |||||||||||||||||||||
1nlu | PICP_PSESR | P42790 | KO_id not found | Others | Others | Others | Others | Others | 1nlu | |||||||||||||||||||||
Enzymes | 1nnu | 1nnu-tct-2.50-d-1 | 0.36241611 | antiinfective | parasitic enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (P.falciparum) | malaria parasitic infection |
inhibition of final step in parasitic fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in parasites |
tct | 2.50 | 434320-70-4 | Oc3ccc2cc(Oc1cc(Cl)ccc1O)ccc2c3 | 434320-70-4 | cas | Structural elucidation of the specificity of the antibacterial agent triclosan for malarial enoyl acyl carrier protein reductase | Perozzo R, Kuo M, Sidhu AS, Valiyaveettil JT, Bittman R, Jacobs WR Jr, Fidock DA, Sacchettini JC | J Biol Chem 277(15):13106-14 | 2002 | 10.1074/jbc.M112000200 | |||||||||
1nup | NMNA3_HUMAN | Q96T66 | K06210 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Nicotinamide-nucleotide adenylyltransferase | 1nup | |||||||||||||||||||||
1nwk | ACTS_RABIT | P68135 | K10354 | Others | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actins | Actins | 1nwk | |||||||||||||||||||||
Receptors | 1nyx | 1nyx-drf-2.65-p-1-s | 1597 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | obesity | activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
drf | 2.65 | ragaglitazar | CCO[C@@H](Cc1ccc(OCCN2c3ccccc3Oc4ccccc24)cc1)C(=O)O | 222834-30-2 | CAS | Synthesis and biological and structural characterization of the dual-acting peroxisome proliferator-activated receptor alpha/gamma agonist ragaglitazar | Ebdrup S, Pettersson I, Rasmussen HB, Deussen HJ, Frost Jensen A, Mortensen SB, Fleckner J, Pridal L, Nygaard L, Sauerberg P | J. Med. Chem 46, 1306-1317 | 2003 | 10.1021/jm021027r | |||||||||
Receptors | 1nyx | 1nyx-drf-2.65-p-1 | 2109 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | obesity | activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
drf | 2.65 | ragaglitazar | CCO[C@@H](Cc1ccc(OCCN2c3ccccc3Oc4ccccc24)cc1)C(=O)O | 222834-30-2 | CAS | Synthesis and biological and structural characterization of the dual-acting peroxisome proliferator-activated receptor alpha/gamma agonist ragaglitazar | Ebdrup S, Pettersson I, Rasmussen HB, Deussen HJ, Frost Jensen A, Mortensen SB, Fleckner J, Pridal L, Nygaard L, Sauerberg P | J. Med. Chem 46, 1306-1317 | 2003 | 10.1021/jm021027r | |||||||||
1nyx | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 1nyx | |||||||||||||||||||||
Enzymes | 1ogx | 1ogx-equ-2.00-d-1-s | 1284 | antiinfective | bacterial steroid delta-isomerase | EC5.- (isomerases) | steroid delta-isomerases | KSI (bacterial) | fundamental research bacterial infection |
inhibition of bacterial steroid delta-isomerase prevention of cleavage and formation of a C-H bond for steroid substrates |
eqn | 2.00 | equilenin | C[C@@]12CCc3c(ccc4cc(O)ccc34)[C@@H]2CCC1=O | 517-09-9 | CAS | Detection of large pKa perturbations of an inhibitor and a catalytic group at an enzyme active site, a mechanistic basis for catalytic power of many enzymes | Ha NC, Kim MS, Lee W, Choi KY, Oh BH | J Biol Chem 275(52):41100-6 | 2000 | 10.1074/jbc.M007561200 | |||||||||
1opb | RET2_RAT | P06768 | KO_id not found | Others | Others | Others | Others | Others | 1opb | |||||||||||||||||||||
Receptors | 1osh | 1osh-fex-1.78-d-1 | 2.5891126 | metabolic, anti-target | farnesoid x receptor | Transduction factor receptors | nuclear hormone receptors | FXR | ADMET bile acid-induced hepatotoxicity |
Lowers bile-acid plasma levels via the repression of the transcription of the cholesterol 7-alpha-hydroxylase gene (P450 7A1) and the P450 8B gene via the inhibitory nuclear receptor SHP (inhibition of bile-acid biosynthesis from cholesterol) and activates the intestinal bile acid-binding protein (IBABP). | fex | 1.78 | fexaramine | CN(C)C1=CC=C(C=C1)C2=CC=C(C=C2)CN(C=3C=CC=C(C3)C=CC(=O)OC)C(=O)C4CCCCC4 | 574013-66-4 | cas | A chemical, genetic, and structural analysis of the nuclear bile acid receptor FXR | Downes M, Verdecia MA, Roecker AJ, Hughes R, Hogenesch JB, Kast-Woelbern HR, Bowman ME, Ferrer JL, Anisfeld AM, Edwards PA, Rosenfeld JM, Alvarez JG, Noel JP, Nicolaou KC, Evans RM | Mol Cell 11(4):1079-92 | 2003 | 10.1016/S1097-2765(03)00104-7 | |||||||||
1oum | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1oum | |||||||||||||||||||||
1ov6 | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1ov6 | |||||||||||||||||||||
1ovg | DEOD_ECOLI | P0ABP8 | K03784 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 1ovg | |||||||||||||||||||||
1oxl | PA2B8_DABRR | P59071 | KO_id not found | Others | Others | Others | Others | Others | 1oxl | |||||||||||||||||||||
1pxl | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1pxl | |||||||||||||||||||||
1pxx | PGH2_MOUSE | Q05769 | K11987 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 1pxx | |||||||||||||||||||||
1py5 | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 1py5 | |||||||||||||||||||||
Enzymes | 1pye | 1pye-pm1-2.00-h-1-s | 773 | oncolytic | cyclin-dependent kinase 2 CDK 2 cell division protein kinase 2 SIN3-associated protein SIN3 associated polypeptide p33 protein kinase |
EC2.- (transferases) | kinases (serine-threonine) | CDK2 | cancer cardiovascular diseases viral infection |
modulation of cell division, inhibition of signal transduction pathways | pm1 | 2.00 | 490038-61-4 | Nc1nc2ccc(cn2c1C(=O)c3ccccc3)C(=O)c4c(F)cccc4F | 490038-61-4 | CAS | The discovery of a new structural class of cyclin-dependent kinase inhibitors, aminoimidazo[1,2-a]pyridines | Hamdouchi C, Keyser H, Collins E, Jaramillo C, De Diego JE, Spencer CD, Dempsey JA, Anderson BD, Leggett T, Stamm NB, Schultz RM, Watkins SA, Cocke K, Lemke S, Burke TF, Beckmann RP, Dixon JT, Gurganus TM, Rankl NB, Houck KA, Zhang F, Vieth M, Espinosa J, Timm DE, Campbell RM, Patel BK, Brooks HB | Mol Cancer Ther 3(1):1-9 | 2004 | ||||||||||
1pye | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1pye | |||||||||||||||||||||
1pzo | BLAT_ECOLX | P62593 | KO_id not found | Others | Others | Others | Others | Others | 1pzo | |||||||||||||||||||||
1q23 | CAT_ECOLX | P62577 | KO_id not found | Others | Others | Others | Others | Others | 1q23 | |||||||||||||||||||||
1q3a | MMP10_HUMAN | P09238 | K01396 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 2 | 1q3a | |||||||||||||||||||||
1q3d | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 1q3d | |||||||||||||||||||||
1q41 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 1q41 | |||||||||||||||||||||
1qca | CAT3_ECOLX | P00484 | K03781 | Enzymes | Oxidoreductases | Acting on a peroxide as acceptor | Peroxidases | Catalase | 1qca | |||||||||||||||||||||
Enzymes | 1qcf | 1qcf-pp1-2.00-h-1-s | 1349 | oncolytic | hck | EC2.- (transferases) | kinases (tyrosine) | Hck | cancer | no info | pp1 | 2.00 | 0 | Cc1ccc(cc1)[C@H]2NN(c3ncnc(N)c23)C(C)(C)C | 0 | CAS | Crystal structure of Hck in complex with a Src family-selective tyrosine kinase inhibitor | Schindler T, Sicheri F, Pico A, Gazit A, Levitzki A, Kuriyan J | Mol Cell 3(5):639-48 | 1999 | 10.1016/S1097-2765(00)80357-3 | |||||||||
1qpe | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 1qpe | |||||||||||||||||||||
1qy8 | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 1qy8 | |||||||||||||||||||||
1qyx | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 1qyx | |||||||||||||||||||||
1r20 | Q7SIF6_HELVI | Q7SIF6 | KO_id not found | Others | Others | Others | Others | Others | 1r20 | |||||||||||||||||||||
Enzymes | 1r9o | 1r9o-flp-2.00-x-2-s | 2042 | metabolism | cytochrome P450 2C9 | EC1.- (oxydo-reductases) | monooxygenases | CYP 2C9 | ADMET | ligand is a substrate of P450 2C9; drug-drug interactions possible | flp | 2.00 | flurbiprofen | CC(C(=O)O)c1ccc(c(F)c1)c2ccccc2 | 5104-49-4 | cas | The structure of human cytochrome P450 2C9 complexed with flurbiprofen at 2.0-A resolution | Wester MR, Yano JK, Schoch GA, Yang C, Griffin KJ, Stout CD, Johnson EF | J Biol Chem 279(34):35630-7 | 2004 | 10.1074/jbc.M405427200 | |||||||||
Enzymes | 1r9o | 1r9o-flp-2.00-x-2 | 22264 | metabolism | cytochrome P450 2C9 | EC1.- (oxydo-reductases) | monooxygenases | CYP 2C9 | ADMET | ligand is a substrate of P450 2C9; drug-drug interactions possible | flp | 2.00 | flurbiprofen | CC(C(=O)O)c1ccc(c(F)c1)c2ccccc2 | 5104-49-4 | cas | The structure of human cytochrome P450 2C9 complexed with flurbiprofen at 2.0-A resolution | Wester MR, Yano JK, Schoch GA, Yang C, Griffin KJ, Stout CD, Johnson EF | J Biol Chem 279(34):35630-7 | 2004 | 10.1074/jbc.M405427200 | |||||||||
Transport proteins | 1rbp | 1rbp-rtl-2.00-d-1-s | 1124 | other class technologic |
retinol binding protein | extracellular proteins | serum proteins | RBP | ADMET fundamental research |
binding and transport of small ligand compounds with appropriate features | rtl | 2.00 | retinol | C/C(=C\CO)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C | 68-26-8 | cas | Crystallographic refinement of human serum retinol binding protein at 2A resolution | Cowan SW, Newcomer ME, Jones TA | Proteins 8(1):44-61 | 1990 | - | |||||||||
1rev | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rev | |||||||||||||||||||||
Enzymes | 1rkp | 1rkp-ibm-2.05-x-1-s | 3.818046234 | cardiovascular | phosphodiesterase 5A | EC3.- (hydrolases) | phosphodiesterases | PDE 5A | cardiovascular diseases | inhibition of cGMP degradation | ibm | 2.05 | 3-isobutyl-1-methylxanthine | CC(C)CN1C2=C(C(=O)N(C1=O)C)N=CN2 | 28822-58-4 | CAS | Crystal structures of phosphodiesterases 4 and 5 in complex with inhibitor 3-isobutyl-1-methylxanthine suggest a conformation determinant of inhibitor selectivity | Huai Q, Liu Y, Francis SH, Corbin JD, Ke H | J Biol Chem 279(13):13095-101 | 2004 | 10.1074/jbc.M311556200 | |||||||||
1rq9 | Q5RTL1_9HIV1 | Q5RTL1 | KO_id not found | Others | Others | Others | Others | Others | 1rq9 | |||||||||||||||||||||
Enzymes | 1rt1 | 1rt1-mkc-2.55-d-1-s | 1042 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
mkc | 2.55 | emivirine | CCOCn1c(Cc2ccccc2)c(C(C)C)c(=O)[nH]c1=O | 149950-60-7 | cas | Complexes of HIV-1 reverse transcriptase with inhibitors of the HEPT series reveal conformational changes relevant to the design of potent non-nucleoside inhibitors | Hopkins AL, Ren J, Esnouf RM, Willcox BE, Jones EY, Ross C, Miyasaka T, Walker RT, Tanaka H, Stammers DK, Stuart DI | J Med Chem 39(8):1589-600 | 1996 | 10.1021/jm960056x | |||||||||
1rt1 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rt1 | |||||||||||||||||||||
1rt5 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rt5 | |||||||||||||||||||||
1rt6 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rt6 | |||||||||||||||||||||
1rt7 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1rt7 | |||||||||||||||||||||
Enzymes | 1rth | 1rth-u05-2.20-d-1-s | 1871 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
u05 | 2.20 | 1051U91 | CCN1c2ncccc2C(=O)N(C)c3ccc(nc13)N(=O)=O | 163046-77-3 | cas | High resolution structures of HIV-1 RT from four RT-inhibitor complexes | Ren J, Esnouf R, Garman E, Somers D, Ross C, Kirby I, Keeling J, Darby G, Jones Y, Stuart D, et al. | Nat Struct Biol 2(4):293-302 | 1995 | 10.1038/nsb0495-293 | |||||||||
1rw8 | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 1rw8 | |||||||||||||||||||||
1ry0 | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 1ry0 | |||||||||||||||||||||
1s1t | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1s1t | |||||||||||||||||||||
Enzymes | 1s2c | 1s2c-flf-1.80-x-2-s | 2059 | endocrine | 17beta-hydroxysteroid dehydrogenase type 5 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 17beta-HSD 5 | contraception (male) cancer |
17beta-HSD 5 is a labile enzyme that catalyzes the transformation of 4-androstene-3, 17-dione into testosterone (like 17beta-HSD 3) and also exerts high 20alpha-dihydroprogesterone activity thereby inactivating progesterone. | flf | 1.80 | flufenamic acid | OC(=O)c1ccccc1Nc2cccc(c2)C(F)(F)F | 530-78-9 | cas | Crystal structure of human prostaglandin F synthase (AKR1C3) | Komoto J, Yamada T, Watanabe K, Takusagawa F | Biochemistry 43(8):2188-98 | 2004 | 10.1021/bi036046x | |||||||||
1s2c | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 1s2c | |||||||||||||||||||||
1s64 | FNTA_RAT | Q04631 | K05955 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Protein farnesyltransferase | 1s64 | |||||||||||||||||||||
1s9d | ARF1_BOVIN | P84080 | K07937 | GTP-binding proteins | Small (Monomeric) G-proteins | Arf-Sar Family | Arf-Arl1 | ARF1; ADP-ribosylation factor 1 | 1s9d | |||||||||||||||||||||
1sbr | YKOF_BACSU | O34911 | KO_id not found | Others | Others | Others | Others | Others | 1sbr | |||||||||||||||||||||
1sd2 | MTAP_HUMAN | Q13126 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 1sd2 | |||||||||||||||||||||
1sjw | Q9RN59_STRNO | Q9RN59 | KO_id not found | Others | Others | Others | Others | Others | 1sjw | |||||||||||||||||||||
Enzymes | 1so2 | 1so2-666-2.40-p-2-s | 1.04847129008203 | metabolic | phosphodiesterase 3B cGMP-inhibited PDE |
EC3.- (hydrolases) | phosphodiesterases | PDE 3B | obesity | development of leptin resistence, inhibition of glycogenolysis, regulator of glucose-mediated insulin release | 666 | 2.40 | Merck1 | C[C@@H]1CC(=O)NN=C1C2=CC=C(C=C2)NC3=C(C(=O)CCC3)CC=4C=CC=C(C4)I | 544985-13-7 | CAS | Crystal structure of human phosphodiesterase 3B: atomic basis for substrate and inhibitor specificity | Scapin G, Patel SB, Chung C, Varnerin JP, Edmondson SD, Mastracchio A, Parmee ER, Singh SB, Becker JW, Van der Ploeg LH, Tota MR | Biochemistry 43(20):6091-100 | 2004 | 10.1021/bi049868i | |||||||||
1so2 | PDE3B_HUMAN | Q13370 | K13296 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1so2 | |||||||||||||||||||||
1sqn | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 1sqn | |||||||||||||||||||||
1srg | SAV_STRAV | P22629 | KO_id not found | Other proteins | Bacterial proteins | binding proteins | streptavidin | Others | 1srg | 1895 | ||||||||||||||||||||
Other proteins | 1sri | 1sri-dmb-1.65-d-1-s | 899 | antiinfective | streptavidin | Bacterial proteins | binding proteins | streptavidin | fundamental research | stabilisation of streptavidin tool for universal test systems in immunology and molecular diagnostics system for analysis of intermolecular interactions of the tight binding of the small molecule ligand biotin to the protein |
dmb | 1.65 | 78733-42-3 | Cc1cc(cc(C)c1O)N=Nc2ccccc2C(O)=O | 78733-42-3 | CAS | Structure-Based Design of Synthetic Azobenzene Ligands for Streptavidin | Weber PC, Pantoliano MW, Simons DM, Salemme FR | J.Am.Chem.Soc v116 pp.2717 | 1994 | 10.1021/ja00086a004 | |||||||||
Enzymes | 1sv5 | 1sv5-65b-2.90-d-1 | 1177 | antiinfective | HIV-1 reverse transcriptase | EC2.- (transferases) | reverse transcriptases | RT (HIV-1) | HIV infection | inhibition of reverse transcription of viral RNA to DNA prevention of integration of viral genetic information into host cell genome |
65b | 2.90 | etravirine | Cc1cc(C#N)cc(C)c1Oc2nc(Nc3ccc(C#N)cc3)nc(N)c2Br | 269055-15-4 | cas | Roles of conformational and positional adaptability in structure-based design of TMC125-R165335 (etravirine) and related non-nucleoside reverse transcriptase inhibitors that are highly potent and effective against wild-type and drug-resistant HIV-1 variants | Das K, Clark AD Jr, Lewi PJ, Heeres J, De Jonge MR, Koymans LM, Vinkers HM, Daeyaert F, Ludovici DW, Kukla MJ, De Corte B, Kavash RW, Ho CY, Ye H, Lichtenstein MA, Andries K, Pauwels R, De Bethune MP, Boyer PL, Clark P, Hughes SH, Janssen PA, Arnold E | J Med Chem 47(10):2550-60 | 2004 | 10.1021/jm030558s | |||||||||
1szm | KAPCA_BOVIN | P00517 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 1szm | |||||||||||||||||||||
1t2w | Q9S446_STAAU | Q9S446 | KO_id not found | Others | Others | Others | Others | Others | 1t2w | |||||||||||||||||||||
1t47 | HPPD_STRAW | Q53586 | K00457 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | 4-hydroxyphenylpyruvate dioxygenase | 1t47 | |||||||||||||||||||||
1t4j | PTN1_HUMAN | P18031 | K05696 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-monoester hydrolases | Protein-tyrosine-phosphatase | 1t4j | |||||||||||||||||||||
1t64 | HDAC8_HUMAN | Q9BY41 | K11405 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Histone deacetylase | 1t64 | |||||||||||||||||||||
1ta2 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1ta2 | |||||||||||||||||||||
1tbb | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1tbb | |||||||||||||||||||||
1tbf | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 1tbf | |||||||||||||||||||||
1tkt | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tkt | |||||||||||||||||||||
1tkx | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tkx | |||||||||||||||||||||
1tkz | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tkz | |||||||||||||||||||||
1tl1 | POL_HV1H2 | P04585 | KO_id not found | Enzymes | 2. Transferases | reverse transcriptases | RT (HIV-1) | Others | 1tl1 | |||||||||||||||||||||
1tou | FABP4_HUMAN | P15090 | KO_id not found | Others | Others | Others | Others | Others | 1tou | |||||||||||||||||||||
1tz8 | TTHY_HUMAN | P02766 | KO_id not found | Others | Others | Others | Others | Others | 1tz8 | |||||||||||||||||||||
1u3r | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 1u3r | |||||||||||||||||||||
1u59 | ZAP70_HUMAN | P43403 | K07360 | Cellular antigens | Non-CD molecules | ZAP70; zeta-chain (TCR) associated protein kinase 70kDa | Others | Others | 1u59 | |||||||||||||||||||||
Enzymes | 1udu | 1udu-cia-2.80-x-1-s | 1.285607755 | cardiovascular | phosphodiesterase 5A | EC3.- (hydrolases) | phosphodiesterases | PDE 5A | cardiovascular diseases | inhibition of cGMP degradation | cia | 2.80 | tadalafil | CN1CC(=O)N2[C@@H](C1=O)CC=3C4=CC=CC=C4NC3[C@H]2C5=CC=C6C(=C5)OCO6 | 171596-29-5 | CAS | Structure of the catalytic domain of human phosphodiesterase 5 with bound drug molecules | Sung BJ, Hwang KY, Jeon YH, Lee JI, Heo YS, Kim JH, Moon J, Yoon JM, Hyun YL, Kim E, Eum SJ, Park SY, Lee JO, Lee TG, Ro S, Cho JM | Nature 425(6953):98-102 | 2003 | 10.1038/nature01914 | |||||||||
Enzymes | 1uh5 | 1uh5-tcl-2.20-d-1 | 2.20432513 | antiinfective | parasitic enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (P.falciparum) | malaria parasitic infection |
inhibition of final step in parasitic fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in parasites |
tcl | 2.20 | triclosan | Oc1cc(Cl)ccc1Oc2ccc(Cl)cc2Cl | 3380-34-5 | cas | Structural Basis for the Variation in Triclosan Affinity to Enoyl Reductases | Swarnamukhi PL, Kapoor M, Surolia N, Surolia A, Suguna K | J Mol Biol 343, 147-155 | 2004 | 10.1016/j.jmb.2004.08.033 | |||||||||
1uho | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 1uho | |||||||||||||||||||||
1unh | CDK5_HUMAN | Q00535 | K02090 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1unh | |||||||||||||||||||||
1uu3 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1uu3 | |||||||||||||||||||||
1uu7 | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 1uu7 | |||||||||||||||||||||
1uv5 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 1uv5 | |||||||||||||||||||||
1uyr | ACAC_YEAST | Q00955 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 1uyr | |||||||||||||||||||||
1uys | ACAC_YEAST | Q00955 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 1uys | |||||||||||||||||||||
1v3x | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 1v3x | |||||||||||||||||||||
1v79 | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1v79 | |||||||||||||||||||||
1vjy | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 1vjy | |||||||||||||||||||||
Structuring proteins | 1vrh | 1vrh-sd8-3.00-d-1 | 1995 | antiinfective | HRV coat protein | Cellular level | viral coat proteins | VP1-4 (HRV) | common cold | inhibition of viral entry into host cell and/or uncoating occupation of a hydrophobic pocket and consequent stabilisation of viral capsid |
sd8 | 3.00 | SDZ 880-061 | CCOC(=O)c1csc(n1)N2CCN(CC2)C3=Nc4ccccc4SC3 | 178433-80-2 | CAS | Synthesis and activity of piperazine-containing antirhinoviral agents and crystal structure of SDZ 880-061 bound to human rhinovirus 14 | Oren DA, Zhang A, Nesvadba H, Rosenwirth B, Arnold E | J Mol Biol 259(1):120-34 | 1996 | 10.1006/jmbi.1996.0307 | |||||||||
Enzymes | 1w0g | 1w0g-myt-2.74-x-1-s | 2311 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | myt | 2.74 | metyrapone | CC(C)(C(=O)c1cccnc1)c2cccnc2 | 54-36-4 | cas | Crystal structures of human cytochrome P450 3A4 bound to metyrapone and progesterone | Williams PA, Cosme J, Vinkovic DM, Ward A, Angove HC, Day PJ, Vonrhein C, Tickle IJ, Jhoti H | Science 305(5684):683-6 | 2004 | 10.1126/science.1099736 | |||||||||
Enzymes | 1w0g | 1w0g-myt-2.74-x-1 | 13889 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | myt | 2.74 | metyrapone | CC(C)(C(=O)c1cccnc1)c2cccnc2 | 54-36-4 | cas | Crystal structures of human cytochrome P450 3A4 bound to metyrapone and progesterone | Williams PA, Cosme J, Vinkovic DM, Ward A, Angove HC, Day PJ, Vonrhein C, Tickle IJ, Jhoti H | Science 305(5684):683-6 | 2004 | 10.1126/science.1099736 | |||||||||
1w0x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 1w0x | |||||||||||||||||||||
1wbv | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wbv | |||||||||||||||||||||
1wbw | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wbw | |||||||||||||||||||||
1wok | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 1wok | |||||||||||||||||||||
1wxy | ADA_BOVIN | P56658 | K01488 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In cyclic amidines | Adenosine deaminase | 1wxy | |||||||||||||||||||||
1wzy | MK01_HUMAN | P28482 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1wzy | |||||||||||||||||||||
1xbc | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 1xbc | |||||||||||||||||||||
1xdk | RXRA_MOUSE | P28700 | K08524 | Nuclear receptors | Hepatocyte nuclear factor 4 like | B. Retinoid X receptor (RXR) | NR2B1, RXRA; retinoid X receptor alpha | Others | 1xdk | |||||||||||||||||||||
Enzymes | 1xiv | 1xiv-rb2-1.70-d-1-s | 0.94556301 | antiinfective | plasmodium falciparum lactate dehydrogenase | EC1.- (oxydo-reductases) | lactate dehydrogenases | LDH (P.falciparum) | parasitic infection | inhibition of parasitic lactate dehydrogenase (glycolysis as energy source) | rb2 | 1.70 | 877066-60-9 | COC(=O)c1cc(Cl)ccc1NC(=O)C(=O)O | 877066-60-9 | cas | Mapping the binding site for gossypol-like inhibitors of Plasmodium falciparum lactate dehydrogenase | Conners R, Schambach F, Read J, Cameron A, Sessions RB, Vivas L, Easton A, Croft SL, Brady RL | Mol Biochem Parasitol 142(2):137-48 | 2005 | 10.1016/j.molbiopara.2005.03.015 | |||||||||
1xls | RXRA_HUMAN | P19793 | K08524 | Nuclear receptors | Hepatocyte nuclear factor 4 like | B. Retinoid X receptor (RXR) | NR2B1, RXRA; retinoid X receptor alpha | Others | 1xls | |||||||||||||||||||||
1xlx | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xlx | |||||||||||||||||||||
1xlz | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xlz | |||||||||||||||||||||
1xm4 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xm4 | |||||||||||||||||||||
1xm6 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xm6 | |||||||||||||||||||||
1xmu | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xmu | |||||||||||||||||||||
1xnn | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1xnn | |||||||||||||||||||||
1xom | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xom | |||||||||||||||||||||
1xoq | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1xoq | |||||||||||||||||||||
1xow | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 1xow | |||||||||||||||||||||
1xp0 | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 1xp0 | |||||||||||||||||||||
1y2e | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1y2e | |||||||||||||||||||||
1y2g | ZIPA_ECOLI | P77173 | KO_id not found | Others | Others | Others | Others | Others | 1y2g | |||||||||||||||||||||
1y2h | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1y2h | |||||||||||||||||||||
1y2k | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 1y2k | |||||||||||||||||||||
1y6a | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 1y6a | |||||||||||||||||||||
1y8j | NEP_HUMAN | P08473 | K01389 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neprilysin | 1y8j | |||||||||||||||||||||
1ygj | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1ygj | |||||||||||||||||||||
1ygk | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1ygk | |||||||||||||||||||||
1yhj | PDXK_SHEEP | P82197 | K00868 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pyridoxal kinase | 1yhj | |||||||||||||||||||||
1yrs | KIF11_HUMAN | P52732 | K10398 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulin-binding proteins | KIF11; kinesin family member 11 | 1yrs | |||||||||||||||||||||
Enzymes | 1yvf | 1yvf-ph7-2.50-d-1 | 2839 | antiinfective | RNA-dependent RNA polymerase (NS5B) from hepatitic C virus | EC2.- (transferases) | RNA polymerases | NS5B (HCV) | hepatitis C virus infection | inhibition of viral replication inhibition of transcription of viral genomic RNA and consequently of viral genome replication |
ph7 | 2.50 | PHA 729145 | OC(=O)\C(NC(=O)c1ccccc1)=C\c2ccc(Oc3ccccc3Br)cc2 | 639517-90-1 | CAS | Inhibitors of HCV NS5B polymerase: Part 1: Evaluation of the southern region of (2Z)-2-(benzoylamino)-3-(5-phenyl-2-furyl)acrylic acid | Pfefferkorn JA, Greene ML, Nugent RA, Gross RJ, Mitchell MA, Finzel BC, Harris MS, Wells PA., Shelly JA, Anstadt RA, Kilkuskie RE, Kopta LA, Schwende FJ | Bioorg.Med.Chem.Lett. v15 pp.2481-2486 | 2005 | 10.1016/j.bmcl.2005.03.066 | |||||||||
1yw7 | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 1yw7 | |||||||||||||||||||||
1yw8 | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 1yw8 | |||||||||||||||||||||
1yw9 | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 1yw9 | |||||||||||||||||||||
Enzymes | 1yxx | 1yxx-li7-2.00-h-1-s | 1676 | no info | pim1 proto oncogene kinase |
EC2.- (transferases) | kinases (serine-threonine) | Pim-1 | cancer | no info | li7 | 2.00 | 0 | Oc1[nH]c2ccccc2c1Nc3ccc(O)cc3 | 0 | CAS | Crystal structures of proto-oncogene kinase Pim1: a target of aberrant somatic hypermutations in diffuse large cell lymphoma | Kumar A, Mandiyan V, Suzuki Y, Zhang C, Rice J, Tsai J, Artis DR, Ibrahim P, Bremer R | J Mol Biol 348(1):183-93 | 2005 | 10.1016/j.jmb.2005.02.039 | |||||||||
1z89 | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 1z89 | |||||||||||||||||||||
1zdp | THER_BACTH | P00800 | KO_id not found | Others | Others | Others | Others | Others | 1zdp | |||||||||||||||||||||
1ze8 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 1ze8 | |||||||||||||||||||||
1zeo | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 1zeo | |||||||||||||||||||||
1zgi | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 1zgi | |||||||||||||||||||||
1zht | KES1_YEAST | P35844 | KO_id not found | Others | Others | Others | Others | Others | 1zht | |||||||||||||||||||||
1zhx | KES1_YEAST | P35844 | KO_id not found | Others | Others | Others | Others | Others | 1zhx | |||||||||||||||||||||
1zhz | KES1_YEAST | P35844 | KO_id not found | Others | Others | Others | Others | Others | 1zhz | |||||||||||||||||||||
1zkk | SETD8_HUMAN | Q9NQR1 | K11428 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Histone-lysine N-methyltransferase | 1zkk | |||||||||||||||||||||
Enzymes | 1zsn | 1zsn-tn2-2.99-d-1-s | 0.12378822 | antiinfective | parasitic enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (P.falciparum) | malaria parasitic infection |
inhibition of final step in parasitic fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in parasites |
tn2 | 2.99 | 36859-73-1 | O=N(=O)c2ccc(Oc1ccc(Cl)cc1O)c(Cl)c2 | 36859-73-1 | cas | Synthesis, biological activity, and X-ray crystal structural analysis of diaryl ether inhibitors of malarial enoyl acyl carrier protein reductase. Part 1: 4′-Substituted triclosan derivatives | Freundlich JS, Anderson JW, Sarantakis D, Shieh HM, Yu M, Valderramos JC, Lucumi E, Kuo M, Jacobs WR Jr, Fidock DA, Schiehser GA, Jacobus DP, Sacchettini JC | Bioorg Med Chem Lett 15(23):5247-52 | 2005 | 10.1016/j.bmcl.2005.08.044 | |||||||||
Enzymes | 1zsn | 1zsn-tn2-2.99-d-1 | 1.02609993 | antiinfective | parasitic enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (P.falciparum) | malaria parasitic infection |
inhibition of final step in parasitic fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in parasites |
tn2 | 2.99 | 36859-73-1 | O=N(=O)c2ccc(Oc1ccc(Cl)cc1O)c(Cl)c2 | 36859-73-1 | cas | Synthesis, biological activity, and X-ray crystal structural analysis of diaryl ether inhibitors of malarial enoyl acyl carrier protein reductase. Part 1: 4′-Substituted triclosan derivatives | Freundlich JS, Anderson JW, Sarantakis D, Shieh HM, Yu M, Valderramos JC, Lucumi E, Kuo M, Jacobs WR Jr, Fidock DA, Schiehser GA, Jacobus DP, Sacchettini JC | Bioorg Med Chem Lett 15(23):5247-52 | 2005 | 10.1016/j.bmcl.2005.08.044 | |||||||||
Enzymes | 1zw1 | 1zw1-tn5-2.90-d-1-s | 0.06263982 | antiinfective | parasitic enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (P.falciparum) | malaria parasitic infection |
inhibition of final step in parasitic fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in parasites |
tn5 | 2.90 | 871103-52-5 | Nc2ccc(Oc1ccc(Cl)cc1O)c(Cl)c2 | 871103-52-5 | cas | Synthesis, biological activity, and X-ray crystal structural analysis of diaryl ether inhibitors of malarial enoyl acyl carrier protein reductase. Part 1: 4′-Substituted triclosan derivatives | Freundlich JS, Anderson JW, Sarantakis D, Shieh HM, Yu M, Valderramos JC, Lucumi E, Kuo M, Jacobs WR Jr, Fidock DA, Schiehser GA, Jacobus DP, Sacchettini JC | Bioorg Med Chem Lett 15(23):5247-52 | 2005 | 10.1016/j.bmcl.2005.08.044 | |||||||||
Enzymes | 1zw1 | 1zw1-tn5-2.90-d-1 | 0.22371365 | antiinfective | parasitic enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (P.falciparum) | malaria parasitic infection |
inhibition of final step in parasitic fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in parasites |
tn5 | 2.90 | 871103-52-5 | Nc2ccc(Oc1ccc(Cl)cc1O)c(Cl)c2 | 871103-52-5 | cas | Synthesis, biological activity, and X-ray crystal structural analysis of diaryl ether inhibitors of malarial enoyl acyl carrier protein reductase. Part 1: 4′-Substituted triclosan derivatives | Freundlich JS, Anderson JW, Sarantakis D, Shieh HM, Yu M, Valderramos JC, Lucumi E, Kuo M, Jacobs WR Jr, Fidock DA, Schiehser GA, Jacobus DP, Sacchettini JC | Bioorg Med Chem Lett 15(23):5247-52 | 2005 | 10.1016/j.bmcl.2005.08.044 | |||||||||
1zyj | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1zyj | |||||||||||||||||||||
1zzl | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 1zzl | |||||||||||||||||||||
2aa6 | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 2aa6 | |||||||||||||||||||||
2ab2 | MCR_HUMAN | P08235 | K08555 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C2, MR; mineralocorticoid receptor | Others | 2ab2 | |||||||||||||||||||||
2ax6 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax6 | |||||||||||||||||||||
2ax8 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax8 | |||||||||||||||||||||
2ax9 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2ax9 | |||||||||||||||||||||
Enzymes | 2b36 | 2b36-5pp-2.80-d-1-s | 0.15063386 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (M.tuberculosis) | tuberculosis bacterial infection |
inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
5pp | 2.80 | 877206-68-3 | CCCCCc2ccc(Oc1ccccc1)c(O)c2 | 877206-68-3 | cas | High Affinity InhA Inhibitors with Activity against Drug-Resistant Strains of Mycobacterium tuberculosis | Sullivan TJ, Truglio JJ, Boyne ME, Novichenok P, Zhang X, Stratton C, Li HJ, Kaur T, Amin A, Johnson F, Slayden RA, Kisker C, Tonge PJ | ACS Chem Biol, 1, 43-53 | 2006 | 10.1021/cb0500042 | |||||||||
Enzymes | 2b36 | 2b36-5pp-2.80-d-1 | 0.64578673 | antiinfective | bacterial enoyl acyl carrier protein reductase | EC1.- (oxydo-reductases) | CH-CH NAD(P)+ oxidoreductases | enoyl-ACP reductase (M.tuberculosis) | tuberculosis bacterial infection |
inhibition of final step in bacterial fatty acid elongation in fatty acid synthesis type II pathway, FAS-II deprivation of critical metabolic precursors of biological membranes and important form of metabolic energy in bacteria |
5pp | 2.80 | 877206-68-3 | CCCCCc2ccc(Oc1ccccc1)c(O)c2 | 877206-68-3 | cas | High Affinity InhA Inhibitors with Activity against Drug-Resistant Strains of Mycobacterium tuberculosis | Sullivan TJ, Truglio JJ, Boyne ME, Novichenok P, Zhang X, Stratton C, Li HJ, Kaur T, Amin A, Johnson F, Slayden RA, Kisker C, Tonge PJ | ACS Chem Biol, 1, 43-53 | 2006 | 10.1021/cb0500042 | |||||||||
2b37 | INHA_MYCTU | P0A5Y6 | K05500 | Lipid biosynthesis proteins | TGF-beta family | Distant members | INHA; inhibin, alpha | Others | 2b37 | |||||||||||||||||||||
2bgd | PTN1_HUMAN | P18031 | K05696 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-monoester hydrolases | Protein-tyrosine-phosphatase | 2bgd | |||||||||||||||||||||
2bhe | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2bhe | |||||||||||||||||||||
2bik | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bik | |||||||||||||||||||||
2bmc | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bmc | |||||||||||||||||||||
2boh | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2boh | |||||||||||||||||||||
2br1 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2br1 | |||||||||||||||||||||
2brb | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brb | |||||||||||||||||||||
Enzymes | 2brh | 2brh-dfw-2.10-h-1-s | 1730 | no info | serin-threonin kinase | EC2.- (transferases) | kinases (serine-threonine) | Chk1 | cancer | no info | dfw | 2.10 | 701223-63-4 | OC(=O)CNc1ncnc2oc(c(c3ccccc3)c12)c4ccccc4 | 701223-63-4 | CAS | Structure-based design of novel Chk1 inhibitors: insights into hydrogen bonding and protein-ligand affinity | Foloppe N, Fisher LM, Howes R, Kierstan P, Potter A, Robertson AG, Surgenor AE | J Med Chem 48(13):4332-45 | 2005 | 10.1021/jm049022c | |||||||||
2brm | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2brm | |||||||||||||||||||||
2bro | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2bro | |||||||||||||||||||||
2bsx | Q8T9Z7_PLAFA | Q8T9Z7 | KO_id not found | Others | Others | Others | Others | Others | 2bsx | |||||||||||||||||||||
2btr | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2btr | |||||||||||||||||||||
2bu7 | PDK2_HUMAN | Q15119 | K00898 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2bu7 | |||||||||||||||||||||
2buj | STK16_HUMAN | O75716 | K08856 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2buj | |||||||||||||||||||||
2bxf | ALBU_HUMAN | P02768 | KO_id not found | Others | Others | Others | Others | Others | 2bxf | |||||||||||||||||||||
2c5n | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c5n | |||||||||||||||||||||
2c5x | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2c5x | |||||||||||||||||||||
2chw | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2chw | |||||||||||||||||||||
2chz | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2chz | |||||||||||||||||||||
2dq7 | FYN_HUMAN | P06241 | K05703 | CAM ligands | 1. Immunoglobulin Superfamily | Immune system | CD2 family | Tyrosine-protein kinase Fyn | 2dq7 | 9606 | ||||||||||||||||||||
2ds1 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2ds1 | |||||||||||||||||||||
2e9u | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2e9u | |||||||||||||||||||||
2e9v | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2e9v | |||||||||||||||||||||
2ea2 | AMPM2_HUMAN | P50579 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 2ea2 | |||||||||||||||||||||
2ei6 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2ei6 | |||||||||||||||||||||
2f1o | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 2f1o | |||||||||||||||||||||
2g97 | NAMPT_RAT | Q80Z29 | K03462 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Nicotinamide phosphoribosyltransferase | 2g97 | |||||||||||||||||||||
Receptors | 2gtk | 2gtk-208-2.10-p-1-s | 2.71140939597315 | metabolic | peroxisome proliferator-activated receptor gamma | Transduction factor receptors | nuclear hormone receptors | PPAR-gamma | obesity | activation of peroxisome proliferator-activated receptor gamma central regulator of adipocyte differentiation, fatty acid metabolism and glucose homeostasis; inhibition of inflammatory cytokines and other proteins |
208 | 2.10 | 671215-78-4 | CCO[C@@H](CC1=CC=C2C(=C1)C=CN2CC3=C(OC(=N3)C4=CC=CC=C4Cl)C)C(=O)O | 671215-78-4 | CAS | Structure-based design of indole propionic acids as novel PPARalpha/gamma co-agonists | Kuhn B, Hilpert H, Benz J, Binggeli A, Grether U, Humm R, Marki HP, Meyer M, Mohr P | Bioorg Med Chem Lett 16(15):4016-20 | 2006 | 10.1016/j.bmcl.2006.05.007 | |||||||||
2gvj | NAMPT_HUMAN | P43490 | K03462 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Nicotinamide phosphoribosyltransferase | 2gvj | |||||||||||||||||||||
2h2i | NPD_THEMA | Q9WYW0 | K12410 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | - | 2h2i | |||||||||||||||||||||
2hka | NPC2_BOVIN | P79345 | K13443 | Others | Cellular Processes | Transport and catabolism | Lysosome | NPC2; Niemann-Pick C2 protein | 2hka | |||||||||||||||||||||
2hkj | TOP6B_SULSH | O05207 | KO_id not found | Others | Others | Others | Others | Others | 2hkj | |||||||||||||||||||||
2hpy | OPSD_BOVIN | P02699 | K04250 | G protein-coupled receptors | Class A. Rhodopsin family | Vision | Opsin | RHO, OPN2; rhodopsin | 2hpy | |||||||||||||||||||||
2hvc | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2hvc | |||||||||||||||||||||
2hxq | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2hxq | |||||||||||||||||||||
2hy0 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2hy0 | |||||||||||||||||||||
2i1m | CSF1R_HUMAN | P07333 | K05090 | Cellular antigens | CD (clusters of differentiation) molecules | CD115; colony stimulating factor 1 receptor (macrophage) | Others | Others | 2i1m | |||||||||||||||||||||
2i80 | DDL_STAAC | Q5HEB7 | K01921 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | D-alanine---D-alanine ligase | 2i80 | |||||||||||||||||||||
2ic3 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2ic3 | |||||||||||||||||||||
2ilt | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 2ilt | |||||||||||||||||||||
2ipf | AK1CL_MOUSE | Q91WR5 | KO_id not found | Others | Others | Others | Others | Others | 2ipf | |||||||||||||||||||||
Enzymes | 2irw | 2irw-nn4-3.10-x-1-s | 0.721849366144 | endocrine, metabolic | 11beta-hydroxysteroid dehydrogenase type 1 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 11beta-HSD 1 | non-insulin dependent diabetes mellitus obesity neurodegenerative diseases cognitive defects (age- and dementia-associated) metabolic disorders |
inhibition of the conversion of inactive cortison into acitve cortisol | nn4 | 3.10 | 898264-92-1 | CC(C)(C(=O)NC1[C@H]2CC3C[C@@H]1CC(C3)(C2)C(=O)N)OC=4C=CC(=CC4)OC | 898264-92-1 | cas | Discovery of adamantane ethers as inhibitors of 11beta-HSD-1: Synthesis and biological evaluation | Patel JR, Shuai Q, Dinges J, Winn M, Pliushchev M, Fung S, Monzon K, Chiou W, Wang J, Pan L, Wagaw S, Engstrom K, Kerdesky FA, Longenecker K, Judge R, Qin W, Imade HM, Stolarik D, Beno DW, Brune M, Chovan LE, Sham HL, Jacobson P, Link JT | Bioorg Med Chem Lett 17(3):750-5 | 2007 | 10.1016/j.bmcl.2006.10.074 | |||||||||
Enzymes | 2irw | 2irw-nn4-3.10-x-1 | 2.751677852 | endocrine, metabolic | 11beta-hydroxysteroid dehydrogenase type 1 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 11beta-HSD 1 | non-insulin dependent diabetes mellitus obesity neurodegenerative diseases cognitive defects (age- and dementia-associated) metabolic disorders |
inhibition of the conversion of inactive cortison into acitve cortisol | nn4 | 3.10 | 898264-92-1 | CC(C)(C(=O)NC1[C@H]2CC3C[C@@H]1CC(C3)(C2)C(=O)N)OC=4C=CC(=CC4)OC | 898264-92-1 | cas | Discovery of adamantane ethers as inhibitors of 11beta-HSD-1: Synthesis and biological evaluation | Patel JR, Shuai Q, Dinges J, Winn M, Pliushchev M, Fung S, Monzon K, Chiou W, Wang J, Pan L, Wagaw S, Engstrom K, Kerdesky FA, Longenecker K, Judge R, Qin W, Imade HM, Stolarik D, Beno DW, Brune M, Chovan LE, Sham HL, Jacobson P, Link JT | Bioorg Med Chem Lett 17(3):750-5 | 2007 | 10.1016/j.bmcl.2006.10.074 | |||||||||
Enzymes | 2irw | 2irw-nn4-3.10-x-2-s | 3.33386201427 | endocrine, metabolic | 11beta-hydroxysteroid dehydrogenase type 1 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 11beta-HSD 1 | non-insulin dependent diabetes mellitus obesity neurodegenerative diseases cognitive defects (age- and dementia-associated) metabolic disorders |
inhibition of the conversion of inactive cortison into acitve cortisol | nn4 | 3.10 | 898264-92-1 | CC(C)(C(=O)NC1[C@H]2CC3C[C@@H]1CC(C3)(C2)C(=O)N)OC=4C=CC(=CC4)OC | 898264-92-1 | cas | Discovery of adamantane ethers as inhibitors of 11beta-HSD-1: Synthesis and biological evaluation | Patel JR, Shuai Q, Dinges J, Winn M, Pliushchev M, Fung S, Monzon K, Chiou W, Wang J, Pan L, Wagaw S, Engstrom K, Kerdesky FA, Longenecker K, Judge R, Qin W, Imade HM, Stolarik D, Beno DW, Brune M, Chovan LE, Sham HL, Jacobson P, Link JT | Bioorg Med Chem Lett 17(3):750-5 | 2007 | 10.1016/j.bmcl.2006.10.074 | |||||||||
Enzymes | 2irw | 2irw-nn4-3.10-x-2 | 3.1841909023117 | endocrine, metabolic | 11beta-hydroxysteroid dehydrogenase type 1 | EC1.- (oxydo-reductases) | steroid dehydrogenases | 11beta-HSD 1 | non-insulin dependent diabetes mellitus obesity neurodegenerative diseases cognitive defects (age- and dementia-associated) metabolic disorders |
inhibition of the conversion of inactive cortison into acitve cortisol | nn4 | 3.10 | 898264-92-1 | CC(C)(C(=O)NC1[C@H]2CC3C[C@@H]1CC(C3)(C2)C(=O)N)OC=4C=CC(=CC4)OC | 898264-92-1 | cas | Discovery of adamantane ethers as inhibitors of 11beta-HSD-1: Synthesis and biological evaluation | Patel JR, Shuai Q, Dinges J, Winn M, Pliushchev M, Fung S, Monzon K, Chiou W, Wang J, Pan L, Wagaw S, Engstrom K, Kerdesky FA, Longenecker K, Judge R, Qin W, Imade HM, Stolarik D, Beno DW, Brune M, Chovan LE, Sham HL, Jacobson P, Link JT | Bioorg Med Chem Lett 17(3):750-5 | 2007 | 10.1016/j.bmcl.2006.10.074 | |||||||||
2ivd | PPOX_MYXXA | P56601 | K00231 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With oxygen as acceptor | Protoporphyrinogen oxidase | 2ivd | |||||||||||||||||||||
2j2u | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2j2u | |||||||||||||||||||||
2j4i | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2j4i | |||||||||||||||||||||
2j50 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2j50 | |||||||||||||||||||||
2j94 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2j94 | |||||||||||||||||||||
2jh0 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2jh0 | |||||||||||||||||||||
2jh5 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2jh5 | |||||||||||||||||||||
2jh6 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2jh6 | |||||||||||||||||||||
2jko | FAK1_CHICK | Q00944 | K05725 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 2jko | |||||||||||||||||||||
2nsd | INHA_MYCTU | P0A5Y6 | K05500 | Lipid biosynthesis proteins | TGF-beta family | Distant members | INHA; inhibin, alpha | Others | 2nsd | |||||||||||||||||||||
2nw4 | ANDR_RAT | P15207 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2nw4 | |||||||||||||||||||||
2o7n | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 2o7n | |||||||||||||||||||||
2o8h | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2o8h | |||||||||||||||||||||
2ofv | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 2ofv | |||||||||||||||||||||
2oi0 | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 2oi0 | |||||||||||||||||||||
2oj9 | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 2oj9 | |||||||||||||||||||||
2on6 | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 2on6 | |||||||||||||||||||||
2op0 | Q9BH77_PLAFA | Q9BH77 | KO_id not found | Others | Others | Others | Others | Others | 2op0 | |||||||||||||||||||||
2ops | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 2ops | |||||||||||||||||||||
2ovh | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 2ovh | |||||||||||||||||||||
2ovv | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2ovv | |||||||||||||||||||||
2ovy | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2ovy | |||||||||||||||||||||
2oxd | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2oxd | |||||||||||||||||||||
2p0m | LOX15_RABIT | P12530 | K00460 | Enzymes | Oxidoreductases | Acting on single donors with O2 as oxidant and incorporation of oxygen into the substrate (oxygenases). The oxygen incorporated need not be derived from O2 | With incorporation of two atoms of oxygen | Arachidonate 15-lipoxygenase | 2p0m | |||||||||||||||||||||
2p2h | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 2p2h | |||||||||||||||||||||
2p2i | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 2p2i | |||||||||||||||||||||
2p4y | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 2p4y | |||||||||||||||||||||
2p95 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2p95 | |||||||||||||||||||||
2pdg | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 2pdg | |||||||||||||||||||||
2phb | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2phb | |||||||||||||||||||||
2pvh | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2pvh | |||||||||||||||||||||
2pvj | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2pvj | |||||||||||||||||||||
2pw3 | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 2pw3 | |||||||||||||||||||||
2pzi | PKNG_MYCTU | P65728 | K14949 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2pzi | |||||||||||||||||||||
2q7i | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2q7i | |||||||||||||||||||||
2q7k | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 2q7k | |||||||||||||||||||||
2q7o | PNPH_HUMAN | P00491 | K03783 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Purine-nucleoside phosphorylase | 2q7o | |||||||||||||||||||||
2q8g | PDK1_HUMAN | Q15118 | K12077 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2q8g | |||||||||||||||||||||
2q8i | PDK3_HUMAN | Q15120 | K00898 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | [pyruvate dehydrogenase (acetyl-transferring)] kinase | 2q8i | |||||||||||||||||||||
2q95 | AMPM_ECOLI | P0AE18 | K01265 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aminopeptidases | Methionyl aminopeptidase | 2q95 | |||||||||||||||||||||
2qc6 | CSK2A_MAIZE | P28523 | KO_id not found | Others | Others | Others | Others | Others | 2qc6 | |||||||||||||||||||||
2qio | Q81JF8_BACAN | Q81JF8 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 2qio | |||||||||||||||||||||
2qo8 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2qo8 | |||||||||||||||||||||
2qr9 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 2qr9 | |||||||||||||||||||||
2r3f | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3f | |||||||||||||||||||||
2r3j | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3j | |||||||||||||||||||||
2r3k | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3k | |||||||||||||||||||||
2r3p | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2r3p | |||||||||||||||||||||
2r4b | ERBB4_HUMAN | Q15303 | K05085 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2r4b | |||||||||||||||||||||
2r7b | PDPK1_HUMAN | O15530 | K06276 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2r7b | |||||||||||||||||||||
2rbe | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 2rbe | |||||||||||||||||||||
2rct | RET2_HUMAN | P50120 | KO_id not found | Others | Others | Others | Others | Others | 2rct | |||||||||||||||||||||
2rcw | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 2rcw | |||||||||||||||||||||
2rfs | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 2rfs | |||||||||||||||||||||
2rgp | EGFR_HUMAN | P00533 | K04361 | Cytokine receptors | Receptor tyrosine kinase | RTK class I (EGF receptor family) | EGFR, ERBB1; epidermal growth factor receptor | Others | 2rgp | |||||||||||||||||||||
2rki | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 2rki | |||||||||||||||||||||
2rkv | Q9HDE2_GIBZA | Q9HDE2 | KO_id not found | Others | Others | Others | Others | Others | 2rkv | |||||||||||||||||||||
2tsr | TYSY_RAT | P45352 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 2tsr | |||||||||||||||||||||
2uwo | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2uwo | |||||||||||||||||||||
2uwu | RCEL_RHOSH | P0C0Y8 | KO_id not found | Others | Others | Others | Others | Others | 2uwu | |||||||||||||||||||||
2uym | KIF11_HUMAN | P52732 | K10398 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulin-binding proteins | KIF11; kinesin family member 11 | 2uym | |||||||||||||||||||||
Enzymes | 2v0m | 2v0m-kln-3.80-x-1-s | 24.19090 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | kln | 3.80 | ketoconazole | [CC(=O)N1CCN(CC1)c2ccc(OC[C@H]3CO[C@@](Cn4ccnc4)(O3)c5ccc(Cl)cc5Cl)cc2] | 65277-42-1 | CAS | Structural basis for ligand promiscuity in cytochrome P450 3A4 | Ekroos M, Sjogren T | Proc Natl Acad Sci U S A 103(37):13682-7 | 2006 | 10.1073/pnas.0603236103 | |||||||||
Enzymes | 2v0m | 2v0m-kln-3.80-x-1 | 28.24012 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | kln | 3.80 | ketoconazole | [CC(=O)N1CCN(CC1)c2ccc(OC[C@H]3CO[C@@](Cn4ccnc4)(O3)c5ccc(Cl)cc5Cl)cc2] | 65277-42-1 | CAS | Structural basis for ligand promiscuity in cytochrome P450 3A4 | Ekroos M, Sjogren T | Proc Natl Acad Sci U S A 103(37):13682-7 | 2006 | 10.1073/pnas.0603236103 | |||||||||
Enzymes | 2v0m | 2v0m-kln-3.80-x-2-s | 26.91126 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | kln | 3.80 | ketoconazole | [CC(=O)N1CCN(CC1)c2ccc(OC[C@H]3CO[C@@](Cn4ccnc4)(O3)c5ccc(Cl)cc5Cl)cc2] | 65277-42-1 | CAS | Structural basis for ligand promiscuity in cytochrome P450 3A4 | Ekroos M, Sjogren T | Proc Natl Acad Sci U S A 103(37):13682-7 | 2006 | 10.1073/pnas.0603236103 | |||||||||
Enzymes | 2v0m | 2v0m-kln-3.80-x-2 | 31.19761 | ADMET | cytochrome P450 3A4 | EC1.- (oxydo-reductases) | monooxygenases | CYP 3A4 | ADMET | P450 3A4 inhibitors can cause severe drug-drug interactions | kln | 3.80 | ketoconazole | [CC(=O)N1CCN(CC1)c2ccc(OC[C@H]3CO[C@@](Cn4ccnc4)(O3)c5ccc(Cl)cc5Cl)cc2] | 65277-42-1 | CAS | Structural basis for ligand promiscuity in cytochrome P450 3A4 | Ekroos M, Sjogren T | Proc Natl Acad Sci U S A 103(37):13682-7 | 2006 | 10.1073/pnas.0603236103 | |||||||||
2v4l | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2v4l | |||||||||||||||||||||
2v95 | CBG_RAT | P31211 | KO_id not found | Others | Others | Others | Others | Others | 2v95 | |||||||||||||||||||||
2ves | LPXC_PSEAE | P47205 | K02535 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | UDP-3-O-acyl-N-acetylglucosamine deacetylase | 2ves | |||||||||||||||||||||
2vg7 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2vg7 | |||||||||||||||||||||
2vpr | Q799E2_PASMD | Q799E2 | KO_id not found | Others | Others | Others | Others | Others | 2vpr | |||||||||||||||||||||
2vrx | AUKBA_XENLA | Q6DE08 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2vrx | |||||||||||||||||||||
2vvt | MURI_ENTFA | Q836J0 | K01776 | Enzymes | Isomerases | Racemases and epimerases | Acting on amino acids and derivatives | Glutamate racemase | 2vvt | |||||||||||||||||||||
2vwy | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vwy | |||||||||||||||||||||
2vx0 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vx0 | |||||||||||||||||||||
2vx1 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 2vx1 | |||||||||||||||||||||
2vz6 | KCC2A_HUMAN | Q9UQM7 | K04515 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Ca2+-calmodulin-dependent protein kinase | 2vz6 | |||||||||||||||||||||
2w1e | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2w1e | |||||||||||||||||||||
2w3i | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2w3i | |||||||||||||||||||||
2w4i | MURI_HELPJ | Q9ZLT0 | K01776 | Enzymes | Isomerases | Racemases and epimerases | Acting on amino acids and derivatives | Glutamate racemase | 2w4i | |||||||||||||||||||||
2w71 | ACCC_ECOLI | P24182 | K01961 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 2w71 | |||||||||||||||||||||
2w98 | PTGR2_HUMAN | Q8N8N7 | K13949 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | 15-oxoprostaglandin 13-oxidase | 2w98 | |||||||||||||||||||||
2wd8 | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 2wd8 | |||||||||||||||||||||
2weh | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2weh | |||||||||||||||||||||
2wek | ZADH2_HUMAN | Q8N4Q0 | KO_id not found | Others | Others | Others | Others | Others | 2wek | |||||||||||||||||||||
2wge | FAB1_MYCTU | P63454 | K00921 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 1-phosphatidylinositol-3-phosphate 5-kinase | 2wge | |||||||||||||||||||||
2wgg | FAB1_MYCTU | P63454 | K00921 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | 1-phosphatidylinositol-3-phosphate 5-kinase | 2wgg | |||||||||||||||||||||
2wmd | NMRL1_HUMAN | Q9HBL8 | KO_id not found | Others | Others | Others | Others | Others | 2wmd | |||||||||||||||||||||
2wmr | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2wmr | |||||||||||||||||||||
2wn9 | Q8WSF8_APLCA | Q8WSF8 | KO_id not found | Others | Others | Others | Others | Others | 2wn9 | |||||||||||||||||||||
2wqb | TIE2_HUMAN | Q02763 | K05121 | Cellular antigens | CD (clusters of differentiation) molecules | CD202b; TEK tyrosine kinase, endothelial | Others | Others | 2wqb | |||||||||||||||||||||
2wu7 | CLK3_HUMAN | P49761 | K08823 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 2wu7 | |||||||||||||||||||||
2wuf | HSAD_MYCTU | P96851 | K16050 | Enzymes | Hydrolases | Acting on carbon-carbon bonds | In ketonic substances | 4,5-9,10-diseco-3-hydroxy-5,9,17-trioxoandrosta-1(10),2-diene-4-oate hydrolase | 2wuf | |||||||||||||||||||||
2wxm | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxm | |||||||||||||||||||||
2wxq | Q3UDT3_MOUSE | Q3UDT3 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 2wxq | |||||||||||||||||||||
2wyg | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2wyg | |||||||||||||||||||||
2wyj | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2wyj | |||||||||||||||||||||
2wyw | Q5SLI9_THET8 | Q5SLI9 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 2wyw | |||||||||||||||||||||
2x00 | Q8WSF8_APLCA | Q8WSF8 | KO_id not found | Others | Others | Others | Others | Others | 2x00 | |||||||||||||||||||||
2x1n | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 2x1n | |||||||||||||||||||||
2x2m | RET_HUMAN | P07949 | K05126 | Cytokine receptors | Receptor tyrosine kinase | RTK class XIV (RET receptor family) | RET; proto-oncogene tyrosine-protein kinase Ret | Others | 2x2m | |||||||||||||||||||||
2x7s | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2x7s | |||||||||||||||||||||
2x7t | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2x7t | |||||||||||||||||||||
2x7u | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 2x7u | |||||||||||||||||||||
2xir | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 2xir | |||||||||||||||||||||
2y05 | PTGR1_HUMAN | Q14914 | K13948 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | 15-oxoprostaglandin 13-oxidase | 2y05 | |||||||||||||||||||||
2y7x | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2y7x | |||||||||||||||||||||
2y80 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2y80 | |||||||||||||||||||||
2y81 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2y81 | |||||||||||||||||||||
2y82 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 2y82 | |||||||||||||||||||||
2yjd | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 2yjd | |||||||||||||||||||||
2ykm | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2ykm | |||||||||||||||||||||
2z77 | P71817_MYCTU | P71817 | K01822 | Enzymes | Isomerases | Intramolecular oxidoreductases | Transposing C=C bonds | Steroid Delta-isomerase | 2z77 | |||||||||||||||||||||
2zaz | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 2zaz | |||||||||||||||||||||
2zb8 | PTGR2_HUMAN | Q8N8N7 | K13949 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | 15-oxoprostaglandin 13-oxidase | 2zb8 | |||||||||||||||||||||
2zc9 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zc9 | |||||||||||||||||||||
2zd1 | POL_HV1B1 | P03366 | KO_id not found | Others | Others | Others | Others | Others | 2zd1 | |||||||||||||||||||||
2zdv | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zdv | |||||||||||||||||||||
2zf0 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zf0 | |||||||||||||||||||||
2zff | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zff | |||||||||||||||||||||
2zfp | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zfp | |||||||||||||||||||||
2zgb | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 2zgb | |||||||||||||||||||||
2zjw | CSK21_HUMAN | P68400 | K03097 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 2zjw | |||||||||||||||||||||
2zm1 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 2zm1 | |||||||||||||||||||||
2zv9 | LYN_MOUSE | P25911 | K05854 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 2zv9 | |||||||||||||||||||||
3a3w | Q93LD7_RHIRD | Q93LD7 | KO_id not found | Others | Others | Others | Others | Others | 3a3w | |||||||||||||||||||||
3a51 | CPVDH_PSEAH | C4B644 | KO_id not found | Others | Others | Others | Others | Others | 3a51 | |||||||||||||||||||||
3ac1 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ac1 | |||||||||||||||||||||
3ac3 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ac3 | |||||||||||||||||||||
3ack | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ack | |||||||||||||||||||||
3ad4 | LCK_HUMAN | P06239 | K05856 | CAM ligands | Immunoglobulin Superfamily | Immune system | CD2 family | CD48, BCM1; CD48 antigen [KO- ] | 3ad4 | |||||||||||||||||||||
3adx | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3adx | |||||||||||||||||||||
3am4 | Q9BJJ9_PLAFA | Q9BJJ9 | KO_id not found | Others | Others | Others | Others | Others | 3am4 | |||||||||||||||||||||
3am5 | Q9BJJ9_PLAFA | Q9BJJ9 | KO_id not found | Others | Others | Others | Others | Others | 3am5 | |||||||||||||||||||||
3anq | DYR1A_HUMAN | Q13627 | K08825 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 3anq | |||||||||||||||||||||
3anr | DYR1A_HUMAN | Q13627 | K08825 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 3anr | |||||||||||||||||||||
3avp | COAA_MYCTU | P63810 | K00867 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pantothenate kinase | 3avp | |||||||||||||||||||||
3avq | COAA_MYCTU | P63810 | K00867 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Pantothenate kinase | 3avq | |||||||||||||||||||||
3aza | Q965D7_PLAFA | Q965D7 | KO_id not found | Others | Others | Others | Others | Others | 3aza | |||||||||||||||||||||
3azb | Q965D7_PLAFA | Q965D7 | KO_id not found | Others | Others | Others | Others | Others | 3azb | |||||||||||||||||||||
3b2s | Q9HDE2_GIBZA | Q9HDE2 | KO_id not found | Others | Others | Others | Others | Others | 3b2s | |||||||||||||||||||||
3b3k | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3b3k | |||||||||||||||||||||
3b67 | ANDR_HUMAN | P10275 | K08557 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C4, AR; androgen receptor | Others | 3b67 | |||||||||||||||||||||
3b92 | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3b92 | |||||||||||||||||||||
3bet | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3bet | |||||||||||||||||||||
3bgp | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3bgp | |||||||||||||||||||||
3bgq | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3bgq | |||||||||||||||||||||
3bjc | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3bjc | |||||||||||||||||||||
3bjh | Q9U9J6_APIME | Q9U9J6 | KO_id not found | Others | Others | Others | Others | Others | 3bjh | |||||||||||||||||||||
3bqm | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 3bqm | |||||||||||||||||||||
3bqn | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 3bqn | |||||||||||||||||||||
3bqz | QACR_STAAM | P0A0N3 | KO_id not found | Others | Others | Others | Others | Others | 3bqz | |||||||||||||||||||||
3bv3 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3bv3 | |||||||||||||||||||||
3bxs | POL_HV1A2 | P03369 | KO_id not found | Others | Others | Others | Others | Others | 3bxs | |||||||||||||||||||||
3byz | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3byz | |||||||||||||||||||||
3bz7 | MYS2_DICDI | P08799 | K10352 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actin-binding proteins | Myosins | 3bz7 | |||||||||||||||||||||
3bz8 | MYS2_DICDI | P08799 | K10352 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actin-binding proteins | Myosins | 3bz8 | |||||||||||||||||||||
3bz9 | MYS2_DICDI | P08799 | K10352 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Actin filaments - Microfilaments | Actin-binding proteins | Myosins | 3bz9 | |||||||||||||||||||||
3bzu | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3bzu | |||||||||||||||||||||
3c06 | TYSY_LACCA | P00469 | K00560 | Enzymes | Transferases | Transferring one-carbon groups | Methyltransferases | Thymidylate synthase | 3c06 | |||||||||||||||||||||
3c79 | Q8WSF8_APLCA | Q8WSF8 | KO_id not found | Others | Others | Others | Others | Others | 3c79 | |||||||||||||||||||||
3cdp | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3cdp | |||||||||||||||||||||
3cjf | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3cjf | |||||||||||||||||||||
3cpc | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3cpc | |||||||||||||||||||||
3csj | GSTP1_HUMAN | P09211 | K00799 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Glutathione transferase | 3csj | |||||||||||||||||||||
3cso | POLG_HCVJ4 | O92972 | KO_id not found | Others | Others | Others | Others | Others | 3cso | |||||||||||||||||||||
3cwd | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3cwd | |||||||||||||||||||||
3cxi | PA2B1_BOTJR | Q90249 | KO_id not found | Others | Others | Others | Others | Others | 3cxi | |||||||||||||||||||||
3cy3 | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3cy3 | |||||||||||||||||||||
3d28 | POLG_HCVBK | P26663 | KO_id not found | Others | Others | Others | Others | Others | 3d28 | |||||||||||||||||||||
3d3e | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3d3e | |||||||||||||||||||||
3d4n | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3d4n | |||||||||||||||||||||
3d5q | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3d5q | |||||||||||||||||||||
3d90 | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 3d90 | |||||||||||||||||||||
3d9z | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3d9z | |||||||||||||||||||||
3da2 | CAH13_HUMAN | Q8N1Q1 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3da2 | |||||||||||||||||||||
3da9 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3da9 | |||||||||||||||||||||
3dcc | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3dcc | |||||||||||||||||||||
3ddp | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3ddp | |||||||||||||||||||||
3ddu | PPCE_HUMAN | P48147 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3ddu | |||||||||||||||||||||
3dhk | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3dhk | |||||||||||||||||||||
3di6 | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3di6 | |||||||||||||||||||||
3dle | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3dle | |||||||||||||||||||||
3dol | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3dol | |||||||||||||||||||||
3dox | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3dox | |||||||||||||||||||||
3ds6 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3ds6 | |||||||||||||||||||||
3dtc | M3K9_HUMAN | P80192 | K04417 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase kinase kinase | 3dtc | |||||||||||||||||||||
3e2m | ITAL_HUMAN | P20701 | K05718 | Cellular antigens | CD (clusters of differentiation) molecules | CD11a; integrin alpha L | Others | Others | 3e2m | |||||||||||||||||||||
3e5a | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3e5a | |||||||||||||||||||||
3e7v | HASP_HUMAN | Q8TF76 | K16315 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3e7v | |||||||||||||||||||||
3edz | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3edz | |||||||||||||||||||||
3efl | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3efl | |||||||||||||||||||||
3egk | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3egk | |||||||||||||||||||||
3ehx | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3ehx | |||||||||||||||||||||
3ene | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ene | |||||||||||||||||||||
3eq7 | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3eq7 | |||||||||||||||||||||
3eq8 | PPCE_PIG | P23687 | K01322 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Prolyl oligopeptidase | 3eq8 | |||||||||||||||||||||
3et7 | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3et7 | |||||||||||||||||||||
3ete | DHE3_BOVIN | P00366 | K00261 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With NAD+ or NADP+ as acceptor | Glutamate dehydrogenase [NAD(P)+] | 3ete | |||||||||||||||||||||
3ewj | ADA17_HUMAN | P78536 | K06059 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | ADAM 17 endopeptidase | 3ewj | |||||||||||||||||||||
3f16 | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3f16 | |||||||||||||||||||||
3f1q | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3f1q | |||||||||||||||||||||
3f4b | Q6TEI5_PLABE | Q6TEI5 | KO_id not found | Others | Others | Others | Others | Others | 3f4b | |||||||||||||||||||||
3f7z | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3f7z | |||||||||||||||||||||
3f88 | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3f88 | |||||||||||||||||||||
3fco | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3fco | |||||||||||||||||||||
3fdn | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3fdn | |||||||||||||||||||||
3fei | PPARA_HUMAN | Q07869 | K07294 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C1, PPARA; peroxisome proliferator-activated receptor alpha | Others | 3fei | |||||||||||||||||||||
3fej | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3fej | |||||||||||||||||||||
3fh7 | LKHA4_HUMAN | P09960 | K01254 | Enzymes | Hydrolases | Acting on ether bonds | Ether hydrolases | Leukotriene-A4 hydrolase | 3fh7 | |||||||||||||||||||||
3fkn | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fkn | |||||||||||||||||||||
3fko | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fko | |||||||||||||||||||||
3fl4 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fl4 | |||||||||||||||||||||
3fln | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fln | |||||||||||||||||||||
3fls | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fls | |||||||||||||||||||||
3flw | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3flw | |||||||||||||||||||||
3fly | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fly | |||||||||||||||||||||
3flz | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3flz | |||||||||||||||||||||
3fma | SMY2_YEAST | P32909 | K11426 | Chromosome | Eukaryotic Type | Histone modification proteins | HMTs (histone methyltransferases) | SMYD; SET and MYND domain-containing protein | 3fma | |||||||||||||||||||||
3fmh | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmh | |||||||||||||||||||||
3fmk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fmk | |||||||||||||||||||||
3fne | INHA_MYCTU | P0A5Y6 | K05500 | Lipid biosynthesis proteins | TGF-beta family | Distant members | INHA; inhibin, alpha | Others | 3fne | |||||||||||||||||||||
3fnf | INHA_MYCTU | P0A5Y6 | K05500 | Lipid biosynthesis proteins | TGF-beta family | Distant members | INHA; inhibin, alpha | Others | 3fnf | |||||||||||||||||||||
3fnu | Q8IM15_PLAF7 | Q8IM15 | KO_id not found | Others | Others | Others | Others | Others | 3fnu | |||||||||||||||||||||
3fqh | KSYK_HUMAN | P43405 | K05855 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fqh | |||||||||||||||||||||
3fqk | POLG_HCVBK | P26663 | KO_id not found | Others | Others | Others | Others | Others | 3fqk | |||||||||||||||||||||
3frq | Q9EVJ6_ECOLX | Q9EVJ6 | KO_id not found | Others | Others | Others | Others | Others | 3frq | |||||||||||||||||||||
3fsf | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fsf | |||||||||||||||||||||
3fsk | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3fsk | |||||||||||||||||||||
3fxw | MAPK3_HUMAN | Q16644 | K04444 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3fxw | |||||||||||||||||||||
3fzr | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fzr | |||||||||||||||||||||
3fzs | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3fzs | |||||||||||||||||||||
3g0e | KIT_HUMAN | P10721 | K05091 | Cellular antigens | CD (clusters of differentiation) molecules | CD117; v-kit Hardy-Zuckerman 4 feline sarcoma viral oncogene homolog | Others | Others | 3g0e | |||||||||||||||||||||
3g0u | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3g0u | |||||||||||||||||||||
3g0x | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3g0x | |||||||||||||||||||||
3g1o | ETHR_MYCTU | P96222 | KO_id not found | Others | Others | Others | Others | Others | 3g1o | |||||||||||||||||||||
3g45 | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3g45 | |||||||||||||||||||||
3g4k | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3g4k | |||||||||||||||||||||
3g7e | C3SLN3_ECOLX | C3SLN3 | KO_id not found | Others | Others | Others | Others | Others | 3g7e | |||||||||||||||||||||
3g8o | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 3g8o | |||||||||||||||||||||
3gbk | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3gbk | |||||||||||||||||||||
3gki | NPC1_HUMAN | O15118 | K12385 | Others | Cellular Processes | Transport and catabolism | Lysosome | NPC1; Niemann-Pick C1 protein | 3gki | |||||||||||||||||||||
3gkj | NPC1_HUMAN | O15118 | K12385 | Others | Cellular Processes | Transport and catabolism | Lysosome | NPC1; Niemann-Pick C1 protein | 3gkj | |||||||||||||||||||||
3gko | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3gko | |||||||||||||||||||||
3gn2 | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 3gn2 | |||||||||||||||||||||
3gnv | POLG_HCVJ4 | O92972 | KO_id not found | Others | Others | Others | Others | Others | 3gnv | |||||||||||||||||||||
3gql | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 3gql | |||||||||||||||||||||
3h0y | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3h0y | |||||||||||||||||||||
3h3c | FAK2_HUMAN | Q14289 | K05871 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 3h3c | |||||||||||||||||||||
3h5u | POLG_HCVBK | P26663 | KO_id not found | Others | Others | Others | Others | Others | 3h5u | |||||||||||||||||||||
3h6k | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3h6k | |||||||||||||||||||||
3h98 | POLG_HCVBK | P26663 | KO_id not found | Others | Others | Others | Others | Others | 3h98 | |||||||||||||||||||||
3ha6 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ha6 | |||||||||||||||||||||
3hbb | Q8T5T8_TRYCR | Q8T5T8 | KO_id not found | Others | Others | Others | Others | Others | 3hbb | |||||||||||||||||||||
3hgy | Q7B8P6_CAMJU | Q7B8P6 | KO_id not found | Others | Others | Others | Others | Others | 3hgy | |||||||||||||||||||||
3hlj | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3hlj | |||||||||||||||||||||
3hlv | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3hlv | |||||||||||||||||||||
3hmp | TTK_HUMAN | P33981 | K08866 | Enzymes | Transferases | Transferring phosphorus-containing groups | Dual-specificity kinases (those acting on Ser-Thr and Tyr residues) | Dual-specificity kinase | 3hmp | |||||||||||||||||||||
3hmv | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3hmv | |||||||||||||||||||||
3hng | VGFR1_HUMAN | P17948 | K05096 | Cytokine receptors | Receptor tyrosine kinase | RTK class V (VEGF receptor family) | FLT1, VEGFR1; FMS-like tyrosine kinase 1 | Others | 3hng | |||||||||||||||||||||
3ho0 | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3ho0 | |||||||||||||||||||||
3hod | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3hod | |||||||||||||||||||||
3hp2 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3hp2 | |||||||||||||||||||||
3hp5 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3hp5 | |||||||||||||||||||||
3hqy | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3hqy | |||||||||||||||||||||
3hqz | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3hqz | |||||||||||||||||||||
3hr1 | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3hr1 | |||||||||||||||||||||
3hrb | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3hrb | |||||||||||||||||||||
3hrr | PKSL1_ASPPA | Q12053 | KO_id not found | Others | Others | Others | Others | Others | 3hrr | |||||||||||||||||||||
3hx3 | RLBP1_HUMAN | P12271 | KO_id not found | Others | Others | Others | Others | Others | 3hx3 | |||||||||||||||||||||
3i7c | Q9BJF5_TOXGO | Q9BJF5 | KO_id not found | Others | Others | Others | Others | Others | 3i7c | |||||||||||||||||||||
3i81 | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 3i81 | |||||||||||||||||||||
3i8v | PDE4A_HUMAN | P27815 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3i8v | |||||||||||||||||||||
3i9l | NADA_APLCA | P29241 | K03517 | Enzymes | Transferases | Transferring alkyl or aryl groups, other than methyl groups | Transferring alkyl or aryl groups, other than methyl groups (only sub-subclass identified to date) | Quinolinate synthase | 3i9l | |||||||||||||||||||||
3iak | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3iak | |||||||||||||||||||||
3iej | CATS_HUMAN | P25774 | K01368 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Cysteine endopeptidases | Cathepsin S | 3iej | |||||||||||||||||||||
3ig7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3ig7 | |||||||||||||||||||||
3ihg | Q54530_9ACTO | Q54530 | KO_id not found | Others | Others | Others | Others | Others | 3ihg | |||||||||||||||||||||
3ik6 | GRIA2_RAT | P19491 | K05198 | Ion Channels | Glutamate-gated cation channels | Glutamate (ionotropic), non-NMDA | GRIA2; glutamate receptor 2 | Others | 3ik6 | |||||||||||||||||||||
3il5 | FABH_ENTFA | Q820T1 | K00648 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Beta-ketoacyl-acyl-carrier-protein synthase III | 3il5 | |||||||||||||||||||||
3imx | Q53Y25_HUMAN | Q53Y25 | K12407 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Glucokinase | 3imx | |||||||||||||||||||||
3ip8 | AMDA_BORBO | Q05115 | KO_id not found | Others | Others | Others | Others | Others | 3ip8 | |||||||||||||||||||||
3iub | PANC_MYCTU | P0A5R0 | K01918 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Pantoate---beta-alanine ligase | 3iub | |||||||||||||||||||||
3ivm | Q9X6R4_AERPU | Q9X6R4 | KO_id not found | Others | Others | Others | Others | Others | 3ivm | |||||||||||||||||||||
3iw5 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3iw5 | |||||||||||||||||||||
3ix8 | LASR_PSEAE | P25084 | KO_id not found | Others | Others | Others | Others | Others | 3ix8 | |||||||||||||||||||||
3jpv | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3jpv | |||||||||||||||||||||
3jq8 | Q581W1_TRYB2 | Q581W1 | K03793 | Enzymes | Oxidoreductases | Acting on the CH-NH group of donors | With NAD+ or NADP+ as acceptor | Pteridine reductase | 3jq8 | |||||||||||||||||||||
3jsx | NQO1_HUMAN | P15559 | K00355 | Enzymes | Oxidoreductases | Acting on NADH or NADPH | With a quinone or similar compound as acceptor | NAD(P)H dehydrogenase (quinone) | 3jsx | |||||||||||||||||||||
3jtk | NMT1_HUMAN | P30419 | K00671 | Enzymes | Transferases | Acyltransferases | Transferring groups other than aminoacyl groups | Glycylpeptide N-tetradecanoyltransferase | 3jtk | |||||||||||||||||||||
3jya | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3jya | |||||||||||||||||||||
3k3h | PDE9A_HUMAN | O76083 | K13761 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3k3h | |||||||||||||||||||||
3k3j | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3k3j | |||||||||||||||||||||
3k4s | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3k4s | |||||||||||||||||||||
3k6p | ERR1_HUMAN | P11474 | K01689 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Phosphopyruvate hydratase | 3k6p | |||||||||||||||||||||
3kba | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 3kba | |||||||||||||||||||||
3kcf | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 3kcf | |||||||||||||||||||||
3kf7 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3kf7 | |||||||||||||||||||||
3khj | Q5CPK7_CRYPI | Q5CPK7 | K00088 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | IMP dehydrogenase | 3khj | |||||||||||||||||||||
3ki3 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki3 | |||||||||||||||||||||
3ki4 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki4 | |||||||||||||||||||||
3ki5 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki5 | |||||||||||||||||||||
3ki6 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ki6 | |||||||||||||||||||||
3kig | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3kig | |||||||||||||||||||||
3kkt | PDE4B_HUMAN | Q07343 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3kkt | |||||||||||||||||||||
3km0 | DHB1_HUMAN | P14061 | K00044 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Estradiol 17beta-dehydrogenase | 3km0 | |||||||||||||||||||||
3kn0 | BACE1_HUMAN | P56817 | K04521 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Aspartic endopeptidases | Memapsin 2 | 3kn0 | |||||||||||||||||||||
3kti | CLPP_BACSU | P80244 | K01358 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Serine endopeptidases | Endopeptidase Clp | 3kti | |||||||||||||||||||||
3l08 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l08 | |||||||||||||||||||||
3l30 | PA21B_PIG | P00592 | K01047 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Phospholipase A2 | 3l30 | |||||||||||||||||||||
3l3l | PARP1_HUMAN | P09874 | K10798 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3l3l | |||||||||||||||||||||
3l54 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3l54 | |||||||||||||||||||||
3l5r | MIF_HUMAN | P14174 | K07253 | Enzymes | Isomerases | Intramolecular oxidoreductases | Interconverting keto- and enol-groups | Phenylpyruvate tautomerase | 3l5r | |||||||||||||||||||||
3l8p | TIE2_HUMAN | Q02763 | K05121 | Cellular antigens | CD (clusters of differentiation) molecules | CD202b; TEK tyrosine kinase, endothelial | Others | Others | 3l8p | |||||||||||||||||||||
3l8w | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3l8w | |||||||||||||||||||||
3l9h | KIF11_HUMAN | P52732 | K10398 | Cytoskeleton proteins | Eukaryotic cytoskeleton proteins | Microtubules | Tubulin-binding proteins | KIF11; kinesin family member 11 | 3l9h | |||||||||||||||||||||
3lal | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3lal | |||||||||||||||||||||
3ld4 | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3ld4 | |||||||||||||||||||||
3le6 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3le6 | |||||||||||||||||||||
3lka | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3lka | |||||||||||||||||||||
3lkh | POLG_HCVJ4 | O92972 | KO_id not found | Others | Others | Others | Others | Others | 3lkh | |||||||||||||||||||||
3lmp | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3lmp | |||||||||||||||||||||
3ln0 | PGH2_MOUSE | Q05769 | K11987 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 3ln0 | |||||||||||||||||||||
3lpf | BGLR_ECOLI | P05804 | K01195 | Enzymes | Hydrolases | Glycosylases | Glycosidases, i.e. enzymes that hydrolyse O- and S-glycosyl compounds | Beta-glucuronidase | 3lpf | |||||||||||||||||||||
3lq5 | CDK9_HUMAN | P50750 | K02211 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3lq5 | |||||||||||||||||||||
3lt0 | Q9BJJ9_PLAFA | Q9BJJ9 | KO_id not found | Others | Others | Others | Others | Others | 3lt0 | |||||||||||||||||||||
3lxg | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3lxg | |||||||||||||||||||||
3m2w | MAPK2_HUMAN | P49137 | K04443 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3m2w | |||||||||||||||||||||
3m42 | MAPK2_HUMAN | P49137 | K04443 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3m42 | |||||||||||||||||||||
3m67 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3m67 | |||||||||||||||||||||
3m7u | PRLA_LYSEN | P00778 | KO_id not found | Others | Others | Others | Others | Others | 3m7u | |||||||||||||||||||||
3mcv | O76290_TRYBB | O76290 | KO_id not found | Others | Others | Others | Others | Others | 3mcv | |||||||||||||||||||||
3mdy | BMR1B_HUMAN | O00238 | K13578 | Cellular antigens | CD (clusters of differentiation) molecules | CDw293; bone morphogenetic protein receptor, type IB | Others | Others | 3mdy | |||||||||||||||||||||
3mdz | CAH7_HUMAN | P43166 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3mdz | |||||||||||||||||||||
3mee | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3mee | |||||||||||||||||||||
3meg | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3meg | |||||||||||||||||||||
3mhj | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3mhj | |||||||||||||||||||||
3mhk | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3mhk | |||||||||||||||||||||
3mla | NADD_BACAC | C3L5T6 | K00969 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Nicotinate-nucleotide adenylyltransferase | 3mla | |||||||||||||||||||||
3mpt | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3mpt | |||||||||||||||||||||
3mqe | PGH2_MOUSE | Q05769 | K11987 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 3mqe | |||||||||||||||||||||
3mtl | CDK16_HUMAN | Q00536 | K08820 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3mtl | |||||||||||||||||||||
3my0 | ACVL1_HUMAN | P37023 | K13594 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | ACVRL1; activin receptor-like kinase 1 | Others | 3my0 | |||||||||||||||||||||
3my5 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3my5 | |||||||||||||||||||||
3mzs | CP11A_BOVIN | P00189 | K00498 | Cytochrome P450 | Cytochrome P450, animal type | CYP11 family | CYP11A subfamily | Cholesterol side-chain cleavage enzyme | 3mzs | 9913 | ||||||||||||||||||||
3n8y | PGH1_SHEEP | P05979 | K00509 | Enzymes | Oxidoreductases | Acting on paired donors with incorporation of molecular oxygen | Miscellaneous | Prostaglandin-endoperoxide synthase | 3n8y | |||||||||||||||||||||
3n9y | CP11A_HUMAN | P05108 | K00498 | Cytochrome P450 | Cytochrome P450, animal type | CYP11 family | CYP11A subfamily | Cholesterol side-chain cleavage enzyme | 3n9y | 9606 | ||||||||||||||||||||
3na1 | CP11A_HUMAN | P05108 | K00498 | Cytochrome P450 | Cytochrome P450, animal type | CYP11 family | CYP11A subfamily | CYP11A; cytochrome P450, family 11, subfamily A (cholesterol monooxygenase (side-chain-cleaving)) | 3na1 | |||||||||||||||||||||
3nbp | POL_HV1H2 | P04585 | KO_id not found | Others | Others | Others | Others | Others | 3nbp | |||||||||||||||||||||
3ncg | A3FQ16_CRYPI | A3FQ16 | K13412 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ncg | |||||||||||||||||||||
3nef | PYL1_ARATH | Q8VZS8 | KO_id not found | Others | Others | Others | Others | Others | 3nef | |||||||||||||||||||||
3nf6 | Q76353_9HIV1 | Q76353 | KO_id not found | Others | Others | Others | Others | Others | 3nf6 | |||||||||||||||||||||
3nj8 | Q6UCJ9_TOXGO | Q6UCJ9 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 3nj8 | |||||||||||||||||||||
3njo | PYR1_ARATH | O49686 | K11540 | Enzymes | Transferases | Transferring one-carbon groups | Carboxy- and carbamoyltransferases | Aspartate carbamoyltransferase | 3njo | |||||||||||||||||||||
3nmh | PYL2_ARATH | O80992 | KO_id not found | Others | Others | Others | Others | Others | 3nmh | |||||||||||||||||||||
3nmn | PYL1_ARATH | Q8VZS8 | KO_id not found | Others | Others | Others | Others | Others | 3nmn | |||||||||||||||||||||
3nrc | Q5NGQ3_FRATT | Q5NGQ3 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 3nrc | |||||||||||||||||||||
3ns2 | PYL2_ARATH | O80992 | KO_id not found | Others | Others | Others | Others | Others | 3ns2 | |||||||||||||||||||||
3ns9 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3ns9 | |||||||||||||||||||||
3ny6 | CHXA_VIBCL | Q5EK40 | KO_id not found | Others | Others | Others | Others | Others | 3ny6 | |||||||||||||||||||||
3nyv | Q9BJF5_TOXGO | Q9BJF5 | KO_id not found | Others | Others | Others | Others | Others | 3nyv | |||||||||||||||||||||
3o23 | IGF1R_HUMAN | P08069 | K05087 | Cellular antigens | CD (clusters of differentiation) molecules | CD221; insulin-like growth factor 1 receptor | Others | Others | 3o23 | |||||||||||||||||||||
3o2f | ENPL_CANFA | P41148 | K09487 | Chaperones and folding catalysts | Heat shock proteins | HSP90 | K09487 HSP90B, TRA1; heat shock protein 90kDa beta | Endoplasmic reticulum | 3o2f | |||||||||||||||||||||
3o3j | DEF1B_ARATH | Q9FUZ2 | K01462 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Peptide deformylase | 3o3j | |||||||||||||||||||||
3o5r | FKBP5_HUMAN | Q13451 | K09571 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 3o5r | |||||||||||||||||||||
3oax | OPSD_BOVIN | P02699 | K04250 | G protein-coupled receptors | Class A. Rhodopsin family | Vision | Opsin | RHO, OPN2; rhodopsin | 3oax | |||||||||||||||||||||
3ohl | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 3ohl | |||||||||||||||||||||
3oho | MMP3_HUMAN | P08254 | K01394 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Stromelysin 1 | 3oho | |||||||||||||||||||||
3oik | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oik | |||||||||||||||||||||
3oil | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oil | |||||||||||||||||||||
3oim | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oim | |||||||||||||||||||||
3oku | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3oku | |||||||||||||||||||||
3okv | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3okv | |||||||||||||||||||||
3omo | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 3omo | |||||||||||||||||||||
3omp | ESR2_HUMAN | Q92731 | K08551 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A2, ESR2; estrogen receptor beta | Others | 3omp | |||||||||||||||||||||
3oom | ACVR1_HUMAN | Q04771 | K04675 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | ACVR1; activin receptor type-1 | Others | 3oom | |||||||||||||||||||||
3oq1 | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3oq1 | |||||||||||||||||||||
3os9 | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3os9 | |||||||||||||||||||||
3osa | ESR1_HUMAN | P03372 | K08550 | Nuclear receptors | Estrogen like | A. Estrogen receptor | NR3A1, ESR1; estrogen receptor alpha | Others | 3osa | |||||||||||||||||||||
3osh | PA2A3_NAJSG | P60045 | KO_id not found | Others | Others | Others | Others | Others | 3osh | |||||||||||||||||||||
3osi | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3osi | |||||||||||||||||||||
3osw | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3osw | |||||||||||||||||||||
3ov4 | SDIS_COMTE | P00947 | KO_id not found | Others | Others | Others | Others | Others | 3ov4 | |||||||||||||||||||||
3ovv | KAPCA_HUMAN | P17612 | K04345 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | CAMP-dependent protein kinase | 3ovv | |||||||||||||||||||||
3ox1 | NQO2_HUMAN | P16083 | K08071 | Enzymes | Oxidoreductases | Acting on diphenols and related substances as donors | With other acceptors | Ribosyldihydronicotinamide dehydrogenase (quinone) | 3ox1 | |||||||||||||||||||||
3ox3 | NQO2_HUMAN | P16083 | K08071 | Enzymes | Oxidoreductases | Acting on diphenols and related substances as donors | With other acceptors | Ribosyldihydronicotinamide dehydrogenase (quinone) | 3ox3 | |||||||||||||||||||||
3ozu | HMP_CUPNH | P39662 | K05916 | Enzymes | Oxidoreductases | Acting on paired donors, with O2 as oxidant and incorporation or reduction of oxygen. The oxygen incorporated need not be derived from O2 | With NADH or NADPH as one donor, and incorporation of two atoms of oxygen into the other donor | Nitric oxide dioxygenase | 3ozu | |||||||||||||||||||||
3ozv | HMP_CUPNH | P39662 | K05916 | Enzymes | Oxidoreductases | Acting on paired donors, with O2 as oxidant and incorporation or reduction of oxygen. The oxygen incorporated need not be derived from O2 | With NADH or NADPH as one donor, and incorporation of two atoms of oxygen into the other donor | Nitric oxide dioxygenase | 3ozv | |||||||||||||||||||||
3p17 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3p17 | |||||||||||||||||||||
3p1f | CBP_HUMAN | Q92793 | K04498 | Chromosome | Eukaryotic Type | Histone modification proteins | HATs (histone acetyltransferases) | EP300, CREBBP, KAT3; E1A-CREB-binding protein | 3p1f | |||||||||||||||||||||
3p2v | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3p2v | |||||||||||||||||||||
3p86 | CTR1_ARATH | Q05609 | K14510 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3p86 | |||||||||||||||||||||
3p9t | Q8KLP4_STEMA | Q8KLP4 | KO_id not found | Others | Others | Others | Others | Others | 3p9t | |||||||||||||||||||||
3pb7 | QPCTL_HUMAN | Q9NXS2 | KO_id not found | Others | Others | Others | Others | Others | 3pb7 | |||||||||||||||||||||
3pbb | QPCT_HUMAN | Q16769 | K00683 | Enzymes | Transferases | Acyltransferases | Aminoacyltransferases | Glutaminyl-peptide cyclotransferase | 3pbb | |||||||||||||||||||||
3pcu | RXRA_HUMAN | P19793 | K08524 | Nuclear receptors | Hepatocyte nuclear factor 4 like | B. Retinoid X receptor (RXR) | NR2B1, RXRA; retinoid X receptor alpha | Others | 3pcu | |||||||||||||||||||||
3pej | Q8I0V4_PLAF7 | Q8I0V4 | KO_id not found | Others | Others | Others | Others | Others | 3pej | |||||||||||||||||||||
3pfb | D3YEX6_LACJH | D3YEX6 | KO_id not found | Others | Others | Others | Others | Others | 3pfb | |||||||||||||||||||||
3pgq | ACAC_YEAST | Q00955 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 3pgq | |||||||||||||||||||||
3pj8 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3pj8 | |||||||||||||||||||||
3pkg | URIC_ASPFL | Q00511 | K00365 | Enzymes | Oxidoreductases | Acting on other nitrogenous compounds as donors | With oxygen as acceptor | Factor-independent urate hydroxylase | 3pkg | |||||||||||||||||||||
3po6 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3po6 | |||||||||||||||||||||
3po7 | AOFB_HUMAN | P27338 | K00274 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With oxygen as acceptor | Monoamine oxidase | 3po7 | |||||||||||||||||||||
3poz | EGFR_HUMAN | P00533 | K04361 | Cytokine receptors | Receptor tyrosine kinase | RTK class I (EGF receptor family) | EGFR, ERBB1; epidermal growth factor receptor | Others | 3poz | |||||||||||||||||||||
3ppm | FAAH1_RAT | P97612 | K15528 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Fatty acid amide hydrolase | 3ppm | |||||||||||||||||||||
3ps6 | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3ps6 | |||||||||||||||||||||
3q2f | BAZ2B_HUMAN | Q9UIF8 | KO_id not found | Others | Others | Others | Others | Others | 3q2f | |||||||||||||||||||||
3q2m | O06916_LEGPN | O06916 | KO_id not found | Others | Others | Others | Others | Others | 3q2m | |||||||||||||||||||||
3q3s | ETHR_MYCTU | P96222 | KO_id not found | Others | Others | Others | Others | Others | 3q3s | |||||||||||||||||||||
3q4t | AVR2A_HUMAN | P27037 | K04670 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Receptor protein serine-threonine kinase | 3q4t | |||||||||||||||||||||
3q6w | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3q6w | |||||||||||||||||||||
3q77 | ELNE_HUMAN | P08246 | K01327 | Heparan sulfate-heparin binding proteins | Enzymes(General comment) Variety | ELANE; leukocyte elastase Protection from inactivation by serpins | Others | Others | 3q77 | |||||||||||||||||||||
3qck | PTPRG_HUMAN | P23470 | K01104 | Others | Hydrolases | Acting on ester bonds | Phosphoric-monoester hydrolases | Protein-tyrosine-phosphatase | 3qck | |||||||||||||||||||||
3qiz | BXA1_CLOBH | A5HZZ9 | K06011 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Bontoxilysin | 3qiz | |||||||||||||||||||||
3qj9 | FAAH1_RAT | P97612 | K15528 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Fatty acid amide hydrolase | 3qj9 | |||||||||||||||||||||
3qjz | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3qjz | |||||||||||||||||||||
3qk5 | FAAH1_RAT | P97612 | K15528 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Fatty acid amide hydrolase | 3qk5 | |||||||||||||||||||||
3qp2 | D3W065_CHRVL | D3W065 | KO_id not found | Others | Others | Others | Others | Others | 3qp2 | |||||||||||||||||||||
3qp4 | D3W065_CHRVL | D3W065 | KO_id not found | Others | Others | Others | Others | Others | 3qp4 | |||||||||||||||||||||
3qpn | PDE10_RAT | Q9QYJ6 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3qpn | |||||||||||||||||||||
3qqp | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3qqp | |||||||||||||||||||||
3qsa | TRPD_MYCTU | P66992 | K00766 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | Anthranilate phosphoribosyltransferase | 3qsa | |||||||||||||||||||||
3qti | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3qti | |||||||||||||||||||||
3qud | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3qud | |||||||||||||||||||||
3qwc | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3qwc | |||||||||||||||||||||
3qx4 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qx4 | |||||||||||||||||||||
3qx5 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3qx5 | |||||||||||||||||||||
3qzh | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzh | |||||||||||||||||||||
3qzi | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3qzi | |||||||||||||||||||||
3r1s | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r1s | |||||||||||||||||||||
3r1y | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r1y | |||||||||||||||||||||
3r21 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3r21 | |||||||||||||||||||||
3r22 | AURKA_HUMAN | O14965 | K11481 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3r22 | |||||||||||||||||||||
3r28 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r28 | |||||||||||||||||||||
3r2y | MAPK2_HUMAN | P49137 | K04443 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3r2y | |||||||||||||||||||||
3r43 | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3r43 | |||||||||||||||||||||
3r5m | RXRA_HUMAN | P19793 | K08524 | Nuclear receptors | Hepatocyte nuclear factor 4 like | B. Retinoid X receptor (RXR) | NR2B1, RXRA; retinoid X receptor alpha | Others | 3r5m | |||||||||||||||||||||
3r6i | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3r6i | |||||||||||||||||||||
3r71 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r71 | |||||||||||||||||||||
3r73 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r73 | |||||||||||||||||||||
3r7o | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3r7o | |||||||||||||||||||||
3r7r | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3r7r | |||||||||||||||||||||
3r7v | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3r7v | |||||||||||||||||||||
3r8h | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3r8h | |||||||||||||||||||||
3rgz | BRI1_ARATH | O22476 | K13415 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 3rgz | |||||||||||||||||||||
3rhx | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 3rhx | |||||||||||||||||||||
3ri1 | FGFR2_HUMAN | P21802 | K05093 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR2; fibroblast growth factor receptor 2 Mitogenesis | Others | Others | 3ri1 | |||||||||||||||||||||
3roc | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3roc | |||||||||||||||||||||
3roy | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3roy | |||||||||||||||||||||
3rz3 | UB2R1_HUMAN | P49427 | K02207 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Acid-D-amino-acid ligases (peptide synthases) | Ubiquitin---protein ligase | 3rz3 | |||||||||||||||||||||
3s2a | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 3s2a | |||||||||||||||||||||
3s3g | ALDR_HUMAN | P15121 | K00011 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | Aldehyde reductase | 3s3g | |||||||||||||||||||||
3s3i | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3s3i | |||||||||||||||||||||
3s71 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s71 | |||||||||||||||||||||
3s72 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s72 | |||||||||||||||||||||
3s73 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s73 | |||||||||||||||||||||
3s74 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s74 | |||||||||||||||||||||
3s76 | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3s76 | |||||||||||||||||||||
3sax | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3sax | |||||||||||||||||||||
3say | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3say | |||||||||||||||||||||
3sha | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3sha | |||||||||||||||||||||
3shc | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3shc | |||||||||||||||||||||
3shz | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3shz | |||||||||||||||||||||
3si3 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3si3 | |||||||||||||||||||||
3si4 | THRB_HUMAN | P00734 | K01313 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F2; coagulation factor II (thrombin) | Others | Others | 3si4 | |||||||||||||||||||||
3sie | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3sie | |||||||||||||||||||||
3sl8 | PDE4D_HUMAN | Q08499 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3sl8 | |||||||||||||||||||||
3smj | PAR14_HUMAN | Q460N5 | K15261 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3smj | |||||||||||||||||||||
3sni | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3sni | |||||||||||||||||||||
3srb | PVDQ_PSEAE | Q9I194 | K07116 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | Acyl-homoserine-lactone acylase | 3srb | |||||||||||||||||||||
3sw2 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 3sw2 | |||||||||||||||||||||
3sw4 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3sw4 | |||||||||||||||||||||
3sw7 | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3sw7 | |||||||||||||||||||||
3t03 | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3t03 | |||||||||||||||||||||
3t5z | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 3t5z | |||||||||||||||||||||
3t94 | MTAP_SULSO | Q97W94 | K00772 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | S-methyl-5'-thioadenosine phosphorylase | 3t94 | |||||||||||||||||||||
3t9i | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3t9i | |||||||||||||||||||||
3tfq | DHI1_HUMAN | P28845 | K15680 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 11beta-hydroxysteroid dehydrogenase | 3tfq | |||||||||||||||||||||
3tge | PDE5A_HUMAN | O76074 | K13762 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-GMP phosphodiesterase | 3tge | |||||||||||||||||||||
3tiz | CDK2_HUMAN | P24941 | K02206 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Cyclin-dependent kinase | 3tiz | |||||||||||||||||||||
3tk6 | FA10_HUMAN | P00742 | K01314 | Heparan sulfate-heparin binding proteins | Coagulation and fibrinolysis(General comment) Coagulation, inflammation, complement control | F10; coagulation factor X | Others | Others | 3tk6 | |||||||||||||||||||||
3ts4 | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 3ts4 | |||||||||||||||||||||
3tt4 | MMP8_HUMAN | P22894 | K01402 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Neutrophil collagenase | 3tt4 | |||||||||||||||||||||
3tv5 | ACAC_YEAST | Q00955 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 3tv5 | |||||||||||||||||||||
3tvw | ACAC_YEAST | Q00955 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 3tvw | |||||||||||||||||||||
3ty0 | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3ty0 | |||||||||||||||||||||
3tz3 | ACAC_YEAST | Q00955 | K11262 | Enzymes | Ligases | Forming carbon-nitrogen bonds | Other carbon-nitrogen ligases | Biotin carboxylase | 3tz3 | |||||||||||||||||||||
3tzm | TGFR1_HUMAN | P36897 | K04674 | Cytokine receptors | TGF-beta receptors | Type I TGF-beta receptor | TGFBR1; TGF-beta receptor type-1 | Others | 3tzm | |||||||||||||||||||||
3u1y | LPXC_PSEAE | P47205 | K02535 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | UDP-3-O-acyl-N-acetylglucosamine deacetylase | 3u1y | |||||||||||||||||||||
3u6h | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 3u6h | |||||||||||||||||||||
3ua9 | TNKS2_HUMAN | Q9H2K2 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3ua9 | |||||||||||||||||||||
3udd | TNKS1_HUMAN | O95271 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3udd | |||||||||||||||||||||
3ugr | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 3ugr | |||||||||||||||||||||
3uh2 | TNKS1_HUMAN | O95271 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 3uh2 | |||||||||||||||||||||
3uhm | LPXC_PSEAE | P47205 | K02535 | Enzymes | Hydrolases | Acting on carbon-nitrogen bonds, other than peptide bonds | In linear amides | UDP-3-O-acyl-N-acetylglucosamine deacetylase | 3uhm | |||||||||||||||||||||
3ui7 | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3ui7 | |||||||||||||||||||||
3uuo | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 3uuo | |||||||||||||||||||||
3v9t | PPARG_HUMAN | P37231 | K08530 | Nuclear receptors | Thyroid hormone like | C. Peroxisome proliferator-activated receptor (PPAR) | NR1C3, PPARG; peroxisome proliferator-activated receptor gamma | Others | 3v9t | |||||||||||||||||||||
3vc4 | PIM1_HUMAN | P11309 | K04702 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3vc4 | |||||||||||||||||||||
3vid | VGFR2_HUMAN | P35968 | K05098 | Cellular antigens | CD (clusters of differentiation) molecules | CD309; kinase insert domain receptor | Others | Others | 3vid | |||||||||||||||||||||
3zr7 | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 3zr7 | |||||||||||||||||||||
3zra | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 3zra | |||||||||||||||||||||
3zrl | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3zrl | |||||||||||||||||||||
3zrm | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 3zrm | |||||||||||||||||||||
3zsh | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3zsh | |||||||||||||||||||||
3zsi | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3zsi | |||||||||||||||||||||
3ztx | AUKBA_XENLA | Q6DE08 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 3ztx | |||||||||||||||||||||
3zws | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3zws | |||||||||||||||||||||
3zwt | PYRD_HUMAN | Q02127 | K00254 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With a quinone or related compound as acceptor | Dihydroorotate dehydrogenase (quinone) | 3zwt | |||||||||||||||||||||
3zya | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 3zya | |||||||||||||||||||||
4a2j | PRGR_HUMAN | P06401 | K08556 | Nuclear receptors | Estrogen like | C. 3-Ketosteroid receptor | NR3C3, PGR; progesterone receptor | Others | 4a2j | |||||||||||||||||||||
4a79 | AOFB_HUMAN | P27338 | K00274 | Enzymes | Oxidoreductases | Acting on the CH-NH2 group of donors | With oxygen as acceptor | Monoamine oxidase | 4a79 | |||||||||||||||||||||
4aa4 | MK14_HUMAN | Q16539 | K04441 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 4aa4 | |||||||||||||||||||||
4ael | PDE10_HUMAN | Q9Y233 | K01120 | Enzymes | Hydrolases | Acting on ester bonds | Phosphoric-diester hydrolases | 3',5'-cyclic-nucleotide phosphodiesterase | 4ael | |||||||||||||||||||||
4af3 | AURKB_HUMAN | Q96GD4 | K11479 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4af3 | |||||||||||||||||||||
4afj | GSK3B_HUMAN | P49841 | K03083 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Tau-protein kinase | 4afj | |||||||||||||||||||||
4aid | PNP_CAUCR | Q9AC32 | K00962 | Enzymes | Transferases | Transferring phosphorus-containing groups | Nucleotidyltransferases | Polyribonucleotide nucleotidyltransferase | 4aid | |||||||||||||||||||||
4aj1 | LDHA_RAT | P04642 | K00016 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | L-lactate dehydrogenase | 4aj1 | |||||||||||||||||||||
4ajw | PK3CD_MOUSE | O35904 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4ajw | |||||||||||||||||||||
4all | Q7A6D8_STAAN | Q7A6D8 | K00208 | Enzymes | Oxidoreductases | Acting on the CH-CH group of donors | With NAD+ or NADP+ as acceptor | Enoyl-[acyl-carrier-protein] reductase (NADH) | 4all | |||||||||||||||||||||
4anv | PK3CG_HUMAN | P48736 | K00922 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Phosphatidylinositol-4,5-bisphosphate 3-kinase | 4anv | |||||||||||||||||||||
4aoj | NTRK1_HUMAN | P04629 | K03176 | Cytokine receptors | Receptor tyrosine kinase | RTK class VII (TRK receptor family) | NTRK1, TRKA; neurotrophic tyrosine kinase receptor type 1 | Others | 4aoj | |||||||||||||||||||||
4at4 | NTRK2_HUMAN | Q16620 | K04360 | Cytokine receptors | Receptor tyrosine kinase | RTK class VII (TRK receptor family) | NTRK2, TRKB; neurotrophic tyrosine kinase receptor type 2 | Others | 4at4 | |||||||||||||||||||||
4aw5 | EPHB4_HUMAN | P54760 | K05113 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Receptor protein-tyrosine kinase | 4aw5 | |||||||||||||||||||||
4dbs | AK1C3_HUMAN | P42330 | K00089 | Enzymes | Oxidoreductases | Acting on the CH-OH group of donors | With NAD+ or NADP+ as acceptor | 3alpha-hydroxysteroid dehydrogenase (A-specific) | 4dbs | |||||||||||||||||||||
4dch | HXK4_HUMAN | P35557 | K12407 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Glucokinase | 4dch | |||||||||||||||||||||
4deg | MET_HUMAN | P08581 | K05099 | Cellular antigens | Non-CD molecules | MET; met proto-oncogene (hepatocyte growth factor receptor) | Others | Others | 4deg | |||||||||||||||||||||
4drk | FKBP5_HUMAN | Q13451 | K09571 | Enzymes | Isomerases | Cis-trans-Isomerases | Cis-trans Isomerases (only sub-subclass identified to date) | Peptidylprolyl isomerase | 4drk | |||||||||||||||||||||
4dvi | TNKS1_HUMAN | O95271 | K10799 | Enzymes | Transferases | Glycosyltransferases | Pentosyltransferases | NAD+ ADP-ribosyltransferase | 4dvi | |||||||||||||||||||||
4e3f | CAH2_HUMAN | P00918 | K01672 | Enzymes | Lyases | Carbon-oxygen lyases | Hydro-lyases | Carbonate dehydratase | 4e3f | |||||||||||||||||||||
4ebw | FAK1_HUMAN | Q05397 | K05725 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4ebw | |||||||||||||||||||||
4efs | MMP12_HUMAN | P39900 | K01413 | Enzymes | Hydrolases | Acting on peptide bonds (peptidases) | Metalloendopeptidases | Macrophage elastase | 4efs | |||||||||||||||||||||
4ei4 | JAK1_HUMAN | P23458 | K11217 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-tyrosine kinases | Non-specific protein-tyrosine kinase | 4ei4 | |||||||||||||||||||||
4erk | MK01_RAT | P63086 | K04371 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Mitogen-activated protein kinase | 4erk | |||||||||||||||||||||
4f4s | ATP9_YEAST | P61829 | K02128 | Enzymes | Hydrolases | Acting on acid anhydrides | Acting on acid anhydrides to catalyse transmembrane movement of substances | H+-transporting two-sector ATPase | 4f4s | |||||||||||||||||||||
4f63 | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 4f63 | |||||||||||||||||||||
4f65 | FGFR1_HUMAN | P11362 | K04362 | Heparan sulfate-heparin binding proteins | Growth factors-receptors(General comment) Ligand-receptor clustering and signaling, cell migration, mitogenesis | FGFR1; fibroblast growth factor receptor 1 Mitogenesis | Others | Others | 4f65 | |||||||||||||||||||||
4fai | Q86PD7_DROME | Q86PD7 | K00683 | Enzymes | Transferases | Acyltransferases | Aminoacyltransferases | Glutaminyl-peptide cyclotransferase | 4fai | |||||||||||||||||||||
4fev | B0VD92_ACIBY | B0VD92 | K00897 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Kanamycin kinase | 4fev | |||||||||||||||||||||
4few | B0VD92_ACIBY | B0VD92 | K00897 | Enzymes | Transferases | Transferring phosphorus-containing groups | Phosphotransferases with an alcohol group as acceptor | Kanamycin kinase | 4few | |||||||||||||||||||||
4fob | ALK_HUMAN | Q9UM73 | K05119 | Cellular antigens | CD (clusters of differentiation) molecules | CD246; anaplastic lymphoma kinase | Others | Others | 4fob | |||||||||||||||||||||
4foc | ALK_HUMAN | Q9UM73 | K05119 | Cellular antigens | CD (clusters of differentiation) molecules | CD246; anaplastic lymphoma kinase | Others | Others | 4foc | |||||||||||||||||||||
4fsm | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsm | |||||||||||||||||||||
4fsq | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsq | |||||||||||||||||||||
4fsw | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4fsw | |||||||||||||||||||||
4ft3 | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ft3 | |||||||||||||||||||||
4ftj | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftj | |||||||||||||||||||||
4ftt | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftt | |||||||||||||||||||||
4ftu | CHK1_HUMAN | O14757 | K02216 | Enzymes | Transferases | Transferring phosphorus-containing groups | Protein-serine-threonine kinases | Non-specific serine-threonine protein kinase | 4ftu | |||||||||||||||||||||
4g55 | CLH1_HUMAN | Q00610 | K08099 | Enzymes | Hydrolases | Acting on ester bonds | Carboxylic-ester hydrolases | Chlorophyllase | 4g55 |